Drug Information| Drug ID:   | NPD8961 |
| Drug Name:   | Sodium Gluconate |
| Molecular Formula:   | C6H10O7.Na |
| Canonical SMILES:   | O[C@H]1O[C@H](C(=O)[O-])[C@H]([C@@H]([C@H]1O)O)O.[Na+] |
| Standard InCHI:   | "InChI=1S/C6H10O7.Na/c7-1-2(8)4(5(10)11)13-6(12)3(1)9;/h1-4,6-9,12H,(H,10,11);/q;+1/p-1/t1-,2-,3+,4-,6-;/m0./s1" |
| Standard InCHIKey:   | MSXHSNHNTORCAW-GGLLEASOSA-M |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD8961Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC281767 |
| High Similarity | 1.0 | NPC301743 |
| Remote Similarity | 0.5625 | NPC282812 |
| Remote Similarity | 0.5625 | NPC317651 |
| Remote Similarity | 0.5625 | NPC326445 |
| Remote Similarity | 0.5625 | NPC138603 |
| Remote Similarity | 0.5625 | NPC258690 |
| Remote Similarity | 0.5625 | NPC46747 |
| Remote Similarity | 0.5625 | NPC178552 |
| Remote Similarity | 0.5625 | NPC63859 |
| Remote Similarity | 0.5625 | NPC107014 |
| Remote Similarity | 0.5625 | NPC496095 |
| Remote Similarity | 0.5625 | NPC498640 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 193.03 |
| ALogP   | -3.089 |
| MLogP   | 1.35 |
| XLogP   | -2.45 |
| HDA   | 7 |
| HBD   | 4 |
| Rotatable Bonds   | 6 |
| TPSA   | 130.28 |
| RO5 Violation   | 0 |