NPASS Compound

Natural Product: NPC553360

Natural Product ID	NPC553360
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{S},4~{S},5~{R},6~{R})-4-hydroxy-2-(hydroxymethyl)-6-[[(1~{R},2~{S},4~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-6-methoxy-7,9,13-trimethyl-6-[(3~{S})-3-methyl-4-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-butyl]-5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosan-16-yl]oxy]-5-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{S},4~{S},5~{R},6~{R})-4-hydroxy-2-(hydroxymethyl)-6-[[(1~{R},2~{S},4~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-6-methoxy-7,9,13-trimethyl-6-[(3~{S})-3-methyl-4-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-butyl]-5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosan-16-yl]oxy]-5-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 163171 0 0 0 0 0 0 0 0999 V2000 7.5007 -2.1184 1.0084 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7121 -1.0394 0.8336 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3896 -0.5462 -0.3592 C 0 0 2 0 0 0 0 0 0 0 0 0 7.4484 0.1525 -1.1775 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9653 1.3689 -0.4701 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6497 1.1496 0.8262 C 0 0 2 0 0 0 0 0 0 0 0 0 9.0464 2.5354 1.4224 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0413 0.5062 0.6035 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8033 1.3998 -0.1673 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0754 0.8888 -0.4170 C 0 0 2 0 0 0 0 0 0 0 0 0 13.0602 1.6756 0.2223 O 0 0 0 0 0 0 0 0 0 0 0 0 14.2540 0.9609 0.0793 C 0 0 2 0 0 0 0 0 0 0 0 0 15.3785 1.5382 0.9066 C 0 0 0 0 0 0 0 0 0 0 0 0 16.5016 0.7407 0.6712 O 0 0 0 0 0 0 0 0 0 0 0 0 14.6888 0.9941 -1.3860 C 0 0 1 0 0 0 0 0 0 0 0 0 15.8876 0.3063 -1.5013 O 0 0 0 0 0 0 0 0 0 0 0 0 13.6211 0.3379 -2.2405 C 0 0 2 0 0 0 0 0 0 0 0 0 13.8940 0.6903 -3.5794 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2968 0.9333 -1.8966 C 0 0 1 0 0 0 0 0 0 0 0 0 11.2340 0.2676 -2.5064 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5058 0.5701 -0.0582 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3075 0.0153 0.2145 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1153 0.6942 -0.4900 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1558 -0.4031 -0.3406 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8016 -0.3630 -0.8612 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0229 0.8684 -0.5487 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3355 0.6809 -1.2468 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8952 -0.6897 -1.2510 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4063 -0.6306 -1.0027 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7384 -0.1770 0.3824 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0570 -0.4225 0.6542 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8377 0.6975 0.8665 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2039 0.8543 2.1831 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1316 -0.0058 2.6558 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8435 -1.4668 2.5556 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7043 -1.8059 3.2798 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5133 0.2988 2.0488 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2104 1.0173 2.9954 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3341 0.4341 3.5044 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.4710 1.2363 3.3978 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2471 2.4245 4.0981 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.1275 3.4879 3.4788 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6431 2.1560 5.5404 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.9363 3.0301 6.3633 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2867 0.7107 5.8264 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.3684 -0.1461 5.6311 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0912 0.2496 5.0095 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.8611 -1.0781 5.3155 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3056 1.0510 0.7591 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.4502 0.6671 -0.0005 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0453 0.6731 0.0090 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9089 1.3821 -1.1733 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0976 0.7915 -2.3527 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9207 0.7431 -3.1737 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1075 -0.2274 -4.1443 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9390 -0.2707 -5.1087 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7695 -0.5687 -4.4210 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4218 -0.2394 -4.8343 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.9981 -1.5392 -4.8206 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4310 0.7557 -4.4179 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7638 1.5746 -5.5014 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0449 1.5916 -3.2097 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.1591 2.0764 -2.5941 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7735 -0.7381 1.3991 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0767 -1.9651 0.9011 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3048 -1.7232 -0.3952 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4262 -3.0765 -1.1569 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1064 -1.4689 -0.0341 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9646 -2.6660 0.0995 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1620 -2.7843 -0.7631 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9105 -1.5463 -1.0336 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0444 -1.3772 -2.5090 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2259 -1.3983 -0.3498 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4645 -1.4347 -1.1706 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9409 -2.8221 -1.3731 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5082 -2.0801 0.5589 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7658 -2.1016 2.1411 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0135 -3.1182 0.9343 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3158 -0.5025 -1.3934 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9936 0.5055 -2.1265 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1351 2.1166 -0.4092 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7229 1.8294 -1.1697 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1550 0.6138 1.6050 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5677 3.1464 0.6833 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6992 2.2993 2.2857 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1437 3.0276 1.8228 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9042 -0.3797 -0.0184 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5600 0.3127 1.5393 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1660 -0.1053 0.0424 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0445 -0.0903 0.3501 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6229 2.5569 0.5399 H 0 0 0 0 0 0 0 0 0 0 0 0 15.1291 1.5895 1.9794 H 0 0 0 0 0 0 0 0 0 0 0 0 16.4687 -0.1013 1.1928 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8003 2.0400 -1.6998 H 0 0 0 0 0 0 0 0 0 0 0 0 15.8174 -0.6055 -1.1270 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6132 -0.7456 -2.1452 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8662 1.6937 -3.6391 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2713 2.0096 -2.2027 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5388 -0.6734 -2.6600 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1146 0.0151 1.3192 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8395 1.6178 0.0926 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3932 0.9159 -1.5095 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1797 -0.7334 0.7675 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7464 -0.5186 -1.9225 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1314 1.0528 0.5305 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4730 1.7834 -0.9736 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0745 1.3672 -0.7409 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2659 1.0469 -2.3090 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8859 -1.1190 -2.3221 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8301 -1.6155 -1.2388 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7682 0.0808 -1.7679 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6199 0.9209 0.3981 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1184 1.5638 0.6025 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1965 0.1950 3.7799 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6943 -1.9825 3.0955 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7697 -1.8453 1.5144 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6048 -1.1955 4.0515 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0072 -0.6597 1.8484 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4688 -0.5465 3.0365 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1812 2.7045 3.9923 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7442 4.5178 3.6358 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1779 3.3620 3.7957 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0997 3.3090 2.3774 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7327 2.3343 5.6153 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2977 3.9280 6.2088 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9606 0.6816 6.8878 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0464 -1.0709 5.4023 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2477 0.9025 5.3372 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9066 -1.2642 5.0411 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4258 2.1218 0.9081 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2417 0.7631 0.5905 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2223 -0.3804 -0.3076 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4468 -0.2549 -2.3455 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0296 -1.2096 -3.5755 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8333 0.6419 -5.7079 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1481 -1.1409 -5.7815 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6720 -1.5330 -4.3592 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1943 -0.0741 -5.9352 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3503 -1.7890 -3.9515 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3939 0.2140 -4.1784 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8325 0.9764 -6.2965 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4269 2.4385 -3.6472 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0802 2.9727 -2.2230 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0046 0.0026 1.6775 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3317 -0.9739 2.3034 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8019 -2.7694 0.6901 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3475 -2.3697 1.6169 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3855 -2.9984 -1.7169 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5772 -3.9124 -0.4422 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5539 -3.1802 -1.8099 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0988 -0.9655 1.0006 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3526 -3.6307 0.1002 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3690 -2.6828 1.1608 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8696 -3.5380 -0.2858 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8518 -3.2777 -1.7173 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5503 -0.4960 -2.8751 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0631 -1.4195 -3.0591 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5277 -2.3382 -2.8701 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3273 -2.1195 0.4966 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3766 -0.9060 -2.1446 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6990 -3.1117 -2.4463 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4585 -3.5960 -0.7741 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0733 -2.8892 -1.3825 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 3 2 1 1 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 12 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 3 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 34 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 41 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 37 49 1 0 49 50 1 0 49 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 55 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 60 62 1 0 62 63 1 0 30 64 1 0 64 65 1 0 65 66 1 0 66 67 1 6 66 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 6 71 73 1 0 73 74 1 0 74 75 1 0 74 3 1 0 19 10 1 0 73 22 1 0 71 24 1 0 68 25 1 0 66 28 1 0 51 32 1 0 62 53 1 0 47 39 1 0 1 76 1 0 1 77 1 0 1 78 1 0 4 79 1 0 4 80 1 0 5 81 1 0 5 82 1 0 6 83 1 1 7 84 1 0 7 85 1 0 7 86 1 0 8 87 1 0 8 88 1 0 10 89 1 1 12 90 1 1 13 91 1 0 13 92 1 0 14 93 1 0 15 94 1 6 16 95 1 0 17 96 1 6 18 97 1 0 19 98 1 6 20 99 1 0 22100 1 1 23101 1 0 23102 1 0 24103 1 1 25104 1 6 26105 1 0 26106 1 0 27107 1 0 27108 1 0 28109 1 6 29110 1 0 29111 1 0 30112 1 6 32113 1 6 34114 1 1 35115 1 0 35116 1 0 36117 1 0 37118 1 6 39119 1 6 41120 1 1 42121 1 0 42122 1 0 42123 1 0 43124 1 6 44125 1 0 45126 1 1 46127 1 0 47128 1 1 48129 1 0 49130 1 1 50131 1 0 51132 1 6 53133 1 1 55134 1 1 56135 1 0 56136 1 0 57137 1 0 58138 1 6 59139 1 0 60140 1 1 61141 1 0 62142 1 6 63143 1 0 64144 1 0 64145 1 0 65146 1 0 65147 1 0 67148 1 0 67149 1 0 67150 1 0 68151 1 1 69152 1 0 69153 1 0 70154 1 0 70155 1 0 72156 1 0 72157 1 0 72158 1 0 73159 1 1 74160 1 6 75161 1 0 75162 1 0 75163 1 0 M END

Standard InCHIKey	FXSPQKQLIBUPIL-RSWUAMCVSA-N
Standard InCHI	InChI=1S/C52H88O23/c1-21(20-67-46-40(62)38(60)35(57)30(17-53)70-46)9-14-52(66-6)22(2)33-29(75-52)16-28-26-8-7-24-15-25(10-12-50(24,4)27(26)11-13-51(28,33)5)69-49-45(74-48-42(64)39(61)36(58)31(18-54)71-48)43(65)44(32(19-55)72-49)73-47-41(63)37(59)34(56)23(3)68-47/h21-49,53-65H,7-20H2,1-6H3/t21-,22-,23-,24+,25-,26+,27-,28-,29-,30+,31+,32+,33-,34-,35+,36+,37+,38-,39-,40+,41+,42+,43-,44+,45+,46+,47-,48-,49+,50-,51-,52+/m0/s1
SMILES	CO[C@]1(CC[C@H](C)CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H]2C[C@H]3[C@@H]4CC[C@@H]5C[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O[C@@H]7O[C@@H](C)[C@H](O)[C@@H](O)[C@H]7O)[C@H](O)[C@H]6O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]2[C@@H]1C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1080.57	Volume:	1033.115 ? Van der Waals volume.
Dense:	1.046	LogP:	0.615 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.697 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.548 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	48.0
TPSA:	355.29 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	13.0	Rings:	9.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.072	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.848	Fsp³:	1.0
MCE-18:	178.75 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.653	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.009 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.416	Promiscuous compounds:	0.027

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.581	MDCK Permeability:	-5.087
Pgp-inhibitor:	0.0	Pgp-substrate:	0.871
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.896
20% Bioavailability (F20%):	0.236	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.016	MRP1:	0.024
Plasma Protein Binding (PPB):	51.975%	Volume Distribution (VD):	-0.355
Fu:	34.371% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.003
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.861	CYP3A4-substrate:	0.999
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.285
HLM stability:	0.003 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.493

Half-life (T1/2):

3.731

ADMET: Toxicity

hERG Blockers:	0.005	hERG Blockers (10um):	0.014
Human Hepatotoxicity (H-HT):	0.579	Drug-induced Liver Injury (DILI):	0.928
AMES Toxicity:	0.971	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.026	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.474	Drug-induced Nephrotoxicity:	0.942
Genotoxicity:	0.008	RPMI-8226 Immunitoxicity:	0.261
A549 Cytotoxicity:	0.947	Hek293 Cytotoxicity:	0.781
BCF:	1.588 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.395 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.51 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.847 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO64227	Smilax aspera subsp.mauritanica (POIR.) ARCANG.	Genus	Smilacaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC553360 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27761
0.1-0.2	18827
0.2-0.3	2555
0.3-0.4	474
0.4-0.5	108
0.5-0.6	68
0.6-0.7	41
0.7-0.8	0
0.8-0.85	3
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8778	High Similarity	NPC6295
0.8511	High Similarity	NPC475643
0.8444	Intermediate Similarity	NPC19400
0.802	Intermediate Similarity	NPC194207
0.802	Intermediate Similarity	NPC22779
0.7642	Intermediate Similarity	NPC232054
0.7629	Intermediate Similarity	NPC160426
0.7426	Intermediate Similarity	NPC471464
0.7423	Intermediate Similarity	NPC485595
0.7347	Intermediate Similarity	NPC195297
0.734	Intermediate Similarity	NPC477451
0.7238	Intermediate Similarity	NPC116756
0.7184	Intermediate Similarity	NPC128572
0.7128	Intermediate Similarity	NPC297348
0.7128	Intermediate Similarity	NPC249204
0.7128	Intermediate Similarity	NPC48339
0.7128	Intermediate Similarity	NPC141769
0.7128	Intermediate Similarity	NPC477547
0.7113	Intermediate Similarity	NPC211354
0.7103	Intermediate Similarity	NPC470864
0.7019	Intermediate Similarity	NPC480555
0.7019	Intermediate Similarity	NPC150372
0.697	Remote Similarity	NPC107962
0.6947	Remote Similarity	NPC325828
0.6837	Remote Similarity	NPC206003
0.6837	Remote Similarity	NPC473610
0.6786	Remote Similarity	NPC470866
0.6731	Remote Similarity	NPC470433
0.6731	Remote Similarity	NPC46190
0.6731	Remote Similarity	NPC171073
0.6699	Remote Similarity	NPC475351
0.6606	Remote Similarity	NPC475333
0.6606	Remote Similarity	NPC224098
0.6606	Remote Similarity	NPC309278
0.6606	Remote Similarity	NPC208383
0.66	Remote Similarity	NPC107188
0.6518	Remote Similarity	NPC480553
0.6481	Remote Similarity	NPC97700
0.6481	Remote Similarity	NPC30856
0.64	Remote Similarity	NPC250393
0.6364	Remote Similarity	NPC269297
0.6364	Remote Similarity	NPC222202
0.6364	Remote Similarity	NPC234352
0.6339	Remote Similarity	NPC480554
0.6306	Remote Similarity	NPC475625
0.6296	Remote Similarity	NPC274200
0.625	Remote Similarity	NPC232611
0.6239	Remote Similarity	NPC480556
0.6204	Remote Similarity	NPC248746
0.6182	Remote Similarity	NPC184617
0.614	Remote Similarity	NPC470862
0.6095	Remote Similarity	NPC125324
0.6087	Remote Similarity	NPC132080
0.6078	Remote Similarity	NPC222731
0.6061	Remote Similarity	NPC485594
0.604	Remote Similarity	NPC291203
0.604	Remote Similarity	NPC217205
0.6036	Remote Similarity	NPC73243
0.6036	Remote Similarity	NPC244086
0.6036	Remote Similarity	NPC84956
0.6	Remote Similarity	NPC42171
0.6	Remote Similarity	NPC51172
0.6	Remote Similarity	NPC49032
0.5946	Remote Similarity	NPC475182
0.5929	Remote Similarity	NPC247037
0.5917	Remote Similarity	NPC224314
0.5909	Remote Similarity	NPC92890
0.5882	Remote Similarity	NPC294686
0.5877	Remote Similarity	NPC32361
0.5862	Remote Similarity	NPC83137
0.5833	Remote Similarity	NPC113044
0.5833	Remote Similarity	NPC283829
0.5833	Remote Similarity	NPC161676
0.5826	Remote Similarity	NPC232037
0.5784	Remote Similarity	NPC177834
0.5776	Remote Similarity	NPC249265
0.5726	Remote Similarity	NPC23808
0.5726	Remote Similarity	NPC87998
0.5714	Remote Similarity	NPC128123
0.5714	Remote Similarity	NPC300557
0.5702	Remote Similarity	NPC475319
0.5603	Remote Similarity	NPC13193
0.5586	Remote Similarity	NPC473601
0.5575	Remote Similarity	NPC6806
0.5565	Remote Similarity	NPC115165
0.5556	Remote Similarity	NPC485601
0.5546	Remote Similarity	NPC233433
0.5536	Remote Similarity	NPC602423
0.5505	Remote Similarity	NPC470432
0.5505	Remote Similarity	NPC230507
0.55	Remote Similarity	NPC308140
0.5487	Remote Similarity	NPC477809
0.5484	Remote Similarity	NPC477808
0.5478	Remote Similarity	NPC98018
0.5478	Remote Similarity	NPC284104
0.5478	Remote Similarity	NPC103616
0.5455	Remote Similarity	NPC141433
0.5455	Remote Similarity	NPC329807
0.5448	Remote Similarity	NPC481189
0.5398	Remote Similarity	NPC485603
0.5385	Remote Similarity	NPC470863
0.5364	Remote Similarity	NPC94272
0.5327	Remote Similarity	NPC474399
0.5321	Remote Similarity	NPC264101
0.5294	Remote Similarity	NPC329727
0.5259	Remote Similarity	NPC485604
0.5243	Remote Similarity	NPC24960
0.5238	Remote Similarity	NPC181845
0.5238	Remote Similarity	NPC220836
0.5229	Remote Similarity	NPC54619
0.5194	Remote Similarity	NPC263359
0.5189	Remote Similarity	NPC485602
0.5164	Remote Similarity	NPC84111
0.5164	Remote Similarity	NPC287483
0.5164	Remote Similarity	NPC470865
0.5161	Remote Similarity	NPC470867
0.5146	Remote Similarity	NPC473774
0.5146	Remote Similarity	NPC481419
0.5146	Remote Similarity	NPC481417
0.5133	Remote Similarity	NPC14704
0.5126	Remote Similarity	NPC486386
0.5124	Remote Similarity	NPC108072
0.5091	Remote Similarity	NPC306131
0.5091	Remote Similarity	NPC200802
0.5088	Remote Similarity	NPC485605
0.5083	Remote Similarity	NPC473518
0.5082	Remote Similarity	NPC476112
0.5082	Remote Similarity	NPC307534
0.5043	Remote Similarity	NPC98696
0.5043	Remote Similarity	NPC124677
0.5041	Remote Similarity	NPC254255

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC553360 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7822
0.1-0.2	1244
0.2-0.3	69
0.3-0.4	8
0.4-0.5	5
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6947	Remote Similarity	NPD8171	Phase 2
0.5943	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data