Drug Information| Drug ID:   | NPD73 |
| Drug Name:   | Calcium Gluceptate |
| Molecular Formula:   | 2C7H14O8.Ca |
| Canonical SMILES:   | OC[C@H]([C@H]([C@@H]([C@H](C(C(=O)[O-])O)O)O)O)O.OC[C@H]([C@H]([C@@H]([C@H](C(C(=O)[O-])O)O)O)O)O.[Ca+2] |
| Standard InCHI:   | "InChI=1S/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2-,3-,4+,5-,6?;/m11./s1" |
| Standard InCHIKey:   | FATUQANACHZLRT-KMRXSBRUSA-L |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD73Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.8696 | NPC319863 |
| High Similarity | 0.8696 | NPC73584 |
| High Similarity | 0.8696 | NPC304431 |
| Intermediate Similarity | 0.7083 | NPC322167 |
| Remote Similarity | 0.6087 | NPC231722 |
| Remote Similarity | 0.6087 | NPC22339 |
| Remote Similarity | 0.5833 | NPC322601 |
| Remote Similarity | 0.5714 | NPC326369 |
| Remote Similarity | 0.5714 | NPC64239 |
| TTD   | |
| DrugBank   | DB00326 |
| ChEMBL   | CHEMBL1237066 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA164746233 |
| KEGG Drug   | D00934 |
| PubChem CID   | 0 |
| ChEBI   | 3314 |
| CAS Number   | 29039-00-7 |
| Molecular Weight   | 225.06 |
| ALogP   | -4.0265 |
| MLogP   | 1.35 |
| XLogP   | -4.892 |
| HDA   | 8 |
| HBD   | 6 |
| Rotatable Bonds   | 13 |
| TPSA   | 161.51 |
| RO5 Violation   | 1 |