NPASS Compound

Natural Product: NPC66182

Natural Product ID	NPC66182
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	GOQOGSISVGPQHY-HYJATFRYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	6326212
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 135143 0 0 0 0 0 0 0 0999 V2000 12.6700 0.0028 2.1354 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3836 0.7802 1.8228 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0553 0.6285 0.3672 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6906 1.1940 0.1335 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6476 0.6401 1.0547 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9673 -0.6098 0.4921 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5884 -1.8678 1.1282 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6155 -0.4915 1.0501 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5934 0.8759 1.7136 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1886 1.4504 1.4603 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4786 0.2583 1.0121 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0874 0.2871 0.5602 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7638 0.9187 -0.7217 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3425 0.6879 -1.0690 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6518 -0.3402 -0.6249 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7923 -0.5805 -0.9749 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6011 -0.6450 0.2978 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9504 -1.3320 1.4384 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5153 -1.1602 1.6002 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2390 -1.3646 0.2725 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9734 -2.7680 -0.2582 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7090 -1.2118 0.4337 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5364 -1.8224 -0.6610 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9915 -1.6767 -0.4070 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4793 -0.3425 0.0284 C 0 0 2 0 0 0 0 0 0 0 0 0 5.8598 0.5995 -1.0753 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8321 -1.2526 0.1047 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9359 -0.4700 0.2325 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8493 -0.5792 -1.0076 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7179 0.6296 -0.9723 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0987 0.9150 0.4620 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8982 -0.1998 1.4224 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1312 -1.1023 1.5456 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9841 -1.9429 2.6657 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7526 -0.9553 1.2687 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5619 2.1189 0.9090 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5471 3.0341 1.1176 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4970 3.6775 2.5069 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8886 4.3010 2.6401 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.0770 5.3160 1.5497 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4303 5.0018 0.2589 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8946 6.3168 -0.3333 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8313 6.7270 0.5040 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4108 4.1165 0.2498 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4751 5.4482 1.3622 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1229 4.8161 3.9008 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1872 2.8011 3.5011 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8099 0.4573 -1.8133 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0816 -0.7323 -2.1501 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3832 -1.9418 -2.7715 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6658 -1.8151 -4.2317 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.7083 -3.1425 -4.8986 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8355 -4.2026 -4.3249 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.5629 -4.0414 -2.8581 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4211 -4.8904 -2.3963 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1920 -4.5785 -1.0343 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1778 -2.6926 -2.6875 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4730 -5.4548 -4.4916 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2911 -2.9332 -6.2343 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9024 -1.1814 -4.4825 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5733 1.5453 1.0285 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0257 0.5014 2.3511 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3012 0.1877 2.6567 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1867 0.4051 3.0180 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4447 -1.0685 2.3536 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3419 -0.0228 1.2391 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6073 1.8409 2.0600 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7794 1.2788 -0.1897 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2107 -0.3878 -0.0235 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7570 2.2945 0.3532 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4007 1.0595 -0.9107 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0966 -0.7405 -0.5727 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9842 -2.7160 0.6892 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4028 -1.9047 2.2063 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6168 -2.0271 0.8131 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3134 -1.3099 1.7345 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7753 0.7751 2.8064 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2014 2.3254 0.8185 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8025 1.7946 2.4650 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4977 -0.4741 1.8816 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4536 0.6843 1.3510 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8926 2.0368 -0.7174 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3232 0.4861 -1.6074 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8041 1.3901 -1.7342 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8150 -1.5258 -1.5409 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0992 0.3050 -1.5705 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7998 0.4117 0.5717 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4179 -0.9077 2.3801 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2361 -2.4257 1.5114 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8522 -1.9107 2.3506 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7175 -0.1403 1.9414 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5930 -3.4808 0.3194 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2193 -2.7506 -1.3335 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0679 -3.0671 -0.1412 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0270 -1.6684 1.3922 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2119 -1.5303 -1.6816 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3188 -2.9330 -0.6216 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2543 -2.4060 0.4140 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5978 -2.0135 -1.2756 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9459 0.8310 -1.1013 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6387 0.1020 -2.0422 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3639 1.5713 -1.0678 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7618 0.5972 0.4727 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5122 -1.4701 -0.9018 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1212 1.5209 -1.3278 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2169 1.0776 0.4177 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7967 0.2715 2.4472 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0395 -0.4935 1.7580 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3407 -1.6657 0.6266 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6443 -1.7861 3.3589 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5792 2.6335 0.9009 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7776 4.5190 2.5203 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6044 3.4603 2.4851 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7542 6.2949 1.9600 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2050 4.6623 -0.4731 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6828 7.0919 -0.3919 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4738 6.1806 -1.3355 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0517 7.5861 0.9163 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6302 5.6604 0.4047 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0357 4.5391 4.2368 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9179 2.2339 3.8016 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8328 1.2049 -2.4920 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1865 -2.4755 -2.2011 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8872 -1.1375 -4.6502 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7447 -3.5285 -4.9864 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8491 -4.3198 -4.8402 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4392 -4.2844 -2.2207 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6321 -5.9709 -2.4339 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4573 -4.6119 -2.9065 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8268 -5.0154 -0.4326 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7863 -6.1352 -4.2050 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3455 -3.1901 -6.3592 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0199 -1.1996 -5.4669 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5133 -0.9087 2.7432 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4863 0.5646 3.7109 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 40 45 1 0 39 46 1 0 38 47 1 0 30 48 1 0 29 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 54 57 1 0 53 58 1 0 52 59 1 0 51 60 1 0 9 61 1 0 5 62 1 0 62 63 1 0 63 2 1 0 61 5 1 0 25 8 1 0 35 28 1 0 44 37 1 0 57 50 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 0 3 68 1 0 3 69 1 0 4 70 1 0 4 71 1 0 6 72 1 0 7 73 1 0 7 74 1 0 7 75 1 0 8 76 1 0 9 77 1 0 10 78 1 0 10 79 1 0 11 80 1 0 12 81 1 0 13 82 1 0 13 83 1 0 14 84 1 0 16 85 1 0 16 86 1 0 17 87 1 1 18 88 1 0 18 89 1 0 19 90 1 0 19 91 1 0 21 92 1 0 21 93 1 0 21 94 1 0 22 95 1 0 23 96 1 0 23 97 1 0 24 98 1 0 24 99 1 0 26100 1 0 26101 1 0 26102 1 0 28103 1 1 29104 1 1 30105 1 6 31106 1 6 32107 1 1 33108 1 0 33109 1 0 34110 1 0 37111 1 6 38112 1 6 39113 1 6 40114 1 1 41115 1 6 42116 1 0 42117 1 0 43118 1 0 45119 1 0 46120 1 0 47121 1 0 48122 1 0 50123 1 1 51124 1 6 52125 1 6 53126 1 6 54127 1 1 55128 1 0 55129 1 0 56130 1 0 58131 1 0 59132 1 0 60133 1 0 63134 1 0 63135 1 0 M END

Standard InCHIKey	GOQOGSISVGPQHY-HYJATFRYSA-N
Standard InCHI	InChI=1S/C45H72O18/c1-19-7-12-45(56-18-19)20(2)30-26(63-45)14-25-23-6-5-21-13-22(8-10-43(21,3)24(23)9-11-44(25,30)4)57-42-39(62-41-36(54)34(52)32(50)28(16-47)59-41)37(55)38(29(17-48)60-42)61-40-35(53)33(51)31(49)27(15-46)58-40/h5,19-20,22-42,46-55H,6-18H2,1-4H3/t19?,20?,22-,23?,24?,25?,26?,27+,28+,29+,30?,31+,32+,33-,34-,35+,36+,37-,38+,39+,40-,41-,42+,43-,44-,45?/m0/s1
SMILES	CC1CCC2(C(C)C3C(CC4C5CC=C6C[C@H](CC[C@]6(C)C5CC[C@]34C)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	900.47	Volume:	865.455 ? Van der Waals volume.
Dense:	1.04	LogP:	1.127 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.061 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.103 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	48.0
TPSA:	276.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	10.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.127	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.701	Fsp³:	0.956
MCE-18:	229.091 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.669	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.028 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.176	Promiscuous compounds:	0.003

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.305	MDCK Permeability:	-5.208
Pgp-inhibitor:	0.0	Pgp-substrate:	0.026
PAMPA:	0.924 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.023
20% Bioavailability (F20%):	0.05	30% Bioavailability (F30%):	0.981
50% Bioavailability (F50%):	0.994

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.923	MRP1:	0.726
Plasma Protein Binding (PPB):	60.526%	Volume Distribution (VD):	-0.458
Fu:	32.29% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.001
BSEP inhibitor:	0.031

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.002	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.117
HLM stability:	0.012 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.353

Half-life (T1/2):

3.79

ADMET: Toxicity

hERG Blockers:	0.022	hERG Blockers (10um):	0.039
Human Hepatotoxicity (H-HT):	0.723	Drug-induced Liver Injury (DILI):	0.945
AMES Toxicity:	0.943	Rat Oral Acute Toxicity:	0.003
Maximum Recommended Daily Dose:	0.008	Skin Sensitization:	1.0
Carcinogencity:	0.156	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	1.0
Hematotoxicity:	0.187	Drug-induced Nephrotoxicity:	0.442
Genotoxicity:	0.009	RPMI-8226 Immunitoxicity:	0.235
A549 Cytotoxicity:	0.859	Hek293 Cytotoxicity:	0.733
BCF:	1.473 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.517 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.826 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.988 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO16818	Trillium tschonoskii	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32870000]
NPO16818	Trillium tschonoskii	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6471	Trillium camtschaticum	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO16818	Trillium tschonoskii	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO16818	Trillium tschonoskii	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO6471	Trillium camtschaticum	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO16818	Trillium tschonoskii	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO6471	Trillium camtschaticum	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO6471	Trillium camtschaticum	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO16818	Trillium tschonoskii	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC66182 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23847
0.1-0.2	22281
0.2-0.3	2874
0.3-0.4	600
0.4-0.5	111
0.5-0.6	69
0.6-0.7	34
0.7-0.8	0
0.8-0.85	10
0.85-0.9	8
0.9-0.95	3
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
0.9556	High Similarity	NPC480555
0.9556	High Similarity	NPC150372
0.9222	High Similarity	NPC470433
0.9222	High Similarity	NPC46190
0.9222	High Similarity	NPC171073
0.8776	High Similarity	NPC480553
0.8646	High Similarity	NPC269297
0.8646	High Similarity	NPC222202
0.8571	High Similarity	NPC480554
0.8557	High Similarity	NPC475333
0.8557	High Similarity	NPC224098
0.8557	High Similarity	NPC208383
0.8511	High Similarity	NPC248746
0.8469	Intermediate Similarity	NPC194207
0.8469	Intermediate Similarity	NPC22779
0.8316	Intermediate Similarity	NPC477809
0.8276	Intermediate Similarity	NPC181845
0.8085	Intermediate Similarity	NPC113044
0.8085	Intermediate Similarity	NPC283829
0.8085	Intermediate Similarity	NPC161676
0.8058	Intermediate Similarity	NPC232054
0.8041	Intermediate Similarity	NPC42171
0.8	Intermediate Similarity	NPC480556
0.7857	Intermediate Similarity	NPC300557
0.785	Intermediate Similarity	NPC477808
0.7757	Intermediate Similarity	NPC224314
0.7684	Intermediate Similarity	NPC470432
0.7684	Intermediate Similarity	NPC230507
0.7653	Intermediate Similarity	NPC602423
0.75	Intermediate Similarity	NPC6295
0.7476	Intermediate Similarity	NPC32361
0.7476	Intermediate Similarity	NPC13193
0.7379	Intermediate Similarity	NPC475550
0.7358	Intermediate Similarity	NPC477811
0.7188	Intermediate Similarity	NPC19400
0.7172	Intermediate Similarity	NPC14704
0.7157	Intermediate Similarity	NPC6806
0.7019	Intermediate Similarity	NPC73243
0.7019	Intermediate Similarity	NPC244086
0.7019	Intermediate Similarity	NPC84956
0.6981	Remote Similarity	NPC309278
0.697	Remote Similarity	NPC94272
0.697	Remote Similarity	NPC485595
0.6923	Remote Similarity	NPC475182
0.6887	Remote Similarity	NPC247037
0.6827	Remote Similarity	NPC124677
0.6733	Remote Similarity	NPC195297
0.6697	Remote Similarity	NPC249265
0.6667	Remote Similarity	NPC160426
0.6636	Remote Similarity	NPC23808
0.6636	Remote Similarity	NPC87998
0.6569	Remote Similarity	NPC141433
0.6518	Remote Similarity	NPC31896
0.6505	Remote Similarity	NPC305423
0.6495	Remote Similarity	NPC297348
0.6495	Remote Similarity	NPC249204
0.6495	Remote Similarity	NPC48339
0.6495	Remote Similarity	NPC141769
0.6495	Remote Similarity	NPC477547
0.6373	Remote Similarity	NPC107962
0.6372	Remote Similarity	NPC308140
0.6327	Remote Similarity	NPC325828
0.6296	Remote Similarity	NPC128572
0.6262	Remote Similarity	NPC122819
0.6238	Remote Similarity	NPC206003
0.6238	Remote Similarity	NPC473610
0.6204	Remote Similarity	NPC249553
0.6204	Remote Similarity	NPC471464
0.62	Remote Similarity	NPC477451
0.6176	Remote Similarity	NPC211354
0.6134	Remote Similarity	NPC210569
0.6019	Remote Similarity	NPC306131
0.6019	Remote Similarity	NPC475643
0.6019	Remote Similarity	NPC200802
0.5982	Remote Similarity	NPC486386
0.5978	Remote Similarity	NPC100451
0.5966	Remote Similarity	NPC477807
0.596	Remote Similarity	NPC165439
0.5926	Remote Similarity	NPC98696
0.5926	Remote Similarity	NPC40440
0.5909	Remote Similarity	NPC182900
0.5877	Remote Similarity	NPC254255
0.5854	Remote Similarity	NPC305771
0.5854	Remote Similarity	NPC94072
0.5854	Remote Similarity	NPC169816
0.5833	Remote Similarity	NPC475351
0.5812	Remote Similarity	NPC287885
0.5804	Remote Similarity	NPC102016
0.5804	Remote Similarity	NPC95051
0.58	Remote Similarity	NPC485594
0.5784	Remote Similarity	NPC294686
0.5784	Remote Similarity	NPC234352
0.5761	Remote Similarity	NPC235126
0.5761	Remote Similarity	NPC242419
0.5714	Remote Similarity	NPC107188
0.5664	Remote Similarity	NPC97700
0.5664	Remote Similarity	NPC184617
0.5664	Remote Similarity	NPC30856
0.5612	Remote Similarity	NPC277715
0.561	Remote Similarity	NPC15918
0.56	Remote Similarity	NPC263359
0.5586	Remote Similarity	NPC265275
0.5556	Remote Similarity	NPC125324
0.5556	Remote Similarity	NPC218571
0.5556	Remote Similarity	NPC487615
0.5536	Remote Similarity	NPC92890
0.5524	Remote Similarity	NPC250393
0.5524	Remote Similarity	NPC222731
0.5517	Remote Similarity	NPC475625
0.5505	Remote Similarity	NPC70204
0.5354	Remote Similarity	NPC244431
0.5333	Remote Similarity	NPC132080
0.5312	Remote Similarity	NPC486119
0.5304	Remote Similarity	NPC150057
0.5304	Remote Similarity	NPC147753
0.5294	Remote Similarity	NPC24960
0.5263	Remote Similarity	NPC469348
0.5238	Remote Similarity	NPC272015
0.5221	Remote Similarity	NPC42482
0.5221	Remote Similarity	NPC473601
0.5221	Remote Similarity	NPC486388
0.5217	Remote Similarity	NPC51172
0.5217	Remote Similarity	NPC49032
0.5214	Remote Similarity	NPC115165
0.5185	Remote Similarity	NPC121453
0.5138	Remote Similarity	NPC54619
0.5135	Remote Similarity	NPC15249
0.5135	Remote Similarity	NPC306991
0.5135	Remote Similarity	NPC25455
0.5128	Remote Similarity	NPC294129
0.5126	Remote Similarity	NPC473518
0.5126	Remote Similarity	NPC116756
0.5124	Remote Similarity	NPC83137
0.5118	Remote Similarity	NPC79900
0.5102	Remote Similarity	NPC22140
0.5102	Remote Similarity	NPC243728
0.5102	Remote Similarity	NPC158088
0.5088	Remote Similarity	NPC161738
0.5085	Remote Similarity	NPC475319
0.5083	Remote Similarity	NPC232037
0.5083	Remote Similarity	NPC63609
0.5045	Remote Similarity	NPC295980
0.5041	Remote Similarity	NPC470864

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC66182 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7608
0.1-0.2	1440
0.2-0.3	92
0.3-0.4	4
0.4-0.5	2
0.5-0.6	2
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6327	Remote Similarity	NPD8171	Phase 2
0.6262	Remote Similarity	NPD8449	Approved
0.5701	Remote Similarity	NPD8170	Phase 2
0.5304	Remote Similarity	NPD8450	Suspended

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data