Drug Information| Drug ID:   | NPD898 |
| Drug Name:   | Calcium Glubionate |
| Molecular Formula:   | C12H22O12.C6H12O7.Ca |
| Canonical SMILES:   | OC[C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O[C@@H]1O[C@H](CO)[C@@H]([C@@H]([C@H]1O)O)O)O.OC[C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O.[Ca+2] |
| Standard InCHI:   | "InChI=1S/C12H22O12.C6H12O7.Ca/c13-1-3(15)10(7(18)8(19)11(21)22)24-12-9(20)6(17)5(16)4(2-14)23-12;7-1-2(8)3(9)4(10)5(11)6(12)13;/h3-10,12-20H,1-2H2,(H,21,22);2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t3-,4-,5+,6+,7-,8-,9-,10-,12+;2-,3-,4+,5-;/m11./s1" |
| Standard InCHIKey:   | YPCRNBPOUVJVMU-LCGAVOCYSA-L |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD898Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.617 | NPC32148 |
| Remote Similarity | 0.617 | NPC600286 |
| Remote Similarity | 0.5435 | NPC597325 |
| Remote Similarity | 0.5349 | NPC329438 |
| Remote Similarity | 0.525 | NPC319863 |
| Remote Similarity | 0.525 | NPC73584 |
| Remote Similarity | 0.525 | NPC304431 |
| Remote Similarity | 0.5238 | NPC308381 |
| Remote Similarity | 0.5238 | NPC550459 |
| Remote Similarity | 0.5227 | NPC34270 |
| Remote Similarity | 0.5227 | NPC305321 |
| Remote Similarity | 0.5227 | NPC70376 |
| Remote Similarity | 0.5227 | NPC234688 |
| Remote Similarity | 0.5227 | NPC117238 |
| Remote Similarity | 0.5227 | NPC188306 |
| Remote Similarity | 0.5227 | NPC320953 |
| Remote Similarity | 0.5227 | NPC283221 |
| Remote Similarity | 0.5227 | NPC279138 |
| Remote Similarity | 0.5227 | NPC291694 |
| Remote Similarity | 0.5227 | NPC546312 |
| Remote Similarity | 0.5227 | NPC568526 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 357.1 |
| ALogP   | -5.2627 |
| MLogP   | 1.46 |
| XLogP   | -5.328 |
| HDA   | 12 |
| HBD   | 8 |
| Rotatable Bonds   | 17 |
| TPSA   | 220.43 |
| RO5 Violation   | 2 |