NPASS Compound

Natural Product: NPC472204

Natural Product ID	NPC472204
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	HOGDDBQBCSSRLP-IRQRUURWSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3344508
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0000198] Oligosaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 163168 0 0 0 0 0 0 0 0999 V2000 12.2161 -1.6776 2.8822 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7865 -1.5203 3.3337 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8528 -1.7686 2.1022 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4476 -1.6145 2.5697 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2933 -1.8516 1.7628 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9220 -1.0879 0.4995 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9327 -1.2408 -0.5448 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7190 -0.7501 -1.9249 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7933 -1.3614 -2.8523 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3237 -1.3047 -2.6226 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7127 -1.9914 -3.8657 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2500 -1.9897 -3.9188 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5247 -2.6677 -2.8037 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0199 -2.6106 -3.0038 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5132 -1.2077 -3.1976 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8217 -0.3197 -2.0795 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4083 -0.8258 -1.0919 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5396 1.0262 -1.9866 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8756 1.8351 -0.8679 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3680 1.9202 -0.6742 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7185 1.9874 0.7930 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2811 0.8148 1.3527 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8993 0.8857 1.5016 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1342 1.4801 0.3883 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9454 0.6465 0.0549 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1757 1.1485 0.3955 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1065 0.0676 0.8168 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3719 0.0483 -0.0365 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9394 1.4642 0.0578 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8793 2.3410 -0.6021 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7137 1.6130 -0.8591 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6497 3.6056 0.1571 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1000 1.6422 -0.6776 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2111 2.0142 0.0171 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7182 3.4151 -0.2719 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3844 3.5737 -1.5962 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4084 2.5093 -1.7769 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8180 1.1391 -1.4295 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2105 1.1060 -0.2011 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0036 0.6314 -2.5758 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5399 2.7020 -1.0346 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5119 3.6994 -2.6718 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7832 4.3767 -0.0094 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2058 -0.9323 0.4187 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6341 -1.7795 -0.5962 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1300 -3.1778 -0.3205 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4285 -3.9788 -1.5899 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9266 -4.0029 -1.7359 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5236 -2.6220 -1.6634 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0271 -1.8185 -0.6793 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0275 -2.7698 -1.6040 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4723 -3.6210 -2.6429 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3628 -4.6750 -2.8529 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8916 -3.2391 -2.6512 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7732 -3.1290 -0.0793 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4018 0.0904 2.1974 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0445 -0.9384 3.0295 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4443 -1.9021 2.4778 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2812 -1.0348 4.4699 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5727 0.0929 5.1727 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7685 -1.0346 4.7559 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3613 0.2406 4.2487 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4284 -0.5005 1.9024 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9816 2.3816 1.0065 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9929 1.7844 0.2474 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0532 2.8713 0.1053 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1545 2.7816 1.0907 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7713 2.2046 2.4201 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6720 1.3564 2.4018 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5811 0.7165 1.1219 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8476 0.2889 0.8719 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5771 3.3071 3.4398 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6094 4.0992 1.3373 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5513 2.8169 -1.1929 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9721 2.9900 -1.3091 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8378 -0.8889 3.3686 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6079 -2.6424 3.2608 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3497 -1.5573 1.7955 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6245 -0.4939 3.7071 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5537 -2.2436 4.1372 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1256 -2.7802 1.7424 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1912 -1.0496 1.3265 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3649 -2.3438 3.4761 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3968 -0.6252 3.1575 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2759 -2.9701 1.4844 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3524 -1.8265 2.4447 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8819 -1.4040 0.2815 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3228 -2.3253 -0.5736 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9067 -0.7092 -0.2079 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5287 0.3858 -1.9009 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7518 -0.7444 -2.4568 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9344 -0.9381 -3.9115 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1223 -2.4401 -3.0276 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9437 -1.9050 -1.7759 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9283 -0.2808 -2.5077 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0677 -3.0530 -3.8833 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1670 -1.4362 -4.7172 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8929 -0.9121 -3.8936 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9029 -2.3418 -4.9214 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7730 -3.7710 -2.9104 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8777 -2.3980 -1.8224 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8099 -3.1804 -3.9472 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5396 -3.1242 -2.1664 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8372 -0.8102 -4.1863 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6043 -1.2936 -3.2663 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5431 2.8544 -1.1646 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7898 1.0045 -1.1318 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0470 2.7885 1.2202 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7854 1.4939 2.4611 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3780 2.3920 0.8297 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1672 2.0726 0.9813 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5792 -0.8882 0.6184 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1905 -0.1317 -1.1038 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1623 1.7287 1.0974 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2677 2.6194 -1.6046 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5646 3.8812 0.2192 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0986 4.4893 -0.3971 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1319 3.6137 1.1567 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9985 2.0414 1.1296 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5425 3.5609 0.4987 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9507 4.5543 -1.5498 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7281 2.3979 -2.8574 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7216 0.4803 -1.3377 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9845 0.3180 -2.3503 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8755 1.4922 -3.3029 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5867 -0.1099 -3.1560 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6082 2.1517 -0.2099 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9584 4.5044 -2.5845 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9796 5.2117 -0.4956 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2445 -1.5004 -1.5863 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6176 -3.6328 0.5672 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9455 -4.9511 -1.6049 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3389 -4.5631 -0.8546 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2880 -2.1465 -2.6538 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3358 -3.2766 -0.6646 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5614 -1.8222 -1.7764 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4692 -3.5724 -2.6138 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6674 -4.6974 -3.5646 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0145 -2.8653 -2.4735 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2261 -3.7369 -0.6582 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8181 -1.9877 4.8609 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8193 -0.2714 5.9045 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3062 0.7808 5.6502 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0213 0.6842 4.4266 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2124 -1.8866 4.1969 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9111 -1.1657 5.8530 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0726 0.6198 5.0394 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5459 0.9692 4.0729 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9177 0.0384 3.3061 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2793 -1.2037 2.0203 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1471 -0.4675 2.8464 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2512 -0.9353 1.1407 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6912 1.4349 -0.7343 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5387 3.8827 0.1601 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0612 2.2669 0.6817 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6327 1.6056 2.7831 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8735 -0.1264 1.2915 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3568 2.8348 4.4088 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8305 4.0652 3.1271 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5957 3.7821 3.5706 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6477 4.6354 0.5309 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0032 2.2126 -1.7756 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4681 3.8087 -1.3531 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 29 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 38 40 1 0 37 41 1 0 36 42 1 0 35 43 1 0 28 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 49 51 1 0 51 52 1 0 48 53 1 0 47 54 1 0 46 55 1 0 27 56 1 0 56 57 1 0 57 58 2 0 57 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 23 63 1 0 21 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 68 72 1 0 67 73 1 0 66 74 1 0 20 75 1 0 71 6 1 0 24 19 1 0 31 26 1 0 39 34 1 0 50 45 1 0 70 65 1 0 1 76 1 0 1 77 1 0 1 78 1 0 2 79 1 0 2 80 1 0 3 81 1 0 3 82 1 0 4 83 1 0 4 84 1 0 5 85 1 0 5 86 1 0 6 87 1 0 7 88 1 0 7 89 1 0 8 90 1 0 8 91 1 0 9 92 1 0 9 93 1 0 10 94 1 0 10 95 1 0 11 96 1 0 11 97 1 0 12 98 1 0 12 99 1 0 13100 1 0 13101 1 0 14102 1 0 14103 1 0 15104 1 0 15105 1 0 19106 1 0 20107 1 0 21108 1 0 23109 1 0 24110 1 0 26111 1 0 27112 1 0 28113 1 0 29114 1 0 30115 1 0 32116 1 0 32117 1 0 32118 1 0 34119 1 0 35120 1 0 36121 1 0 37122 1 0 38123 1 0 40124 1 0 40125 1 0 40126 1 0 41127 1 0 42128 1 0 43129 1 0 45130 1 0 46131 1 0 47132 1 0 48133 1 0 49134 1 0 51135 1 0 51136 1 0 52137 1 0 53138 1 0 54139 1 0 55140 1 0 59141 1 0 60142 1 0 60143 1 0 60144 1 0 61145 1 0 61146 1 0 62147 1 0 62148 1 0 62149 1 0 63150 1 0 63151 1 0 63152 1 0 65153 1 0 66154 1 0 67155 1 0 68156 1 0 70157 1 0 72158 1 0 72159 1 0 72160 1 0 73161 1 0 74162 1 0 75163 1 0 M END

Standard InCHIKey	HOGDDBQBCSSRLP-IRQRUURWSA-N
Standard InCHI	InChI=1S/C51H88O24/c1-8-10-16-19-28-20-17-14-12-11-13-15-18-21-30(53)70-42-39(62)49(74-43-36(59)32(55)25(5)65-50(43)68-28)66-26(6)40(42)73-51-45(71-46(63)23(3)9-2)44(75-48-38(61)35(58)33(56)29(22-52)69-48)41(27(7)67-51)72-47-37(60)34(57)31(54)24(4)64-47/h23-29,31-45,47-52,54-62H,8-22H2,1-7H3/t23-,24-,25+,26-,27-,28-,29+,31-,32-,33+,34+,35-,36-,37+,38+,39+,40-,41-,42-,43+,44+,45+,47-,48-,49-,50-,51-/m0/s1
SMILES	CCCCCC1CCCCCCCCCC(=O)OC2C(C(OC(C2OC3C(C(C(C(O3)C)OC4C(C(C(C(O4)C)O)O)O)OC5C(C(C(C(O5)CO)O)O)O)OC(=O)C(C)CC)C)OC6C(C(C(OC6O1)C)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1084.57	Volume:	1045.005 ? Van der Waals volume.
Dense:	1.038	LogP:	2.208 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.594 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.623 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	48.0
TPSA:	347.2 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	10.0	Rings:	6.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.08	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.701	Fsp³:	0.961
MCE-18:	126.9 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.046	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.009 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.133 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.546	Promiscuous compounds:	0.0

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.383	MDCK Permeability:	-4.713
Pgp-inhibitor:	0.0	Pgp-substrate:	1.0
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	0.768	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	1.0
Plasma Protein Binding (PPB):	53.688%	Volume Distribution (VD):	-0.338
Fu:	24.878% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.306	BCRP inhibitor:	0.026
BSEP inhibitor:	0.031

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.94	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.24

Half-life (T1/2):

3.942

ADMET: Toxicity

hERG Blockers:	0.043	hERG Blockers (10um):	0.533
Human Hepatotoxicity (H-HT):	0.269	Drug-induced Liver Injury (DILI):	0.779
AMES Toxicity:	0.126	Rat Oral Acute Toxicity:	0.083
Maximum Recommended Daily Dose:	0.13	Skin Sensitization:	0.382
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.506	Ototoxicity:	1.0
Hematotoxicity:	0.008	Drug-induced Nephrotoxicity:	0.016
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.29
A549 Cytotoxicity:	0.144	Hek293 Cytotoxicity:	0.736
BCF:	0.447 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.436 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.453 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.128 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33128	merremia hederacea	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25310730]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Ratio IC50	1
IC50	1

Activity Type	# Activity
Others	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	Ratio IC50	=	15.8	n.a.	PMID[20405844]
NPT2	Others	Unspecified	n.a.	IC50	=	36.0	nM	PMID[20405844]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC472204 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22932
0.1-0.2	22935
0.2-0.3	3414
0.3-0.4	439
0.4-0.5	23
0.5-0.6	30
0.6-0.7	38
0.7-0.8	0
0.8-0.85	5
0.85-0.9	9
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9125	High Similarity	NPC126685
0.8947	High Similarity	NPC604005
0.8947	High Similarity	NPC605014
0.8889	High Similarity	NPC183888
0.8861	High Similarity	NPC477319
0.875	High Similarity	NPC143421
0.8659	High Similarity	NPC259294
0.8537	High Similarity	NPC290012
0.8519	High Similarity	NPC307400
0.8519	High Similarity	NPC27289
0.8333	Intermediate Similarity	NPC22742
0.8333	Intermediate Similarity	NPC477346
0.8289	Intermediate Similarity	NPC146380
0.825	Intermediate Similarity	NPC477326
0.8118	Intermediate Similarity	NPC123204
0.7875	Intermediate Similarity	NPC113745
0.7875	Intermediate Similarity	NPC477320
0.7875	Intermediate Similarity	NPC477323
0.7875	Intermediate Similarity	NPC477325
0.7875	Intermediate Similarity	NPC609436
0.7831	Intermediate Similarity	NPC146992
0.7831	Intermediate Similarity	NPC85759
0.7831	Intermediate Similarity	NPC267592
0.7647	Intermediate Similarity	NPC294748
0.7586	Intermediate Similarity	NPC224953
0.7527	Intermediate Similarity	NPC63404
0.7471	Intermediate Similarity	NPC238056
0.747	Intermediate Similarity	NPC478734
0.747	Intermediate Similarity	NPC89843
0.7386	Intermediate Similarity	NPC184915
0.7381	Intermediate Similarity	NPC600446
0.7381	Intermediate Similarity	NPC605013
0.734	Intermediate Similarity	NPC35338
0.734	Intermediate Similarity	NPC204214
0.734	Intermediate Similarity	NPC92283
0.7326	Intermediate Similarity	NPC472205
0.7294	Intermediate Similarity	NPC478733
0.725	Intermediate Similarity	NPC477350
0.7241	Intermediate Similarity	NPC119583
0.7222	Intermediate Similarity	NPC44782
0.7176	Intermediate Similarity	NPC477344
0.7159	Intermediate Similarity	NPC483170
0.7126	Intermediate Similarity	NPC297768
0.7079	Intermediate Similarity	NPC115013
0.7041	Intermediate Similarity	NPC10121
0.7041	Intermediate Similarity	NPC198918
0.6966	Remote Similarity	NPC238264
0.6966	Remote Similarity	NPC477345
0.6932	Remote Similarity	NPC173328
0.6897	Remote Similarity	NPC109887
0.6889	Remote Similarity	NPC169345
0.6875	Remote Similarity	NPC124878
0.6875	Remote Similarity	NPC231888
0.686	Remote Similarity	NPC477331
0.6824	Remote Similarity	NPC477349
0.6796	Remote Similarity	NPC472352
0.6786	Remote Similarity	NPC281563
0.6782	Remote Similarity	NPC158302
0.6739	Remote Similarity	NPC472200
0.6703	Remote Similarity	NPC477317
0.6703	Remote Similarity	NPC477318
0.6667	Remote Similarity	NPC186992
0.6396	Remote Similarity	NPC147032
0.6395	Remote Similarity	NPC477329
0.6386	Remote Similarity	NPC478729
0.6381	Remote Similarity	NPC600940
0.6373	Remote Similarity	NPC290276
0.6373	Remote Similarity	NPC10883
0.6279	Remote Similarity	NPC477330
0.6238	Remote Similarity	NPC77651
0.6237	Remote Similarity	NPC476087
0.6237	Remote Similarity	NPC475667
0.6237	Remote Similarity	NPC478726
0.619	Remote Similarity	NPC606819
0.617	Remote Similarity	NPC478732
0.6111	Remote Similarity	NPC477332
0.6105	Remote Similarity	NPC475270
0.6105	Remote Similarity	NPC475327
0.6092	Remote Similarity	NPC477328
0.6078	Remote Similarity	NPC28069
0.6061	Remote Similarity	NPC475241
0.6055	Remote Similarity	NPC471024
0.6038	Remote Similarity	NPC600721
0.6038	Remote Similarity	NPC605872
0.5979	Remote Similarity	NPC269318
0.5918	Remote Similarity	NPC475164
0.5918	Remote Similarity	NPC478728
0.5859	Remote Similarity	NPC478727
0.5851	Remote Similarity	NPC478724
0.5795	Remote Similarity	NPC475425
0.5755	Remote Similarity	NPC611287
0.5745	Remote Similarity	NPC478722
0.5745	Remote Similarity	NPC478725
0.57	Remote Similarity	NPC473605
0.57	Remote Similarity	NPC475375
0.5684	Remote Similarity	NPC478723
0.5648	Remote Similarity	NPC471025
0.5625	Remote Similarity	NPC478730
0.5556	Remote Similarity	NPC163409
0.5556	Remote Similarity	NPC600672
0.5556	Remote Similarity	NPC610996
0.5446	Remote Similarity	NPC471026
0.5417	Remote Similarity	NPC479061
0.54	Remote Similarity	NPC475525
0.54	Remote Similarity	NPC475540
0.5361	Remote Similarity	NPC479060
0.5357	Remote Similarity	NPC610997
0.5354	Remote Similarity	NPC478731
0.5347	Remote Similarity	NPC476066
0.5316	Remote Similarity	NPC206823
0.5208	Remote Similarity	NPC216883
0.5204	Remote Similarity	NPC44682
0.52	Remote Similarity	NPC162925
0.5051	Remote Similarity	NPC476781

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC472204 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7399
0.1-0.2	1678
0.2-0.3	69
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data