NPASS Compound

Natural Product: NPC206823

Natural Product ID	NPC206823
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Tricolorin F
IUPAC Name	n.a.
Synonyms	Tricolorin F
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL446864
PubChem CID	11331512
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0000198] Oligosaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 109112 0 0 0 0 0 0 0 0999 V2000 7.5970 -0.6553 -0.2992 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0937 -0.6299 -0.7114 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9400 -0.0027 -2.0281 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6168 0.1406 -2.6730 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5443 0.9234 -2.0807 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8406 0.5507 -0.8518 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7865 1.6774 -0.5423 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4744 2.8905 -0.0699 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4326 4.0323 0.0868 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0749 5.1584 0.8036 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2806 6.3774 0.9636 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1098 6.2781 1.4975 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1135 6.0515 0.3855 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5215 5.9650 0.8482 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9384 4.7108 1.5365 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9827 3.5698 0.5767 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5881 3.8128 -0.6089 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4226 2.2934 0.8857 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4052 1.3697 -0.1903 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4400 -0.0613 0.1979 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4920 -0.4910 1.0897 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4119 -1.8512 1.0812 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0445 -2.4313 1.3704 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0051 -1.6530 0.9393 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1167 -2.3268 0.5569 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2205 -1.3003 0.2513 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0389 -0.5895 -0.8954 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4584 -1.8842 0.4019 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5381 -3.2033 -0.0265 C 0 0 2 0 0 0 0 0 0 0 0 0 3.3146 -3.3926 -1.4871 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6934 -4.1332 0.8430 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7555 -3.1962 1.6178 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9179 -3.8586 2.4491 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9062 -4.8781 -0.0135 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0848 -3.7029 0.7818 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0169 -4.5231 1.3447 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0208 -5.8228 0.5669 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9347 -6.7420 1.0521 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3964 -4.0037 1.4985 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3471 -2.5644 2.0346 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5875 -2.0198 2.1571 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0292 -4.7439 2.5211 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3725 -0.7843 -1.0224 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5657 -0.6840 -1.7028 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5573 -1.5488 -2.9176 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8831 0.7355 -2.1182 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7374 1.6264 -0.9283 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9671 2.9497 -1.1798 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2377 0.7502 -2.4912 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0437 0.3368 -0.4303 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6783 -1.0306 0.7364 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1271 -1.3910 -0.9455 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5861 -0.1852 0.1351 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8782 -1.7358 -0.8238 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6948 -0.4461 -2.7648 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3728 1.0623 -1.9189 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2535 -0.8737 -3.0623 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8513 0.6437 -3.6887 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7925 1.2592 -2.8952 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0205 1.9554 -1.8548 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4847 0.6208 0.0365 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1564 1.7860 -1.4364 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1693 1.2509 0.2665 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2550 3.3237 -0.6867 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8862 2.7906 0.9649 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2121 4.3632 -0.9589 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5921 3.5928 0.6224 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0243 5.4508 0.2619 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4410 4.8051 1.8317 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2394 6.9055 -0.0535 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8737 7.1439 1.5865 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3612 7.2258 2.0258 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1264 5.4613 2.2478 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8345 5.2600 -0.3184 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0534 7.0041 -0.2320 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7377 6.8675 1.4607 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1705 6.1044 -0.0670 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2596 4.4326 2.3483 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9444 4.8800 1.9701 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5603 1.5605 -0.8854 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4564 -0.3061 0.5912 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7407 -2.1986 0.0539 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9707 -2.5006 2.4804 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9112 -2.9660 -0.3129 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1548 -0.5448 1.0949 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6010 -3.5153 0.1932 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8231 -4.3829 -1.6438 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6327 -2.6482 -1.9447 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2919 -3.3826 -2.0078 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2767 -4.7647 1.5097 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4377 -2.5627 2.2346 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0172 -3.6816 3.4090 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1191 -5.8379 -0.0094 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6546 -4.8047 2.3748 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1378 -5.6974 -0.5087 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9979 -6.2727 0.7289 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5437 -7.6309 1.2183 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0012 -4.0755 0.5847 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8174 -2.6307 3.0111 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2534 -2.6756 1.8256 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5598 -5.4790 2.1608 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3887 -1.0059 -1.0100 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8108 -2.3531 -2.9066 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5704 -2.0349 -3.0342 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4173 -0.9639 -3.8672 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3183 1.0700 -2.9951 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5116 1.2799 -0.1791 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3156 3.3684 -0.3343 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8223 0.5881 -1.6906 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 26 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 32 33 1 0 31 34 1 0 23 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 36 39 1 0 39 40 1 0 40 41 1 0 39 42 1 0 20 43 1 0 43 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 27 6 1 0 47 19 1 0 40 22 1 0 32 25 1 0 1 50 1 0 1 51 1 0 1 52 1 0 2 53 1 0 2 54 1 0 3 55 1 0 3 56 1 0 4 57 1 0 4 58 1 0 5 59 1 0 5 60 1 0 6 61 1 1 7 62 1 0 7 63 1 0 8 64 1 0 8 65 1 0 9 66 1 0 9 67 1 0 10 68 1 0 10 69 1 0 11 70 1 0 11 71 1 0 12 72 1 0 12 73 1 0 13 74 1 0 13 75 1 0 14 76 1 0 14 77 1 0 15 78 1 0 15 79 1 0 19 80 1 6 20 81 1 1 22 82 1 6 23 83 1 1 25 84 1 6 26 85 1 1 29 86 1 6 30 87 1 0 30 88 1 0 30 89 1 0 31 90 1 1 32 91 1 1 33 92 1 0 34 93 1 0 36 94 1 1 37 95 1 0 37 96 1 0 38 97 1 0 39 98 1 6 40 99 1 1 41100 1 0 42101 1 0 44102 1 1 45103 1 0 45104 1 0 45105 1 0 46106 1 6 47107 1 1 48108 1 0 49109 1 0 M END

Standard InCHIKey	BLGCNDRGZMCMJB-DMPWARCPSA-N
Standard InCHI	InChI=1S/C34H60O15/c1-4-5-11-14-20-15-12-9-7-6-8-10-13-16-22(36)47-29-26(40)23(37)19(3)44-33(29)48-31-28(42)25(39)21(17-35)46-34(31)49-30-27(41)24(38)18(2)43-32(30)45-20/h18-21,23-35,37-42H,4-17H2,1-3H3/t18-,19-,20+,21-,23-,24+,25-,26+,27+,28+,29-,30-,31-,32+,33+,34+/m1/s1
SMILES	CCCCC[C@H]1CCCCCCCCCC(=O)O[C@H]2[C@H](O[C@H]3[C@H](O[C@H]4[C@H](O1)O[C@H](C)[C@@H]([C@@H]4O)O)O[C@H](CO)[C@H]([C@@H]3O)O)O[C@H](C)[C@H]([C@@H]2O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO24622	Ipomoea tricolor	Species	Convolvulaceae	Eukaryota	crude resin	Mexican	n.a.	DOI[10.1016/S0040-4020(97)00607-8]
NPO24622	Ipomoea tricolor	Species	Convolvulaceae	Eukaryota	crude resin	Mexican	n.a.	PMID[16562846]
NPO24622	Ipomoea tricolor	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8496705]
NPO24622	Ipomoea tricolor	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO24622	Ipomoea tricolor	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO24622	Ipomoea tricolor	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO24622	Ipomoea tricolor	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	4

Activity Type	# Activity
Organism	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	>	512.0	ug.mL-1	PMID[12392745]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC206823 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	18436
0.1-0.2	27168
0.2-0.3	3846
0.3-0.4	259
0.4-0.5	88
0.5-0.6	40
0.6-0.7	13
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7188	Intermediate Similarity	NPC475425
0.6984	Remote Similarity	NPC478729
0.6769	Remote Similarity	NPC477350
0.6721	Remote Similarity	NPC479056
0.6567	Remote Similarity	NPC477328
0.6567	Remote Similarity	NPC477330
0.6471	Remote Similarity	NPC477329
0.6286	Remote Similarity	NPC22742
0.6286	Remote Similarity	NPC477349
0.6286	Remote Similarity	NPC477346
0.6111	Remote Similarity	NPC478734
0.6111	Remote Similarity	NPC477331
0.6111	Remote Similarity	NPC477332
0.6027	Remote Similarity	NPC477344
0.5946	Remote Similarity	NPC109887
0.5946	Remote Similarity	NPC478733
0.5789	Remote Similarity	NPC297768
0.5753	Remote Similarity	NPC604005
0.5753	Remote Similarity	NPC605014
0.5735	Remote Similarity	NPC606819
0.5658	Remote Similarity	NPC478722
0.5641	Remote Similarity	NPC238264
0.5641	Remote Similarity	NPC477345
0.56	Remote Similarity	NPC477326
0.56	Remote Similarity	NPC600446
0.56	Remote Similarity	NPC605013
0.5517	Remote Similarity	NPC241265
0.55	Remote Similarity	NPC224953
0.5455	Remote Similarity	NPC146992
0.5455	Remote Similarity	NPC85759
0.5455	Remote Similarity	NPC479061
0.5405	Remote Similarity	NPC87153
0.5385	Remote Similarity	NPC479060
0.5345	Remote Similarity	NPC76881
0.5316	Remote Similarity	NPC472204
0.5316	Remote Similarity	NPC294748
0.5309	Remote Similarity	NPC184915
0.5301	Remote Similarity	NPC478728
0.5278	Remote Similarity	NPC146380
0.5263	Remote Similarity	NPC89843
0.5256	Remote Similarity	NPC478725
0.5238	Remote Similarity	NPC478727
0.5195	Remote Similarity	NPC216883
0.519	Remote Similarity	NPC472205
0.519	Remote Similarity	NPC478723
0.519	Remote Similarity	NPC478724
0.519	Remote Similarity	NPC476781
0.5185	Remote Similarity	NPC238056
0.5181	Remote Similarity	NPC44782
0.5135	Remote Similarity	NPC281563
0.5122	Remote Similarity	NPC183888
0.5122	Remote Similarity	NPC126685
0.5063	Remote Similarity	NPC60849
0.5062	Remote Similarity	NPC478726

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC206823 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6766
0.1-0.2	2255
0.2-0.3	123
0.3-0.4	5
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data