NPASS Compound

Natural Product: NPC224953

Natural Product ID	NPC224953
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Murucoidin Iv
IUPAC Name	n.a.
Synonyms	Murucoidin IV
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL502394
PubChem CID	11693806
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0000198] Oligosaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 177182 0 0 0 0 0 0 0 0999 V2000 -12.4338 3.2466 2.0010 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.4297 4.3655 1.9944 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4008 4.1578 0.9329 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6333 2.8297 1.1695 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6661 2.7307 0.0800 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7257 1.6151 -0.0411 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.1877 0.2220 -0.2219 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2059 -0.3443 0.6762 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4190 -1.8349 0.6160 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6994 -2.4919 -0.6327 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8772 -2.6774 -1.7944 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6899 -3.4928 -1.9313 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4283 -3.3706 -1.1836 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4194 -3.6552 0.2733 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0130 -3.8328 0.8566 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1978 -2.6076 0.8326 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2715 -1.7671 1.7991 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3361 -2.3038 -0.1912 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5661 -1.1052 -0.1480 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3811 0.1031 0.0749 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3704 0.9204 -1.0690 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6540 0.9965 -1.6218 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5449 1.9820 -0.8643 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8490 1.8430 -1.1481 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9743 3.2103 -0.9982 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9004 3.7084 -2.2615 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.3177 3.8912 -2.8014 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1073 2.8257 -3.1659 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4766 1.3890 -3.0691 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5507 1.0182 -3.8700 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2358 3.2470 -4.5003 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8003 0.9192 1.0756 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4976 1.2607 0.6357 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0381 2.5359 1.3002 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6482 0.0721 0.9139 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3951 -1.2204 0.7534 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7128 -1.6813 2.0477 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5618 0.0672 0.2105 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6760 0.1289 1.0305 C 0 0 2 0 0 0 0 0 0 0 0 0 2.3929 1.2916 0.7198 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4643 1.4278 1.6120 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0078 1.3874 3.0412 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5180 0.3374 1.4004 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0103 -0.6486 0.4234 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5639 -1.0443 0.7789 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6328 -1.9264 1.8895 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2744 -3.2634 1.7867 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8876 -3.6501 0.6580 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3197 -4.2383 2.9021 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8637 -5.5950 2.4074 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7771 -6.0528 1.2986 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4842 -3.7746 4.0769 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7106 -1.8517 0.5131 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2141 -2.2993 -0.6806 C 0 0 2 0 0 0 0 0 0 0 0 0 4.4549 -3.4351 -1.0586 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8198 -3.8367 -2.3478 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9231 -4.9884 -2.7305 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2879 -5.3982 -4.0279 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2425 -4.3037 -2.3065 C 0 0 2 0 0 0 0 0 0 0 0 0 6.8828 -4.0646 -0.9674 C 0 0 1 0 0 0 0 0 0 0 0 0 6.6569 -2.6144 -0.5788 C 0 0 1 0 0 0 0 0 0 0 0 0 7.4833 -1.7551 -1.2630 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1434 -4.8353 -0.0427 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0530 -3.7085 -3.2750 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7008 0.9860 0.9774 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7020 0.9553 1.9118 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9547 2.2331 2.4498 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3859 3.1440 1.4886 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7628 4.4111 2.2291 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6491 2.6643 0.8029 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5130 1.2647 0.2947 C 0 0 2 0 0 0 0 0 0 0 0 0 8.0251 0.4210 1.4597 C 0 0 1 0 0 0 0 0 0 0 0 0 8.9299 0.5703 2.5232 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7940 0.8017 -0.0302 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9172 3.5268 -0.2827 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0978 4.2634 -0.3484 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9057 4.1064 0.6259 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3876 5.1711 -1.4841 C 0 0 2 0 0 0 0 0 0 0 0 0 10.4523 4.4105 -2.7920 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5475 3.3554 -2.7422 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6305 5.9669 -1.2099 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.7412 2.9741 0.9863 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0246 2.3799 2.5195 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3331 3.5799 2.5665 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8875 4.4138 2.9719 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9321 5.3315 1.7822 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6879 5.0061 0.9739 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8176 4.1360 -0.0960 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4032 2.1023 1.3194 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0781 3.0272 2.1358 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2378 2.8082 -0.9057 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1103 3.7289 0.0667 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0315 1.6211 0.8326 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2603 -0.4200 -0.1167 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5294 0.0396 -1.2748 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2405 0.0730 0.4544 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0100 -0.0985 1.7389 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7662 -2.3232 1.3694 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4403 -1.9346 1.2155 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1341 -3.5423 -0.3659 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6946 -2.0186 -1.0211 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6441 -3.2406 -2.5416 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7941 -1.7463 -2.4777 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3294 -3.4617 -3.0498 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9795 -4.6358 -1.9456 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9553 -2.3620 -1.3964 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6366 -4.0700 -1.6271 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0083 -4.5212 0.5889 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7418 -2.6903 0.7681 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5121 -4.6430 0.2715 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0613 -4.1963 1.8939 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1379 -1.0445 -1.2015 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4262 -0.0612 0.3849 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0627 -0.0209 -1.5957 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4102 1.6968 0.2243 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4527 4.7401 -2.1924 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9541 4.2140 -1.9559 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2970 4.6585 -3.6055 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6917 2.9245 -3.1903 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0297 2.9170 -2.8439 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6117 0.7631 -3.4484 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9736 0.1939 -3.5634 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9407 2.6677 -4.9098 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5541 1.4991 -0.4682 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6998 3.3507 0.8853 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0437 2.4932 2.3891 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0279 2.7589 0.8730 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3175 0.1648 2.0029 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6857 -2.0250 0.3671 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0152 -1.3575 2.6846 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3286 0.1565 2.0888 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9396 2.3946 1.4143 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9993 1.7594 3.2130 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7141 2.0248 3.6284 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1420 0.3576 3.4801 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7794 -0.0933 2.3929 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0234 -0.2471 -0.6183 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1996 -1.6492 -0.0936 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3717 -4.2883 3.2514 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8691 -6.2831 3.2684 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8410 -5.4703 1.9695 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2547 -6.2405 0.3459 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5451 -5.2559 1.0819 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3261 -6.9623 1.6151 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4785 -4.2393 4.0175 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4265 -2.6810 4.1162 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9656 -4.1238 5.0138 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0221 -1.5563 -1.4948 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6540 -3.0367 -3.1021 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8916 -4.5583 -2.8449 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9401 -5.8187 -2.0037 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9095 -6.1753 -3.9746 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2534 -5.3984 -2.5617 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9202 -4.3864 -0.9141 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9347 -2.5753 0.5181 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9742 -1.2409 -1.9088 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8843 -5.7094 -0.4541 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8069 -4.3414 -3.4910 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3677 0.3612 2.7981 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6018 3.2879 0.7401 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6438 4.1400 2.8788 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1059 5.2050 1.5197 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9648 4.7288 2.9024 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5186 2.7039 1.5102 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8578 1.1465 -0.5685 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0429 -0.6280 1.1632 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6272 -0.1256 2.5163 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7735 -0.1148 -0.3815 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5035 5.8586 -1.5589 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4855 3.9360 -2.9836 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6422 5.1282 -3.5999 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3280 2.5086 -3.4244 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4815 3.8741 -3.1082 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6675 2.9846 -1.7198 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4768 7.0064 -1.5835 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4857 5.5057 -1.7445 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7773 5.9683 -0.1043 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 26 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 20 32 1 0 32 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 41 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 2 0 47 49 1 0 49 50 1 0 50 51 1 0 49 52 1 0 44 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 56 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 60 63 1 0 59 64 1 0 43 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 68 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 71 74 1 0 70 75 1 0 75 76 1 0 76 77 2 0 76 78 1 0 78 79 1 0 79 80 1 0 78 81 1 0 24 6 1 0 45 39 1 0 61 54 1 0 72 66 1 0 36 19 1 0 29 22 1 0 1 82 1 0 1 83 1 0 1 84 1 0 2 85 1 0 2 86 1 0 3 87 1 0 3 88 1 0 4 89 1 0 4 90 1 0 5 91 1 0 5 92 1 0 6 93 1 1 7 94 1 0 7 95 1 0 8 96 1 0 8 97 1 0 9 98 1 0 9 99 1 0 10100 1 0 10101 1 0 11102 1 0 11103 1 0 12104 1 0 12105 1 0 13106 1 0 13107 1 0 14108 1 0 14109 1 0 15110 1 0 15111 1 0 19112 1 6 20113 1 1 22114 1 6 23115 1 1 26116 1 1 27117 1 0 27118 1 0 27119 1 0 28120 1 1 29121 1 6 30122 1 0 31123 1 0 33124 1 6 34125 1 0 34126 1 0 34127 1 0 35128 1 1 36129 1 6 37130 1 0 39131 1 1 41132 1 6 42133 1 0 42134 1 0 42135 1 0 43136 1 1 44137 1 6 45138 1 6 49139 1 1 50140 1 0 50141 1 0 51142 1 0 51143 1 0 51144 1 0 52145 1 0 52146 1 0 52147 1 0 54148 1 6 56149 1 6 57150 1 0 57151 1 0 58152 1 0 59153 1 6 60154 1 6 61155 1 1 62156 1 0 63157 1 0 64158 1 0 66159 1 1 68160 1 6 69161 1 0 69162 1 0 69163 1 0 70164 1 1 71165 1 6 72166 1 6 73167 1 0 74168 1 0 78169 1 6 79170 1 0 79171 1 0 80172 1 0 80173 1 0 80174 1 0 81175 1 0 81176 1 0 81177 1 0 M END

Standard InCHIKey	UGFCYMGNAMSNEL-VGSNSOKESA-N
Standard InCHI	InChI=1S/C56H96O25/c1-10-13-19-22-32-23-20-17-15-14-16-18-21-24-34(58)75-47-42(66)44(30(8)71-55(47)80-46-38(62)35(59)28(6)69-54(46)73-32)78-56-49(77-51(68)27(5)12-3)48(81-53-40(64)37(61)36(60)33(25-57)74-53)45(31(9)72-56)79-52-41(65)39(63)43(29(7)70-52)76-50(67)26(4)11-2/h26-33,35-49,52-57,59-66H,10-25H2,1-9H3/t26-,27-,28+,29-,30-,31-,32-,33+,35-,36+,37-,38-,39-,40+,41+,42+,43-,44-,45-,46+,47+,48+,49+,52-,53-,54-,55-,56-/m0/s1
SMILES	CCCCC[C@H]1CCCCCCCCCC(=O)O[C@H]2[C@H](O[C@H]3[C@H](O1)O[C@H](C)[C@@H]([C@@H]3O)O)O[C@@H](C)[C@@H]([C@H]2O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1OC(=O)[C@H](CC)C)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)OC(=O)[C@H](CC)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1168.62	Volume:	1137.639 ? Van der Waals volume.
Dense:	1.027	LogP:	2.877 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.271 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.74 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	19.0	Rigid Bonds:	49.0
TPSA:	353.27 ? Topological Polar Surface Area.	H-Bond Acceptor:	25.0
H-Bond Donor:	9.0	Rings:	6.0
Heavy Atoms:	25.0

MedChem Properties

QED Drug-Likeness Score:	0.056	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.278	Fsp³:	0.946
MCE-18:	129.468 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.984	Fluc inhibitor:	0.333 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.002 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.558	Promiscuous compounds:	0.123

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.121	MDCK Permeability:	-5.044
Pgp-inhibitor:	0.0	Pgp-substrate:	0.978
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.0	30% Bioavailability (F30%):	0.192
50% Bioavailability (F50%):	0.842

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.968
Plasma Protein Binding (PPB):	70.716%	Volume Distribution (VD):	-0.298
Fu:	19.529% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.002

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.996
HLM stability:	0.707 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.449

Half-life (T1/2):

2.944

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.031
Human Hepatotoxicity (H-HT):	0.481	Drug-induced Liver Injury (DILI):	0.99
AMES Toxicity:	0.806	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.813	Drug-induced Nephrotoxicity:	0.979
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.628
A549 Cytotoxicity:	0.955	Hek293 Cytotoxicity:	0.217
BCF:	0.439 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.362 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.241 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.14 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO2520	Ipomoea murucoides	Species	Convolvulaceae	Eukaryota	Roots	Ixpantepec, in the state of Oaxaca, Mexico	1996-DEC	PMID[16124750]
NPO2520	Ipomoea murucoides	Species	Convolvulaceae	Eukaryota	flowers	n.a.	n.a.	PMID[16643033]
NPO2520	Ipomoea murucoides	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[18500841]
NPO2520	Ipomoea murucoides	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	4
ED50	4
Ratio IC50	3

Activity Type	# Activity
Cell line	4
Organism	4
Others	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT165	Cell line	HeLa	Homo sapiens	ED50	>	20.0	ug ml-1	PMID[10346942]
NPT91	Cell line	KB	Homo sapiens	ED50	=	15.0	ug ml-1	PMID[12798338]
NPT1171	Cell line	HEp-2	Homo sapiens	ED50	=	4.0	ug ml-1	PMID[18316521]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	>	512.0	ug.mL-1	PMID[20329739]
NPT2	Others	Unspecified	n.a.	Ratio IC50	>	1593.8	n.a.	PMID[23398362]
NPT2	Others	Unspecified	n.a.	Ratio IC50	>	1906.3	n.a.	PMID[23398362]
NPT2	Others	Unspecified	n.a.	Ratio IC50	>	73.4	n.a.	PMID[27017556]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC224953 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22061
0.1-0.2	23848
0.2-0.3	3473
0.3-0.4	325
0.4-0.5	33
0.5-0.6	13
0.6-0.7	53
0.7-0.8	0
0.8-0.85	6
0.85-0.9	6
0.9-0.95	3
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9259	High Similarity	NPC184915
0.9125	High Similarity	NPC119583
0.9036	High Similarity	NPC44782
0.8902	High Similarity	NPC115013
0.875	High Similarity	NPC109887
0.869	High Similarity	NPC472200
0.8554	High Similarity	NPC483170
0.85	High Similarity	NPC478734
0.85	High Similarity	NPC89843
0.8353	Intermediate Similarity	NPC126685
0.8293	Intermediate Similarity	NPC478733
0.8272	Intermediate Similarity	NPC477331
0.8171	Intermediate Similarity	NPC477344
0.814	Intermediate Similarity	NPC183888
0.8095	Intermediate Similarity	NPC297768
0.7816	Intermediate Similarity	NPC169345
0.7816	Intermediate Similarity	NPC477317
0.7816	Intermediate Similarity	NPC477318
0.7805	Intermediate Similarity	NPC22742
0.7805	Intermediate Similarity	NPC477346
0.7701	Intermediate Similarity	NPC238264
0.7701	Intermediate Similarity	NPC477345
0.7595	Intermediate Similarity	NPC478729
0.7586	Intermediate Similarity	NPC143421
0.7586	Intermediate Similarity	NPC472204
0.7528	Intermediate Similarity	NPC259294
0.7526	Intermediate Similarity	NPC290276
0.75	Intermediate Similarity	NPC478726
0.7471	Intermediate Similarity	NPC477319
0.7416	Intermediate Similarity	NPC290012
0.7412	Intermediate Similarity	NPC477332
0.7386	Intermediate Similarity	NPC307400
0.7386	Intermediate Similarity	NPC27289
0.7356	Intermediate Similarity	NPC146992
0.7356	Intermediate Similarity	NPC85759
0.7326	Intermediate Similarity	NPC477326
0.7326	Intermediate Similarity	NPC600446
0.7326	Intermediate Similarity	NPC605013
0.7273	Intermediate Similarity	NPC472205
0.7234	Intermediate Similarity	NPC475241
0.7229	Intermediate Similarity	NPC477328
0.7229	Intermediate Similarity	NPC477330
0.7191	Intermediate Similarity	NPC294748
0.7159	Intermediate Similarity	NPC478722
0.7143	Intermediate Similarity	NPC477329
0.7111	Intermediate Similarity	NPC476087
0.7111	Intermediate Similarity	NPC475667
0.7097	Intermediate Similarity	NPC478728
0.7065	Intermediate Similarity	NPC123204
0.7033	Intermediate Similarity	NPC238056
0.7033	Intermediate Similarity	NPC478732
0.7021	Intermediate Similarity	NPC478727
0.6972	Remote Similarity	NPC147032
0.6966	Remote Similarity	NPC478725
0.6957	Remote Similarity	NPC475270
0.6957	Remote Similarity	NPC475327
0.6889	Remote Similarity	NPC478723
0.6889	Remote Similarity	NPC478724
0.6869	Remote Similarity	NPC77651
0.6786	Remote Similarity	NPC477350
0.6778	Remote Similarity	NPC267592
0.6747	Remote Similarity	NPC606819
0.6744	Remote Similarity	NPC281563
0.6705	Remote Similarity	NPC604005
0.6705	Remote Similarity	NPC605014
0.67	Remote Similarity	NPC28069
0.6667	Remote Similarity	NPC10883
0.6667	Remote Similarity	NPC600940
0.6667	Remote Similarity	NPC611287
0.6636	Remote Similarity	NPC471024
0.6593	Remote Similarity	NPC479061
0.6591	Remote Similarity	NPC113745
0.6591	Remote Similarity	NPC477320
0.6591	Remote Similarity	NPC477323
0.6591	Remote Similarity	NPC477325
0.6591	Remote Similarity	NPC609436
0.6562	Remote Similarity	NPC475164
0.6522	Remote Similarity	NPC173328
0.6522	Remote Similarity	NPC479060
0.6452	Remote Similarity	NPC478730
0.6442	Remote Similarity	NPC610996
0.6404	Remote Similarity	NPC477349
0.6374	Remote Similarity	NPC158302
0.6327	Remote Similarity	NPC473605
0.6327	Remote Similarity	NPC475375
0.6296	Remote Similarity	NPC471026
0.6289	Remote Similarity	NPC269318
0.6289	Remote Similarity	NPC477347
0.6286	Remote Similarity	NPC600672
0.6277	Remote Similarity	NPC186992
0.6226	Remote Similarity	NPC471025
0.619	Remote Similarity	NPC10121
0.619	Remote Similarity	NPC198918
0.6186	Remote Similarity	NPC163409
0.6168	Remote Similarity	NPC600721
0.6168	Remote Similarity	NPC605872
0.6147	Remote Similarity	NPC472352
0.6146	Remote Similarity	NPC478731
0.6136	Remote Similarity	NPC146380
0.61	Remote Similarity	NPC477348
0.6064	Remote Similarity	NPC60849
0.6055	Remote Similarity	NPC610997
0.6022	Remote Similarity	NPC479059
0.602	Remote Similarity	NPC475525
0.602	Remote Similarity	NPC475540
0.596	Remote Similarity	NPC476066
0.581	Remote Similarity	NPC63404
0.566	Remote Similarity	NPC35338
0.566	Remote Similarity	NPC204214
0.566	Remote Similarity	NPC92283
0.551	Remote Similarity	NPC479058
0.55	Remote Similarity	NPC206823
0.5446	Remote Similarity	NPC479057
0.5435	Remote Similarity	NPC475425
0.5278	Remote Similarity	NPC124878
0.5278	Remote Similarity	NPC231888
0.5208	Remote Similarity	NPC87153
0.5196	Remote Similarity	NPC162925

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC224953 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7258
0.1-0.2	1801
0.2-0.3	88
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data