NPASS Compound

Natural Product: NPC478733

Natural Product ID	NPC478733
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	PQNGYHZFXPTARB-AVRURECRSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	11297652
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0000198] Oligosaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 154158 0 0 0 0 0 0 0 0999 V2000 -9.9421 4.1033 3.3703 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7514 3.7741 2.4664 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2210 2.9527 1.2914 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0485 2.6079 0.3468 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0164 1.8250 1.0515 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8381 1.3562 0.2485 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0350 2.4321 -0.3925 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5288 2.8464 -1.7357 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9003 4.0634 -2.3216 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4244 4.0984 -2.3977 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7644 2.9476 -3.0840 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2659 3.2170 -3.0972 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5167 1.9740 -3.5857 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9531 2.2200 -3.6553 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7232 0.9166 -3.9421 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4112 0.0796 -2.7088 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4444 -0.7039 -2.7208 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1658 0.1748 -1.5867 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0737 -0.4433 -0.3738 C 0 0 2 0 0 0 0 0 0 0 0 0 3.3414 -0.3312 0.4661 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8929 -0.7120 1.8868 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7069 -1.8144 2.4739 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5541 -1.0960 1.8707 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3379 -2.2270 1.0949 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6493 -1.8962 -0.3574 C 0 0 2 0 0 0 0 0 0 0 0 0 2.6563 -2.7296 -0.8746 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4578 -3.5959 -1.9170 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3041 -3.6233 -2.4124 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4923 -4.4802 -2.4833 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8944 -5.2514 -3.6353 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8979 -5.5283 -1.4448 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4461 -4.8792 -0.2169 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0761 -2.6910 1.3123 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9127 -1.7767 1.5505 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9898 -1.5823 3.0722 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.0746 -2.9588 3.7466 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9669 -3.8221 2.8719 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.6807 -4.8628 3.7154 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4948 -5.6155 2.8807 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8664 -2.9753 2.2370 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2242 -2.4270 1.1305 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0525 -1.5738 0.4156 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3721 -1.9251 0.6118 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8166 -3.0691 -0.3152 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.1345 -3.5403 0.2566 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0666 -2.4538 0.6131 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8193 -2.8952 1.8822 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5882 -1.2313 0.8483 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3721 -0.8432 0.3250 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0892 0.3928 0.9239 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7136 -4.3961 -0.6776 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9258 -4.0975 -0.3972 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2129 -3.4603 3.8479 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1123 -0.8103 3.3937 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7662 0.9917 0.4474 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1058 1.1299 0.1082 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2818 2.1361 -0.9822 C 0 0 1 0 0 0 0 0 0 0 0 0 6.7860 2.1622 -1.3224 C 0 0 2 0 0 0 0 0 0 0 0 0 7.5109 2.5663 -0.0796 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0730 1.7713 1.1311 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6259 2.4752 2.3498 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7087 1.6974 1.2530 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9078 2.4569 -0.2242 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7454 3.5496 -0.1025 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1866 4.6660 0.1479 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2251 3.4594 -0.2510 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6246 2.9469 -1.6239 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8106 4.8408 -0.0937 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0029 3.1527 -2.2867 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5351 1.9362 -2.1149 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6928 3.8892 4.4272 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2338 5.1802 3.2323 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7975 3.4941 3.0490 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0067 3.2275 3.0774 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2902 4.7132 2.1081 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0127 3.4844 0.7541 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5666 1.9613 1.6876 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4456 2.1259 -0.5348 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6582 3.6278 0.0531 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4980 0.9597 1.5748 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5843 2.4265 1.9119 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3299 0.7943 -0.6352 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0008 2.0091 -0.5458 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8826 3.3012 0.2941 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6102 2.9480 -1.7859 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3071 2.0129 -2.4883 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2280 5.0024 -1.7993 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2987 4.1637 -3.3647 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9485 4.3108 -1.3963 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1466 5.0152 -2.9976 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0916 2.9567 -4.1532 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9819 1.9572 -2.6926 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9060 3.4854 -2.0832 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0589 4.0899 -3.7532 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9319 1.7858 -4.6175 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8448 1.1379 -2.9744 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3372 2.6900 -2.7360 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1547 2.8718 -4.5367 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7873 1.0849 -4.0683 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2278 0.4150 -4.7901 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2886 0.0620 0.3011 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1160 -1.0480 0.1571 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9707 0.1894 2.5282 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4938 -1.3612 3.1144 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0462 -2.3997 3.1659 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1029 -2.5282 1.7494 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0857 -2.9787 1.4599 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7031 -2.0056 -0.8958 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3831 -3.9519 -2.8563 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3770 -6.1448 -3.2379 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6535 -5.5199 -4.4002 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0775 -4.6319 -4.1050 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6317 -6.2371 -1.8585 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9922 -6.1340 -1.1903 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6873 -3.7963 -0.3766 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7408 -4.9674 0.6382 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4356 -5.3335 0.0692 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7845 -0.7980 1.0981 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1194 -1.0847 3.4886 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5520 -2.8136 4.7284 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3050 -4.3531 2.1590 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8899 -5.4621 4.1989 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2570 -4.3002 4.4916 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0288 -6.4676 2.6195 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9987 -3.2975 0.4457 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5790 -2.3072 1.6467 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0390 -2.6339 -1.3213 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8775 -4.1745 1.1485 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8705 -2.3959 -0.1780 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2018 -3.9111 1.8025 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0201 -2.9249 2.6806 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5447 -2.1387 2.2041 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3766 -0.6759 -0.7661 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2965 -5.0724 -0.2613 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7844 -4.3681 -1.3310 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2935 -4.3629 3.4284 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4961 -1.0178 4.2661 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6033 0.1708 -0.1420 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0999 3.1676 -0.5481 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0470 1.1654 -1.6851 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2769 3.6307 0.1390 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5647 0.7718 1.0985 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2722 3.5355 2.3710 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2397 2.0196 3.3066 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7366 2.4638 2.3608 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6717 2.8290 0.5493 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2974 3.6993 -2.3599 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1978 1.9441 -1.8246 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7411 2.9495 -1.6283 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9644 5.3484 -1.0773 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1531 5.5219 0.4884 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8336 4.8091 0.3822 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1960 4.0314 -1.8671 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8307 2.5662 -2.8174 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 27 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 24 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 37 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 49 50 1 0 45 51 1 0 44 52 1 0 36 53 1 0 35 54 1 0 20 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 60 62 1 0 59 63 1 0 63 64 1 0 64 65 2 0 64 66 1 0 66 67 1 0 66 68 1 0 58 69 1 0 57 70 1 0 50 6 1 0 62 56 1 0 25 19 1 0 41 34 1 0 49 43 1 0 1 71 1 0 1 72 1 0 1 73 1 0 2 74 1 0 2 75 1 0 3 76 1 0 3 77 1 0 4 78 1 0 4 79 1 0 5 80 1 0 5 81 1 0 6 82 1 6 7 83 1 0 7 84 1 0 8 85 1 0 8 86 1 0 9 87 1 0 9 88 1 0 10 89 1 0 10 90 1 0 11 91 1 0 11 92 1 0 12 93 1 0 12 94 1 0 13 95 1 0 13 96 1 0 14 97 1 0 14 98 1 0 15 99 1 0 15100 1 0 19101 1 1 20102 1 6 21103 1 1 22104 1 0 22105 1 0 22106 1 0 24107 1 1 25108 1 6 29109 1 0 30110 1 0 30111 1 0 30112 1 0 31113 1 0 31114 1 0 32115 1 0 32116 1 0 32117 1 0 34118 1 6 35119 1 1 36120 1 1 37121 1 6 38122 1 0 38123 1 0 39124 1 0 41125 1 6 43126 1 1 44127 1 6 45128 1 1 46129 1 6 47130 1 0 47131 1 0 47132 1 0 49133 1 6 51134 1 0 52135 1 0 53136 1 0 54137 1 0 56138 1 6 57139 1 1 58140 1 6 59141 1 1 60142 1 6 61143 1 0 61144 1 0 61145 1 0 66146 1 0 67147 1 0 67148 1 0 67149 1 0 68150 1 0 68151 1 0 68152 1 0 69153 1 0 70154 1 0 M END

Standard InCHIKey	PQNGYHZFXPTARB-AVRURECRSA-N
Standard InCHI	InChI=1S/C49H84O21/c1-9-11-17-20-29-21-18-15-13-12-14-16-19-22-31(51)65-42-39(68-46-37(57)36(56)38(27(7)61-46)66-44(58)24(3)4)28(8)62-49(43(42)67-45(59)25(5)10-2)70-41-35(55)33(53)30(23-50)64-48(41)69-40-34(54)32(52)26(6)60-47(40)63-29/h24-30,32-43,46-50,52-57H,9-23H2,1-8H3/t25?,26-,27-,28+,29+,30-,32-,33-,34+,35+,36-,37-,38-,39+,40-,41-,42-,43-,46+,47+,48+,49+/m1/s1
SMILES	CCCCC[C@H]1CCCCCCCCCC(=O)O[C@@H]2[C@H]([C@H](C)O[C@H]([C@@H]2OC(=O)C(C)CC)O[C@@H]2[C@H]([C@@H]([C@@H](CO)O[C@H]2O[C@@H]2[C@H]([C@@H]([C@@H](C)O[C@H]2O1)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C)O1)OC(=O)C(C)C)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1008.55	Volume:	989.963 ? Van der Waals volume.
Dense:	1.019	LogP:	3.562 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.499 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.107 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	14.0	Rigid Bonds:	45.0
TPSA:	294.35 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	7.0	Rings:	5.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.084	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.433	Fsp³:	0.939
MCE-18:	107.895 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.983	Fluc inhibitor:	0.322 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.002 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.516	Promiscuous compounds:	0.185

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.684	MDCK Permeability:	-5.012
Pgp-inhibitor:	0.0	Pgp-substrate:	0.396
PAMPA:	0.469 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.061
20% Bioavailability (F20%):	0.054	30% Bioavailability (F30%):	0.998
50% Bioavailability (F50%):	0.996

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.133	MRP1:	0.925
Plasma Protein Binding (PPB):	82.203%	Volume Distribution (VD):	-0.281
Fu:	11.606% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.998
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.005
BSEP inhibitor:	0.335

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.137
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.997
HLM stability:	0.999 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.903

Half-life (T1/2):

3.165

ADMET: Toxicity

hERG Blockers:	0.013	hERG Blockers (10um):	0.104
Human Hepatotoxicity (H-HT):	0.734	Drug-induced Liver Injury (DILI):	0.998
AMES Toxicity:	0.925	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.001	Eye Corrosion:	0.0
Eye Irritation:	0.003	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.999
Hematotoxicity:	0.673	Drug-induced Nephrotoxicity:	0.978
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.592
A549 Cytotoxicity:	0.993	Hek293 Cytotoxicity:	0.375
BCF:	0.437 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.294 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.088 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.094 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO3955	Ipomoea stans	Species	Convolvulaceae	Eukaryota	Roots	n.a.	n.a.	PMID[15387658]
NPO3955	Ipomoea stans	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8594150]
NPO3955	Ipomoea stans	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT382	Cell line	OVCAR-5	Homo sapiens	ED50	=	5.5	ug ml-1	PMID[15387658]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC478733 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21692
0.1-0.2	24846
0.2-0.3	3096
0.3-0.4	91
0.4-0.5	17
0.5-0.6	33
0.6-0.7	42
0.7-0.8	0
0.8-0.85	6
0.85-0.9	2
0.9-0.95	2
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9722	High Similarity	NPC478734
0.9324	High Similarity	NPC477344
0.9211	High Similarity	NPC297768
0.8734	High Similarity	NPC238264
0.8734	High Similarity	NPC477345
0.8313	Intermediate Similarity	NPC44782
0.8293	Intermediate Similarity	NPC224953
0.8182	Intermediate Similarity	NPC22742
0.8182	Intermediate Similarity	NPC477346
0.8072	Intermediate Similarity	NPC184915
0.8072	Intermediate Similarity	NPC126685
0.7952	Intermediate Similarity	NPC115013
0.7857	Intermediate Similarity	NPC183888
0.7831	Intermediate Similarity	NPC476087
0.7831	Intermediate Similarity	NPC475667
0.7738	Intermediate Similarity	NPC290012
0.7738	Intermediate Similarity	NPC478732
0.7711	Intermediate Similarity	NPC119583
0.7647	Intermediate Similarity	NPC259294
0.7647	Intermediate Similarity	NPC475270
0.7647	Intermediate Similarity	NPC475327
0.7528	Intermediate Similarity	NPC475241
0.75	Intermediate Similarity	NPC143421
0.75	Intermediate Similarity	NPC478730
0.75	Intermediate Similarity	NPC606819
0.7412	Intermediate Similarity	NPC483170
0.7381	Intermediate Similarity	NPC477319
0.7294	Intermediate Similarity	NPC307400
0.7294	Intermediate Similarity	NPC472204
0.7294	Intermediate Similarity	NPC27289
0.7294	Intermediate Similarity	NPC294748
0.7191	Intermediate Similarity	NPC475164
0.7159	Intermediate Similarity	NPC472200
0.7143	Intermediate Similarity	NPC109887
0.7108	Intermediate Similarity	NPC89843
0.7089	Intermediate Similarity	NPC477350
0.7059	Intermediate Similarity	NPC146992
0.7059	Intermediate Similarity	NPC85759
0.7059	Intermediate Similarity	NPC267592
0.7024	Intermediate Similarity	NPC477326
0.6977	Remote Similarity	NPC472205
0.6966	Remote Similarity	NPC123204
0.6966	Remote Similarity	NPC475525
0.6966	Remote Similarity	NPC475540
0.6923	Remote Similarity	NPC473605
0.6923	Remote Similarity	NPC475375
0.6824	Remote Similarity	NPC600446
0.6824	Remote Similarity	NPC605013
0.6742	Remote Similarity	NPC238056
0.6742	Remote Similarity	NPC478731
0.6706	Remote Similarity	NPC477331
0.6703	Remote Similarity	NPC476066
0.6667	Remote Similarity	NPC477349
0.6591	Remote Similarity	NPC173328
0.6556	Remote Similarity	NPC169345
0.6556	Remote Similarity	NPC477317
0.6556	Remote Similarity	NPC477318
0.6471	Remote Similarity	NPC113745
0.6471	Remote Similarity	NPC477320
0.6471	Remote Similarity	NPC477323
0.6471	Remote Similarity	NPC477325
0.6471	Remote Similarity	NPC609436
0.6444	Remote Similarity	NPC478726
0.6429	Remote Similarity	NPC281563
0.64	Remote Similarity	NPC611287
0.6395	Remote Similarity	NPC604005
0.6395	Remote Similarity	NPC605014
0.6373	Remote Similarity	NPC600721
0.6373	Remote Similarity	NPC605872
0.6344	Remote Similarity	NPC477347
0.6333	Remote Similarity	NPC186992
0.6292	Remote Similarity	NPC479061
0.625	Remote Similarity	NPC158302
0.6238	Remote Similarity	NPC290276
0.6222	Remote Similarity	NPC479060
0.6176	Remote Similarity	NPC610996
0.6146	Remote Similarity	NPC477348
0.6067	Remote Similarity	NPC479059
0.6038	Remote Similarity	NPC472352
0.6024	Remote Similarity	NPC478729
0.6019	Remote Similarity	NPC600672
0.6	Remote Similarity	NPC146380
0.5955	Remote Similarity	NPC477332
0.5946	Remote Similarity	NPC206823
0.5938	Remote Similarity	NPC478728
0.5934	Remote Similarity	NPC478722
0.5934	Remote Similarity	NPC478725
0.5876	Remote Similarity	NPC478727
0.587	Remote Similarity	NPC478723
0.587	Remote Similarity	NPC478724
0.5841	Remote Similarity	NPC147032
0.5794	Remote Similarity	NPC600940
0.5761	Remote Similarity	NPC60849
0.5747	Remote Similarity	NPC477328
0.5747	Remote Similarity	NPC477330
0.5699	Remote Similarity	NPC479058
0.5686	Remote Similarity	NPC63404
0.5682	Remote Similarity	NPC477329
0.5648	Remote Similarity	NPC610997
0.5636	Remote Similarity	NPC471024
0.5631	Remote Similarity	NPC77651
0.5619	Remote Similarity	NPC10121
0.5619	Remote Similarity	NPC198918
0.5619	Remote Similarity	NPC10883
0.5534	Remote Similarity	NPC35338
0.5534	Remote Similarity	NPC204214
0.5534	Remote Similarity	NPC92283
0.551	Remote Similarity	NPC269318
0.5481	Remote Similarity	NPC28069
0.5437	Remote Similarity	NPC124878
0.5437	Remote Similarity	NPC231888
0.5281	Remote Similarity	NPC475425
0.5253	Remote Similarity	NPC163409
0.5229	Remote Similarity	NPC471025
0.5179	Remote Similarity	NPC471026

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC478733 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7243
0.1-0.2	1837
0.2-0.3	69
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data