NPASS Compound

Natural Product: NPC477349

Natural Product ID	NPC477349
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Tyrianthin 8
IUPAC Name	[(1S,3R,4R,5R,6R,8S,10R,11R,12R,13R,15R,29R,30R,31R,33R)-4,5,11,12-tetrahydroxy-6-(hydroxymethyl)-13,31-dimethyl-27-oxo-17-pentyl-30-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,7,9,14,16,28,32-heptaoxatetracyclo[27.3.1.03,8.010,15]tritriacontan-33-yl] (E)-2-methylbut-2-enoate
Synonyms	Tyrianthin 8
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44579632
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0000198] Oligosaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 141145 0 0 0 0 0 0 0 0999 V2000 7.8522 4.5378 -0.1399 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8370 3.3983 -0.2825 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2502 2.3645 -1.2411 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9079 1.8498 -0.6445 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3258 0.8319 -1.5675 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0888 0.1952 -1.0757 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9974 1.1706 -0.8021 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0300 1.8561 0.5108 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9440 2.9728 0.4820 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9089 3.6476 1.8060 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1545 4.9021 1.9591 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7308 5.0140 1.6285 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3261 4.9699 0.1940 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1157 5.2553 -0.0415 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0537 4.2586 0.5528 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9710 2.9122 -0.0686 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1571 2.7517 -1.0329 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7516 1.8468 0.3697 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5977 0.6191 -0.3140 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8476 0.3157 -1.1458 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6512 -1.0631 -1.7362 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.2809 -1.4256 -1.6678 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0610 -1.7580 -0.3309 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3354 -0.5549 0.5811 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3510 -0.8045 1.4946 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0890 -0.8133 2.8438 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8967 -0.5851 3.2476 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0880 -1.0674 3.8587 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3472 -1.3150 3.5124 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3760 -1.5770 4.5529 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7482 -1.0586 5.3014 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9143 -2.4189 -0.0572 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0507 -2.4917 -1.0309 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3125 -3.6129 -1.9777 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7654 -4.7721 -1.1035 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3486 -4.9250 -0.0598 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5036 -4.3050 -0.4865 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4002 -2.9224 -0.4073 C 0 0 1 0 0 0 0 0 0 0 0 0 2.4695 -2.2472 -0.9028 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5914 -2.9574 -1.1827 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9600 -4.0018 -0.1173 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4747 -4.0555 0.0955 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2163 -3.8664 -1.1928 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7834 -2.7818 -1.9115 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7961 -2.0554 -1.2406 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6528 -0.8646 -1.8839 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2134 -5.1579 -1.9805 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8119 -5.3535 0.5541 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4464 -3.6418 1.1311 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6647 -6.4236 -0.0300 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0088 -6.7543 -1.3554 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9197 -5.9056 -1.8741 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1454 -3.3078 -2.9986 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0461 -1.1472 -3.1917 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9606 0.4461 -0.3581 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8347 1.4291 -0.8118 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9790 2.5851 0.1235 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2129 3.3871 -0.2357 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4629 2.5478 -0.1955 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.0616 1.0982 -0.2840 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0435 0.8832 -1.2028 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2676 0.3115 -0.7460 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3465 2.9181 -1.1935 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3879 4.4519 0.6447 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9581 2.2431 1.4658 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0183 4.2554 0.5211 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5391 4.8283 -1.1546 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4248 5.4180 0.2768 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0326 2.8851 0.6707 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8033 3.7834 -0.6604 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9521 1.5106 -1.2530 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1202 2.7464 -2.2505 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2922 2.8096 -0.7079 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1256 1.5202 0.3556 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0911 1.3430 -2.5533 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1543 0.1070 -1.7702 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3855 -0.2523 -0.0556 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9945 0.6717 -0.8911 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9419 1.9805 -1.5837 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9197 2.2937 0.8910 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6855 1.1327 1.3313 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0131 2.4018 0.2379 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2088 3.6289 -0.3346 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9834 3.7713 2.1343 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5286 2.9058 2.5963 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2600 5.1978 3.0696 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7031 5.7785 1.4724 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3570 6.0181 2.0136 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0957 4.2957 2.2414 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8876 5.7616 -0.4061 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5876 4.0341 -0.2944 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2598 5.1990 -1.1659 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3987 6.3047 0.2119 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7632 4.1024 1.6209 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1223 4.6287 0.5088 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7688 0.6471 -1.0611 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8213 1.0218 -2.0014 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2491 -1.7655 -1.1001 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9078 -2.4769 -0.0900 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3746 -0.3931 1.1476 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6335 -1.3289 2.4834 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5671 -0.6877 5.1937 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3418 -1.8281 4.0720 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0436 -2.3860 5.2454 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6513 -1.0007 5.4576 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1635 -0.1489 5.7997 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0926 -1.9714 5.8323 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1478 -1.5091 -1.5122 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6562 -3.9736 -2.4356 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6882 -4.4956 -0.5477 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0686 -4.5273 0.9130 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3078 -2.6776 0.6720 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5456 -3.4883 -2.1756 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6922 -5.0305 -0.4294 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8062 -3.3933 0.9210 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2888 -3.6819 -0.9272 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0707 -1.8635 -0.1831 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9765 -5.8330 -1.5166 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2526 -5.6919 -1.9236 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4406 -4.9952 -3.0643 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3116 -5.4629 1.3992 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9809 -2.8575 1.4160 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6170 -6.5202 0.5457 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1579 -7.0273 0.3530 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8572 -6.3209 -1.5858 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7985 -5.6918 -2.8153 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8434 -3.9511 -3.2055 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8414 -0.1790 -3.6914 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0966 -1.4862 -3.3194 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4174 -1.9180 -3.6734 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3640 1.8535 -1.7483 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1062 3.2813 -0.0271 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1031 3.8100 -1.2441 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0022 2.6739 0.7703 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7498 0.7314 0.6970 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9189 0.9612 -1.3709 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8811 0.0218 0.1307 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9897 -0.5738 -1.3309 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0274 2.6482 -2.0959 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4096 5.3362 0.1804 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9798 3.1094 1.9666 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 28 29 2 0 29 30 1 0 28 31 1 0 23 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 43 47 1 0 42 48 1 0 41 49 1 0 36 50 1 0 50 51 1 0 35 52 1 0 34 53 1 0 21 54 1 0 20 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 60 62 1 0 59 63 1 0 58 64 1 0 57 65 1 0 46 6 1 0 24 19 1 0 38 33 1 0 45 40 1 0 61 56 1 0 1 66 1 0 1 67 1 0 1 68 1 0 2 69 1 0 2 70 1 0 3 71 1 0 3 72 1 0 4 73 1 0 4 74 1 0 5 75 1 0 5 76 1 0 6 77 1 0 7 78 1 0 7 79 1 0 8 80 1 0 8 81 1 0 9 82 1 0 9 83 1 0 10 84 1 0 10 85 1 0 11 86 1 0 11 87 1 0 12 88 1 0 12 89 1 0 13 90 1 0 13 91 1 0 14 92 1 0 14 93 1 0 15 94 1 0 15 95 1 0 19 96 1 6 20 97 1 6 21 98 1 1 23 99 1 1 24100 1 1 29101 1 0 30102 1 0 30103 1 0 30104 1 0 31105 1 0 31106 1 0 31107 1 0 33108 1 6 34109 1 6 35110 1 1 36111 1 1 38112 1 1 40113 1 6 41114 1 6 42115 1 1 43116 1 1 45117 1 1 47118 1 0 47119 1 0 47120 1 0 48121 1 0 49122 1 0 50123 1 0 50124 1 0 51125 1 0 52126 1 0 53127 1 0 54128 1 0 54129 1 0 54130 1 0 56131 1 6 57132 1 1 58133 1 6 59134 1 1 60135 1 1 62136 1 0 62137 1 0 62138 1 0 63139 1 0 64140 1 0 65141 1 0 M END

Standard InCHIKey	MDEMDKARDFUEHH-PSTHPRIPSA-N
Standard InCHI	InChI=1S/C45H76O20/c1-7-9-15-18-26-19-16-13-11-10-12-14-17-20-28(47)61-39-36(63-42-35(54)32(51)29(48)23(4)56-42)25(6)58-45(40(39)62-41(55)22(3)8-2)65-38-34(53)31(50)27(21-46)60-44(38)64-37-33(52)30(49)24(5)57-43(37)59-26/h8,23-27,29-40,42-46,48-54H,7,9-21H2,1-6H3/b22-8+/t23-,24-,25-,26?,27-,29+,30+,31+,32-,33-,34-,35-,36-,37-,38-,39-,40-,42-,43+,44+,45+/m1/s1
SMILES	CCCCCC1CCCCCCCCCC(=O)O[C@@H]2[C@@H]([C@H](O[C@H]([C@@H]2OC(=O)/C(=C/C)/C)O[C@@H]3[C@@H]([C@H]([C@H](O[C@H]3O[C@@H]4[C@@H]([C@H]([C@H](O[C@H]4O1)C)O)O)CO)O)O)C)O[C@@H]5[C@@H]([C@@H]([C@H]([C@H](O5)C)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	936.49	Volume:	911.989 ? Van der Waals volume.
Dense:	1.027	LogP:	2.279 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.921 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.911 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	45.0
TPSA:	288.28 ? Topological Polar Surface Area.	H-Bond Acceptor:	20.0
H-Bond Donor:	8.0	Rings:	5.0
Heavy Atoms:	20.0

MedChem Properties

QED Drug-Likeness Score:	0.091	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.277	Fsp³:	0.911
MCE-18:	105.209 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.894	Fluc inhibitor:	0.333 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.009 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.414	Promiscuous compounds:	0.115

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.822	MDCK Permeability:	-4.924
Pgp-inhibitor:	0.0	Pgp-substrate:	0.945
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.239
20% Bioavailability (F20%):	0.238	30% Bioavailability (F30%):	0.873
50% Bioavailability (F50%):	0.997

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.991
Plasma Protein Binding (PPB):	87.36%	Volume Distribution (VD):	-0.202
Fu:	7.571% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.601
OATP1B3 inhibitor:	0.987	BCRP inhibitor:	0.0
BSEP inhibitor:	0.026

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.91
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.051
HLM stability:	0.97 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.435

Half-life (T1/2):

2.701

ADMET: Toxicity

hERG Blockers:	0.006	hERG Blockers (10um):	0.167
Human Hepatotoxicity (H-HT):	0.813	Drug-induced Liver Injury (DILI):	0.999
AMES Toxicity:	0.986	Rat Oral Acute Toxicity:	0.01
Maximum Recommended Daily Dose:	0.009	Skin Sensitization:	1.0
Carcinogencity:	0.003	Eye Corrosion:	0.0
Eye Irritation:	0.008	Respiratory Toxicity:	0.007
Drug-induced Neurotoxicity:	0.013	Ototoxicity:	0.999
Hematotoxicity:	0.967	Drug-induced Nephrotoxicity:	0.994
Genotoxicity:	0.002	RPMI-8226 Immunitoxicity:	0.762
A549 Cytotoxicity:	0.999	Hek293 Cytotoxicity:	0.662
BCF:	0.453 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.272 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.948 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.908 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	roots	n.a.	n.a.	PMID[17309299]
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	Roots	states of Puebla, Morelos, and Distrito Federal, Mexico	2000-2005	PMID[18826278]
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	1
ED50	4
Activity	1

Activity Type	# Activity
Cell line	3
Organism	2
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	ED50	=	2.2	ug/ml	PMID[18826278]
NPT382	Cell line	OVCAR-5	Homo sapiens	ED50	>	5	ug/ml	PMID[18826278]
NPT148	Cell line	HCT-15	Homo sapiens	ED50	>	5	ug/ml	PMID[18826278]
NPT88	Organism	Mycobacterium tuberculosis	Mycobacterium tuberculosis	MIC	=	25	ug/ml	PMID[18826278]
NPT2	Others	Unspecified	n.a.	ED50	>	5	ug/ml	PMID[18826278]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT32	Organism	Mus musculus	Mus musculus	Activity	=	70	%	PMID[18826278]

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC477349 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22772
0.1-0.2	22492
0.2-0.3	4067
0.3-0.4	385
0.4-0.5	27
0.5-0.6	40
0.6-0.7	64
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8714	High Similarity	NPC477350
0.8133	Intermediate Similarity	NPC22742
0.8133	Intermediate Similarity	NPC477346
0.7561	Intermediate Similarity	NPC238264
0.7561	Intermediate Similarity	NPC477345
0.7342	Intermediate Similarity	NPC604005
0.7342	Intermediate Similarity	NPC605014
0.716	Intermediate Similarity	NPC600446
0.716	Intermediate Similarity	NPC605013
0.7126	Intermediate Similarity	NPC478728
0.6923	Remote Similarity	NPC146380
0.6867	Remote Similarity	NPC109887
0.6829	Remote Similarity	NPC478734
0.6824	Remote Similarity	NPC472204
0.6786	Remote Similarity	NPC146992
0.6786	Remote Similarity	NPC85759
0.675	Remote Similarity	NPC281563
0.6747	Remote Similarity	NPC477344
0.6747	Remote Similarity	NPC477326
0.6706	Remote Similarity	NPC297768
0.6706	Remote Similarity	NPC173328
0.6705	Remote Similarity	NPC163409
0.6667	Remote Similarity	NPC238056
0.6667	Remote Similarity	NPC478733
0.6628	Remote Similarity	NPC294748
0.6628	Remote Similarity	NPC186992
0.6627	Remote Similarity	NPC89843
0.6591	Remote Similarity	NPC184915
0.6585	Remote Similarity	NPC113745
0.6585	Remote Similarity	NPC477320
0.6585	Remote Similarity	NPC477323
0.6585	Remote Similarity	NPC477325
0.6585	Remote Similarity	NPC609436
0.6543	Remote Similarity	NPC477329
0.6538	Remote Similarity	NPC478729
0.6538	Remote Similarity	NPC606819
0.65	Remote Similarity	NPC475425
0.6444	Remote Similarity	NPC44782
0.642	Remote Similarity	NPC477328
0.642	Remote Similarity	NPC477330
0.6404	Remote Similarity	NPC224953
0.6404	Remote Similarity	NPC259294
0.6395	Remote Similarity	NPC479061
0.6344	Remote Similarity	NPC475241
0.6333	Remote Similarity	NPC475525
0.6333	Remote Similarity	NPC475540
0.6322	Remote Similarity	NPC44682
0.6322	Remote Similarity	NPC478724
0.6322	Remote Similarity	NPC479060
0.6304	Remote Similarity	NPC478727
0.6286	Remote Similarity	NPC206823
0.6264	Remote Similarity	NPC476066
0.625	Remote Similarity	NPC119583
0.6235	Remote Similarity	NPC477332
0.6222	Remote Similarity	NPC183888
0.6222	Remote Similarity	NPC126685
0.6207	Remote Similarity	NPC267592
0.6207	Remote Similarity	NPC478725
0.6196	Remote Similarity	NPC475164
0.6186	Remote Similarity	NPC28069
0.618	Remote Similarity	NPC483170
0.6163	Remote Similarity	NPC158302
0.6136	Remote Similarity	NPC478723
0.6136	Remote Similarity	NPC477319
0.6129	Remote Similarity	NPC473605
0.6129	Remote Similarity	NPC475375
0.6111	Remote Similarity	NPC169345
0.6111	Remote Similarity	NPC115013
0.6067	Remote Similarity	NPC143421
0.6067	Remote Similarity	NPC307400
0.6067	Remote Similarity	NPC27289
0.6047	Remote Similarity	NPC477331
0.6023	Remote Similarity	NPC478722
0.6	Remote Similarity	NPC478726
0.5977	Remote Similarity	NPC216883
0.5955	Remote Similarity	NPC476781
0.5934	Remote Similarity	NPC290012
0.5859	Remote Similarity	NPC77651
0.5842	Remote Similarity	NPC290276
0.5806	Remote Similarity	NPC123204
0.5714	Remote Similarity	NPC478730
0.5696	Remote Similarity	NPC479056
0.566	Remote Similarity	NPC472352
0.5652	Remote Similarity	NPC476087
0.5652	Remote Similarity	NPC475667
0.5591	Remote Similarity	NPC478732
0.5591	Remote Similarity	NPC478731
0.5532	Remote Similarity	NPC475270
0.5532	Remote Similarity	NPC475327
0.55	Remote Similarity	NPC124878
0.55	Remote Similarity	NPC231888
0.5474	Remote Similarity	NPC472200
0.5446	Remote Similarity	NPC35338
0.5446	Remote Similarity	NPC204214
0.5446	Remote Similarity	NPC63404
0.5446	Remote Similarity	NPC92283
0.5435	Remote Similarity	NPC472205
0.5426	Remote Similarity	NPC477317
0.5426	Remote Similarity	NPC477318
0.5417	Remote Similarity	NPC269318
0.5385	Remote Similarity	NPC10121
0.5385	Remote Similarity	NPC198918
0.5385	Remote Similarity	NPC10883
0.537	Remote Similarity	NPC471026
0.5368	Remote Similarity	NPC479057
0.5361	Remote Similarity	NPC476783
0.5278	Remote Similarity	NPC600940
0.5253	Remote Similarity	NPC477348
0.5152	Remote Similarity	NPC476782
0.514	Remote Similarity	NPC471025
0.5135	Remote Similarity	NPC241265
0.5093	Remote Similarity	NPC600721
0.5093	Remote Similarity	NPC605872
0.5086	Remote Similarity	NPC147032

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC477349 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7414
0.1-0.2	1650
0.2-0.3	83
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data