NPASS Compound

Natural Product: NPC192206

Natural Product ID	NPC192206
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	DQYACEDUQHWXQZ-YJLLQRRRSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	101674001
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 130138 0 0 0 0 0 0 0 0999 V2000 10.9839 1.9267 3.5367 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8077 1.8488 2.0328 C 0 0 2 0 0 0 0 0 0 0 0 0 9.8917 2.9217 1.5233 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2111 2.4136 0.2458 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3368 1.2562 0.6720 C 0 0 2 0 0 0 0 0 0 0 0 0 7.7929 0.5361 -0.5528 C 0 0 1 0 0 0 0 0 0 0 0 0 8.7628 -0.6216 -0.8291 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5353 -0.0574 -0.0046 C 0 0 1 0 0 0 0 0 0 0 0 0 6.2544 0.7608 1.2631 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8070 1.2551 1.1247 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2489 0.1994 0.2359 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8800 0.4507 -0.3191 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9106 0.4823 0.8148 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5302 0.4971 0.2897 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2156 0.0070 -0.8918 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2129 0.0723 -1.3241 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6483 -1.3443 -1.6528 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7255 -1.9850 -2.6631 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6895 -2.0090 -2.1204 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1818 -0.6099 -1.8255 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2332 0.1410 -3.1387 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5674 -0.7082 -1.2405 C 0 0 1 0 0 0 0 0 0 0 0 0 3.6259 -0.7337 -2.3242 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9773 -1.0355 -1.7153 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3150 0.1382 -0.8367 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4365 1.4220 -1.6006 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9383 -1.3966 -2.1235 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7068 -2.1618 -1.2898 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9083 -1.4224 -0.6980 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3019 -2.2621 0.4734 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.6462 -3.6401 -0.0255 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0777 -4.0575 -1.3137 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1952 -4.5324 -2.2611 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0843 -5.3789 -1.6171 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2370 -3.2340 -1.9842 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3743 -4.5864 0.9909 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2475 -1.7320 1.3092 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7901 -1.5698 2.6163 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8092 -0.1169 3.0259 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1475 0.2624 3.5595 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.2390 -0.7083 3.2131 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8461 -2.1258 3.5030 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4956 -2.3683 3.5126 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5425 -0.5794 1.8668 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5049 1.5245 3.0429 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8468 0.1216 4.0347 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6627 -0.1021 -0.4404 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4210 0.7628 -1.2560 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4358 1.5570 -0.5139 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8633 2.8010 0.0503 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4775 3.1375 -0.3777 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0861 2.6278 -1.7170 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2925 3.6836 -2.8052 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6469 1.4645 -2.1328 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5159 2.8444 0.6184 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7631 3.8657 -0.2211 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4831 1.8349 -1.4051 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1725 1.7796 1.2861 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9620 0.3755 1.5200 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3277 0.5061 1.5825 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4340 1.1384 4.0698 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5830 2.9049 3.9059 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0328 1.8795 3.8533 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8307 2.0503 1.6025 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0695 3.0640 2.2607 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4367 3.8665 1.3012 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5380 3.1841 -0.1771 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9614 2.0703 -0.4948 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6848 1.1773 -1.4254 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1879 -1.2963 -1.5286 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9729 -1.1526 0.1111 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6414 -0.2757 -1.3830 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6542 -1.1311 0.2726 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2757 0.0919 2.1383 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3335 1.3293 2.1151 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7663 2.2239 0.6123 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2255 -0.7917 0.7330 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7842 1.4118 -0.8608 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0073 -0.4153 1.4835 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1451 1.3834 1.4331 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2489 0.9323 0.9118 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3554 0.7546 -2.1832 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8855 0.4336 -0.5157 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5114 -1.9333 -0.7013 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7961 -1.5311 -3.6542 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0517 -3.0451 -2.7599 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3724 -2.4657 -2.8647 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7047 -2.5753 -1.1818 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7999 1.0757 -3.0955 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6135 -0.5810 -3.9063 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1912 0.3901 -3.4726 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7003 -1.6365 -0.6480 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3918 -1.4870 -3.1078 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6482 0.2706 -2.7857 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7358 -1.0400 -2.5396 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9773 -1.9461 -1.1120 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9794 2.1990 -1.0295 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4756 1.8844 -1.8884 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9824 1.1956 -2.5395 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0908 -2.5132 -0.4374 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6840 -1.4739 -1.4949 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3713 -2.4089 1.1008 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7709 -3.6600 -0.1012 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4792 -5.0062 -1.1284 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6831 -3.6682 -2.7549 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7411 -5.1332 -3.1027 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9433 -4.9634 -1.3866 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1817 -4.1273 1.8478 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7320 -1.9139 2.6790 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5234 0.5532 2.2025 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0677 0.4068 4.6610 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1335 -0.3880 3.7999 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2316 -2.3488 4.5406 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4082 -2.8550 2.8541 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5275 -0.5317 1.7149 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1753 1.3901 2.3337 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4195 0.9914 3.9466 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0328 0.0559 -1.9139 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8912 0.9279 0.2784 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8244 2.6914 1.1761 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4454 4.2678 -0.4484 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9642 2.4827 -1.6819 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8426 3.3559 -3.7525 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8462 4.6573 -2.5393 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3918 3.8825 -2.9330 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6453 2.6166 0.1693 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5480 3.7384 0.3972 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7078 0.9524 -1.8384 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8486 0.2578 0.6196 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6828 -0.2424 2.3434 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 30 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 40 45 1 0 39 46 1 0 29 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 52 54 1 0 51 55 1 0 50 56 1 0 49 57 1 0 9 58 1 0 5 59 1 1 59 60 1 0 60 2 1 0 58 5 1 0 25 8 1 0 35 28 1 0 43 38 1 0 54 48 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 61 1 0 1 62 1 0 1 63 1 0 2 64 1 6 3 65 1 0 3 66 1 0 4 67 1 0 4 68 1 0 6 69 1 6 7 70 1 0 7 71 1 0 7 72 1 0 8 73 1 1 9 74 1 1 10 75 1 0 10 76 1 0 11 77 1 1 12 78 1 6 13 79 1 0 13 80 1 0 14 81 1 0 16 82 1 0 16 83 1 0 17 84 1 1 18 85 1 0 18 86 1 0 19 87 1 0 19 88 1 0 21 89 1 0 21 90 1 0 21 91 1 0 22 92 1 1 23 93 1 0 23 94 1 0 24 95 1 0 24 96 1 0 26 97 1 0 26 98 1 0 26 99 1 0 28100 1 1 29101 1 6 30102 1 1 31103 1 6 32104 1 1 33105 1 0 33106 1 0 34107 1 0 36108 1 0 38109 1 6 39110 1 6 40111 1 1 41112 1 1 42113 1 0 42114 1 0 44115 1 0 45116 1 0 46117 1 0 48118 1 6 49119 1 1 50120 1 1 51121 1 6 52122 1 1 53123 1 0 53124 1 0 53125 1 0 55126 1 0 56127 1 0 57128 1 0 60129 1 0 60130 1 0 M END

Standard InCHIKey	DQYACEDUQHWXQZ-YJLLQRRRSA-N
Standard InCHI	InChI=1S/C44H70O16/c1-19-8-13-44(54-17-19)20(2)30-28(60-44)15-26-24-7-6-22-14-23(9-11-42(22,4)25(24)10-12-43(26,30)5)56-41-38(59-40-36(52)34(50)31(47)21(3)55-40)37(33(49)29(16-45)57-41)58-39-35(51)32(48)27(46)18-53-39/h6,19-21,23-41,45-52H,7-18H2,1-5H3/t19-,20+,21+,23+,24-,25+,26+,27+,28+,29-,30+,31+,32+,33-,34-,35-,36-,37+,38-,39+,40+,41-,42+,43+,44-/m1/s1
SMILES	C[C@@H]1CC[C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@H](CC[C@]6(C)[C@H]5CC[C@]34C)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O[C@H]3[C@@H]([C@H]([C@H](CO3)O)O)O)O[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21524113]
NPO7703	Xanthorrhoea preissii	Species	Asphodelaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8173	Lupinus multiflorus	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6023	Neurolaena venturana	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO6023	Neurolaena venturana	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7703	Xanthorrhoea preissii	Species	Asphodelaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO2383	Mimosa acacioides	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO5425	Polygala nyikensis	Species	Polygalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO10340	Crepis rubra	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO8173	Lupinus multiflorus	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC192206 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24002
0.1-0.2	22278
0.2-0.3	2646
0.3-0.4	655
0.4-0.5	109
0.5-0.6	87
0.6-0.7	42
0.7-0.8	0
0.8-0.85	4
0.85-0.9	0
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9255	High Similarity	NPC602423
0.9062	High Similarity	NPC300557
0.8431	Intermediate Similarity	NPC309278
0.8252	Intermediate Similarity	NPC475333
0.8252	Intermediate Similarity	NPC224098
0.8252	Intermediate Similarity	NPC208383
0.7909	Intermediate Similarity	NPC480556
0.7706	Intermediate Similarity	NPC31896
0.7624	Intermediate Similarity	NPC113044
0.7624	Intermediate Similarity	NPC283829
0.7624	Intermediate Similarity	NPC161676
0.7573	Intermediate Similarity	NPC470433
0.7573	Intermediate Similarity	NPC46190
0.7573	Intermediate Similarity	NPC171073
0.7549	Intermediate Similarity	NPC475351
0.7524	Intermediate Similarity	NPC480555
0.7524	Intermediate Similarity	NPC150372
0.7477	Intermediate Similarity	NPC232054
0.7455	Intermediate Similarity	NPC477811
0.7451	Intermediate Similarity	NPC14704
0.7431	Intermediate Similarity	NPC218571
0.7431	Intermediate Similarity	NPC487615
0.7426	Intermediate Similarity	NPC470432
0.7426	Intermediate Similarity	NPC230507
0.7304	Intermediate Similarity	NPC477808
0.7273	Intermediate Similarity	NPC480554
0.7241	Intermediate Similarity	NPC210569
0.7216	Intermediate Similarity	NPC181845
0.7156	Intermediate Similarity	NPC269297
0.7156	Intermediate Similarity	NPC222202
0.7143	Intermediate Similarity	NPC480553
0.7027	Intermediate Similarity	NPC194207
0.7027	Intermediate Similarity	NPC22779
0.7009	Intermediate Similarity	NPC248746
0.6972	Remote Similarity	NPC97700
0.6972	Remote Similarity	NPC30856
0.6972	Remote Similarity	NPC102016
0.6972	Remote Similarity	NPC95051
0.6949	Remote Similarity	NPC15918
0.6944	Remote Similarity	NPC6806
0.6917	Remote Similarity	NPC305771
0.6917	Remote Similarity	NPC94072
0.6917	Remote Similarity	NPC169816
0.6863	Remote Similarity	NPC206003
0.6863	Remote Similarity	NPC473610
0.6822	Remote Similarity	NPC473601
0.6789	Remote Similarity	NPC51172
0.6789	Remote Similarity	NPC49032
0.678	Remote Similarity	NPC224314
0.6697	Remote Similarity	NPC477809
0.6667	Remote Similarity	NPC294129
0.6639	Remote Similarity	NPC263359
0.6636	Remote Similarity	NPC42171
0.6607	Remote Similarity	NPC475319
0.6579	Remote Similarity	NPC232037
0.6552	Remote Similarity	NPC132080
0.646	Remote Similarity	NPC115165
0.6371	Remote Similarity	NPC244431
0.6348	Remote Similarity	NPC116756
0.6325	Remote Similarity	NPC476112
0.6325	Remote Similarity	NPC307534
0.6283	Remote Similarity	NPC150057
0.6283	Remote Similarity	NPC147753
0.6239	Remote Similarity	NPC141433
0.6239	Remote Similarity	NPC249265
0.623	Remote Similarity	NPC477807
0.6207	Remote Similarity	NPC32361
0.6207	Remote Similarity	NPC473518
0.6207	Remote Similarity	NPC13193
0.6182	Remote Similarity	NPC305423
0.6147	Remote Similarity	NPC125324
0.614	Remote Similarity	NPC151134
0.6134	Remote Similarity	NPC233433
0.6129	Remote Similarity	NPC79900
0.605	Remote Similarity	NPC83137
0.6	Remote Similarity	NPC128572
0.5985	Remote Similarity	NPC329807
0.5984	Remote Similarity	NPC470866
0.5981	Remote Similarity	NPC250393
0.5966	Remote Similarity	NPC108072
0.5948	Remote Similarity	NPC184617
0.5948	Remote Similarity	NPC475247
0.5946	Remote Similarity	NPC70204
0.5913	Remote Similarity	NPC471464
0.5902	Remote Similarity	NPC167183
0.5888	Remote Similarity	NPC477451
0.5882	Remote Similarity	NPC232611
0.5872	Remote Similarity	NPC19400
0.5862	Remote Similarity	NPC475182
0.5856	Remote Similarity	NPC6295
0.5852	Remote Similarity	NPC481189
0.5847	Remote Similarity	NPC475550
0.5812	Remote Similarity	NPC73243
0.5812	Remote Similarity	NPC244086
0.5812	Remote Similarity	NPC84956
0.5809	Remote Similarity	NPC329727
0.5806	Remote Similarity	NPC94086
0.5806	Remote Similarity	NPC473817
0.5794	Remote Similarity	NPC220836
0.5789	Remote Similarity	NPC98696
0.5789	Remote Similarity	NPC40440
0.5776	Remote Similarity	NPC124677
0.5727	Remote Similarity	NPC306131
0.5727	Remote Similarity	NPC200802
0.5714	Remote Similarity	NPC247037
0.5714	Remote Similarity	NPC473505
0.5714	Remote Similarity	NPC485595
0.5667	Remote Similarity	NPC475625
0.5662	Remote Similarity	NPC329820
0.566	Remote Similarity	NPC485594
0.5657	Remote Similarity	NPC100451
0.5652	Remote Similarity	NPC42482
0.5641	Remote Similarity	NPC48886
0.5641	Remote Similarity	NPC94881
0.5614	Remote Similarity	NPC160426
0.5581	Remote Similarity	NPC32707
0.5574	Remote Similarity	NPC470864
0.5556	Remote Similarity	NPC297348
0.5556	Remote Similarity	NPC249204
0.5556	Remote Similarity	NPC48339
0.5556	Remote Similarity	NPC177834
0.5556	Remote Similarity	NPC141769
0.5556	Remote Similarity	NPC477547
0.5528	Remote Similarity	NPC23808
0.5528	Remote Similarity	NPC87998
0.5512	Remote Similarity	NPC248202
0.5508	Remote Similarity	NPC249553
0.5508	Remote Similarity	NPC182900
0.5484	Remote Similarity	NPC256983
0.547	Remote Similarity	NPC469347
0.5446	Remote Similarity	NPC211354
0.5446	Remote Similarity	NPC107188
0.5439	Remote Similarity	NPC94272
0.5413	Remote Similarity	NPC325828
0.5407	Remote Similarity	NPC330026
0.5398	Remote Similarity	NPC264101
0.5364	Remote Similarity	NPC234352
0.5344	Remote Similarity	NPC208832
0.5317	Remote Similarity	NPC308140
0.53	Remote Similarity	NPC235126
0.53	Remote Similarity	NPC242419
0.5268	Remote Similarity	NPC222731
0.5259	Remote Similarity	NPC195297
0.5259	Remote Similarity	NPC475670
0.5242	Remote Similarity	NPC197003
0.5217	Remote Similarity	NPC107962
0.5169	Remote Similarity	NPC112274
0.5167	Remote Similarity	NPC122819
0.5164	Remote Similarity	NPC98018
0.5164	Remote Similarity	NPC284104
0.5164	Remote Similarity	NPC103616
0.5159	Remote Similarity	NPC470862
0.5126	Remote Similarity	NPC486388
0.51	Remote Similarity	NPC207617
0.51	Remote Similarity	NPC607440
0.5094	Remote Similarity	NPC144790
0.5094	Remote Similarity	NPC149400
0.5094	Remote Similarity	NPC88962
0.5083	Remote Similarity	NPC475643
0.5081	Remote Similarity	NPC486386
0.5043	Remote Similarity	NPC15249
0.5043	Remote Similarity	NPC306991
0.5043	Remote Similarity	NPC25455

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC192206 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7613
0.1-0.2	1451
0.2-0.3	76
0.3-0.4	5
0.4-0.5	2
0.5-0.6	2
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6283	Remote Similarity	NPD8450	Suspended
0.5413	Remote Similarity	NPD8171	Phase 2
0.5167	Remote Similarity	NPD8449	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data