NPASS Compound

Natural Product: NPC479058

Natural Product ID	NPC479058
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	OXPMXNOQWPDRHJ-RNNSIVFJSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	132584640
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0003909] Fatty Acyls [CHEMONTID:0001766] Fatty acyl glycosides [CHEMONTID:0003861] Fatty acyl glycosides of mono- and disaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 143147 0 0 0 0 0 0 0 0999 V2000 -4.1513 -6.9554 -1.7867 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1070 -6.1935 -2.5684 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2352 -4.7170 -2.4033 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1049 -4.2101 -1.0232 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7194 -4.5870 -0.4779 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6787 -3.8766 -1.3262 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6745 -3.9485 -0.7980 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3731 -5.2806 -0.7038 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6779 -4.9104 0.0272 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6652 -6.0053 0.1595 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7582 -5.4107 1.1042 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0816 -4.0437 0.6029 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1278 -3.4027 1.5391 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1914 -1.9841 1.0114 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0847 -1.5751 0.2724 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1611 -1.1726 1.4178 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0175 0.1707 1.0380 C 0 0 2 0 0 0 0 0 0 0 0 0 6.1538 0.9565 1.5976 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7506 1.5093 2.9452 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5011 2.3191 2.8305 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8857 3.7902 2.8364 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7436 2.0042 1.7130 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6555 0.6068 1.5997 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6939 0.2324 0.6778 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4068 0.0918 1.2559 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5061 -0.2955 0.0663 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6098 0.8360 -0.8847 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7013 1.2114 -1.5271 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7172 1.2181 -0.4073 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8597 -0.2620 -0.0524 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6871 -0.8017 0.3926 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8406 -0.5397 0.8673 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0508 -0.9744 0.3767 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0397 -0.9177 1.5634 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.4159 -1.1226 1.0301 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3803 -1.9900 -0.1806 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5398 -1.1286 -1.4084 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3573 -2.8873 -0.2675 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0924 -2.4363 -0.0215 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2064 -2.8053 -0.9853 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2953 -1.6212 2.0089 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8752 0.2382 2.2980 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8299 1.8179 -0.8810 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4044 2.8229 -0.1100 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2905 4.1273 -0.8411 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2571 5.1960 -0.4749 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5196 4.6431 0.0718 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7032 3.1922 -0.3209 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9952 2.7409 0.3280 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6818 2.4044 0.1485 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6120 5.3712 -0.4476 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4760 6.0638 0.3679 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2640 6.0361 1.6260 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6433 6.8491 -0.0711 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6880 6.1588 0.3813 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9867 4.6421 -0.6377 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5986 2.4611 -2.0785 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5125 0.5956 -1.9482 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6339 0.4643 3.8590 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5381 2.0483 0.7840 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8288 2.2019 0.3000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6416 1.2973 0.6364 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2935 3.3105 -0.5485 C 0 0 2 0 0 0 0 0 0 0 0 0 8.1428 4.6699 0.1137 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5709 3.3536 -1.8820 C 0 0 1 0 0 0 0 0 0 0 0 0 8.1159 4.5201 -2.6790 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7197 2.1676 -2.5793 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2429 -7.9544 -2.2978 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1443 -6.4990 -1.8304 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7736 -7.1626 -0.7722 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3270 -6.4020 -3.6587 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1312 -6.6265 -2.3608 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5646 -4.2202 -3.1377 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2865 -4.4625 -2.7439 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8103 -4.6922 -0.3402 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6043 -5.6697 -0.6567 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5968 -4.3513 0.5763 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9701 -2.8138 -1.4469 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6809 -4.2839 -2.3729 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3506 -3.3191 -1.4600 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7235 -3.4199 0.1928 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8729 -6.0322 -0.1017 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5989 -5.7097 -1.6975 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0811 -4.0859 -0.6385 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3845 -4.5138 1.0183 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1491 -6.1895 -0.8220 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2234 -6.8882 0.6259 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2685 -5.3314 2.0848 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6520 -6.0367 1.0744 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4939 -3.9989 -0.4022 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1886 -3.3684 0.7293 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7350 -3.3568 2.5568 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0961 -3.9056 1.4785 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9924 0.3039 -0.0648 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0062 0.2655 1.7882 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6145 2.1489 3.2783 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8386 2.1745 3.7242 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0473 4.4309 2.4671 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8338 3.9871 2.3185 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0373 4.0731 3.9139 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5033 0.1739 2.5895 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4984 -0.7596 1.9674 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0804 1.0202 1.7217 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1068 -1.1351 -0.4080 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9945 1.7872 -0.4093 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0312 0.4394 -2.2660 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3592 1.6950 0.5269 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1301 -0.7623 -1.0024 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3652 -0.3066 -0.4300 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7498 -1.7936 2.2089 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8320 -0.1069 0.7837 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3273 -2.6177 -0.1324 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4754 -1.3747 -1.9805 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6163 -0.0482 -1.1884 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7153 -1.2829 -2.1490 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7586 -2.9823 0.9234 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2139 -1.3812 1.7139 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7252 0.5842 2.6828 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8524 2.9730 0.8476 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3880 3.8854 -1.9290 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4741 5.7865 -1.4168 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5628 4.7593 1.1915 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8291 3.1419 -1.4127 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5280 1.9561 -0.2760 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7908 2.2313 1.3106 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6852 3.5712 0.5445 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5757 6.4524 0.4273 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5680 7.9006 0.2713 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7816 6.8506 -1.1642 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4674 6.5759 0.8533 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8992 4.8964 0.3158 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1490 2.9487 -1.6414 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3672 1.3236 -2.6062 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2835 0.8294 4.7013 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3619 3.1472 -0.7886 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1016 5.2376 0.0105 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9801 4.4947 1.1931 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2926 5.2342 -0.3008 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5023 3.5668 -1.6413 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8754 4.1041 -3.3744 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6458 5.2133 -2.0067 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3203 5.0093 -3.2795 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8713 2.3869 -3.5305 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 14 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 39 40 1 0 35 41 1 0 34 42 1 0 29 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 48 50 1 0 47 51 1 0 51 52 1 0 52 53 2 0 52 54 1 0 46 55 1 0 45 56 1 0 28 57 1 0 27 58 1 0 19 59 1 0 18 60 1 0 60 61 1 0 61 62 2 0 61 63 1 0 63 64 1 0 63 65 1 0 65 66 1 0 65 67 1 0 40 4 1 0 50 44 1 0 23 17 1 0 31 26 1 0 39 33 1 0 1 68 1 0 1 69 1 0 1 70 1 0 2 71 1 0 2 72 1 0 3 73 1 0 3 74 1 0 4 75 1 1 5 76 1 0 5 77 1 0 6 78 1 0 6 79 1 0 7 80 1 0 7 81 1 0 8 82 1 0 8 83 1 0 9 84 1 0 9 85 1 0 10 86 1 0 10 87 1 0 11 88 1 0 11 89 1 0 12 90 1 0 12 91 1 0 13 92 1 0 13 93 1 0 17 94 1 6 18 95 1 1 19 96 1 1 20 97 1 1 21 98 1 0 21 99 1 0 21100 1 0 23101 1 1 25102 1 0 25103 1 0 26104 1 6 27105 1 1 28106 1 6 29107 1 1 30108 1 6 33109 1 6 34110 1 1 35111 1 6 36112 1 1 37113 1 0 37114 1 0 37115 1 0 39116 1 1 41117 1 0 42118 1 0 44119 1 1 45120 1 6 46121 1 6 47122 1 1 48123 1 6 49124 1 0 49125 1 0 49126 1 0 54127 1 0 54128 1 0 54129 1 0 55130 1 0 56131 1 0 57132 1 0 58133 1 0 59134 1 0 63135 1 6 64136 1 0 64137 1 0 64138 1 0 65139 1 1 66140 1 0 66141 1 0 66142 1 0 67143 1 0 M END

Standard InCHIKey	OXPMXNOQWPDRHJ-RNNSIVFJSA-N
Standard InCHI	InChI=1S/C45H76O22/c1-8-16-26-17-14-12-10-9-11-13-15-18-28(48)64-40-37(65-41(56)20(2)21(3)46)30(50)23(5)58-43(40)57-19-27-31(51)33(53)39(66-42-35(55)34(54)36(24(6)60-42)61-25(7)47)45(63-27)67-38-32(52)29(49)22(4)59-44(38)62-26/h20-24,26-27,29-40,42-46,49-55H,8-19H2,1-7H3/t20-,21-,22-,23-,24+,26+,27-,29-,30-,31-,32+,33+,34+,35-,36+,37+,38-,39-,40-,42+,43-,44+,45+/m1/s1
SMILES	CCC[C@H]1CCCCCCCCCC(=O)O[C@@H]2[C@H]([C@@H]([C@@H](C)O[C@H]2OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O[C@@H]2[C@H]([C@@H]([C@@H](C)O[C@H]2O1)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](C)O1)OC(=O)C)O)O)O)O)O)OC(=O)[C@H](C)[C@@H](C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	968.48	Volume:	929.569 ? Van der Waals volume.
Dense:	1.042	LogP:	1.581 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.971 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.46 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	46.0
TPSA:	314.58 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	8.0	Rings:	5.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.115	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.461	Fsp³:	0.933
MCE-18:	111.218 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.737	Fluc inhibitor:	0.082 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.009 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.462	Promiscuous compounds:	0.241

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.862	MDCK Permeability:	-4.915
Pgp-inhibitor:	0.0	Pgp-substrate:	0.426
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.0	30% Bioavailability (F30%):	0.738
50% Bioavailability (F50%):	0.567

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.728
Plasma Protein Binding (PPB):	58.552%	Volume Distribution (VD):	-0.393
Fu:	29.187% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.047

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.996
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.187
HLM stability:	0.991 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.878

Half-life (T1/2):

3.542

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.028
Human Hepatotoxicity (H-HT):	0.701	Drug-induced Liver Injury (DILI):	0.996
AMES Toxicity:	0.84	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.007	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.346	Drug-induced Nephrotoxicity:	0.993
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.555
A549 Cytotoxicity:	0.829	Hek293 Cytotoxicity:	0.062
BCF:	0.446 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.132 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.729 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.733 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO13214	Ipomoea alba	Species	Convolvulaceae	Eukaryota	seeds	n.a.	n.a.	PMID[22924480]
NPO13214	Ipomoea alba	Species	Convolvulaceae	Eukaryota	Seeds	n.a.	n.a.	PMID[28006904]
NPO13214	Ipomoea alba	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13214	Ipomoea alba	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	7
FC	3

Activity Type	# Activity
Cell line	8
Others	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT83	Cell line	MCF7	Homo sapiens	IC50	>	20000.0	nM	PMID[28006904]
NPT82	Cell line	MDA-MB-231	Homo sapiens	IC50	>	20000.0	nM	PMID[28006904]
NPT165	Cell line	HeLa	Homo sapiens	IC50	>	20000.0	nM	PMID[28006904]
NPT148	Cell line	HCT-15	Homo sapiens	IC50	>	20000.0	nM	PMID[28006904]
NPT393	Cell line	HCT-116	Homo sapiens	IC50	>	20000.0	nM	PMID[28006904]
NPT83	Cell line	MCF7	Homo sapiens	FC	=	4.0	n.a.	PMID[28006904]
NPT2	Others	Unspecified	n.a.	FC	=	1.0	n.a.	PMID[28006904]
NPT2	Others	Unspecified	n.a.	FC	=	2.0	n.a.	PMID[28006904]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC479058 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23711
0.1-0.2	23536
0.2-0.3	2426
0.3-0.4	56
0.4-0.5	40
0.5-0.6	67
0.6-0.7	14
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8375	Intermediate Similarity	NPC60849
0.8354	Intermediate Similarity	NPC479059
0.7159	Intermediate Similarity	NPC478731
0.7126	Intermediate Similarity	NPC478730
0.6966	Remote Similarity	NPC478732
0.6889	Remote Similarity	NPC475270
0.6889	Remote Similarity	NPC475327
0.6854	Remote Similarity	NPC476087
0.6854	Remote Similarity	NPC475667
0.6559	Remote Similarity	NPC476066
0.6452	Remote Similarity	NPC475525
0.6452	Remote Similarity	NPC475540
0.6421	Remote Similarity	NPC473605
0.6421	Remote Similarity	NPC475375
0.6316	Remote Similarity	NPC475164
0.6264	Remote Similarity	NPC297768
0.6071	Remote Similarity	NPC606819
0.6	Remote Similarity	NPC477332
0.5978	Remote Similarity	NPC478722
0.5934	Remote Similarity	NPC477344
0.5914	Remote Similarity	NPC44682
0.5876	Remote Similarity	NPC269318
0.5851	Remote Similarity	NPC186992
0.5824	Remote Similarity	NPC478734
0.5806	Remote Similarity	NPC267592
0.58	Remote Similarity	NPC475241
0.5789	Remote Similarity	NPC483170
0.5745	Remote Similarity	NPC173328
0.5745	Remote Similarity	NPC479060
0.5699	Remote Similarity	NPC478733
0.5684	Remote Similarity	NPC307400
0.5684	Remote Similarity	NPC27289
0.5684	Remote Similarity	NPC119583
0.567	Remote Similarity	NPC479057
0.5663	Remote Similarity	NPC479056
0.5638	Remote Similarity	NPC479061
0.5604	Remote Similarity	NPC113745
0.5604	Remote Similarity	NPC477320
0.5604	Remote Similarity	NPC477323
0.5604	Remote Similarity	NPC477325
0.5604	Remote Similarity	NPC609436
0.5567	Remote Similarity	NPC115013
0.5567	Remote Similarity	NPC477317
0.5567	Remote Similarity	NPC477318
0.5556	Remote Similarity	NPC281563
0.5532	Remote Similarity	NPC109887
0.5521	Remote Similarity	NPC143421
0.551	Remote Similarity	NPC183888
0.551	Remote Similarity	NPC224953
0.5464	Remote Similarity	NPC238264
0.5464	Remote Similarity	NPC477345
0.5455	Remote Similarity	NPC472200
0.5455	Remote Similarity	NPC123204
0.5444	Remote Similarity	NPC477328
0.5426	Remote Similarity	NPC477326
0.5417	Remote Similarity	NPC477319
0.5408	Remote Similarity	NPC238056
0.5408	Remote Similarity	NPC290012
0.5354	Remote Similarity	NPC126685
0.5341	Remote Similarity	NPC478729
0.5333	Remote Similarity	NPC475425
0.5321	Remote Similarity	NPC610996
0.5319	Remote Similarity	NPC477331
0.5268	Remote Similarity	NPC610997
0.5263	Remote Similarity	NPC158302
0.5263	Remote Similarity	NPC600446
0.5263	Remote Similarity	NPC605013
0.5258	Remote Similarity	NPC472205
0.5258	Remote Similarity	NPC478723
0.5253	Remote Similarity	NPC169345
0.5248	Remote Similarity	NPC477347
0.5225	Remote Similarity	NPC600721
0.5225	Remote Similarity	NPC605872
0.52	Remote Similarity	NPC184915
0.52	Remote Similarity	NPC259294
0.5196	Remote Similarity	NPC478728
0.5182	Remote Similarity	NPC600672
0.5165	Remote Similarity	NPC146380
0.5158	Remote Similarity	NPC89843
0.5146	Remote Similarity	NPC478727
0.5109	Remote Similarity	NPC477330
0.5098	Remote Similarity	NPC44782
0.5091	Remote Similarity	NPC611287
0.5088	Remote Similarity	NPC472352
0.5054	Remote Similarity	NPC477329

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC479058 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7365
0.1-0.2	1715
0.2-0.3	70
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data