Drug Information| Drug ID:   | NPD6705 |
| Drug Name:   | TRO-40303 |
| Molecular Formula:   | C26H47NO2 |
| Canonical SMILES:   | OCCC[C@@]1(C)/C(=N/O)/CC[C@@H]2[C@@H]1CC[C@]1([C@H]2CC[C@@H]1[C@@H](CCCC(C)C)C)C |
| Standard InCHI:   | "InChI=1S/C26H47NO2/c1-18(2)8-6-9-19(3)21-11-12-22-20-10-13-24(27-29)26(5,15-7-17-28)23(20)14-16-25(21,22)4/h18-23,28-29H,6-17H2,1-5H3/b27-24+/t19-,20+,21-,22+,23+,25-,26-/m1/s1" |
| Standard InCHIKey:   | OBKBVSFXEIFOMS-YVABUZGXSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD6705Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5333 | NPC469948 |
| Remote Similarity | 0.5333 | NPC531588 |
| Remote Similarity | 0.5246 | NPC562709 |
| Remote Similarity | 0.5091 | NPC184819 |
| Remote Similarity | 0.5091 | NPC199112 |
| Remote Similarity | 0.5091 | NPC507023 |
| Molecular Weight   | 405.36 |
| ALogP   | 1.2883 |
| MLogP   | 3.99 |
| XLogP   | 9.275 |
| HDA   | 1 |
| HBD   | 2 |
| Rotatable Bonds   | 15 |
| TPSA   | 52.82 |
| RO5 Violation   | 1 |