NPASS Compound

Natural Product: NPC129829

Natural Product ID	NPC129829
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3Beta,15Alpha,22-Trihydroxyhopane
IUPAC Name	(3S,3aS,5S,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bS)-3-(2-hydroxypropan-2-yl)-5a,5b,8,8,11a,13b-hexamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysene-5,9-diol
Synonyms	3Beta,15Alpha,22-Trihydroxyhopane
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1928583
PubChem CID	57397239
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001823] Hopanoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 85 89 0 0 0 0 0 0 0 0999 V2000 -5.9122 -0.7138 -0.5876 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0203 0.4595 -0.4476 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2782 1.3684 -1.6640 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5561 0.2002 -0.4466 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.9938 -0.2517 -1.7555 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5086 0.1315 -1.7042 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8248 -0.4663 -0.5200 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5442 -1.9025 -0.9270 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5573 -0.3657 0.7708 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8578 -1.0987 1.8612 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5733 -0.5786 1.9931 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2513 -0.5397 0.6738 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7119 -0.2614 0.7424 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1283 0.9627 1.4296 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4676 -1.4306 1.3592 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8722 -1.2041 0.7902 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6653 -0.7040 -0.6264 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2495 -0.4170 -0.6845 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7036 0.6595 -1.5033 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1981 0.5016 -1.6275 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4989 0.3024 -0.3209 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2144 1.6900 0.1937 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7554 1.7092 -2.2243 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6796 0.2700 -1.0648 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0457 -0.4425 -0.9862 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8468 1.5422 -0.3465 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5413 0.5977 -2.4182 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0386 -0.6360 0.6995 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3775 -2.0904 0.5852 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7556 -0.1192 1.9256 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2230 1.3091 1.7652 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3432 1.3118 0.7717 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.5103 0.8212 1.3896 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3904 -1.0205 0.3901 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4830 -1.5966 -1.0624 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8104 -0.4445 -1.2224 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3917 2.0405 -1.7899 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1235 2.0430 -1.4083 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4982 0.7797 -2.5599 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0987 1.2252 -0.2610 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1586 -1.2850 -2.0212 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4557 0.3779 -2.5578 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0761 -0.2921 -2.6425 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4863 1.2078 -1.8048 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3923 -2.0018 -1.5463 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5379 -2.6208 -0.1195 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3369 -2.2735 -1.6486 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5078 0.7244 1.0792 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8565 -2.1806 1.8271 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3066 -0.8411 2.8683 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6263 0.3143 2.6137 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1002 -1.3796 2.5983 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1804 -1.6005 0.2760 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2243 1.8799 0.8315 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3904 1.2044 2.2270 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0885 0.8283 1.9634 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5079 -1.3577 2.4578 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1173 -2.3890 0.9726 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3612 -2.2060 0.8421 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4815 -0.5403 1.4052 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8824 -1.6250 -1.2649 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6961 -1.3535 -1.0262 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8620 1.6979 -1.1569 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0757 0.5236 -2.5630 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9749 -0.2630 -2.3955 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7319 2.1319 -0.1676 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9995 2.4236 -0.1672 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2186 1.7882 1.2803 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4092 2.4192 -2.1653 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7824 0.1438 -1.5753 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0054 -1.4481 -1.3941 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4233 -0.3990 0.0729 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0997 2.3367 -0.5905 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0456 1.4597 0.7392 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8100 2.0004 -0.7427 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6967 -0.1778 -3.0078 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7305 -2.6927 1.2291 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3697 -2.5124 -0.4096 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4217 -2.2480 0.9888 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2197 -0.1892 2.8602 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7032 -0.7210 2.0683 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6758 1.5872 2.7580 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4286 2.0270 1.5821 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5561 2.3693 0.5140 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1982 1.5108 1.4965 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 6 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 1 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 1 20 23 1 0 17 24 1 0 24 25 1 0 24 26 1 0 24 27 1 0 9 28 1 0 28 29 1 6 28 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 32 2 1 0 28 4 1 0 21 7 1 0 21 12 1 0 18 13 1 0 1 34 1 0 1 35 1 0 1 36 1 0 3 37 1 0 3 38 1 0 3 39 1 0 4 40 1 1 5 41 1 0 5 42 1 0 6 43 1 0 6 44 1 0 8 45 1 0 8 46 1 0 8 47 1 0 9 48 1 1 10 49 1 0 10 50 1 0 11 51 1 0 11 52 1 0 12 53 1 6 14 54 1 0 14 55 1 0 14 56 1 0 15 57 1 0 15 58 1 0 16 59 1 0 16 60 1 0 17 61 1 6 18 62 1 6 19 63 1 0 19 64 1 0 20 65 1 6 22 66 1 0 22 67 1 0 22 68 1 0 23 69 1 0 25 70 1 0 25 71 1 0 25 72 1 0 26 73 1 0 26 74 1 0 26 75 1 0 27 76 1 0 29 77 1 0 29 78 1 0 29 79 1 0 30 80 1 0 30 81 1 0 31 82 1 0 31 83 1 0 32 84 1 6 33 85 1 0 M END

Standard InCHIKey	DKCBVIPOQXEXSD-NPOVCAEKSA-N
Standard InCHI	InChI=1S/C30H52O3/c1-25(2)20-12-16-29(7)21(28(20,6)15-13-23(25)31)9-10-22-27(5)14-11-18(26(3,4)33)19(27)17-24(32)30(22,29)8/h18-24,31-33H,9-17H2,1-8H3/t18-,19-,20-,21+,22+,23-,24-,27-,28-,29+,30-/m0/s1
SMILES	CC1(C)[C@@H]2CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@@H]([C@@H]5C[C@@H]([C@@]34C)O)C(C)(C)O)[C@@]2(C)CC[C@@H]1O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	460.39	Volume:	511.024 ? Van der Waals volume.
Dense:	0.901	LogP:	4.991 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.531 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.549 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	1.0	Rigid Bonds:	25.0
TPSA:	60.69 ? Topological Polar Surface Area.	H-Bond Acceptor:	3.0
H-Bond Donor:	3.0	Rings:	5.0
Heavy Atoms:	3.0

MedChem Properties

QED Drug-Likeness Score:	0.437	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.948	Fsp³:	1.0
MCE-18:	108.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.504	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.431	Promiscuous compounds:	0.382

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.322	MDCK Permeability:	-5.026
Pgp-inhibitor:	0.042	Pgp-substrate:	0.348
PAMPA:	0.974 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.002
20% Bioavailability (F20%):	0.111	30% Bioavailability (F30%):	0.016
50% Bioavailability (F50%):	0.983

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.989	MRP1:	0.535
Plasma Protein Binding (PPB):	96.358%	Volume Distribution (VD):	-0.28
Fu:	3.987% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.957	BCRP inhibitor:	0.926
BSEP inhibitor:	0.871

ADMET: Metabolism

CYP1A2-inhibitor:	0.444	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.991	CYP2C19-substrate:	0.005
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.001
CYP2D6-inhibitor:	0.012	CYP2D6-substrate:	0.046
CYP3A4-inhibitor:	0.361	CYP3A4-substrate:	0.932
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.918
HLM stability:	0.617 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

15.807

Half-life (T1/2):

1.369

ADMET: Toxicity

hERG Blockers:	0.06	hERG Blockers (10um):	0.133
Human Hepatotoxicity (H-HT):	0.582	Drug-induced Liver Injury (DILI):	0.188
AMES Toxicity:	0.338	Rat Oral Acute Toxicity:	0.155
Maximum Recommended Daily Dose:	0.63	Skin Sensitization:	0.978
Carcinogencity:	0.961	Eye Corrosion:	0.035
Eye Irritation:	0.742	Respiratory Toxicity:	0.881
Drug-induced Neurotoxicity:	0.008	Ototoxicity:	0.702
Hematotoxicity:	0.458	Drug-induced Nephrotoxicity:	0.889
Genotoxicity:	0.211	RPMI-8226 Immunitoxicity:	0.06
A549 Cytotoxicity:	0.158	Hek293 Cytotoxicity:	0.447
BCF:	1.571 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.784 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.265 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.539 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO30117	Hypocrella	Genus	Clavicipitaceae	Eukaryota	n.a.	mycelium	n.a.	PMID[21995505]
NPO33604	Hypocrella sp. BCC 14524	Species	Clavicipitaceae	Eukaryota	n.a.	The fungus used in this study was isolated from a scale insect collected in Nam Nao National Park, Phetcha Bun Province, Thailand	n.a.	PMID[21995505]
NPO33604	Hypocrella sp. BCC 14524	Species	Clavicipitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	1

Activity Type	# Activity
Organism	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT115	Organism	Mycobacterium tuberculosis H37Ra	Mycobacterium tuberculosis H37Ra	MIC	>	50.0	ug.mL-1	PMID[21995505]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC129829 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	29415
0.1-0.2	17546
0.2-0.3	2426
0.3-0.4	361
0.4-0.5	96
0.5-0.6	9
0.6-0.7	3
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7778	Intermediate Similarity	NPC127094
0.7292	Intermediate Similarity	NPC254037
0.6429	Remote Similarity	NPC220379
0.6154	Remote Similarity	NPC480925
0.6154	Remote Similarity	NPC48079
0.5439	Remote Similarity	NPC285761
0.5439	Remote Similarity	NPC34930
0.5385	Remote Similarity	NPC11908
0.5263	Remote Similarity	NPC245869
0.5254	Remote Similarity	NPC13554
0.5172	Remote Similarity	NPC73515
0.5098	Remote Similarity	NPC162685
0.5094	Remote Similarity	NPC232112
0.5091	Remote Similarity	NPC142712

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC129829 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8196
0.1-0.2	903
0.2-0.3	48
0.3-0.4	2
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data