NPASS Compound

Natural Product: NPC530069

Natural Product ID	NPC530069
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{R},3~{R},4~{S},5~{S},6~{S})-6-[[(3~{S},4~{a}~{S},6~{a}~{R},6~{b}~{S},8~{a}~{S},12~{a}~{S},14~{a}~{R},14~{b}~{R})-8~{a}-[(2~{S},3~{S},4~{R},5~{R})-3-[(2~{S},3~{R},4~{R},5~{R},6~{S})-5-[(2~{R},3~{S},4~{S},5~{S})-3,5-dihydroxy-4-[(2~{R},3~{R},4~{R},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]oxy-3-hydroxy-6-methyl-4-[(2~{R},3~{R},4~{R},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]oxy-4,5-dihydroxy-tetrahydropyran-2-yl]oxycarbonyl-4,4,6~{a},6~{b},11,11,14~{b}-heptamethyl-1,2,3,4~{a},5,6,7,8,9,10,12,12~{a},14,14~{a}-tetradecahydropicen-3-yl]oxy]-3,5-dihydroxy-4-[(2~{R},3~{R},4~{R},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-2-carboxylic acid
IUPAC Name	(2~{R},3~{R},4~{S},5~{S},6~{S})-6-[[(3~{S},4~{a}~{S},6~{a}~{R},6~{b}~{S},8~{a}~{S},12~{a}~{S},14~{a}~{R},14~{b}~{R})-8~{a}-[(2~{S},3~{S},4~{R},5~{R})-3-[(2~{S},3~{R},4~{R},5~{R},6~{S})-5-[(2~{R},3~{S},4~{S},5~{S})-3,5-dihydroxy-4-[(2~{R},3~{R},4~{R},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]oxy-3-hydroxy-6-methyl-4-[(2~{R},3~{R},4~{R},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]oxy-4,5-dihydroxy-tetrahydropyran-2-yl]oxycarbonyl-4,4,6~{a},6~{b},11,11,14~{b}-heptamethyl-1,2,3,4~{a},5,6,7,8,9,10,12,12~{a},14,14~{a}-tetradecahydropicen-3-yl]oxy]-3,5-dihydroxy-4-[(2~{R},3~{R},4~{R},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-2-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 206217 0 0 0 0 0 0 0 0999 V2000 -7.7396 2.8666 -2.6218 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2216 1.7862 -1.7566 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2295 1.0818 -2.4481 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4050 0.4233 -1.4962 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8474 1.3890 -0.6469 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5511 1.6603 -0.9641 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5313 1.7211 0.1114 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9862 0.4685 0.5082 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6795 0.1164 0.1102 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1174 0.9762 -0.6120 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0034 -1.1473 0.4886 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.0745 -2.2107 0.4893 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5734 -3.4821 1.0863 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1626 -3.2189 2.4809 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4114 -2.9162 3.3109 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3905 -4.5159 3.0736 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8402 -2.1348 2.6719 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7676 -0.9923 1.7329 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1797 -0.5065 1.5226 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7055 0.2669 2.4683 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0480 0.8699 2.5125 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8951 0.1191 1.4977 C 0 0 2 0 0 0 0 0 0 0 0 0 6.3198 0.5958 1.4320 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5557 1.2787 2.7654 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2812 -0.5998 1.4695 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6881 -0.1515 1.5779 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0675 0.7298 0.4205 C 0 0 2 0 0 0 0 0 0 0 0 0 10.2556 1.3455 0.7743 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3383 1.0638 0.0153 C 0 0 1 0 0 0 0 0 0 0 0 0 11.7290 2.2238 -0.6290 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8046 2.8797 -0.1252 C 0 0 1 0 0 0 0 0 0 0 0 0 12.7252 3.3605 1.2453 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7339 3.9858 1.7214 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6420 3.1812 2.0367 O 0 0 0 0 0 0 0 0 0 0 0 0 14.0473 2.0154 -0.3577 C 0 0 2 0 0 0 0 0 0 0 0 0 14.5012 2.2695 -1.6264 O 0 0 0 0 0 0 0 0 0 0 0 0 13.8032 0.5901 -0.0440 C 0 0 2 0 0 0 0 0 0 0 0 0 14.0256 -0.2880 -1.0896 O 0 0 0 0 0 0 0 0 0 0 0 0 15.0213 -1.2073 -0.8801 C 0 0 1 0 0 0 0 0 0 0 0 0 14.4850 -2.4627 -1.1568 O 0 0 0 0 0 0 0 0 0 0 0 0 15.3207 -3.4882 -0.7098 C 0 0 0 0 0 0 0 0 0 0 0 0 16.7147 -3.3009 -1.2775 C 0 0 1 0 0 0 0 0 0 0 0 0 17.2827 -4.4877 -1.6707 O 0 0 0 0 0 0 0 0 0 0 0 0 16.6369 -2.2894 -2.4018 C 0 0 1 0 0 0 0 0 0 0 0 0 15.7943 -2.8489 -3.3743 O 0 0 0 0 0 0 0 0 0 0 0 0 16.1004 -0.9611 -1.9146 C 0 0 1 0 0 0 0 0 0 0 0 0 15.5582 -0.3052 -3.0199 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4673 0.3321 0.6651 C 0 0 2 0 0 0 0 0 0 0 0 0 12.3014 -1.0515 0.6326 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0843 1.7706 0.0364 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3037 2.0169 -1.4752 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5159 3.1048 0.6663 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6333 1.4715 0.2628 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0536 0.9967 -1.0256 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0162 -0.0918 -0.9201 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1344 0.1505 0.2388 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4191 1.4651 -0.0202 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9772 -0.8573 0.3438 C 0 0 1 0 0 0 0 0 0 0 0 0 3.5309 -2.2341 0.3414 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0988 -0.7353 -0.8825 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8554 -1.5034 -0.7217 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9188 2.4163 1.2216 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7818 3.4753 0.9164 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4555 4.1031 -0.4002 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2005 4.7322 -0.3984 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5852 3.1159 -1.5374 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5396 3.2551 -2.4415 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2133 -0.5792 -0.7730 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.3124 -1.6993 -1.6530 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6030 -0.1685 -0.3855 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7330 0.1135 0.9607 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5082 -0.7737 1.6794 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6844 -1.3706 2.6192 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2344 -2.3317 3.4044 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7128 -2.4150 3.2526 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.3033 -3.2819 4.1750 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3033 -1.0278 3.3457 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.9806 -0.5359 4.6329 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7255 -0.1110 2.2893 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.4802 1.1471 2.7831 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2910 0.7776 -1.2930 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7413 0.2067 -2.4968 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0099 0.6678 -2.8457 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.9661 1.3999 -4.0346 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1469 2.0631 -4.2815 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.2705 1.6302 -3.4021 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.3793 2.3510 -2.2108 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.3750 0.1404 -3.2106 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.1788 -0.0471 -2.0751 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.3186 -0.7899 -2.3811 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.2858 -1.9598 -1.6212 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.6666 -1.7103 -0.2988 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.1738 -1.7148 -0.2861 C 0 0 1 0 0 0 0 0 0 0 0 0 -16.7183 -1.3643 0.9293 O 0 0 0 0 0 0 0 0 0 0 0 0 -16.6520 -0.8620 -1.4388 C 0 0 1 0 0 0 0 0 0 0 0 0 -17.6128 0.0066 -0.9291 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.5367 -0.0012 -2.0134 C 0 0 1 0 0 0 0 0 0 0 0 0 -15.2863 1.0101 -1.0800 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0217 -0.4181 -2.8828 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.0140 -1.0899 -1.6563 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7708 3.1915 -2.3332 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1169 3.7914 -2.4050 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6060 2.7122 -3.7045 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7353 2.2178 -0.8643 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5785 0.0366 -2.1349 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2494 1.0047 -1.8067 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6791 2.3264 -0.3787 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8713 -1.8221 1.1676 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4367 -2.3357 -0.5400 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1650 -4.0131 0.4591 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4579 -4.1875 1.1371 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6216 -1.8401 3.2037 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1931 -3.1585 4.3824 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2398 -3.5749 2.9844 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5719 -4.2727 4.1631 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3939 -4.7694 2.6620 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3271 -5.3474 3.0172 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8578 -2.6269 2.7065 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7150 -1.8068 3.7517 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2454 -0.1568 2.3066 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0701 0.5138 3.3599 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4241 0.7146 3.5505 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9907 1.9620 2.3113 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9372 -0.9074 1.9045 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4101 0.4447 3.5222 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5730 1.6124 2.9465 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8893 2.1235 2.9668 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0197 -1.1455 2.4164 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1675 -1.2893 0.6439 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0050 0.2438 2.5630 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3196 -1.0872 1.4612 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1806 0.0534 -0.4574 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9780 0.3608 -0.8050 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9587 3.7859 -0.7707 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6141 3.2454 3.0360 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8133 2.4889 0.3354 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2507 2.8902 -1.6987 H 0 0 0 0 0 0 0 0 0 0 0 0 14.5555 0.2920 0.7310 H 0 0 0 0 0 0 0 0 0 0 0 0 15.5166 -1.1417 0.1015 H 0 0 0 0 0 0 0 0 0 0 0 0 15.3189 -3.5425 0.3911 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9250 -4.4320 -1.0990 H 0 0 0 0 0 0 0 0 0 0 0 0 17.3295 -2.8363 -0.4795 H 0 0 0 0 0 0 0 0 0 0 0 0 17.2883 -4.5888 -2.6626 H 0 0 0 0 0 0 0 0 0 0 0 0 17.6680 -2.2023 -2.8215 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7023 -2.2202 -4.1355 H 0 0 0 0 0 0 0 0 0 0 0 0 16.9703 -0.4258 -1.4790 H 0 0 0 0 0 0 0 0 0 0 0 0 14.5695 -0.4181 -2.9723 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5143 0.6174 1.7326 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7805 -1.3324 1.4307 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7097 1.1053 -1.9742 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4476 2.4797 -1.9579 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1470 2.7625 -1.6148 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3352 3.5764 0.0408 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6941 3.8519 0.6244 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9697 2.9764 1.6635 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2147 2.4838 0.5146 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7903 0.5897 -1.7556 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5563 1.8591 -1.5603 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4905 -1.0630 -1.0164 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3572 -0.0060 -1.8404 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3743 1.5955 -1.1194 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3795 1.4786 0.3528 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9038 2.3556 0.3632 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0473 -2.3818 -0.6512 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7343 -3.0266 0.2982 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1431 -2.5073 1.2072 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6929 -1.2915 -1.6929 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8979 0.2805 -1.2103 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0475 -2.6173 -0.7451 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2147 -1.3322 -1.6172 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8366 3.2011 0.9476 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6141 4.2614 1.7018 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1871 4.9527 -0.5311 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8633 4.6591 0.5340 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5424 3.2979 -2.0328 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0030 2.4283 -2.5223 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6223 -0.9036 0.1325 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7574 -2.4145 -1.1305 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2207 -1.1344 -0.4908 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9023 -1.6040 1.0514 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8998 -2.2997 4.4657 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8239 -3.3200 3.0337 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9512 -2.8384 2.2567 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2501 -3.4025 3.8674 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4096 -1.0168 3.2871 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5810 0.1900 4.9033 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5031 -0.0067 1.5031 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6457 1.1714 3.3456 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0552 1.4367 -0.8302 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3003 1.3733 -2.0440 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9460 3.1471 -4.0577 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3820 2.0188 -5.3536 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2192 1.9089 -3.9671 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7993 3.2537 -2.3675 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8273 -0.3559 -4.0990 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.3315 -1.0718 -3.4531 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.2755 -2.4906 0.3839 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.2355 -0.7421 0.0658 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.4805 -2.7624 -0.5322 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.3738 -2.0579 1.2372 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.1110 -1.4431 -2.2481 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.2225 0.7168 -0.3429 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.9537 0.4166 -2.9676 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.7869 1.8525 -1.3146 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6922 -1.1393 -3.6760 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5491 -0.5442 -1.0386 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 11 9 1 6 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 14 16 1 0 14 17 1 0 17 18 1 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 1 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 2 0 32 34 1 0 31 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 37 48 1 0 48 49 1 0 27 50 1 0 50 51 1 0 50 52 1 0 50 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 6 56 58 1 0 58 59 1 1 58 60 1 0 60 61 1 0 7 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 64 66 1 0 66 67 1 0 4 68 1 0 68 69 1 0 68 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 75 77 1 0 77 78 1 0 77 79 1 0 79 80 1 0 70 81 1 0 81 82 1 0 82 83 1 0 83 84 1 0 84 85 1 0 85 86 1 0 86 87 1 0 86 88 1 0 88 89 1 0 89 90 1 0 90 91 1 0 91 92 1 0 92 93 1 0 93 94 1 0 93 95 1 0 95 96 1 0 95 97 1 0 97 98 1 0 88 99 1 0 99100 1 0 81 2 1 0 99 83 1 0 66 6 1 0 79 72 1 0 97 90 1 0 18 11 1 0 58 19 1 0 61 11 1 0 56 22 1 0 53 23 1 0 48 29 1 0 46 39 1 0 1101 1 0 1102 1 0 1103 1 0 2104 1 1 4105 1 6 6106 1 6 7107 1 6 12108 1 0 12109 1 0 13110 1 0 13111 1 0 15112 1 0 15113 1 0 15114 1 0 16115 1 0 16116 1 0 16117 1 0 17118 1 0 17119 1 0 18120 1 1 20121 1 0 21122 1 0 21123 1 0 22124 1 1 24125 1 0 24126 1 0 24127 1 0 25128 1 0 25129 1 0 26130 1 0 26131 1 0 27132 1 6 29133 1 6 31134 1 6 34135 1 0 35136 1 1 36137 1 0 37138 1 1 39139 1 1 41140 1 0 41141 1 0 42142 1 1 43143 1 0 44144 1 6 45145 1 0 46146 1 1 47147 1 0 48148 1 1 49149 1 0 51150 1 0 51151 1 0 51152 1 0 52153 1 0 52154 1 0 52155 1 0 53156 1 1 54157 1 0 54158 1 0 55159 1 0 55160 1 0 57161 1 0 57162 1 0 57163 1 0 59164 1 0 59165 1 0 59166 1 0 60167 1 0 60168 1 0 61169 1 0 61170 1 0 63171 1 0 63172 1 0 64173 1 6 65174 1 0 66175 1 6 67176 1 0 68177 1 1 69178 1 0 70179 1 1 72180 1 6 74181 1 0 74182 1 0 75183 1 6 76184 1 0 77185 1 1 78186 1 0 79187 1 6 80188 1 0 81189 1 1 83190 1 1 85191 1 0 85192 1 0 86193 1 6 87194 1 0 88195 1 6 90196 1 6 92197 1 0 92198 1 0 93199 1 6 94200 1 0 95201 1 6 96202 1 0 97203 1 6 98204 1 0 99205 1 6 100206 1 0 M END

Standard InCHIKey	AUWIBYQJUPOTCJ-CCDMBRKPSA-N
Standard InCHI	InChI=1S/C67H106O33/c1-25-47(94-57-44(81)48(32(72)24-90-57)95-54-40(77)36(73)28(68)20-87-54)50(97-56-42(79)38(75)30(70)22-89-56)46(83)58(92-25)99-52-39(76)31(71)23-91-60(52)100-61(86)67-17-15-62(2,3)19-27(67)26-9-10-34-64(6)13-12-35(63(4,5)33(64)11-14-66(34,8)65(26,7)16-18-67)93-59-45(82)49(43(80)51(98-59)53(84)85)96-55-41(78)37(74)29(69)21-88-55/h9,25,27-52,54-60,68-83H,10-24H2,1-8H3,(H,84,85)/t25-,27-,28+,29+,30+,31+,32-,33+,34+,35-,36+,37+,38+,39+,40+,41+,42+,43+,44-,45-,46+,47+,48-,49-,50+,51+,52-,54+,55+,56+,57+,58-,59-,60-,64-,65+,66+,67-/m0/s1
SMILES	C[C@@H]1O[C@@H](O[C@@H]2[C@H](OC(=O)[C@]34CCC(C)(C)C[C@H]3C3=CC[C@@H]5[C@@]6(C)CC[C@H](O[C@H]7O[C@@H](C(=O)O)[C@H](O)[C@H](O[C@H]8OC[C@@H](O)[C@@H](O)[C@H]8O)[C@@H]7O)C(C)(C)[C@H]6CC[C@@]5(C)[C@]3(C)CC4)OC[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O[C@H]2OC[C@@H](O)[C@@H](O)[C@H]2O)[C@@H]1O[C@H]1OC[C@H](O)[C@H](O[C@H]2OC[C@@H](O)[C@@H](O)[C@H]2O)[C@@H]1O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1438.66	Volume:	1346.878 ? Van der Waals volume.
Dense:	1.068	LogP:	0.584 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.124 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.398 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	70.0
TPSA:	507.27 ? Topological Polar Surface Area.	H-Bond Acceptor:	33.0
H-Bond Donor:	17.0	Rings:	12.0
Heavy Atoms:	33.0

MedChem Properties

QED Drug-Likeness Score:	0.042	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.933	Fsp³:	0.94
MCE-18:	259.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.807	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.387	Promiscuous compounds:	0.125

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.791	MDCK Permeability:	-5.071
Pgp-inhibitor:	0.0	Pgp-substrate:	1.0
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.783	30% Bioavailability (F30%):	0.098
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.054
Plasma Protein Binding (PPB):	53.382%	Volume Distribution (VD):	-0.259
Fu:	27.56% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.001	BCRP inhibitor:	0.0
BSEP inhibitor:	0.896

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.012	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.523
HLM stability:	0.206 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-2.106

Half-life (T1/2):

6.012

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.01
Human Hepatotoxicity (H-HT):	0.211	Drug-induced Liver Injury (DILI):	0.074
AMES Toxicity:	0.132	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.028	Skin Sensitization:	1.0
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.803	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.668
A549 Cytotoxicity:	0.026	Hek293 Cytotoxicity:	0.019
BCF:	0.613 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.71 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.77 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.298 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27170	Luffa acutangula	Species	Cucurbitaceae	Eukaryota	n.a.	whole plant	n.a.	PMID[1863290]
NPO27170	Luffa acutangula	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO27170	Luffa acutangula	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO27170	Luffa acutangula	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC530069 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24188
0.1-0.2	22616
0.2-0.3	2156
0.3-0.4	419
0.4-0.5	320
0.5-0.6	123
0.6-0.7	27
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7364	Intermediate Similarity	NPC480422
0.6977	Remote Similarity	NPC70809
0.6923	Remote Similarity	NPC224381
0.6765	Remote Similarity	NPC475368
0.6752	Remote Similarity	NPC159309
0.6752	Remote Similarity	NPC86222
0.6693	Remote Similarity	NPC4749
0.6639	Remote Similarity	NPC187290
0.6612	Remote Similarity	NPC301449
0.6612	Remote Similarity	NPC601290
0.6562	Remote Similarity	NPC85154
0.6529	Remote Similarity	NPC114484
0.6462	Remote Similarity	NPC13998
0.6454	Remote Similarity	NPC297950
0.6408	Remote Similarity	NPC472268
0.6371	Remote Similarity	NPC481078
0.632	Remote Similarity	NPC11242
0.626	Remote Similarity	NPC21691
0.6239	Remote Similarity	NPC475516
0.6231	Remote Similarity	NPC488560
0.6212	Remote Similarity	NPC480418
0.6148	Remote Similarity	NPC475591
0.6148	Remote Similarity	NPC236870
0.6136	Remote Similarity	NPC57484
0.6077	Remote Similarity	NPC123199
0.6066	Remote Similarity	NPC251768
0.6	Remote Similarity	NPC6377
0.6	Remote Similarity	NPC208381
0.5987	Remote Similarity	NPC472269
0.5971	Remote Similarity	NPC102505
0.5971	Remote Similarity	NPC488514
0.5956	Remote Similarity	NPC236638
0.5956	Remote Similarity	NPC294453
0.595	Remote Similarity	NPC469946
0.5909	Remote Similarity	NPC283417
0.5909	Remote Similarity	NPC200049
0.5873	Remote Similarity	NPC281148
0.5868	Remote Similarity	NPC157868
0.5859	Remote Similarity	NPC104137
0.5859	Remote Similarity	NPC26626
0.5852	Remote Similarity	NPC286457
0.5839	Remote Similarity	NPC481081
0.5827	Remote Similarity	NPC481079
0.5802	Remote Similarity	NPC79643
0.5797	Remote Similarity	NPC309223
0.5789	Remote Similarity	NPC475160
0.5789	Remote Similarity	NPC473714
0.5775	Remote Similarity	NPC8524
0.5772	Remote Similarity	NPC192791
0.5772	Remote Similarity	NPC112352
0.576	Remote Similarity	NPC63159
0.5745	Remote Similarity	NPC480417
0.5735	Remote Similarity	NPC473645
0.5734	Remote Similarity	NPC33012
0.5725	Remote Similarity	NPC475287
0.5714	Remote Similarity	NPC297263
0.5704	Remote Similarity	NPC489209
0.5694	Remote Similarity	NPC480421
0.5693	Remote Similarity	NPC41061
0.5693	Remote Similarity	NPC227551
0.5683	Remote Similarity	NPC302543
0.5615	Remote Similarity	NPC477194
0.5612	Remote Similarity	NPC305981
0.5606	Remote Similarity	NPC60557
0.5606	Remote Similarity	NPC67857
0.5588	Remote Similarity	NPC481080
0.5584	Remote Similarity	NPC485563
0.558	Remote Similarity	NPC258617
0.5578	Remote Similarity	NPC489208
0.5571	Remote Similarity	NPC261506
0.5571	Remote Similarity	NPC4328
0.5547	Remote Similarity	NPC476068
0.5538	Remote Similarity	NPC295823
0.5538	Remote Similarity	NPC174720
0.5538	Remote Similarity	NPC475467
0.5538	Remote Similarity	NPC477193
0.5528	Remote Similarity	NPC173583
0.55	Remote Similarity	NPC202828
0.55	Remote Similarity	NPC119592
0.5496	Remote Similarity	NPC31838
0.5493	Remote Similarity	NPC267694
0.5481	Remote Similarity	NPC135904
0.5481	Remote Similarity	NPC480419
0.5476	Remote Similarity	NPC30735
0.5469	Remote Similarity	NPC481082
0.5469	Remote Similarity	NPC164419
0.5461	Remote Similarity	NPC33068
0.5455	Remote Similarity	NPC250247
0.5448	Remote Similarity	NPC123522
0.5441	Remote Similarity	NPC470218
0.544	Remote Similarity	NPC263756
0.5433	Remote Similarity	NPC40775
0.5433	Remote Similarity	NPC46665
0.5396	Remote Similarity	NPC473452
0.5385	Remote Similarity	NPC142151
0.5373	Remote Similarity	NPC300419
0.5372	Remote Similarity	NPC90856
0.536	Remote Similarity	NPC473884
0.5349	Remote Similarity	NPC475504
0.5328	Remote Similarity	NPC471550
0.5328	Remote Similarity	NPC191827
0.5316	Remote Similarity	NPC23020
0.5312	Remote Similarity	NPC164389
0.5312	Remote Similarity	NPC488526
0.5303	Remote Similarity	NPC480473
0.5303	Remote Similarity	NPC480474
0.5286	Remote Similarity	NPC265841
0.5285	Remote Similarity	NPC48499
0.5276	Remote Similarity	NPC223301
0.5276	Remote Similarity	NPC242840
0.5276	Remote Similarity	NPC171544
0.5274	Remote Similarity	NPC51099
0.5245	Remote Similarity	NPC37860
0.5238	Remote Similarity	NPC295371
0.5211	Remote Similarity	NPC293330
0.52	Remote Similarity	NPC235405
0.5194	Remote Similarity	NPC104400
0.5194	Remote Similarity	NPC10320
0.5194	Remote Similarity	NPC480475
0.5191	Remote Similarity	NPC64715
0.5188	Remote Similarity	NPC477192
0.5159	Remote Similarity	NPC114441
0.5159	Remote Similarity	NPC58448
0.5159	Remote Similarity	NPC249848
0.5159	Remote Similarity	NPC107966
0.5152	Remote Similarity	NPC104372
0.5147	Remote Similarity	NPC76972
0.5147	Remote Similarity	NPC469782
0.5147	Remote Similarity	NPC204414
0.5139	Remote Similarity	NPC298034
0.5139	Remote Similarity	NPC71065
0.5139	Remote Similarity	NPC144644
0.5139	Remote Similarity	NPC170407
0.5123	Remote Similarity	NPC472270
0.5123	Remote Similarity	NPC112492
0.5113	Remote Similarity	NPC477191
0.5106	Remote Similarity	NPC473386
0.5105	Remote Similarity	NPC43550
0.5102	Remote Similarity	NPC293031
0.5093	Remote Similarity	NPC482013
0.5078	Remote Similarity	NPC213674
0.5076	Remote Similarity	NPC302887
0.5075	Remote Similarity	NPC241909
0.5074	Remote Similarity	NPC477196
0.507	Remote Similarity	NPC488308
0.507	Remote Similarity	NPC110633
0.5064	Remote Similarity	NPC45606
0.5038	Remote Similarity	NPC235438
0.5035	Remote Similarity	NPC271610
0.5035	Remote Similarity	NPC312650
0.5035	Remote Similarity	NPC71391

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC530069 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7122
0.1-0.2	1994
0.2-0.3	31
0.3-0.4	1
0.4-0.5	1
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5079	Remote Similarity	NPD8295	Clinical (unspecified phase)

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data