NPASS Compound

Natural Product: NPC506033

Natural Product ID	NPC506033
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{R},6~{S})-4-hydroxy-6-[(1~{R},2~{S},4~{S},5'~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-5-[(2~{R},3~{R},4~{S},5~{R},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-2-[[(2~{R},3~{R},4~{S},5~{R},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxymethyl]tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{R},6~{S})-4-hydroxy-6-[(1~{R},2~{S},4~{S},5'~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-5-[(2~{R},3~{R},4~{S},5~{R},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-2-[[(2~{R},3~{R},4~{S},5~{R},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxymethyl]tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 157166 0 0 0 0 0 0 0 0999 V2000 13.1674 1.5101 2.7872 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9581 1.5823 1.8913 C 0 0 1 0 0 0 0 0 0 0 0 0 12.2955 1.3802 0.4409 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2168 0.7385 -0.3528 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8827 0.6840 0.2856 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8562 0.6123 1.6472 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0523 0.4031 2.2742 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0565 1.7716 -0.0853 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8885 1.4356 0.5857 C 0 0 1 0 0 0 0 0 0 0 0 0 6.6667 2.0661 -0.0599 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6936 0.9506 0.0360 C 0 0 1 0 0 0 0 0 0 0 0 0 4.4035 1.1243 -0.6509 C 0 0 2 0 0 0 0 0 0 0 0 0 3.6570 2.2865 -0.0858 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3431 1.9914 0.5176 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4957 0.9497 -0.1356 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7599 0.2463 0.9850 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0786 -0.9225 0.4980 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9612 -0.4044 -0.4141 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3090 -0.4645 0.0396 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7340 0.7950 0.1662 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6278 1.3815 -0.6680 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4525 2.4434 0.0312 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0364 1.8852 1.1595 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7059 2.7992 1.9392 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9556 3.0596 3.1222 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4152 4.2050 3.7066 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.6368 4.0532 5.2033 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4818 3.7161 5.8766 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6439 4.8013 3.1100 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.1879 5.6735 4.0841 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7249 3.8279 2.7612 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.6862 3.6841 3.7305 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0699 2.4829 2.3898 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.9145 1.8868 1.5013 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2608 0.6238 -1.7584 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5622 0.2864 -1.5057 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4745 0.8226 -2.4280 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.4092 1.5511 -1.8055 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6394 1.0297 -1.5398 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6484 2.1334 -1.1822 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2170 0.1276 -2.6005 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.3421 -1.1697 -2.1174 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3845 0.1519 -3.8360 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4478 1.3952 -4.4251 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9702 -0.2089 -3.4114 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2122 -0.0678 -4.5982 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4286 -0.5881 -2.1766 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1366 -1.4828 -2.9595 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0209 -1.3532 -0.9383 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2054 -2.4201 -1.2063 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7098 -3.6619 -0.8521 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8774 -4.2829 0.1112 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7349 -5.1250 0.8392 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0639 -5.7010 2.0598 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0034 -6.5138 2.6971 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1752 -6.2031 -0.1266 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8028 -7.4395 0.3367 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5078 -6.0042 -1.4938 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.1520 -6.1993 -1.3123 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7993 -4.6138 -2.0136 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0179 -4.5642 -2.6861 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9087 -1.9189 -0.0655 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5542 -1.2973 -1.2599 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2640 -0.0092 -1.0078 C 0 0 1 0 0 0 0 0 0 0 0 0 2.3983 0.6540 -2.3890 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6198 -0.1549 -0.4251 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3491 -1.3880 -0.8421 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7195 -1.4559 -0.2223 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5222 -0.2240 -0.4757 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8385 -0.1143 -1.9264 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7178 -0.0745 0.4230 C 0 0 1 0 0 0 0 0 0 0 0 0 9.0202 -0.4529 -0.2469 C 0 0 2 0 0 0 0 0 0 0 0 0 9.5105 -1.7935 0.2525 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8864 1.9703 3.7584 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0252 2.0881 2.3961 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3970 0.4501 2.9825 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3727 2.4956 1.9928 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6232 2.3740 0.0408 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2279 0.7427 0.4277 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5324 -0.2871 -0.6420 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1298 1.3032 -1.3273 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5295 -0.5596 2.0868 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8875 0.5112 3.3673 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9479 1.7404 1.6315 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3909 2.9737 0.5101 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8767 2.3902 -1.0997 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5104 0.7456 1.1138 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5831 1.3345 -1.7243 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5364 3.1248 -0.8353 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2893 2.7821 0.7126 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7394 2.9471 0.5109 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4909 1.7957 1.6214 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7078 1.4090 -0.7849 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5579 -0.2194 1.6352 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1816 0.9952 1.5335 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5817 -1.3094 1.4101 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2199 -0.9529 1.0463 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8791 2.0977 -1.2815 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2590 2.7514 -0.6556 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8809 3.3648 0.2646 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6779 3.7762 1.4161 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5983 4.9779 3.6069 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3911 3.2506 5.4091 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0733 4.9795 5.6287 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2484 2.7844 5.6279 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4088 5.4882 2.2437 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0839 5.9681 3.7628 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2368 4.2115 1.8349 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8507 2.7239 3.9142 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0173 1.9209 3.3706 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5684 1.3203 2.0133 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2168 1.2786 -2.7016 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8255 1.5065 -3.0609 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5398 0.4006 -0.6340 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1699 3.1167 -1.1377 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4700 2.0789 -1.9271 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0980 1.8614 -0.2152 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2563 0.4706 -2.8100 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7119 -1.3913 -1.4030 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7392 -0.6576 -4.5078 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6395 2.0602 -3.7291 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9862 -1.2322 -3.0544 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5497 -0.7256 -5.2586 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5182 -0.2119 -2.6478 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8107 -1.9670 -2.4193 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9502 -1.7307 -0.4724 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7245 -3.5031 -0.4212 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6279 -4.5188 1.0902 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8493 -4.8730 2.7634 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1686 -6.2539 1.7582 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8909 -6.4937 2.2683 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2665 -6.1816 -0.3243 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7672 -8.0576 -0.4552 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9670 -6.7369 -2.1725 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5891 -5.7758 -2.0085 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9489 -4.3419 -2.7058 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8570 -4.2384 -3.6042 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3799 -2.8126 -0.3952 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6420 -2.1180 0.7495 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2563 -1.9673 -1.7988 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7269 -1.0840 -1.9992 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3134 0.2818 -2.9164 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3128 1.7370 -2.3486 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5537 0.3131 -3.0605 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4858 -0.2140 0.6967 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7784 -2.2587 -0.4440 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3854 -1.5210 -1.9362 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6095 -1.5806 0.8771 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2145 -2.3743 -0.5984 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8820 -0.0378 -2.4871 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2971 -1.0684 -2.2486 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4986 0.7192 -2.1923 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6035 -0.5855 1.3864 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9902 -0.3931 -1.3379 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5718 -1.7399 1.3580 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4526 -2.0298 -0.2402 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7459 -2.5379 0.0032 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 1 6 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 26 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 21 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 41 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 35 47 1 0 47 48 1 0 47 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 53 56 1 0 56 57 1 0 56 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 17 62 1 0 62 63 1 0 63 64 1 0 64 65 1 6 64 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 6 69 71 1 0 71 72 1 0 72 73 1 0 7 2 1 0 71 9 1 0 72 5 1 0 69 11 1 0 66 12 1 0 64 15 1 0 49 19 1 0 60 51 1 0 33 24 1 0 45 37 1 0 1 74 1 0 1 75 1 0 1 76 1 0 2 77 1 6 3 78 1 0 3 79 1 0 4 80 1 0 4 81 1 0 7 82 1 0 7 83 1 0 9 84 1 1 10 85 1 0 10 86 1 0 11 87 1 1 12 88 1 6 13 89 1 0 13 90 1 0 14 91 1 0 14 92 1 0 15 93 1 6 16 94 1 0 16 95 1 0 17 96 1 1 19 97 1 1 21 98 1 6 22 99 1 0 22100 1 0 24101 1 6 26102 1 1 27103 1 0 27104 1 0 28105 1 0 29106 1 6 30107 1 0 31108 1 6 32109 1 0 33110 1 1 34111 1 0 35112 1 6 37113 1 6 39114 1 1 40115 1 0 40116 1 0 40117 1 0 41118 1 6 42119 1 0 43120 1 6 44121 1 0 45122 1 1 46123 1 0 47124 1 6 48125 1 0 49126 1 1 51127 1 1 53128 1 1 54129 1 0 54130 1 0 55131 1 0 56132 1 6 57133 1 0 58134 1 6 59135 1 0 60136 1 6 61137 1 0 62138 1 0 62139 1 0 63140 1 0 63141 1 0 65142 1 0 65143 1 0 65144 1 0 66145 1 1 67146 1 0 67147 1 0 68148 1 0 68149 1 0 70150 1 0 70151 1 0 70152 1 0 71153 1 1 72154 1 6 73155 1 0 73156 1 0 73157 1 0 M END

Standard InCHIKey	DLUTTXMPJCVUFR-ZGQYASCASA-N
Standard InCHI	InChI=1S/C51H84O22/c1-20-8-13-51(65-18-20)21(2)32-28(73-51)15-27-25-7-6-23-14-24(9-11-49(23,4)26(25)10-12-50(27,32)5)67-48-44(72-47-41(62)38(59)35(56)30(17-53)69-47)42(63)43(71-46-40(61)36(57)33(54)22(3)66-46)31(70-48)19-64-45-39(60)37(58)34(55)29(16-52)68-45/h20-48,52-63H,6-19H2,1-5H3/t20-,21-,22-,23+,24-,25+,26-,27-,28-,29+,30+,31+,32-,33-,34-,35-,36+,37-,38-,39+,40+,41+,42-,43-,44+,45+,46-,47-,48-,49-,50-,51+/m0/s1
SMILES	C[C@H]1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC[C@@H]5C[C@@H](O[C@H]6O[C@H](CO[C@@H]7O[C@H](CO)[C@H](O)[C@H](O)[C@H]7O)[C@H](O[C@@H]7O[C@@H](C)[C@H](O)[C@@H](O)[C@H]7O)[C@H](O)[C@H]6O[C@@H]6O[C@H](CO)[C@H](O)[C@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1048.55	Volume:	998.472 ? Van der Waals volume.
Dense:	1.05	LogP:	1.312 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.018 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.786 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	54.0
TPSA:	335.06 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	12.0	Rings:	10.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.101	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.156	Fsp³:	1.0
MCE-18:	261.333 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.677	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.014 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.389	Promiscuous compounds:	0.038

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.518	MDCK Permeability:	-4.975
Pgp-inhibitor:	0.0	Pgp-substrate:	0.977
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.1
20% Bioavailability (F20%):	0.982	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.311
Plasma Protein Binding (PPB):	54.183%	Volume Distribution (VD):	-0.363
Fu:	34.003% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.949	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.998
HLM stability:	0.008 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.063

Half-life (T1/2):

2.654

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.02
Human Hepatotoxicity (H-HT):	0.634	Drug-induced Liver Injury (DILI):	0.975
AMES Toxicity:	0.992	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.031	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.826	Drug-induced Nephrotoxicity:	0.95
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.449
A549 Cytotoxicity:	0.997	Hek293 Cytotoxicity:	0.952
BCF:	1.651 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.398 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.493 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.824 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO418	Smilax aristolochiaefolia	Species	Staphylinidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO50917	Smilax aristolochaefolia	Genus	Smilacaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO61670	Radix sarsaparillae	Genus	Lymnaeidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO418	Smilax aristolochiaefolia	Species	Staphylinidae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO418	Smilax aristolochiaefolia	Species	Staphylinidae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO418	Smilax aristolochiaefolia	Species	Staphylinidae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC506033 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27568
0.1-0.2	19038
0.2-0.3	2515
0.3-0.4	495
0.4-0.5	111
0.5-0.6	61
0.6-0.7	42
0.7-0.8	1
0.8-0.85	3
0.85-0.9	2
0.9-0.95	1
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9655	High Similarity	NPC160426
0.9032	High Similarity	NPC128572
0.871	High Similarity	NPC475643
0.8571	High Similarity	NPC6295
0.8242	Intermediate Similarity	NPC19400
0.8043	Intermediate Similarity	NPC211354
0.8043	Intermediate Similarity	NPC107188
0.7912	Intermediate Similarity	NPC477451
0.7692	Intermediate Similarity	NPC297348
0.7692	Intermediate Similarity	NPC249204
0.7692	Intermediate Similarity	NPC48339
0.7692	Intermediate Similarity	NPC141769
0.7692	Intermediate Similarity	NPC477547
0.7368	Intermediate Similarity	NPC206003
0.7368	Intermediate Similarity	NPC473610
0.7255	Intermediate Similarity	NPC471464
0.7245	Intermediate Similarity	NPC485595
0.72	Intermediate Similarity	NPC475351
0.7172	Intermediate Similarity	NPC195297
0.7143	Intermediate Similarity	NPC107962
0.7128	Intermediate Similarity	NPC325828
0.6875	Remote Similarity	NPC234352
0.6857	Remote Similarity	NPC480555
0.6857	Remote Similarity	NPC150372
0.6636	Remote Similarity	NPC97700
0.6636	Remote Similarity	NPC30856
0.6571	Remote Similarity	NPC470433
0.6571	Remote Similarity	NPC46190
0.6571	Remote Similarity	NPC171073
0.6569	Remote Similarity	NPC125324
0.6566	Remote Similarity	NPC250393
0.6566	Remote Similarity	NPC222731
0.6562	Remote Similarity	NPC485594
0.6535	Remote Similarity	NPC264101
0.6455	Remote Similarity	NPC475333
0.6455	Remote Similarity	NPC475625
0.6455	Remote Similarity	NPC224098
0.6455	Remote Similarity	NPC208383
0.6449	Remote Similarity	NPC51172
0.6449	Remote Similarity	NPC49032
0.6429	Remote Similarity	NPC177834
0.6396	Remote Similarity	NPC194207
0.6396	Remote Similarity	NPC22779
0.6372	Remote Similarity	NPC480553
0.6364	Remote Similarity	NPC294686
0.633	Remote Similarity	NPC184617
0.6286	Remote Similarity	NPC113044
0.6286	Remote Similarity	NPC283829
0.6286	Remote Similarity	NPC161676
0.6283	Remote Similarity	NPC83137
0.6228	Remote Similarity	NPC132080
0.6216	Remote Similarity	NPC269297
0.6216	Remote Similarity	NPC222202
0.6195	Remote Similarity	NPC480554
0.6147	Remote Similarity	NPC300557
0.6126	Remote Similarity	NPC475319
0.6121	Remote Similarity	NPC232054
0.6102	Remote Similarity	NPC480556
0.6055	Remote Similarity	NPC248746
0.6055	Remote Similarity	NPC92890
0.6019	Remote Similarity	NPC473601
0.6018	Remote Similarity	NPC116756
0.6	Remote Similarity	NPC274200
0.5965	Remote Similarity	NPC232037
0.5963	Remote Similarity	NPC602423
0.5913	Remote Similarity	NPC470864
0.5888	Remote Similarity	NPC141433
0.5872	Remote Similarity	NPC202898
0.5856	Remote Similarity	NPC42171
0.5785	Remote Similarity	NPC224314
0.5739	Remote Similarity	NPC32361
0.5739	Remote Similarity	NPC309278
0.5728	Remote Similarity	NPC291203
0.5728	Remote Similarity	NPC217205
0.5702	Remote Similarity	NPC115165
0.57	Remote Similarity	NPC24960
0.5686	Remote Similarity	NPC181845
0.5682	Remote Similarity	NPC481189
0.5678	Remote Similarity	NPC233433
0.5667	Remote Similarity	NPC470866
0.566	Remote Similarity	NPC54619
0.5648	Remote Similarity	NPC470432
0.5648	Remote Similarity	NPC230507
0.5625	Remote Similarity	NPC477809
0.5619	Remote Similarity	NPC474399
0.56	Remote Similarity	NPC473774
0.56	Remote Similarity	NPC481419
0.56	Remote Similarity	NPC481417
0.5575	Remote Similarity	NPC6806
0.5573	Remote Similarity	NPC329807
0.5545	Remote Similarity	NPC14704
0.5514	Remote Similarity	NPC306131
0.5514	Remote Similarity	NPC200802
0.5508	Remote Similarity	NPC108072
0.547	Remote Similarity	NPC13193
0.5421	Remote Similarity	NPC128123
0.5413	Remote Similarity	NPC215408
0.5407	Remote Similarity	NPC329727
0.54	Remote Similarity	NPC277715
0.5391	Remote Similarity	NPC151134
0.536	Remote Similarity	NPC220836
0.536	Remote Similarity	NPC477808
0.5315	Remote Similarity	NPC70204
0.53	Remote Similarity	NPC144790
0.53	Remote Similarity	NPC149400
0.5294	Remote Similarity	NPC481420
0.5294	Remote Similarity	NPC481421
0.5273	Remote Similarity	NPC485601
0.5214	Remote Similarity	NPC73243
0.5214	Remote Similarity	NPC244086
0.5214	Remote Similarity	NPC84956
0.521	Remote Similarity	NPC473518
0.5207	Remote Similarity	NPC476112
0.5207	Remote Similarity	NPC307534
0.5167	Remote Similarity	NPC232611
0.5152	Remote Similarity	NPC481190
0.5128	Remote Similarity	NPC475182
0.5126	Remote Similarity	NPC247037
0.512	Remote Similarity	NPC94086
0.512	Remote Similarity	NPC473817
0.5085	Remote Similarity	NPC294129
0.5082	Remote Similarity	NPC470862
0.5041	Remote Similarity	NPC477811
0.5036	Remote Similarity	NPC329820

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC506033 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7807
0.1-0.2	1263
0.2-0.3	69
0.3-0.4	5
0.4-0.5	4
0.5-0.6	0
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7128	Intermediate Similarity	NPD8171	Phase 2
0.6095	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data