NPASS Compound

Natural Product: NPC297400

Natural Product ID	NPC297400
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	FYOUZAVGEYRIAZ-UHFFFAOYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	175951
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 154163 0 0 0 0 0 0 0 0999 V2000 12.6227 -0.3738 2.2662 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3569 0.3781 2.6718 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4430 1.7915 2.1809 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1587 2.4872 1.9649 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9654 1.6464 1.7300 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5776 1.4692 0.2832 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5279 2.2115 -0.6546 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2641 2.1375 0.1480 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0933 2.8576 1.4636 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6257 2.7925 1.8252 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9329 2.0391 0.6681 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7792 1.2935 1.2013 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5471 1.8725 0.4715 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2817 1.3293 0.9981 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3339 -0.1141 1.4181 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0412 -0.8318 1.0417 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0383 -1.1508 -0.3960 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1544 -2.0340 -0.8368 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4502 -1.4373 -0.4296 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4951 -0.8967 0.9790 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5179 -2.1607 1.8671 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8042 -0.1725 1.2365 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9149 -0.8258 0.4092 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1897 -0.0784 0.7395 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0580 1.2366 0.0602 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7594 1.0048 -1.3940 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1311 -1.7394 -0.9119 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7573 -1.1646 -1.9579 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2211 -1.0342 -1.9952 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7358 -1.7092 -3.2988 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3093 -3.1518 -3.1986 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8164 -3.1764 -3.1159 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1809 -3.9641 -4.2428 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6832 -5.2717 -4.3075 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3056 -1.9286 -3.0867 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9107 -3.7763 -2.0991 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7300 -4.8086 -2.5669 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1728 -4.5745 -2.1808 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8071 -5.9054 -1.8552 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1429 -6.5837 -0.6688 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6794 -6.1578 -0.6953 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3406 -6.0381 -2.0416 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7082 -6.2033 0.5265 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1775 -5.7768 -1.6202 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2740 -3.6685 -1.1333 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2222 -1.1514 -4.4182 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7032 0.2075 -1.8544 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7373 0.4600 -0.9945 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9498 1.0103 -1.7938 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7313 2.4288 -2.1854 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2788 2.8180 -2.3151 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5982 2.6158 -0.9783 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3643 1.6338 -0.1105 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5178 2.2448 0.4033 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5388 2.2847 1.8065 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7727 1.5074 2.2169 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9550 2.3949 1.8486 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9426 3.5508 2.8162 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5341 3.8663 3.2087 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4956 5.3965 3.4085 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7749 6.0526 2.2131 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5760 3.5884 2.2709 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6884 3.1817 3.9369 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1540 1.7127 1.8303 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8403 1.3363 3.6192 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3244 2.1556 -1.1935 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2370 4.1598 -2.6864 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2859 2.5770 -3.4842 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0567 0.9283 -0.9751 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8780 2.2295 2.3887 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0684 0.3620 2.2842 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2167 -0.2879 1.9064 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7186 -0.1838 1.1593 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5000 -1.4580 2.3929 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4610 0.0613 2.8206 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1899 0.3423 3.7555 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1302 1.7723 1.2829 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0620 2.3455 2.9489 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2822 3.1744 1.0901 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9840 3.1910 2.8323 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6191 0.4165 -0.0562 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2571 1.8374 -1.6844 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5735 1.9554 -0.5192 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3020 3.2977 -0.6937 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2175 2.9207 -0.6455 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3765 3.9249 1.4019 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5473 2.2091 2.7622 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1840 3.7719 1.9998 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6186 2.8481 -0.0245 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6006 1.7043 2.2609 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6819 1.8134 -0.6205 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5942 2.9815 0.7054 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8983 1.9924 1.8004 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5147 1.4229 0.1844 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3326 -0.0938 2.5463 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7733 -0.1190 1.3518 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0564 -1.6736 1.7463 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1788 -0.1962 -0.9702 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0528 -3.0123 -0.3086 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0824 -2.2652 -1.9134 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2462 -2.1922 -0.5960 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6843 -0.6061 -1.1315 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8125 -1.9466 2.8919 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6069 -2.7695 1.7401 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3479 -2.8110 1.4501 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0863 -0.4740 2.2949 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1084 -1.8615 0.7660 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7226 -0.8074 -0.6634 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2382 -0.0238 1.8467 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0105 -0.7055 0.3211 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1466 1.8643 -2.0115 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6775 0.9740 -1.6196 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1903 0.0469 -1.7686 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2872 -0.1836 -2.1702 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6895 -1.6965 -1.2460 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8344 -1.6976 -3.3551 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6539 -3.6480 -4.1406 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4869 -3.7144 -2.1790 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1092 -4.0813 -3.9460 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1828 -3.4608 -5.2082 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7757 -5.6151 -3.3694 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7041 -4.8974 -3.6728 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7305 -4.1799 -3.0557 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6226 -6.5685 -2.7316 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1624 -7.7031 -0.8130 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5176 -5.1982 -0.1702 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0631 -6.9883 -0.2784 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1385 -7.0160 0.9270 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6452 -6.1434 -2.4138 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0120 -3.9666 -0.5396 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4476 -1.6785 -5.2172 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1395 -0.3897 -0.4463 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1369 0.3679 -2.6729 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2766 3.1747 -1.5740 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8025 2.2390 -3.1370 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5319 3.6154 -0.4942 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7382 1.3599 0.7312 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6586 1.8133 2.2681 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8258 0.5391 1.7027 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7224 2.8370 0.8487 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4714 4.4376 2.3895 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2567 3.4727 4.2296 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3030 5.6951 4.1208 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5427 5.7244 3.8416 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0589 6.6243 1.8885 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6594 3.3548 3.7230 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7262 2.1249 1.1067 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7701 1.0522 3.8750 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0493 1.4565 -0.5820 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4506 4.5651 -2.2028 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1371 2.0451 -3.4553 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9069 1.0974 -1.4106 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4545 -0.1886 0.8445 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1086 -1.3522 2.2272 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 39 44 1 0 38 45 1 0 30 46 1 0 29 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 59 62 1 0 58 63 1 0 57 64 1 0 56 65 1 0 52 66 1 0 51 67 1 0 50 68 1 0 49 69 1 0 9 70 1 0 5 71 1 0 71 72 1 0 72 2 1 0 70 5 1 0 25 8 1 0 35 28 1 0 42 37 1 0 53 48 1 0 62 55 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 73 1 0 1 74 1 0 1 75 1 0 2 76 1 0 3 77 1 0 3 78 1 0 4 79 1 0 4 80 1 0 6 81 1 0 7 82 1 0 7 83 1 0 7 84 1 0 8 85 1 0 9 86 1 0 10 87 1 0 10 88 1 0 11 89 1 0 12 90 1 0 13 91 1 0 13 92 1 0 14 93 1 0 14 94 1 0 15 95 1 0 16 96 1 0 16 97 1 0 17 98 1 0 18 99 1 0 18100 1 0 19101 1 0 19102 1 0 21103 1 0 21104 1 0 21105 1 0 22106 1 0 23107 1 0 23108 1 0 24109 1 0 24110 1 0 26111 1 0 26112 1 0 26113 1 0 28114 1 0 29115 1 0 30116 1 0 31117 1 0 32118 1 0 33119 1 0 33120 1 0 34121 1 0 37122 1 0 38123 1 0 39124 1 0 40125 1 0 41126 1 0 41127 1 0 43128 1 0 44129 1 0 45130 1 0 46131 1 0 48132 1 0 49133 1 0 50134 1 0 51135 1 0 52136 1 0 53137 1 0 55138 1 0 56139 1 0 57140 1 0 58141 1 0 59142 1 0 60143 1 0 60144 1 0 61145 1 0 63146 1 0 64147 1 0 65148 1 0 66149 1 0 67150 1 0 68151 1 0 69152 1 0 72153 1 0 72154 1 0 M END

Standard InCHIKey	FYOUZAVGEYRIAZ-UHFFFAOYSA-N
Standard InCHI	InChI=1S/C50H82O22/c1-19-7-12-50(65-17-19)20(2)30-27(72-50)14-25-23-6-5-21-13-22(8-10-48(21,3)24(23)9-11-49(25,30)4)66-47-44(40(63)41(29(16-52)68-47)70-45-38(61)31(54)26(53)18-64-45)69-42-36(59)34(57)35(58)37(60)43(42)71-46-39(62)33(56)32(55)28(15-51)67-46/h19-47,51-63H,5-18H2,1-4H3
SMILES	CC1CCC2(C(C)C3C(CC4C5CCC6CC(CCC6(C)C5CCC34C)OC3C(C(C(C(CO)O3)OC3C(C(C(CO3)O)O)O)O)OC3C(C(C(C(C3OC3C(C(C(C(CO)O3)O)O)O)O)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1530	Agave cantala	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1530	Agave cantala	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO1530	Agave cantala	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO1530	Agave cantala	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC297400 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	28430
0.1-0.2	18394
0.2-0.3	2401
0.3-0.4	412
0.4-0.5	93
0.5-0.6	63
0.6-0.7	39
0.7-0.8	1
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8105	Intermediate Similarity	NPC6295
0.8	Intermediate Similarity	NPC128572
0.79	Intermediate Similarity	NPC471464
0.7857	Intermediate Similarity	NPC475351
0.7789	Intermediate Similarity	NPC19400
0.7579	Intermediate Similarity	NPC250393
0.7576	Intermediate Similarity	NPC160426
0.7573	Intermediate Similarity	NPC97700
0.7573	Intermediate Similarity	NPC30856
0.7263	Intermediate Similarity	NPC297348
0.7263	Intermediate Similarity	NPC325828
0.7263	Intermediate Similarity	NPC249204
0.7263	Intermediate Similarity	NPC48339
0.7263	Intermediate Similarity	NPC141769
0.7263	Intermediate Similarity	NPC477547
0.7245	Intermediate Similarity	NPC211354
0.7196	Intermediate Similarity	NPC475625
0.7143	Intermediate Similarity	NPC206003
0.7143	Intermediate Similarity	NPC473610
0.71	Intermediate Similarity	NPC107962
0.7091	Intermediate Similarity	NPC132080
0.6939	Remote Similarity	NPC477451
0.69	Remote Similarity	NPC107188
0.6887	Remote Similarity	NPC51172
0.6887	Remote Similarity	NPC49032
0.6881	Remote Similarity	NPC475333
0.6881	Remote Similarity	NPC224098
0.6881	Remote Similarity	NPC116756
0.6881	Remote Similarity	NPC208383
0.6863	Remote Similarity	NPC485595
0.6857	Remote Similarity	NPC475643
0.6818	Remote Similarity	NPC232037
0.6796	Remote Similarity	NPC195297
0.6735	Remote Similarity	NPC177834
0.6697	Remote Similarity	NPC475319
0.6667	Remote Similarity	NPC234352
0.6604	Remote Similarity	NPC473601
0.6545	Remote Similarity	NPC115165
0.6522	Remote Similarity	NPC232054
0.6514	Remote Similarity	NPC480555
0.6514	Remote Similarity	NPC150372
0.6496	Remote Similarity	NPC480556
0.6491	Remote Similarity	NPC233433
0.6466	Remote Similarity	NPC470866
0.6455	Remote Similarity	NPC184617
0.6422	Remote Similarity	NPC274200
0.6346	Remote Similarity	NPC264101
0.6239	Remote Similarity	NPC470433
0.6239	Remote Similarity	NPC46190
0.6239	Remote Similarity	NPC171073
0.6226	Remote Similarity	NPC125324
0.6116	Remote Similarity	NPC220836
0.6087	Remote Similarity	NPC194207
0.6087	Remote Similarity	NPC22779
0.6068	Remote Similarity	NPC480553
0.6036	Remote Similarity	NPC92890
0.6034	Remote Similarity	NPC470864
0.6031	Remote Similarity	NPC481189
0.6019	Remote Similarity	NPC294686
0.6	Remote Similarity	NPC473518
0.5983	Remote Similarity	NPC476112
0.5983	Remote Similarity	NPC307534
0.5948	Remote Similarity	NPC232611
0.5923	Remote Similarity	NPC329807
0.5913	Remote Similarity	NPC269297
0.5913	Remote Similarity	NPC222202
0.5897	Remote Similarity	NPC108072
0.5897	Remote Similarity	NPC480554
0.5882	Remote Similarity	NPC485594
0.5868	Remote Similarity	NPC94086
0.5868	Remote Similarity	NPC473817
0.5789	Remote Similarity	NPC151134
0.5755	Remote Similarity	NPC222731
0.5752	Remote Similarity	NPC248746
0.575	Remote Similarity	NPC31896
0.5746	Remote Similarity	NPC329727
0.5739	Remote Similarity	NPC98018
0.5739	Remote Similarity	NPC284104
0.5739	Remote Similarity	NPC103616
0.5726	Remote Similarity	NPC477808
0.5714	Remote Similarity	NPC83137
0.5714	Remote Similarity	NPC202898
0.5688	Remote Similarity	NPC215408
0.5645	Remote Similarity	NPC224314
0.5614	Remote Similarity	NPC477809
0.5573	Remote Similarity	NPC330026
0.5565	Remote Similarity	NPC300557
0.5536	Remote Similarity	NPC113044
0.5536	Remote Similarity	NPC283829
0.5536	Remote Similarity	NPC161676
0.5534	Remote Similarity	NPC24960
0.5524	Remote Similarity	NPC181845
0.5462	Remote Similarity	NPC32361
0.5437	Remote Similarity	NPC481418
0.5433	Remote Similarity	NPC210569
0.5431	Remote Similarity	NPC42171
0.5421	Remote Similarity	NPC291203
0.5421	Remote Similarity	NPC217205
0.541	Remote Similarity	NPC84111
0.541	Remote Similarity	NPC287483
0.541	Remote Similarity	NPC470865
0.5391	Remote Similarity	NPC602423
0.5372	Remote Similarity	NPC249265
0.5368	Remote Similarity	NPC329820
0.5357	Remote Similarity	NPC470432
0.5357	Remote Similarity	NPC230507
0.5321	Remote Similarity	NPC474399
0.5299	Remote Similarity	NPC6806
0.5243	Remote Similarity	NPC277715
0.5225	Remote Similarity	NPC54619
0.521	Remote Similarity	NPC294129
0.5207	Remote Similarity	NPC13193
0.5207	Remote Similarity	NPC309278
0.5203	Remote Similarity	NPC470862
0.5175	Remote Similarity	NPC141433
0.5161	Remote Similarity	NPC477811
0.5159	Remote Similarity	NPC262050
0.5149	Remote Similarity	NPC481190
0.5146	Remote Similarity	NPC88962
0.5135	Remote Similarity	NPC128123
0.5135	Remote Similarity	NPC121453
0.504	Remote Similarity	NPC92297
0.5039	Remote Similarity	NPC473505

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC297400 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7947
0.1-0.2	1131
0.2-0.3	62
0.3-0.4	5
0.4-0.5	3
0.5-0.6	0
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7263	Intermediate Similarity	NPD8171	Phase 2
0.6226	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data