Drug Information| Drug ID:   | NPD11 |
| Drug Name:   | Calcium Pangamate |
| Molecular Formula:   | 2C10H19NO8.Ca |
| Canonical SMILES:   | O[C@@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)COC(=O)CN(C)C.O[C@@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)COC(=O)CN(C)C.[Ca+2] |
| Standard InCHI:   | "InChI=1S/2C10H19NO8.Ca/c2*1-11(2)3-6(13)19-4-5(12)7(14)8(15)9(16)10(17)18;/h2*5,7-9,12,14-16H,3-4H2,1-2H3,(H,17,18);/q;;+2/p-2/t2*5-,7-,8+,9-;/m11./s1" |
| Standard InCHIKey:   | JWLAOERSRUNGEF-JQVJEGKNSA-L |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD11Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 280.1 |
| ALogP   | -3.1306 |
| MLogP   | 1.57 |
| XLogP   | -3.955 |
| HDA   | 9 |
| HBD   | 4 |
| Rotatable Bonds   | 16 |
| TPSA   | 150.59 |
| RO5 Violation   | 0 |