NPASS Compound

Natural Product: NPC526835

Natural Product ID	NPC526835
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{R},4~{S},5~{R},6~{R})-2-[(2~{S},3~{R},4~{S},5~{R},6~{R})-2-[(2~{R},3~{S},4~{R},5~{R},6~{R})-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1~{R},2~{S},4~{S},5'~{R},6~{R},7~{S},8~{R},9~{S},12~{R},13~{R},16~{S},18~{S})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-tetrahydropyran-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-[(2~{S},3~{R},4~{S},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{S},3~{R},4~{S},5~{R},6~{R})-2-[(2~{S},3~{R},4~{S},5~{R},6~{R})-2-[(2~{R},3~{S},4~{R},5~{R},6~{R})-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1~{R},2~{S},4~{S},5'~{R},6~{R},7~{S},8~{R},9~{S},12~{R},13~{R},16~{S},18~{S})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-tetrahydropyran-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-[(2~{S},3~{R},4~{S},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 154163 0 0 0 0 0 0 0 0999 V2000 12.9969 1.5687 -1.9727 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8952 1.6427 -0.4574 C 0 0 2 0 0 0 0 0 0 0 0 0 13.4484 0.3509 0.1024 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4997 -0.8016 -0.1388 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0989 -0.3097 0.1385 C 0 0 1 0 0 0 0 0 0 0 0 0 11.1210 0.8864 0.8781 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4934 1.9015 0.0007 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3492 -0.0587 -0.9809 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0676 0.0713 -0.5210 C 0 0 1 0 0 0 0 0 0 0 0 0 8.0304 -0.2710 -1.5914 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0725 -1.0662 -0.7689 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0185 -1.7882 -1.4507 C 0 0 2 0 0 0 0 0 0 0 0 0 5.2064 -1.0083 -2.4379 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7584 -0.8223 -2.0436 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7708 -0.4433 -0.5751 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5906 0.2740 -0.0846 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4078 -0.4563 0.3936 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2875 -0.2505 -0.4328 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6932 0.4408 0.2162 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8283 -0.3025 0.3210 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9098 0.1184 -0.4507 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7695 -0.2338 -1.8918 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8546 0.2212 -2.6021 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3653 1.5151 -0.1501 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3313 1.5566 0.8386 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4809 2.2232 0.5911 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7791 3.1745 1.5765 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7214 2.6809 2.8559 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4085 2.8129 3.5528 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4666 2.2880 4.8510 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2589 1.2482 2.9337 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7923 0.9369 4.1584 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3559 1.2410 1.8348 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.2271 0.2099 2.0212 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5019 0.6492 2.3889 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.7036 0.1898 3.6780 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6250 -0.8102 3.7956 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.9966 -0.1687 3.5290 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.3031 0.7123 4.5467 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.9355 0.5755 2.2181 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.9800 0.2094 1.3824 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6130 0.2532 1.5026 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.6671 1.0678 0.3384 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6435 1.1696 0.5373 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4381 1.4360 -0.5613 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2962 0.4875 -1.5915 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7722 1.1419 -2.6762 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0363 0.6455 -3.9086 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.1033 1.4692 -4.6035 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3556 0.9399 -5.8740 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3076 -0.8211 -3.9564 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8536 -1.0839 -5.2334 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2884 -1.3049 -2.9522 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.5059 -1.6939 -3.5303 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5151 -0.3251 -1.8307 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.7361 -1.1166 -0.6895 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1846 2.4244 0.1972 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3111 3.6841 -0.3992 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8982 1.8365 -0.3388 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1275 2.6990 0.1231 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6198 -1.8741 0.7373 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8226 -2.5489 0.2309 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0890 -1.7070 0.1820 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3535 -1.3138 1.6145 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1704 -2.5302 -0.4343 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9699 -3.3204 0.5387 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3559 -2.9542 0.8437 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0606 -2.0397 -0.1089 C 0 0 1 0 0 0 0 0 0 0 0 0 8.9080 -2.7892 -1.0619 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9020 -0.9866 0.5788 C 0 0 1 0 0 0 0 0 0 0 0 0 10.2865 -1.3308 0.9032 C 0 0 2 0 0 0 0 0 0 0 0 0 10.4751 -1.1301 2.4164 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2362 2.2143 -2.4622 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0217 1.9052 -2.2385 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9296 0.4999 -2.3036 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5227 2.4858 -0.1074 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6148 0.5384 1.1959 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4569 0.1724 -0.3230 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7149 -1.5764 0.6281 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6601 -1.1656 -1.1608 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8544 1.9014 -0.9113 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3816 2.8953 0.4982 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7854 1.0584 -0.1461 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5028 0.6348 -1.9478 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4836 -0.8095 -2.4356 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7752 -0.3998 0.0880 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5127 -2.6061 -2.0639 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6083 0.0420 -2.5627 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2094 -1.4178 -3.4634 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3538 0.0299 -2.6304 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1532 -1.7128 -2.1999 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6348 0.2836 -0.4926 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9405 1.0071 0.7093 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2508 0.9615 -0.9077 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1213 0.0478 1.3811 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3480 0.6329 1.2775 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7544 -0.5582 -0.0799 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8199 -1.3716 -1.9623 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7997 -0.0023 -2.3591 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5618 -0.4684 -2.5805 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7869 1.9730 -1.0595 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5499 2.7320 -0.3865 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4661 3.2744 3.4669 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6194 2.2561 3.0062 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1256 3.8828 3.5709 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2891 2.9522 5.5326 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4523 0.5842 2.5883 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7841 -0.0472 4.2619 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8566 2.2468 1.9218 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4577 1.7688 2.4329 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3995 -1.6148 3.0863 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5802 -1.1629 4.8601 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7193 -0.9814 3.4253 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5587 0.7412 5.2216 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0001 1.6586 2.4345 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.6167 0.9554 1.2765 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6729 -0.8093 1.2357 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0236 1.8316 0.4626 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1747 0.1780 0.3979 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5122 -0.2291 -1.2057 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0964 0.7996 -4.5312 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0206 1.4162 -4.0036 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7458 2.5089 -4.7389 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0504 1.4727 -6.3047 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3402 -1.3677 -3.9116 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5779 -1.7352 -5.2099 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8720 -2.2738 -2.5330 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2378 -1.0551 -3.3050 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4505 0.2569 -1.9776 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4400 -1.7932 -0.8643 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0190 2.5075 1.2905 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5952 4.3104 0.3163 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8862 1.9265 -1.4132 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2372 3.5845 0.3690 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7373 -2.4395 0.2724 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4371 -2.0607 1.8335 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6189 -3.0254 -0.7562 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0282 -3.4349 0.9143 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3982 -1.1900 1.8780 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9511 -2.0929 2.3316 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8201 -0.3837 1.9074 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6339 -3.2885 -1.0951 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3926 -3.2730 1.5154 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9378 -4.4276 0.3011 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4855 -2.4882 1.8700 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0160 -3.8674 0.9225 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6845 -2.2195 -1.5765 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3689 -3.3834 -1.8225 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4567 -3.5652 -0.4494 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3084 -0.5687 1.4246 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6133 -2.3652 0.7119 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5137 -1.3017 2.9532 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7327 -0.0584 2.6250 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1990 -1.8291 2.8403 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 1 6 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 38 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 33 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 48 51 1 0 51 52 1 0 51 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 24 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 17 61 1 0 61 62 1 0 62 63 1 0 63 64 1 1 63 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 6 68 70 1 0 70 71 1 0 71 72 1 0 7 2 1 0 70 9 1 0 71 5 1 0 68 11 1 0 65 12 1 0 63 15 1 0 59 19 1 0 44 26 1 0 55 46 1 0 42 35 1 0 1 73 1 0 1 74 1 0 1 75 1 0 2 76 1 1 3 77 1 0 3 78 1 0 4 79 1 0 4 80 1 0 7 81 1 0 7 82 1 0 9 83 1 1 10 84 1 0 10 85 1 0 11 86 1 1 12 87 1 6 13 88 1 0 13 89 1 0 14 90 1 0 14 91 1 0 15 92 1 6 16 93 1 0 16 94 1 0 17 95 1 1 19 96 1 1 21 97 1 1 22 98 1 0 22 99 1 0 23100 1 0 24101 1 6 26102 1 6 28103 1 1 29104 1 0 29105 1 0 30106 1 0 31107 1 6 32108 1 0 33109 1 6 35110 1 1 37111 1 0 37112 1 0 38113 1 6 39114 1 0 40115 1 1 41116 1 0 42117 1 6 43118 1 0 44119 1 6 46120 1 1 48121 1 6 49122 1 0 49123 1 0 50124 1 0 51125 1 6 52126 1 0 53127 1 1 54128 1 0 55129 1 6 56130 1 0 57131 1 1 58132 1 0 59133 1 6 60134 1 0 61135 1 0 61136 1 0 62137 1 0 62138 1 0 64139 1 0 64140 1 0 64141 1 0 65142 1 6 66143 1 0 66144 1 0 67145 1 0 67146 1 0 69147 1 0 69148 1 0 69149 1 0 70150 1 1 71151 1 6 72152 1 0 72153 1 0 72154 1 0 M END

Standard InCHIKey	BJNQXJIQCPPOHN-HQQFDBCMSA-N
Standard InCHI	InChI=1S/C50H82O22/c1-20-7-12-50(64-18-20)21(2)32-28(72-50)14-26-24-6-5-22-13-23(8-10-48(22,3)25(24)9-11-49(26,32)4)65-45-40(62)37(59)41(31(17-53)68-45)69-47-43(71-46-39(61)36(58)34(56)29(15-51)66-46)42(35(57)30(16-52)67-47)70-44-38(60)33(55)27(54)19-63-44/h20-47,51-62H,5-19H2,1-4H3/t20-,21+,22+,23+,24-,25-,26+,27-,28+,29-,30-,31-,32+,33+,34+,35-,36+,37-,38-,39-,40-,41-,42+,43-,44+,45-,46+,47+,48-,49+,50-/m1/s1
SMILES	C[C@@H]1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC[C@H]5C[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O[C@@H]8OC[C@@H](O)[C@H](O)[C@H]8O)[C@H]7O[C@@H]7O[C@H](CO)[C@H](O)[C@H](O)[C@H]7O)[C@H](O)[C@H]6O)CC[C@@]5(C)[C@@H]4CC[C@]3(C)[C@H]1[C@@H]2C

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO49038	Solanum nigrum L.	Genus	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC526835 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	28729
0.1-0.2	18108
0.2-0.3	2355
0.3-0.4	434
0.4-0.5	90
0.5-0.6	53
0.6-0.7	50
0.7-0.8	0
0.8-0.85	8
0.85-0.9	3
0.9-0.95	3
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC97700
1.0	High Similarity	NPC30856
0.9286	High Similarity	NPC132080
0.913	High Similarity	NPC475351
0.9072	High Similarity	NPC116756
0.898	High Similarity	NPC232037
0.8571	High Similarity	NPC184617
0.8529	High Similarity	NPC233433
0.8485	Intermediate Similarity	NPC115165
0.8462	Intermediate Similarity	NPC250393
0.8462	Intermediate Similarity	NPC470866
0.837	Intermediate Similarity	NPC206003
0.837	Intermediate Similarity	NPC473610
0.8132	Intermediate Similarity	NPC325828
0.8	Intermediate Similarity	NPC51172
0.8	Intermediate Similarity	NPC49032
0.7982	Intermediate Similarity	NPC220836
0.7981	Intermediate Similarity	NPC470864
0.7961	Intermediate Similarity	NPC475625
0.7905	Intermediate Similarity	NPC476112
0.7905	Intermediate Similarity	NPC307534
0.7879	Intermediate Similarity	NPC473601
0.7788	Intermediate Similarity	NPC473518
0.7767	Intermediate Similarity	NPC475319
0.7732	Intermediate Similarity	NPC107962
0.7714	Intermediate Similarity	NPC232611
0.7706	Intermediate Similarity	NPC94086
0.7706	Intermediate Similarity	NPC473817
0.75	Intermediate Similarity	NPC98018
0.75	Intermediate Similarity	NPC284104
0.75	Intermediate Similarity	NPC103616
0.7431	Intermediate Similarity	NPC31896
0.7407	Intermediate Similarity	NPC83137
0.7347	Intermediate Similarity	NPC107188
0.73	Intermediate Similarity	NPC125324
0.7238	Intermediate Similarity	NPC128572
0.7027	Intermediate Similarity	NPC84111
0.7027	Intermediate Similarity	NPC287483
0.7027	Intermediate Similarity	NPC470865
0.6983	Remote Similarity	NPC210569
0.6961	Remote Similarity	NPC6295
0.6939	Remote Similarity	NPC234352
0.6916	Remote Similarity	NPC151134
0.688	Remote Similarity	NPC481189
0.6875	Remote Similarity	NPC477811
0.6847	Remote Similarity	NPC108072
0.6842	Remote Similarity	NPC262050
0.6837	Remote Similarity	NPC297348
0.6837	Remote Similarity	NPC249204
0.6837	Remote Similarity	NPC48339
0.6837	Remote Similarity	NPC177834
0.6837	Remote Similarity	NPC141769
0.6837	Remote Similarity	NPC477547
0.6827	Remote Similarity	NPC160426
0.6822	Remote Similarity	NPC471464
0.6786	Remote Similarity	NPC470862
0.6774	Remote Similarity	NPC329807
0.6693	Remote Similarity	NPC329727
0.6667	Remote Similarity	NPC211354
0.6667	Remote Similarity	NPC473505
0.6667	Remote Similarity	NPC330026
0.6667	Remote Similarity	NPC19400
0.6579	Remote Similarity	NPC92297
0.6577	Remote Similarity	NPC470863
0.6574	Remote Similarity	NPC92890
0.6535	Remote Similarity	NPC477451
0.6529	Remote Similarity	NPC305771
0.6529	Remote Similarity	NPC94072
0.6529	Remote Similarity	NPC169816
0.6514	Remote Similarity	NPC300557
0.6442	Remote Similarity	NPC264101
0.6393	Remote Similarity	NPC263359
0.6387	Remote Similarity	NPC477807
0.6339	Remote Similarity	NPC51520
0.6339	Remote Similarity	NPC303069
0.633	Remote Similarity	NPC602423
0.632	Remote Similarity	NPC481190
0.6281	Remote Similarity	NPC15918
0.6198	Remote Similarity	NPC273002
0.6182	Remote Similarity	NPC475643
0.6154	Remote Similarity	NPC329820
0.6134	Remote Similarity	NPC470867
0.6129	Remote Similarity	NPC244431
0.6126	Remote Similarity	NPC477809
0.6091	Remote Similarity	NPC202898
0.6087	Remote Similarity	NPC309278
0.6019	Remote Similarity	NPC470432
0.6019	Remote Similarity	NPC230507
0.6016	Remote Similarity	NPC79900
0.598	Remote Similarity	NPC485594
0.5963	Remote Similarity	NPC195297
0.5948	Remote Similarity	NPC475333
0.5948	Remote Similarity	NPC224098
0.5948	Remote Similarity	NPC208383
0.5935	Remote Similarity	NPC477808
0.5929	Remote Similarity	NPC6806
0.5872	Remote Similarity	NPC485595
0.581	Remote Similarity	NPC294686
0.578	Remote Similarity	NPC215408
0.5772	Remote Similarity	NPC480556
0.5656	Remote Similarity	NPC167183
0.5656	Remote Similarity	NPC232054
0.5652	Remote Similarity	NPC274200
0.5648	Remote Similarity	NPC121453
0.5619	Remote Similarity	NPC181845
0.5603	Remote Similarity	NPC480555
0.5603	Remote Similarity	NPC150372
0.5556	Remote Similarity	NPC222731
0.5556	Remote Similarity	NPC294129
0.5546	Remote Similarity	NPC470861
0.5481	Remote Similarity	NPC24960
0.5385	Remote Similarity	NPC481418
0.5366	Remote Similarity	NPC480553
0.5349	Remote Similarity	NPC32707
0.5345	Remote Similarity	NPC470433
0.5345	Remote Similarity	NPC46190
0.5345	Remote Similarity	NPC171073
0.5333	Remote Similarity	NPC269297
0.5333	Remote Similarity	NPC222202
0.5333	Remote Similarity	NPC475550
0.5328	Remote Similarity	NPC218571
0.5328	Remote Similarity	NPC487615
0.5328	Remote Similarity	NPC92710
0.5276	Remote Similarity	NPC248202
0.5246	Remote Similarity	NPC194207
0.5246	Remote Similarity	NPC22779
0.5242	Remote Similarity	NPC256983
0.5217	Remote Similarity	NPC113044
0.5217	Remote Similarity	NPC283829
0.5217	Remote Similarity	NPC14704
0.5217	Remote Similarity	NPC161676
0.5203	Remote Similarity	NPC480554
0.5192	Remote Similarity	NPC277715
0.5135	Remote Similarity	NPC474399
0.5126	Remote Similarity	NPC249553
0.5116	Remote Similarity	NPC224314
0.5115	Remote Similarity	NPC208832
0.5096	Remote Similarity	NPC88962
0.5091	Remote Similarity	NPC291203
0.5091	Remote Similarity	NPC217205
0.5044	Remote Similarity	NPC54619
0.5041	Remote Similarity	NPC32361

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC526835 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7898
0.1-0.2	1176
0.2-0.3	66
0.3-0.4	5
0.4-0.5	3
0.5-0.6	0
0.6-0.7	1
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.8132	Intermediate Similarity	NPD8171	Phase 2
0.6961	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data