NPASS Compound

Natural Product: NPC133596

Natural Product ID	NPC133596
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(4R,20S,24R)-Epoxydammarane-3Alpha,25,28-Triol
IUPAC Name	(3R,4R,5R,8R,9R,10R,13R,14R,17S)-4-(hydroxymethyl)-17-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4,8,10,14-tetramethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3109463
PubChem CID	76310275
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 86 90 0 0 0 0 0 0 0 0999 V2000 -5.9688 1.8699 0.2145 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0351 0.7530 1.2074 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5008 0.4076 1.4571 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3597 -0.5073 0.7450 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9393 -0.9977 -0.5604 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7248 -1.0601 -1.4510 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6121 -1.2618 -0.4142 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6281 -2.6859 -0.0035 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3305 -0.8100 -1.0602 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5365 0.6641 -1.4157 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2922 1.3986 -0.9317 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3152 0.3148 -0.7836 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0721 -0.1504 -2.1686 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1568 -0.7957 -0.1464 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3971 -2.0634 -0.0372 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9662 -1.8797 0.5409 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6955 -0.6906 -0.0014 C 0 0 2 0 0 0 0 0 0 0 0 0 3.0989 -0.5801 0.4836 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2218 -0.6356 1.9827 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8482 -1.7943 -0.0544 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1546 -1.4629 -0.6783 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9667 -0.4390 0.0342 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1604 0.8489 0.0691 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5320 1.6592 1.2851 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6679 1.6657 -1.1345 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0333 1.9152 -1.0032 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7077 0.6536 -0.1182 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9574 1.8950 0.3084 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5763 1.7838 -0.3528 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8526 0.5550 0.1172 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3705 0.8223 1.5141 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1566 -0.2727 -0.7172 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0022 -0.3798 0.5710 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4853 1.1278 2.4284 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9391 2.4122 0.2227 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7985 1.5325 -0.8296 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1960 2.6237 0.4968 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0119 0.1235 0.5253 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0471 1.2760 1.8790 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5154 -0.4603 2.1470 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5428 -1.2810 1.5175 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6663 -0.3077 -0.9998 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3986 -2.0020 -0.4491 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7357 -1.9658 -2.0987 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5678 -0.1652 -2.0543 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6903 -3.0532 -0.0747 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3345 -2.8607 1.0534 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0592 -3.2870 -0.7261 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0910 -1.4170 -1.9558 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3866 1.1047 -0.8674 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7211 0.7964 -2.4891 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4796 2.0685 -0.1125 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9728 2.0415 -1.8049 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7171 0.1591 -2.9191 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1613 -1.2285 -2.2806 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9998 0.3324 -2.5483 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5151 -0.5165 0.8622 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9642 -2.7199 0.6914 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3993 -2.6850 -0.9780 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9237 -1.9388 1.6385 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5655 -2.7876 0.2303 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7905 -0.8777 -1.1158 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7274 0.1662 2.5192 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8308 -1.6520 2.2850 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2779 -0.6439 2.2778 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2459 -2.3434 -0.8303 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0254 -2.5536 0.7466 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7400 -2.4167 -0.7498 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0296 -1.1172 -1.7339 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3193 -0.7503 1.0365 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7694 2.7311 1.0311 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4918 1.2511 1.6828 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7741 1.6918 2.0608 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1612 2.6483 -1.1995 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5110 1.1399 -2.0784 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1986 2.8543 -0.7344 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5166 0.5647 -1.2305 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8735 1.9997 1.3898 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4508 2.7729 -0.1056 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6530 1.9025 -1.4302 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0012 2.6646 0.0548 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9496 1.6764 1.9788 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6908 1.2096 1.5482 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3655 -0.0590 2.1732 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9195 -0.0658 -0.1346 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5860 1.5446 2.3148 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 1 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 6 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 1 18 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 1 23 25 1 0 25 26 1 0 23 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 1 22 32 1 0 7 33 1 0 2 34 1 0 33 4 1 0 14 9 1 0 30 17 1 0 30 12 1 0 27 18 1 0 1 35 1 0 1 36 1 0 1 37 1 0 3 38 1 0 3 39 1 0 3 40 1 0 4 41 1 1 5 42 1 0 5 43 1 0 6 44 1 0 6 45 1 0 8 46 1 0 8 47 1 0 8 48 1 0 9 49 1 6 10 50 1 0 10 51 1 0 11 52 1 0 11 53 1 0 13 54 1 0 13 55 1 0 13 56 1 0 14 57 1 1 15 58 1 0 15 59 1 0 16 60 1 0 16 61 1 0 17 62 1 6 19 63 1 0 19 64 1 0 19 65 1 0 20 66 1 0 20 67 1 0 21 68 1 0 21 69 1 0 22 70 1 1 24 71 1 0 24 72 1 0 24 73 1 0 25 74 1 0 25 75 1 0 26 76 1 0 27 77 1 6 28 78 1 0 28 79 1 0 29 80 1 0 29 81 1 0 31 82 1 0 31 83 1 0 31 84 1 0 32 85 1 0 34 86 1 0 M END

Standard InCHIKey	GHWLHGPBZCFOOC-KQJYESDVSA-N
Standard InCHI	InChI=1S/C30H52O4/c1-25(2,33)24-13-17-30(7,34-24)20-10-15-28(5)19(20)8-9-22-26(3)14-12-23(32)27(4,18-31)21(26)11-16-29(22,28)6/h19-24,31-33H,8-18H2,1-7H3/t19-,20+,21-,22-,23-,24-,26+,27+,28-,29-,30+/m1/s1
SMILES	CC(C)([C@H]1CC[C@@](C)([C@H]2CC[C@]3(C)[C@@H]2CC[C@@H]2[C@@]4(C)CC[C@H]([C@@](C)(CO)[C@@H]4CC[C@@]32C)O)O1)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	476.39	Volume:	519.815 ? Van der Waals volume.
Dense:	0.916	LogP:	3.796 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.845 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.558 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	3.0	Rigid Bonds:	25.0
TPSA:	69.92 ? Topological Polar Surface Area.	H-Bond Acceptor:	4.0
H-Bond Donor:	3.0	Rings:	5.0
Heavy Atoms:	4.0

MedChem Properties

QED Drug-Likeness Score:	0.488	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.923	Fsp³:	1.0
MCE-18:	105.3 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.78	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.449	Promiscuous compounds:	0.441

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.226	MDCK Permeability:	-4.928
Pgp-inhibitor:	0.872	Pgp-substrate:	0.047
PAMPA:	0.757 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.174	30% Bioavailability (F30%):	0.016
50% Bioavailability (F50%):	0.933

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.534	MRP1:	0.822
Plasma Protein Binding (PPB):	90.714%	Volume Distribution (VD):	-0.252
Fu:	9.402% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.993
OATP1B3 inhibitor:	0.192	BCRP inhibitor:	0.375
BSEP inhibitor:	0.999

ADMET: Metabolism

CYP1A2-inhibitor:	0.029	CYP1A2-substrate:	0.003
CYP2C19-inhibitor:	0.998	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.087	CYP2C9-substrate:	0.001
CYP2D6-inhibitor:	0.951	CYP2D6-substrate:	0.01
CYP3A4-inhibitor:	0.988	CYP3A4-substrate:	0.5
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.705
HLM stability:	0.171 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

12.778

Half-life (T1/2):

1.216

ADMET: Toxicity

hERG Blockers:	0.049	hERG Blockers (10um):	0.172
Human Hepatotoxicity (H-HT):	0.5	Drug-induced Liver Injury (DILI):	0.062
AMES Toxicity:	0.385	Rat Oral Acute Toxicity:	0.25
Maximum Recommended Daily Dose:	0.347	Skin Sensitization:	0.972
Carcinogencity:	0.854	Eye Corrosion:	0.028
Eye Irritation:	0.637	Respiratory Toxicity:	0.477
Drug-induced Neurotoxicity:	0.011	Ototoxicity:	0.72
Hematotoxicity:	0.233	Drug-induced Nephrotoxicity:	0.55
Genotoxicity:	0.17	RPMI-8226 Immunitoxicity:	0.054
A549 Cytotoxicity:	0.131	Hek293 Cytotoxicity:	0.391
BCF:	1.481 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.529 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.877 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.19 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32464	dysoxylum binecteriferum	Species	Meliaceae	Eukaryota	stem bark	n.a.	n.a.	PMID[24547740]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4

Activity Type	# Activity
Cell line	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT65	Cell line	HepG2	Homo sapiens	IC50	>	50000.0	nM	PMID[24079846]
NPT83	Cell line	MCF7	Homo sapiens	IC50	=	23000.0	nM	PMID[19742452]
NPT81	Cell line	A549	Homo sapiens	IC50	>	50000.0	nM	PMID[20655237]
NPT113	Cell line	RAW264.7	Mus musculus	IC50	>	100000.0	nM	PMID[10785413]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC133596 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22647
0.1-0.2	23725
0.2-0.3	3085
0.3-0.4	297
0.4-0.5	71
0.5-0.6	18
0.6-0.7	4
0.7-0.8	0
0.8-0.85	3
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC11907
0.8333	Intermediate Similarity	NPC91387
0.8333	Intermediate Similarity	NPC231680
0.8333	Intermediate Similarity	NPC270306
0.7	Intermediate Similarity	NPC292458
0.7	Intermediate Similarity	NPC217559
0.7	Intermediate Similarity	NPC268578
0.6557	Remote Similarity	NPC245029
0.6557	Remote Similarity	NPC31302
0.6452	Remote Similarity	NPC190940
0.623	Remote Similarity	NPC64081
0.597	Remote Similarity	NPC103782
0.5758	Remote Similarity	NPC250687
0.5758	Remote Similarity	NPC48824
0.5758	Remote Similarity	NPC148740
0.5758	Remote Similarity	NPC102156
0.5735	Remote Similarity	NPC311642
0.5735	Remote Similarity	NPC164289
0.5735	Remote Similarity	NPC100366
0.5735	Remote Similarity	NPC471747
0.5735	Remote Similarity	NPC242771
0.5672	Remote Similarity	NPC80700
0.5645	Remote Similarity	NPC58631
0.5588	Remote Similarity	NPC254572
0.5588	Remote Similarity	NPC229407
0.5588	Remote Similarity	NPC111582
0.5588	Remote Similarity	NPC269267
0.5556	Remote Similarity	NPC114378
0.5147	Remote Similarity	NPC474574

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC133596 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7227
0.1-0.2	1860
0.2-0.3	59
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data