NPASS Compound

Natural Product: NPC529499

Natural Product ID	NPC529499
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{R},3~{R},4~{R},5~{R},6~{S})-2-[[(2~{R},3~{R},4~{R},5~{R},6~{R})-4,5-dihydroxy-6-[(1~{R},2~{S},4~{S},5'~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-3-[(2~{S},3~{R},4~{R},5~{R},6~{S})-3,4,5-trihydroxy-6-methyl-tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]methoxy]-6-methyl-tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{R},3~{R},4~{R},5~{R},6~{S})-2-[[(2~{R},3~{R},4~{R},5~{R},6~{R})-4,5-dihydroxy-6-[(1~{R},2~{S},4~{S},5'~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-3-[(2~{S},3~{R},4~{R},5~{R},6~{S})-3,4,5-trihydroxy-6-methyl-tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]methoxy]-6-methyl-tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 135143 0 0 0 0 0 0 0 0999 V2000 12.9673 0.6886 -1.0317 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6501 -0.7831 -0.9519 C 0 0 1 0 0 0 0 0 0 0 0 0 12.3305 -1.1751 0.4851 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1005 -0.4926 0.9994 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0151 -0.3692 -0.0384 C 0 0 1 0 0 0 0 0 0 0 0 0 10.4604 -0.0621 -1.2975 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3887 -1.0089 -1.7600 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1803 -1.5059 -0.0190 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0269 -1.1602 -0.6670 C 0 0 1 0 0 0 0 0 0 0 0 0 6.7836 -1.8290 -0.0663 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7757 -0.7585 -0.2456 C 0 0 1 0 0 0 0 0 0 0 0 0 4.4742 -0.9411 0.4336 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8025 -2.1751 -0.1247 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3053 -2.1028 -0.0955 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8002 -1.1475 0.9689 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3194 -1.2578 1.1160 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4589 -0.6624 -0.0316 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7021 -0.2089 0.3728 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7753 -0.9137 -0.2500 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4490 -0.1359 -1.1130 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7358 0.2670 -0.8110 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7731 1.5224 0.0103 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0854 1.8723 0.2674 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1637 3.0509 1.0120 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8791 2.8205 2.1596 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1193 2.3236 1.8935 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9027 2.1273 3.2041 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0009 3.2139 1.0426 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.0406 2.4198 0.5486 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2418 3.7542 -0.1521 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9201 4.8861 -0.5981 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8360 4.1537 0.2260 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9428 5.2959 1.0512 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5157 -0.8838 -0.1962 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8409 -0.5383 -0.0559 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7105 -1.3217 -0.8063 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.3897 -0.5069 -1.7084 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0084 -1.2772 -2.6843 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.1178 -1.2310 -3.9199 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1574 -2.7131 -2.2998 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.1932 -3.2564 -3.0963 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5222 -2.9448 -0.8713 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.1673 -4.2738 -0.5632 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7242 -2.0388 0.0312 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.1856 -2.7235 1.1168 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8604 -1.3854 1.0391 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9088 -0.4258 2.0816 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4316 -1.6948 0.8005 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3868 -3.0730 0.4439 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3013 0.4160 -0.7667 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3127 1.1339 0.0579 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2900 0.2541 0.7697 C 0 0 1 0 0 0 0 0 0 0 0 0 2.4668 0.8518 2.1730 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6300 0.2848 0.1074 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3234 1.5674 0.4146 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7101 1.6564 -0.1703 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5227 0.4683 0.2596 C 0 0 1 0 0 0 0 0 0 0 0 0 6.6607 0.4736 1.7624 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8242 0.3384 -0.4555 C 0 0 1 0 0 0 0 0 0 0 0 0 9.0169 0.6992 0.3718 C 0 0 2 0 0 0 0 0 0 0 0 0 9.5188 2.0979 0.1036 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5278 1.1257 -1.9651 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4766 1.1875 -0.1843 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0743 0.8754 -1.0165 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4965 -1.4147 -1.2888 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2050 -0.8881 1.1072 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2738 -2.2851 0.5241 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3312 0.4808 1.4857 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6830 -1.1458 1.8171 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6021 -0.7653 -2.8264 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0237 -2.0346 -1.6347 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0687 -1.3795 -1.7579 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5288 -2.6926 -0.7039 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9538 -2.0849 0.9956 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5922 -0.5891 -1.3211 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5387 -1.0860 1.5286 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1819 -3.0449 0.4842 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1649 -2.3940 -1.1685 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9369 -3.1218 0.2253 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8925 -1.9333 -1.0877 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2398 -1.5381 1.9319 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0867 -2.3515 1.1985 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0115 -0.7485 2.0418 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6034 -1.4863 -0.7598 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2165 -1.6675 -0.9107 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2316 0.4999 -1.7725 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3375 2.3466 -0.6036 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1431 1.4681 0.9184 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1240 3.4190 1.2336 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0696 1.3239 1.4358 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7244 1.4129 2.9725 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3127 3.1057 3.5609 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2893 1.6609 3.9825 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4689 4.0075 1.6600 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9992 2.2960 -0.4322 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1982 3.0375 -0.9791 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8896 4.8386 -0.4512 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2923 4.4065 -0.6993 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6900 5.0876 1.6868 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5060 -1.7522 -0.9229 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1264 -2.0630 -1.3539 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9904 -0.8130 -2.9774 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0782 -0.9205 -3.6697 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5276 -0.5390 -4.6902 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0173 -2.2469 -4.3857 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2387 -3.2620 -2.6074 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4984 -4.1147 -2.7323 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6160 -2.8755 -0.6866 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4900 -4.4897 0.3644 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4381 -1.2499 0.4111 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8365 -2.6174 1.8703 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4011 -2.3060 1.3539 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8856 -0.3715 2.3208 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8491 -1.6971 1.7780 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8377 -3.1377 -0.4295 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4693 1.1782 -1.0805 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7161 0.0480 -1.7457 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8751 1.8006 -0.6409 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7726 1.8322 0.7511 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5456 0.5109 2.7302 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3123 0.4043 2.7017 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4316 1.9473 2.1618 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4436 0.2685 -1.0054 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7370 2.3884 -0.0802 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3701 1.8387 1.4723 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6498 1.6678 -1.2800 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1635 2.5929 0.1645 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1127 1.4470 2.0327 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2095 -0.4013 2.1346 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6634 0.4558 2.2265 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8693 0.9038 -1.4077 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8666 0.5789 1.4630 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2886 2.1381 -0.6928 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0143 2.4683 1.0265 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6766 2.7996 -0.1087 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 6 6 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 26 28 1 0 28 29 1 0 28 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 21 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 38 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 34 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 17 50 1 0 50 51 1 0 51 52 1 0 52 53 1 1 52 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 1 57 59 1 0 59 60 1 0 60 61 1 0 7 2 1 0 59 9 1 0 60 5 1 0 57 11 1 0 54 12 1 0 52 15 1 0 48 19 1 0 32 24 1 0 44 36 1 0 1 62 1 0 1 63 1 0 1 64 1 0 2 65 1 6 3 66 1 0 3 67 1 0 4 68 1 0 4 69 1 0 7 70 1 0 7 71 1 0 9 72 1 6 10 73 1 0 10 74 1 0 11 75 1 6 12 76 1 1 13 77 1 0 13 78 1 0 14 79 1 0 14 80 1 0 15 81 1 1 16 82 1 0 16 83 1 0 17 84 1 6 19 85 1 6 21 86 1 6 22 87 1 0 22 88 1 0 24 89 1 1 26 90 1 6 27 91 1 0 27 92 1 0 27 93 1 0 28 94 1 1 29 95 1 0 30 96 1 6 31 97 1 0 32 98 1 6 33 99 1 0 34100 1 6 36101 1 6 38102 1 6 39103 1 0 39104 1 0 39105 1 0 40106 1 6 41107 1 0 42108 1 6 43109 1 0 44110 1 1 45111 1 0 46112 1 1 47113 1 0 48114 1 1 49115 1 0 50116 1 0 50117 1 0 51118 1 0 51119 1 0 53120 1 0 53121 1 0 53122 1 0 54123 1 6 55124 1 0 55125 1 0 56126 1 0 56127 1 0 58128 1 0 58129 1 0 58130 1 0 59131 1 6 60132 1 1 61133 1 0 61134 1 0 61135 1 0 M END

Standard InCHIKey	BWYAGTYHXROECV-XGYRUUDGSA-N
Standard InCHI	InChI=1S/C45H74O16/c1-19-9-14-45(55-17-19)20(2)30-28(61-45)16-27-25-8-7-23-15-24(10-12-43(23,5)26(25)11-13-44(27,30)6)58-42-38(53)35(50)39(60-41-37(52)34(49)32(47)22(4)57-41)29(59-42)18-54-40-36(51)33(48)31(46)21(3)56-40/h19-42,46-53H,7-18H2,1-6H3/t19-,20-,21-,22-,23+,24-,25+,26-,27-,28-,29+,30-,31-,32-,33+,34+,35+,36+,37+,38+,39-,40+,41-,42+,43-,44-,45+/m0/s1
SMILES	C[C@H]1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC[C@@H]5C[C@@H](O[C@@H]6O[C@H](CO[C@@H]7O[C@@H](C)[C@H](O)[C@@H](O)[C@H]7O)[C@H](O[C@@H]7O[C@@H](C)[C@H](O)[C@@H](O)[C@H]7O)[C@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	870.5	Volume:	850.511 ? Van der Waals volume.
Dense:	1.024	LogP:	2.769 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.265 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.269 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	48.0
TPSA:	235.68 ? Topological Polar Surface Area.	H-Bond Acceptor:	16.0
H-Bond Donor:	8.0	Rings:	9.0
Heavy Atoms:	16.0

MedChem Properties

QED Drug-Likeness Score:	0.169	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.659	Fsp³:	1.0
MCE-18:	230.667 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.747	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.036 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.274	Promiscuous compounds:	0.008

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.066	MDCK Permeability:	-4.999
Pgp-inhibitor:	0.001	Pgp-substrate:	0.984
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.539	30% Bioavailability (F30%):	0.85
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.278
Plasma Protein Binding (PPB):	64.32%	Volume Distribution (VD):	-0.346
Fu:	26.408% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.042
BSEP inhibitor:	0.368

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.998	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.088
HLM stability:	0.003 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.276

Half-life (T1/2):

2.579

ADMET: Toxicity

hERG Blockers:	0.037	hERG Blockers (10um):	0.208
Human Hepatotoxicity (H-HT):	0.282	Drug-induced Liver Injury (DILI):	0.801
AMES Toxicity:	0.813	Rat Oral Acute Toxicity:	0.007
Maximum Recommended Daily Dose:	0.019	Skin Sensitization:	1.0
Carcinogencity:	0.024	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.995
Hematotoxicity:	0.163	Drug-induced Nephrotoxicity:	0.606
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.302
A549 Cytotoxicity:	0.821	Hek293 Cytotoxicity:	0.842
BCF:	2.243 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.725 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.674 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.27 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO17292	Asparagus racemosus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO17292	Asparagus racemosus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC529499 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26039
0.1-0.2	20936
0.2-0.3	2362
0.3-0.4	309
0.4-0.5	98
0.5-0.6	75
0.6-0.7	29
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9024	High Similarity	NPC107188
0.7558	Intermediate Similarity	NPC325828
0.75	Intermediate Similarity	NPC250393
0.75	Intermediate Similarity	NPC160426
0.7356	Intermediate Similarity	NPC177834
0.734	Intermediate Similarity	NPC202898
0.7253	Intermediate Similarity	NPC264101
0.7143	Intermediate Similarity	NPC19400
0.7041	Intermediate Similarity	NPC128572
0.7	Intermediate Similarity	NPC477451
0.6957	Remote Similarity	NPC211354
0.6915	Remote Similarity	NPC6295
0.6809	Remote Similarity	NPC107962
0.6735	Remote Similarity	NPC475643
0.6703	Remote Similarity	NPC234352
0.6667	Remote Similarity	NPC206003
0.6667	Remote Similarity	NPC473610
0.6634	Remote Similarity	NPC97700
0.6634	Remote Similarity	NPC30856
0.6593	Remote Similarity	NPC297348
0.6593	Remote Similarity	NPC249204
0.6593	Remote Similarity	NPC48339
0.6593	Remote Similarity	NPC141769
0.6593	Remote Similarity	NPC477547
0.6556	Remote Similarity	NPC485594
0.6531	Remote Similarity	NPC475351
0.6392	Remote Similarity	NPC470432
0.6392	Remote Similarity	NPC230507
0.6392	Remote Similarity	NPC485595
0.6311	Remote Similarity	NPC184617
0.6275	Remote Similarity	NPC471464
0.6226	Remote Similarity	NPC232037
0.6222	Remote Similarity	NPC473774
0.6222	Remote Similarity	NPC481419
0.6222	Remote Similarity	NPC481417
0.6204	Remote Similarity	NPC132080
0.6132	Remote Similarity	NPC475625
0.6122	Remote Similarity	NPC215408
0.6111	Remote Similarity	NPC83137
0.5981	Remote Similarity	NPC116756
0.59	Remote Similarity	NPC125324
0.5889	Remote Similarity	NPC144790
0.5889	Remote Similarity	NPC149400
0.5876	Remote Similarity	NPC222731
0.5872	Remote Similarity	NPC470864
0.587	Remote Similarity	NPC481420
0.587	Remote Similarity	NPC481421
0.5842	Remote Similarity	NPC195297
0.581	Remote Similarity	NPC51172
0.581	Remote Similarity	NPC6806
0.581	Remote Similarity	NPC49032
0.5714	Remote Similarity	NPC92890
0.5631	Remote Similarity	NPC14704
0.5625	Remote Similarity	NPC233433
0.5625	Remote Similarity	NPC181845
0.5619	Remote Similarity	NPC470433
0.5619	Remote Similarity	NPC46190
0.5619	Remote Similarity	NPC171073
0.5619	Remote Similarity	NPC602423
0.5614	Remote Similarity	NPC470866
0.5596	Remote Similarity	NPC269297
0.5596	Remote Similarity	NPC222202
0.5545	Remote Similarity	NPC475333
0.5545	Remote Similarity	NPC224098
0.5545	Remote Similarity	NPC208383
0.5536	Remote Similarity	NPC476112
0.5536	Remote Similarity	NPC307534
0.5524	Remote Similarity	NPC473601
0.5514	Remote Similarity	NPC300557
0.551	Remote Similarity	NPC294686
0.5505	Remote Similarity	NPC115165
0.5505	Remote Similarity	NPC475319
0.5481	Remote Similarity	NPC113044
0.5481	Remote Similarity	NPC283829
0.5481	Remote Similarity	NPC161676
0.5474	Remote Similarity	NPC24960
0.5469	Remote Similarity	NPC329727
0.5464	Remote Similarity	NPC481424
0.5464	Remote Similarity	NPC481422
0.5463	Remote Similarity	NPC480555
0.5463	Remote Similarity	NPC150372
0.5446	Remote Similarity	NPC306131
0.5446	Remote Similarity	NPC200802
0.5413	Remote Similarity	NPC294129
0.5397	Remote Similarity	NPC329807
0.5391	Remote Similarity	NPC481189
0.5385	Remote Similarity	NPC70204
0.5368	Remote Similarity	NPC481418
0.5357	Remote Similarity	NPC248944
0.5357	Remote Similarity	NPC7479
0.5357	Remote Similarity	NPC257296
0.5354	Remote Similarity	NPC131693
0.5354	Remote Similarity	NPC475436
0.5299	Remote Similarity	NPC94086
0.5299	Remote Similarity	NPC473817
0.5294	Remote Similarity	NPC220836
0.5278	Remote Similarity	NPC477809
0.5268	Remote Similarity	NPC32361
0.521	Remote Similarity	NPC224314
0.5196	Remote Similarity	NPC121453
0.5175	Remote Similarity	NPC480554
0.5158	Remote Similarity	NPC277715
0.5152	Remote Similarity	NPC481425
0.5152	Remote Similarity	NPC481426
0.5138	Remote Similarity	NPC248746
0.5133	Remote Similarity	NPC473518
0.5133	Remote Similarity	NPC309278
0.5126	Remote Similarity	NPC480556
0.5094	Remote Similarity	NPC141433
0.5091	Remote Similarity	NPC274200
0.5088	Remote Similarity	NPC194207
0.5088	Remote Similarity	NPC22779
0.5086	Remote Similarity	NPC480553
0.5053	Remote Similarity	NPC88962

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC529499 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7631
0.1-0.2	1440
0.2-0.3	63
0.3-0.4	11
0.4-0.5	1
0.5-0.6	2
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7558	Intermediate Similarity	NPD8171	Phase 2
0.6392	Remote Similarity	NPD8170	Phase 2
0.5357	Remote Similarity	NPD6928	Phase 2
0.5104	Remote Similarity	NPD7991	Discontinued

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data