NPASS Compound

Natural Product: NPC581388

Natural Product ID	NPC581388
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{R},4~{R},5~{R},6~{R})-2-methyl-6-[[(2~{R},3~{R},4~{S},5~{R},6~{R})-3,4,5-trihydroxy-6-[[(2~{R},3~{R},4~{S},5~{R},6~{R})-3,4,5-trihydroxy-6-[(1~{R},2~{S},4~{S},5'~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-tetrahydropyran-2-yl]methoxy]tetrahydropyran-2-yl]methoxy]tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{S},3~{R},4~{R},5~{R},6~{R})-2-methyl-6-[[(2~{R},3~{R},4~{S},5~{R},6~{R})-3,4,5-trihydroxy-6-[[(2~{R},3~{R},4~{S},5~{R},6~{R})-3,4,5-trihydroxy-6-[(1~{R},2~{S},4~{S},5'~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-tetrahydropyran-2-yl]methoxy]tetrahydropyran-2-yl]methoxy]tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 136144 0 0 0 0 0 0 0 0999 V2000 13.9925 -0.6027 2.0825 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6939 -0.3209 1.3567 C 0 0 1 0 0 0 0 0 0 0 0 0 11.5850 -0.2273 2.3817 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7153 0.9523 2.0301 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5054 1.0643 0.5489 C 0 0 1 0 0 0 0 0 0 0 0 0 11.7075 1.3372 -0.0892 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8080 1.0161 0.6696 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0462 -0.1631 0.0797 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3103 0.0860 -1.0545 C 0 0 1 0 0 0 0 0 0 0 0 0 8.1831 -0.9234 -1.2505 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0048 -0.0467 -1.4854 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6688 -0.7023 -1.2522 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4050 -1.5503 -2.5192 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9377 -1.7300 -2.7342 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1742 -1.7519 -1.3996 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8311 -2.2730 -1.7020 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6627 -1.3888 -1.4257 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2317 -1.3942 -0.1031 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0747 -1.8288 -0.0067 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9387 -0.8492 0.5200 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2189 -1.2731 0.1711 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2613 -0.2043 0.2328 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4675 -0.7867 -0.1447 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5366 0.1146 -0.1465 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5092 -0.2106 0.7512 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6950 0.4323 0.4471 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.6655 0.4019 1.6139 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8297 1.0557 1.1961 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.7643 1.0718 2.2156 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.9196 0.3875 1.7917 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.1708 0.7688 0.4849 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.3598 -0.0720 0.0113 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.5074 2.2182 0.3511 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.2962 2.5733 -0.9922 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.6892 3.1318 1.2033 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.5036 4.2185 1.5548 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1819 2.4912 2.4785 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.2402 2.4545 3.3940 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3769 -0.1928 -0.7562 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.9778 -1.3771 -0.3736 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3197 -0.4929 -1.8070 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.0823 -1.8466 -1.8256 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0641 0.3120 -1.5269 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3476 1.6454 -1.8001 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6396 -2.4934 0.9471 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8512 -2.2718 2.2857 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6000 -3.5972 0.7083 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8251 -4.6874 1.5179 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1848 -3.0401 0.8862 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3190 -4.0389 0.4750 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1059 0.0102 -1.7931 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0803 0.4063 -0.7036 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3026 -0.4659 -0.6641 C 0 0 1 0 0 0 0 0 0 0 0 0 3.5083 -0.8117 0.8111 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5439 0.2474 -1.1274 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8470 1.4913 -0.3421 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1993 2.0629 -0.6761 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2335 1.0238 -0.4446 C 0 0 1 0 0 0 0 0 0 0 0 0 7.1846 0.5273 0.9686 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6279 1.4423 -0.8337 C 0 0 1 0 0 0 0 0 0 0 0 0 9.4291 2.0845 0.2357 C 0 0 2 0 0 0 0 0 0 0 0 0 10.0642 3.3418 -0.3790 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8879 -0.4248 3.1785 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7922 0.0881 1.7360 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3010 -1.6606 1.9478 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5409 -1.1506 0.6325 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0290 -0.0265 3.3779 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0358 -1.1730 2.4374 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2573 1.8619 2.3614 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7646 0.8479 2.5723 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0747 1.7691 1.4270 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6853 0.9372 -0.0300 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8994 0.0809 -1.9842 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0090 -1.4836 -0.3091 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4019 -1.6184 -2.0778 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0401 0.4731 -2.4720 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8138 -1.4348 -0.4610 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8239 -1.0075 -3.3881 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9020 -2.5235 -2.4554 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7789 -2.7439 -3.1740 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5026 -1.0158 -3.4546 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7319 -2.5583 -0.8235 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7511 -2.5313 -2.8053 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7004 -3.2938 -1.2249 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1855 -1.7338 -2.0552 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5134 -2.0996 -0.9889 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1644 -1.6127 -0.9058 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3038 0.2653 1.2376 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9763 0.5884 -0.4932 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0881 1.0992 0.1749 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5056 1.4986 0.2147 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1702 0.9399 2.4455 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8655 -0.6504 1.8537 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3876 0.5876 3.1264 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3329 0.4892 -0.1869 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.7443 0.3651 -0.9433 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.0580 -1.1299 -0.1515 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.1614 -0.0477 0.7664 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.6123 2.3405 0.5215 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3344 2.5582 -1.2293 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8218 3.5642 0.6622 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2652 5.0394 1.0371 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3608 3.1142 2.8845 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0185 1.9196 4.1940 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1494 0.4773 -1.1703 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8669 -1.5089 -0.7551 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7290 -0.1831 -2.7860 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3215 -2.0573 -1.2271 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3125 -0.0192 -2.3038 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9054 1.9673 -2.6155 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5900 -2.8446 0.5054 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9640 -1.3181 2.4774 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6974 -3.8727 -0.3635 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0018 -4.9785 1.9877 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0545 -2.7840 1.9581 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4690 -4.1801 -0.4891 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2053 0.6558 -1.6282 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4978 0.0857 -2.8063 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5011 0.3240 0.2404 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3011 1.4605 -0.8496 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6635 -1.5080 1.1220 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4050 -1.4397 0.9813 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3930 0.0446 1.4798 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3243 0.6163 -2.1783 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6759 1.4100 0.7439 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1273 2.2864 -0.6942 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1881 2.3267 -1.7597 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3529 2.9950 -0.1025 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1848 1.4550 1.6145 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2526 0.0234 1.2118 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0242 -0.1323 1.2441 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5871 2.0098 -1.7812 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8957 2.4285 1.1179 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2091 4.0088 -0.6606 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5918 3.1042 -1.3095 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6556 3.8846 0.3648 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 6 6 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 26 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 41 43 1 0 43 44 1 0 21 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 47 49 1 0 49 50 1 0 17 51 1 0 51 52 1 0 52 53 1 0 53 54 1 1 53 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 1 58 60 1 0 60 61 1 0 61 62 1 0 7 2 1 0 60 9 1 0 61 5 1 0 58 11 1 0 55 12 1 0 53 15 1 0 49 19 1 0 43 24 1 0 37 29 1 0 1 63 1 0 1 64 1 0 1 65 1 0 2 66 1 6 3 67 1 0 3 68 1 0 4 69 1 0 4 70 1 0 7 71 1 0 7 72 1 0 9 73 1 6 10 74 1 0 10 75 1 0 11 76 1 6 12 77 1 1 13 78 1 0 13 79 1 0 14 80 1 0 14 81 1 0 15 82 1 1 16 83 1 0 16 84 1 0 17 85 1 6 19 86 1 6 21 87 1 6 22 88 1 0 22 89 1 0 24 90 1 1 26 91 1 6 27 92 1 0 27 93 1 0 29 94 1 1 31 95 1 6 32 96 1 0 32 97 1 0 32 98 1 0 33 99 1 1 34100 1 0 35101 1 6 36102 1 0 37103 1 1 38104 1 0 39105 1 6 40106 1 0 41107 1 6 42108 1 0 43109 1 6 44110 1 0 45111 1 6 46112 1 0 47113 1 6 48114 1 0 49115 1 1 50116 1 0 51117 1 0 51118 1 0 52119 1 0 52120 1 0 54121 1 0 54122 1 0 54123 1 0 55124 1 6 56125 1 0 56126 1 0 57127 1 0 57128 1 0 59129 1 0 59130 1 0 59131 1 0 60132 1 6 61133 1 1 62134 1 0 62135 1 0 62136 1 0 M END

Standard InCHIKey	SOLLLKXKOBZXOZ-JRUHDRENSA-N
Standard InCHI	InChI=1S/C45H74O17/c1-19-8-13-45(57-16-19)20(2)30-27(62-45)15-26-24-7-6-22-14-23(9-11-43(22,4)25(24)10-12-44(26,30)5)59-42-39(54)36(51)33(48)29(61-42)18-56-41-38(53)35(50)32(47)28(60-41)17-55-40-37(52)34(49)31(46)21(3)58-40/h19-42,46-54H,6-18H2,1-5H3/t19-,20-,21-,22+,23-,24+,25-,26-,27-,28+,29+,30-,31-,32-,33-,34+,35-,36-,37+,38+,39+,40+,41+,42+,43-,44-,45+/m0/s1
SMILES	C[C@H]1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC[C@@H]5C[C@@H](O[C@@H]6O[C@H](CO[C@@H]7O[C@H](CO[C@@H]8O[C@@H](C)[C@H](O)[C@@H](O)[C@H]8O)[C@H](O)[C@H](O)[C@H]7O)[C@H](O)[C@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	886.49	Volume:	859.302 ? Van der Waals volume.
Dense:	1.032	LogP:	2.676 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.361 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.777 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	48.0
TPSA:	255.91 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	9.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.149	GASA:	0.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.68	Fsp³:	1.0
MCE-18:	230.667 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.695	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.027 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.255	Promiscuous compounds:	0.009

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.112	MDCK Permeability:	-5.095
Pgp-inhibitor:	0.001	Pgp-substrate:	0.963
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.723	30% Bioavailability (F30%):	0.981
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.287
Plasma Protein Binding (PPB):	60.691%	Volume Distribution (VD):	-0.363
Fu:	28.785% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.021
BSEP inhibitor:	0.097

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.001	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.957	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.375
HLM stability:	0.007 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.457

Half-life (T1/2):

2.13

ADMET: Toxicity

hERG Blockers:	0.034	hERG Blockers (10um):	0.145
Human Hepatotoxicity (H-HT):	0.346	Drug-induced Liver Injury (DILI):	0.893
AMES Toxicity:	0.956	Rat Oral Acute Toxicity:	0.015
Maximum Recommended Daily Dose:	0.027	Skin Sensitization:	1.0
Carcinogencity:	0.076	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.991
Hematotoxicity:	0.395	Drug-induced Nephrotoxicity:	0.687
Genotoxicity:	0.002	RPMI-8226 Immunitoxicity:	0.373
A549 Cytotoxicity:	0.98	Hek293 Cytotoxicity:	0.952
BCF:	2.159 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.621 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.581 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.171 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO17292	Asparagus racemosus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO17292	Asparagus racemosus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC581388 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25464
0.1-0.2	21119
0.2-0.3	2636
0.3-0.4	392
0.4-0.5	124
0.5-0.6	78
0.6-0.7	31
0.7-0.8	1
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8718	High Similarity	NPC177834
0.7765	Intermediate Similarity	NPC211354
0.7619	Intermediate Similarity	NPC477451
0.7558	Intermediate Similarity	NPC107188
0.7294	Intermediate Similarity	NPC234352
0.7191	Intermediate Similarity	NPC215408
0.7176	Intermediate Similarity	NPC297348
0.7176	Intermediate Similarity	NPC325828
0.7176	Intermediate Similarity	NPC249204
0.7176	Intermediate Similarity	NPC48339
0.7176	Intermediate Similarity	NPC141769
0.7176	Intermediate Similarity	NPC477547
0.7159	Intermediate Similarity	NPC19400
0.7126	Intermediate Similarity	NPC250393
0.6957	Remote Similarity	NPC160426
0.6941	Remote Similarity	NPC485594
0.6923	Remote Similarity	NPC6295
0.6813	Remote Similarity	NPC107962
0.6703	Remote Similarity	NPC264101
0.6667	Remote Similarity	NPC206003
0.6667	Remote Similarity	NPC473610
0.6588	Remote Similarity	NPC473774
0.6588	Remote Similarity	NPC481419
0.6588	Remote Similarity	NPC481417
0.6531	Remote Similarity	NPC128572
0.6526	Remote Similarity	NPC475351
0.6429	Remote Similarity	NPC471464
0.6392	Remote Similarity	NPC475643
0.6374	Remote Similarity	NPC222731
0.63	Remote Similarity	NPC97700
0.63	Remote Similarity	NPC30856
0.625	Remote Similarity	NPC83137
0.6235	Remote Similarity	NPC144790
0.6235	Remote Similarity	NPC149400
0.6211	Remote Similarity	NPC485595
0.6207	Remote Similarity	NPC481420
0.6207	Remote Similarity	NPC481421
0.6139	Remote Similarity	NPC184617
0.6122	Remote Similarity	NPC202898
0.6117	Remote Similarity	NPC475625
0.6082	Remote Similarity	NPC14704
0.6058	Remote Similarity	NPC232037
0.6042	Remote Similarity	NPC470432
0.6042	Remote Similarity	NPC230507
0.6038	Remote Similarity	NPC132080
0.5978	Remote Similarity	NPC294686
0.5934	Remote Similarity	NPC181845
0.5918	Remote Similarity	NPC113044
0.5918	Remote Similarity	NPC283829
0.5918	Remote Similarity	NPC161676
0.5895	Remote Similarity	NPC306131
0.5895	Remote Similarity	NPC200802
0.5882	Remote Similarity	NPC329807
0.5876	Remote Similarity	NPC125324
0.5849	Remote Similarity	NPC470864
0.5816	Remote Similarity	NPC195297
0.5816	Remote Similarity	NPC70204
0.581	Remote Similarity	NPC116756
0.5806	Remote Similarity	NPC131693
0.5806	Remote Similarity	NPC475436
0.5784	Remote Similarity	NPC51172
0.5784	Remote Similarity	NPC49032
0.5778	Remote Similarity	NPC24960
0.5761	Remote Similarity	NPC481424
0.5761	Remote Similarity	NPC481422
0.5696	Remote Similarity	NPC248944
0.5696	Remote Similarity	NPC7479
0.5696	Remote Similarity	NPC257296
0.5691	Remote Similarity	NPC329727
0.5686	Remote Similarity	NPC92890
0.5667	Remote Similarity	NPC481418
0.561	Remote Similarity	NPC481189
0.5588	Remote Similarity	NPC470433
0.5588	Remote Similarity	NPC46190
0.5588	Remote Similarity	NPC171073
0.5588	Remote Similarity	NPC602423
0.5586	Remote Similarity	NPC470866
0.5514	Remote Similarity	NPC475333
0.5514	Remote Similarity	NPC224098
0.5514	Remote Similarity	NPC208383
0.55	Remote Similarity	NPC141433
0.549	Remote Similarity	NPC473601
0.5481	Remote Similarity	NPC300557
0.5481	Remote Similarity	NPC6806
0.5472	Remote Similarity	NPC475319
0.5444	Remote Similarity	NPC277715
0.5429	Remote Similarity	NPC480555
0.5429	Remote Similarity	NPC150372
0.5426	Remote Similarity	NPC481425
0.5426	Remote Similarity	NPC481426
0.5377	Remote Similarity	NPC294129
0.5333	Remote Similarity	NPC88962
0.5315	Remote Similarity	NPC233433
0.5309	Remote Similarity	NPC227260
0.528	Remote Similarity	NPC329820
0.5278	Remote Similarity	NPC269297
0.5278	Remote Similarity	NPC222202
0.5273	Remote Similarity	NPC480554
0.5253	Remote Similarity	NPC54619
0.5238	Remote Similarity	NPC477809
0.5229	Remote Similarity	NPC309278
0.5225	Remote Similarity	NPC476112
0.5225	Remote Similarity	NPC307534
0.5217	Remote Similarity	NPC480556
0.5204	Remote Similarity	NPC312678
0.5204	Remote Similarity	NPC253268
0.5185	Remote Similarity	NPC115165
0.5182	Remote Similarity	NPC194207
0.5182	Remote Similarity	NPC22779
0.5179	Remote Similarity	NPC480553
0.5164	Remote Similarity	NPC481190
0.5155	Remote Similarity	NPC291203
0.5155	Remote Similarity	NPC217205
0.513	Remote Similarity	NPC94086
0.513	Remote Similarity	NPC473817
0.5128	Remote Similarity	NPC220836
0.5106	Remote Similarity	NPC172838
0.5096	Remote Similarity	NPC112274
0.5094	Remote Similarity	NPC248746
0.5051	Remote Similarity	NPC474399
0.505	Remote Similarity	NPC485590
0.5049	Remote Similarity	NPC475670
0.5047	Remote Similarity	NPC274200

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC581388 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7595
0.1-0.2	1477
0.2-0.3	60
0.3-0.4	13
0.4-0.5	1
0.5-0.6	2
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7176	Intermediate Similarity	NPD8171	Phase 2
0.6042	Remote Similarity	NPD8170	Phase 2
0.5696	Remote Similarity	NPD6928	Phase 2
0.5385	Remote Similarity	NPD7991	Discontinued

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data