15 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
6 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC62640
Formula: C19H12O6
Ingredient ID: NPC62640
| Common Name | n.a. |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-methoxyfuro[2,3-h]chromen-4-one |
| Canonical SMILES | COc1c(oc2c(c1=O)ccc1c2cco1)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C19H12O6/c1-21-19-16(20)12-3-5-13-11(6-7-22-13)18(12)25-17(19)10-2-4-14-15(8-10)24-9-23-14/h2-8H,9H2,1H3 |
| Standard InCHIKey | IGFBIJDAWSAJIF-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 3083586 ZINC ID: ZINC000014677195 |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC62640] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Millettia pinnata | Millettia | Fabaceae |
  |
| Derris indica | Derris | Fabaceae |
|
Ingredient ID: NPC476342
Formula: C24H28O6
Ingredient ID: NPC476342
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1cc(OC)c2c(c1CC=C(C)C)O[C@H](CC2=O)c1ccc(c(c1)OC)OC |
| Standard InCHI | InChI=1S/C24H28O6/c1-14(2)7-9-16-20(27-4)13-22(29-6)23-17(25)12-19(30-24(16)23)15-8-10-18(26-3)21(11-15)28-5/h7-8,10-11,13,19H,9,12H2,1-6H3/t19-/m1/s1 |
| Standard InCHIKey | KBPWAJPFHMEGLH-LJQANCHMSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC476342] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Derris indica | Derris | Fabaceae |
|
Ingredient ID: NPC45404
Formula: C8H6O4
Ingredient ID: NPC45404
| Common Name | Piperonylic Acid |
| IUPAC Name | 1,3-benzodioxole-5-carboxylic acid |
| Canonical SMILES | OC(=O)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C8H6O4/c9-8(10)5-1-2-6-7(3-5)12-4-11-6/h1-3H,4H2,(H,9,10) |
| Standard InCHIKey | VDVJGIYXDVPQLP-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 7196 ChEMBL ID: CHEMBL573781 |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC45404] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Trapa japonica | Trapa | Lythraceae |
|
| Diospyros peregrina | Diospyros | Ebenaceae |
|
| Diospyros elliptifolia | Diospyros | Ebenaceae | |
| Diospyros abyssinica | Diospyros | Ebenaceae |
|
| Cratystylis conocephala | Cratystylis | Asteraceae | |
| Beaucarnea recurvata | Beaucarnea | Asparagaceae | |
| Distemonanthus benthamianus | Distemonanthus | Fabaceae |
|
| Asplenium adiantum-nigrum | Asplenium | Aspleniaceae |
|
| Derris indica | Derris | Fabaceae |
|
| Centaurea arenaria | Centaurea | Asteraceae | |
| Scorzonera hispanica | Scorzonera | Asteraceae |
 |
| Gutenbergia cordifolia | Gutenbergia | Asteraceae |
|
| Schisandra sphenanthera | Schisandra | Schisandraceae |
|
| Phyllodium pulchellum | Phyllodium | Fabaceae |
|
| Mikania scandens | Mikania | Asteraceae |
 |
| Cotylelobium scabriusculum | Cotylelobium | Dipterocarpaceae |
Ingredient ID: NPC41719
Formula: C18H12O4
Ingredient ID: NPC41719
| Common Name | Karanjin |
| IUPAC Name | 3-methoxy-2-phenylfuro[2,3-h]chromen-4-one |
| Canonical SMILES | COc1c(oc2c(c1=O)ccc1c2cco1)c1ccccc1 |
| Standard InCHI | InChI=1S/C18H12O4/c1-20-18-15(19)13-7-8-14-12(9-10-21-14)17(13)22-16(18)11-5-3-2-4-6-11/h2-10H,1H3 |
| Standard InCHIKey | LKPQNZRGGNOPPU-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 100633 ZINC ID: ZINC000000039119 ChEMBL ID: CHEMBL208484 |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC41719] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Derris indica | Derris | Fabaceae |
|
Ingredient ID: NPC38914
Formula: C17H10O5
Ingredient ID: NPC38914
| Common Name | n.a. |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)furo[2,3-h]chromen-4-one |
| Canonical SMILES | Oc1cc(ccc1O)c1cc(=O)c2c(o1)c1ccoc1cc2 |
| Standard InCHI | InChI=1S/C17H10O5/c18-12-3-1-9(7-14(12)20)16-8-13(19)10-2-4-15-11(5-6-21-15)17(10)22-16/h1-8,18,20H |
| Standard InCHIKey | HQXNJTYEMIKUKO-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 44537938 |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC38914] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Derris indica | Derris | Fabaceae |
|
Ingredient ID: NPC302741
Formula: C22H18O6
Ingredient ID: NPC302741
| Common Name | n.a. |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-methoxy-8,8-dimethylpyrano[2,3-f]chromen-4-one |
| Canonical SMILES | COc1c(oc2c(c1=O)ccc1c2C=CC(O1)(C)C)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C22H18O6/c1-22(2)9-8-13-15(28-22)7-5-14-18(23)21(24-3)19(27-20(13)14)12-4-6-16-17(10-12)26-11-25-16/h4-10H,11H2,1-3H3 |
| Standard InCHIKey | SVCOJIPWISPOJZ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 14033985 |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC302741] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Derris indica | Derris | Fabaceae |
|
Ingredient ID: NPC299923
Formula: C19H18O6
Ingredient ID: NPC299923
| Common Name | Fisetin Tetramethyl Ether |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3,7-dimethoxychromen-4-one |
| Canonical SMILES | COc1ccc2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)OC)OC |
| Standard InCHI | InChI=1S/C19H18O6/c1-21-12-6-7-13-15(10-12)25-18(19(24-4)17(13)20)11-5-8-14(22-2)16(9-11)23-3/h5-10H,1-4H3 |
| Standard InCHIKey | NAMFTZBUZYVNST-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 631171 ChEMBL ID: CHEMBL575808 |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC299923] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Artemisia incanescens | Artemisia | Asteraceae | |
| Perriera orientalis | Perriera | Simaroubaceae | |
| Ichthyothere latifolia | Ichthyothere | Asteraceae | |
| Scrophularia umbrosa | Scrophularia | Scrophulariaceae |
|
| Solanum sublobatum | Solanum | Solanaceae | |
| Swertia pseudochinensis | Swertia | Gentianaceae |
|
| Pseudofumaria lutea | Pseudofumaria | Papaveraceae | |
| Cyperus papyrus | Cyperus | Cyperaceae |
|
| Sabal blackburniana | Sabal | Arecaceae | |
| Lachnophyllum gossypinum | Lachnophyllum | Asteraceae | |
| Pteris cretica var. nervosa | Pteris | Pteridaceae |
|
| Derris indica | Derris | Fabaceae |
|
| Dimorphotheca aurantiaca | Dimorphotheca | Asteraceae | |
| Othonna dentata | Othonna | Asteraceae | |
| Acacia mearnsii | Acacia | Fabaceae |
|
| Neorautanenia ficifolia | Neorautanenia | Fabaceae | |
| Strychnos erichsonii | Strychnos | Loganiaceae |
|
| Fagus grandifolia | Fagus | Fagaceae |
|
| Mitragyna inermis | Mitragyna | Rubiaceae |
|
Ingredient ID: NPC29353
Formula: C17H14O5
Ingredient ID: NPC29353
| Common Name | n.a. |
| IUPAC Name | 5-hydroxy-7-methoxy-2-(4-methoxyphenyl)chromen-4-one |
| Canonical SMILES | COc1ccc(cc1)c1cc(=O)c2c(o1)cc(cc2O)OC |
| Standard InCHI | InChI=1S/C17H14O5/c1-20-11-5-3-10(4-6-11)15-9-14(19)17-13(18)7-12(21-2)8-16(17)22-15/h3-9,18H,1-2H3 |
| Standard InCHIKey | LZERJKGWTQYMBB-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5281601 ZINC ID: ZINC000005733551 |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC29353] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tristania conferta | Tristania | Myrtaceae | |
| Plectranthus myrianthus | Plectranthus | Lamiaceae | |
| Pentaclethra macrophylla | Pentaclethra | Fabaceae |
|
| Maackia tashiroi | Maackia | Fabaceae | |
| Veronica polita | Veronica | Plantaginaceae |
|
| Glycosmis macrophylla | Glycosmis | Rutaceae | |
| Colchicum filifolium | Colchicum | Colchicaceae | |
| Stephania zippeliana | Stephania | Menispermaceae | |
| Cynoglossum macrostylum | Cynoglossum | Boraginaceae | |
| Eucalyptus apodophylla | Eucalyptus | Myrtaceae |
|
| Hypericum polyanthemum | Hypericum | Hypericaceae | |
| Distephanus angulifolius | Distephanus | Asteraceae | |
| Periploca sepium | Periploca | Apocynaceae |
|
| Campylotropis hirtella | Campylotropis | Fabaceae |
|
| Metanarthecium luteoviride | Metanarthecium | Nartheciaceae | |
| Pulsatilla chinensis | Pulsatilla | Ranunculaceae |
|
| Polytrichastrum alpinum | Polytrichastrum | Polytrichaceae | |
| Scutellaria barbata | Scutellaria | Lamiaceae |
|
| Mucuna holtonii | Mucuna | Fabaceae | |
| Quercus marilandica | Quercus | Fagaceae |
|
| Pandanus tectorius | Pandanus | Pandanaceae |
|
| Centaurea scoparia | Centaurea | Asteraceae | |
| Breonia chinensis | Breonia | Rubiaceae |
|
| Turnera diffusa | Turnera | Passifloraceae |
|
| Mimosa pigra | Mimosa | Fabaceae |
|
| Cheilanthes fragrans | Cheilanthes | Pteridaceae |
|
| Fadogia agrestis | Fadogia | Rubiaceae |
|
| Ostrya carpinifolia | Ostrya | Betulaceae |
|
| Aconitum variegatum | Aconitum | Ranunculaceae |
|
| Chrysanthemum indicum | Chrysanthemum | Asteraceae |
|
| Stephania dielsiana | Stephania | Menispermaceae |
|
| Mentha cardiaca | Mentha | Lamiaceae | |
| Alpinia oxyphylla | Alpinia | Zingiberaceae |
|
| Maclura cochinchinensis | Maclura | Moraceae |
|
| Rhodiola semenovii | Rhodiola | Crassulaceae | |
| Lycopodium japonicum | Lycopodium | Lycopodiaceae |
|
| Agave xylonacantha | Agave | Asparagaceae | |
| Angelica saxatilis | Angelica | Apiaceae | |
| Campanula choziatowskyi | Campanula | Campanulaceae | |
| Euphorbia latazi | Euphorbia | Euphorbiaceae | |
| Rosmarinus officinalis | Salvia | Lamiaceae |
|
| Salvia patens | Salvia | Lamiaceae | |
| Dialium excelsum | Dialium | Fabaceae | |
| Euphorbia hylonoma | Euphorbia | Euphorbiaceae | |
| Senecio platyphylloides | Senecio | Asteraceae | |
| Drymaria cordata | Drymaria | Caryophyllaceae |
|
| Boesenbergia pandurata | Boesenbergia | Zingiberaceae |
|
| Helleborus macranthus | Helleborus | Ranunculaceae | |
| Salix rosmarinifolia | Salix | Salicaceae | |
| Heliotropium scabrum | Heliotropium | Heliotropiaceae | |
| Podocarpus dacrydioides | Podocarpus | Podocarpaceae |
|
| Centaurea sonchifolia | Centaurea | Asteraceae | |
| Matricaria sabulosa | Matricaria | Asteraceae | |
| Pterocaulon serrulatum | Pterocaulon | Asteraceae |
|
| Boswellia ovalifoliolata | Boswellia | Burseraceae |
|
| Sarcococca saligna | Sarcococca | Buxaceae |
|
| Hardenbergia violacea | Hardenbergia | Fabaceae |
|
| Lonchocarpus chiricanus | Lonchocarpus | Fabaceae | |
| Astragalus circassicus | Astragalus | Fabaceae | |
| Calophyllum inophyllum | Calophyllum | Calophyllaceae |
|
| Erythrina hypaphorus | Erythrina | Fabaceae | |
| Beilschmiedia madang | Beilschmiedia | Lauraceae |
|
| Salvia lavanduloides | Salvia | Lamiaceae | |
| Rubia akane | Rubia | Rubiaceae |
|
| Aniba santalodora | Aniba | Lauraceae | |
| Mentzelia decapetala | Mentzelia | Loasaceae |
|
| Amorphophallus konjac | Amorphophallus | Araceae |
|
| Oroxylum indicum | Oroxylum | Bignoniaceae |
|
| Afrocarpus gracilior | Afrocarpus | Podocarpaceae | |
| Andrographis herba | Andrographis | Acanthaceae | |
| Derris indica | Derris | Fabaceae |
|
| Anthemis cretica | Anthemis | Asteraceae |
|
| Andrographis paniculata | Andrographis | Acanthaceae |
|
| Crotalaria candicans | Crotalaria | Fabaceae | |
| Salvia virgata | Salvia | Lamiaceae |
|
| Eria japonica | Eria | Orchidaceae | |
| Salvia sessei | Salvia | Lamiaceae | |
| Juniperus drupacea | Juniperus | Cupressaceae |
|
| Petunia axillaris subsp. parodii | Petunia | Solanaceae |
|
| Ceropegia dichotoma | Ceropegia | Apocynaceae |
|
| Ononis spinosa | Ononis | Fabaceae |
|
| Antiphiona pinnatisecta | Antiphiona | Asteraceae | |
| Crinum moorei | Crinum | Amaryllidaceae | |
| Eucalyptus globulus subsp. bicostata | Eucalyptus | Myrtaceae |
|
| Dendrobium loddigesii | Dendrobium | Orchidaceae |
|
| Gypsophila perfoliata | Gypsophila | Caryophyllaceae | |
| Bethencourtia palmensis | Bethencourtia | Asteraceae | |
| Pseudocyclosorus subochthodes | Pseudocyclosorus | Thelypteridaceae | |
| Pterocaulon virgatum | Pterocaulon | Asteraceae |
|
| Lepechinia urbanii | Lepechinia | Lamiaceae | |
| Vernonia cistifolia | Vernonia | Asteraceae | |
| Enicosanthum cupulare | Enicosanthum | Annonaceae | |
| Sonneratia caseolaris | Sonneratia | Lythraceae |
|
| Daphne genkwa | Daphne | Thymelaeaceae |
|
Ingredient ID: NPC269906
Formula: C17H12O6
Ingredient ID: NPC269906
| Common Name | n.a. |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-7-hydroxy-3-methoxychromen-4-one |
| Canonical SMILES | COc1c(oc2c(c1=O)ccc(c2)O)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C17H12O6/c1-20-17-15(19)11-4-3-10(18)7-13(11)23-16(17)9-2-5-12-14(6-9)22-8-21-12/h2-7,18H,8H2,1H3 |
| Standard InCHIKey | ZVVHEMAXIYCVCR-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 13983769 |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC269906] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Derris indica | Derris | Fabaceae |
|
Ingredient ID: NPC263676
Formula: C18H14O4
Ingredient ID: NPC263676
| Common Name | Pongamol |
| IUPAC Name | (Z)-3-hydroxy-1-(4-methoxy-1-benzofuran-5-yl)-3-phenylprop-2-en-1-one |
| Canonical SMILES | COc1c(ccc2c1cco2)C(=O)/C=C(/c1ccccc1)O |
| Standard InCHI | InChI=1S/C18H14O4/c1-21-18-13(7-8-17-14(18)9-10-22-17)16(20)11-15(19)12-5-3-2-4-6-12/h2-11,19H,1H3/b15-11- |
| Standard InCHIKey | IHWPQGIYXJKCOV-PTNGSMBKSA-N |
| Ingredient External Links |
PubChem CID: 5320675 ZINC ID: ZINC000100003085 ChEMBL ID: CHEMBL458131 |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC263676] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Millettia pinnata | Millettia | Fabaceae |
|
| Citrus trifoliata | Citrus | Rutaceae |
|
| Derris indica | Derris | Fabaceae |
|
Ingredient ID: NPC241820
Formula: C17H10O6
Ingredient ID: NPC241820
| Common Name | n.a. |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3-hydroxyfuro[2,3-h]chromen-4-one |
| Canonical SMILES | Oc1cc(ccc1O)c1oc2c(c(=O)c1O)ccc1c2cco1 |
| Standard InCHI | InChI=1S/C17H10O6/c18-11-3-1-8(7-12(11)19)16-15(21)14(20)10-2-4-13-9(5-6-22-13)17(10)23-16/h1-7,18-19,21H |
| Standard InCHIKey | JSFYLRKWLFOVED-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 44537939 |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC241820] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Derris indica | Derris | Fabaceae |
|
Ingredient ID: NPC167479
Formula: C18H10O5
Ingredient ID: NPC167479
| Common Name | Pongaglabrone |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)furo[2,3-h]chromen-4-one |
| Canonical SMILES | O=c1cc(oc2c1ccc1c2cco1)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C18H10O5/c19-13-8-16(10-1-3-15-17(7-10)22-9-21-15)23-18-11(13)2-4-14-12(18)5-6-20-14/h1-8H,9H2 |
| Standard InCHIKey | OLRNTGNFKYRPHW-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 10957726 ZINC ID: ZINC000014677168 ChEMBL ID: CHEMBL583961 |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC167479] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Millettia erythrocalyx | Millettia | Fabaceae |
|
| Derris indica | Derris | Fabaceae |
|
Ingredient ID: NPC157522
Formula: C19H14O6
Ingredient ID: NPC157522
| Common Name | n.a. |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-yl)-3-hydroxy-1-(4-methoxy-1-benzofuran-5-yl)prop-2-en-1-one |
| Canonical SMILES | COc1c(ccc2c1cco2)C(=O)/C=C(/c1ccc2c(c1)OCO2)O |
| Standard InCHI | InChI=1S/C19H14O6/c1-22-19-12(3-5-16-13(19)6-7-23-16)15(21)9-14(20)11-2-4-17-18(8-11)25-10-24-17/h2-9,20H,10H2,1H3/b14-9- |
| Standard InCHIKey | UGTDFAIKXQRVER-ZROIWOOFSA-N |
| Ingredient External Links |
PubChem CID: 10947732 |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC157522] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Derris indica | Derris | Fabaceae |
|
Ingredient ID: NPC148423
Formula: C18H12O4
Ingredient ID: NPC148423
| Common Name | n.a. |
| IUPAC Name | 4-methoxy-7-phenylfuro[3,2-g]chromen-5-one |
| Canonical SMILES | COc1c2c(=O)cc(oc2cc2c1cco2)c1ccccc1 |
| Standard InCHI | InChI=1S/C18H12O4/c1-20-18-12-7-8-21-15(12)10-16-17(18)13(19)9-14(22-16)11-5-3-2-4-6-11/h2-10H,1H3 |
| Standard InCHIKey | QNWOJWLIFBMWKQ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5320607 ZINC ID: ZINC000014657704 |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC148423] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Millettia pinnata | Millettia | Fabaceae |
|
| Strychnos nux-vomica | Strychnos | Loganiaceae |
|
| Derris indica | Derris | Fabaceae |
|
Ingredient ID: NPC127447
Formula: C16H12O4
Ingredient ID: NPC127447
| Common Name | Techtochrysin |
| IUPAC Name | 5-hydroxy-7-methoxy-2-phenylchromen-4-one |
| Canonical SMILES | COc1cc(O)c2c(c1)oc(cc2=O)c1ccccc1 |
| Standard InCHI | InChI=1S/C16H12O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-9,17H,1H3 |
| Standard InCHIKey | IRZVHDLBAYNPCT-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5281954 ZINC ID: ZINC000018136415 ChEMBL ID: CHEMBL164841 |
| Plant-Ingredient Association Reference |
PMID: 19515570 Database: NPASS [NPC127447] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Melaleuca cuticularis | Melaleuca | Myrtaceae | |
| Bellardia viscosa | Bellardia | Orobanchaceae | |
| Garcinia cambogia | Garcinia | Clusiaceae |
|
| Colchicum filifolium | Colchicum | Colchicaceae | |
| Petasites laevigatus | Petasites | Asteraceae |
|
| Cynoglossum macrostylum | Cynoglossum | Boraginaceae | |
| Sphaeranthus confertifolius | Sphaeranthus | Asteraceae | |
| Ornithoglossum viride | Ornithoglossum | Colchicaceae | |
| Schizanthus tricolor | Schizanthus | Solanaceae | |
| Anodendron affine | Anodendron | Apocynaceae |
|
| Hertia cheirifolia | Hertia | Asteraceae | |
| Pulsatilla chinensis | Pulsatilla | Ranunculaceae |
|
| Cedrela salvadorensis | Cedrela | Meliaceae | |
| Phagnalon rupestre | Phagnalon | Asteraceae |
|
| Mucuna holtonii | Mucuna | Fabaceae | |
| Quercus marilandica | Quercus | Fagaceae |
|
| Dalbergia nitidula | Dalbergia | Fabaceae |
|
| Saposhnikovia divaricata | Saposhnikovia | Apiaceae |
|
| Piliostigma thonningii | Piliostigma | Fabaceae |
|
| Centaurea scoparia | Centaurea | Asteraceae | |
| Kopsia lapidilecta | Kopsia | Apocynaceae | |
| Dryopteris arguta | Dryopteris | Dryopteridaceae |
|
| Plenckia populnea | Plenckia | Celastraceae | |
| Aconitum contortum | Aconitum | Ranunculaceae | |
| Uvaria lucida | Uvaria | Annonaceae |
|
| Mimosa pigra | Mimosa | Fabaceae |
|
| Cheilanthes fragrans | Cheilanthes | Pteridaceae |
|
| Neolitsea villosa | Neolitsea | Lauraceae | |
| Fadogia agrestis | Fadogia | Rubiaceae |
|
| Ostrya carpinifolia | Ostrya | Betulaceae |
|
| Crinum giganteum | Crinum | Amaryllidaceae | |
| Aconitum variegatum | Aconitum | Ranunculaceae |
|
| Nuxia sphaerocephala | Nuxia | Stilbaceae |
|
| Saussurea salicifolia | Saussurea | Asteraceae | |
| Stephania dielsiana | Stephania | Menispermaceae |
|
| Pinus aristata | Pinus | Pinaceae |
|
| Alpinia oxyphylla | Alpinia | Zingiberaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Callistemon coccineus | Callistemon | Myrtaceae | |
| Maclura cochinchinensis | Maclura | Moraceae |
|
| Justicia betonica | Justicia | Acanthaceae |
|
| Hypericum reptans | Hypericum | Hypericaceae | |
| Uncaria africana | Uncaria | Rubiaceae |
|
| Strychnos amazonica | Strychnos | Loganiaceae |
|
| Alpinia zerumbet | Alpinia | Zingiberaceae |
|
| Escontria chiotilla | Escontria | Cactaceae |
|
| Rubus laciniatus | Rubus | Rosaceae |
|
| Buglossoides arvensis | Buglossoides | Boraginaceae |
|
| Eucryphia cordifolia | Eucryphia | Cunoniaceae | |
| Buxus hildebrandtii | Buxus | Buxaceae | |
| Drypetes tessmanniana | Drypetes | Putranjivaceae | |
| Pteryxia terebinthina | Pteryxia | Apiaceae | |
| Gratiola officinalis | Gratiola | Plantaginaceae |
|
| Rhizophora tagal | Rhizophora | Rhizophoraceae | |
| Salvia lavandulifolia | Salvia | Lamiaceae |
|
| Echinacea simulata | Echinacea | Asteraceae | |
| Cotinus coggygria | Cotinus | Anacardiaceae |
|
| Grindelia discoidea | Grindelia | Asteraceae | |
| Eremurus chinensis | Eremurus | Asphodelaceae | |
| Pachygone dasycarpa | Pachygone | Menispermaceae | |
| Croton geayi | Croton | Euphorbiaceae | |
| Callicarpa acuminata | Callicarpa | Lamiaceae |
|
| Ageratum mexicanum | Ageratum | Asteraceae | |
| Petunia nyctaginiflora | Petunia | Solanaceae |
|
| Arnica parryi | Arnica | Asteraceae | |
| Kalanchoe spathulata | Kalanchoe | Crassulaceae |
|
| Campanula choziatowskyi | Campanula | Campanulaceae | |
| Salvia patens | Salvia | Lamiaceae | |
| Dialium excelsum | Dialium | Fabaceae | |
| Kniphofia foliosa | Kniphofia | Asphodelaceae |
|
| Euphorbia hylonoma | Euphorbia | Euphorbiaceae | |
| Senecio platyphylloides | Senecio | Asteraceae | |
| Drymaria cordata | Drymaria | Caryophyllaceae |
|
| Boesenbergia pandurata | Boesenbergia | Zingiberaceae |
|
| Helleborus macranthus | Helleborus | Ranunculaceae | |
| Salix rosmarinifolia | Salix | Salicaceae | |
| Heliotropium scabrum | Heliotropium | Heliotropiaceae | |
| Podocarpus dacrydioides | Podocarpus | Podocarpaceae |
|
| Centaurea sonchifolia | Centaurea | Asteraceae | |
| Matricaria sabulosa | Matricaria | Asteraceae | |
| Pterocaulon serrulatum | Pterocaulon | Asteraceae |
|
| Mimusops laurifolia | Mimusops | Sapotaceae |
|
| Boswellia ovalifoliolata | Boswellia | Burseraceae |
|
| Hardenbergia violacea | Hardenbergia | Fabaceae |
|
| Lonchocarpus chiricanus | Lonchocarpus | Fabaceae | |
| Salvia pisidica | Salvia | Lamiaceae |
|
| Astragalus circassicus | Astragalus | Fabaceae | |
| Erythrina hypaphorus | Erythrina | Fabaceae | |
| Beilschmiedia madang | Beilschmiedia | Lauraceae |
|
| Pentachondra pumila | Pentachondra | Ericaceae |
|
| Salvia lavanduloides | Salvia | Lamiaceae | |
| Ursinia speciosa | Ursinia | Asteraceae | |
| Rubia akane | Rubia | Rubiaceae |
|
| Anacyclus pyrethrum | Anacyclus | Asteraceae |
|
| Brachylaena perrieri | Brachylaena | Asteraceae | |
| Aniba santalodora | Aniba | Lauraceae | |
| Diplotropis ferruginea | Diplotropis | Fabaceae | |
| Viguiera pinnatilobata | Viguiera | Asteraceae | |
| Phlomis ostrowskiana | Phlomis | Lamiaceae | |
| Mentzelia decapetala | Mentzelia | Loasaceae |
|
| Uncaria longiflora | Uncaria | Rubiaceae |
|
| Pimpinella peregrina | Pimpinella | Apiaceae |
|
| Amorphophallus konjac | Amorphophallus | Araceae |
|
| Medicosma fareana | Medicosma | Rutaceae | |
| Solanum crinitum | Solanum | Solanaceae | |
| Mentha sylvestris | Mentha | Lamiaceae |
|
| Euphrasia regelii | Euphrasia | Orobanchaceae |
|
| Hortonia angustifolia | Hortonia | Monimiaceae | |
| Julbernardia globifera | Julbernardia | Fabaceae | |
| Oroxylum indicum | Oroxylum | Bignoniaceae |
|
| Phlox decussata | Phlox | Polemoniaceae | |
| Tubocapsicum anomalum | Tubocapsicum | Solanaceae |
|
| Cuscuta australis | Cuscuta | Convolvulaceae |
|
| Aster tataricus | Aster | Asteraceae |
|
| Salvia lanigera | Salvia | Lamiaceae |
|
| Othonna macrophylla | Othonna | Asteraceae | |
| Miliusa balansae | Miliusa | Annonaceae | |
| Eucalyptus viminalis | Eucalyptus | Myrtaceae |
|
| Laggera pterodonta | Laggera | Asteraceae |
|
| Acronychia haplophylla | Acronychia | Rutaceae |
|
| Salix petiolaris | Salix | Salicaceae | |
| Scutellaria baicalensis | Scutellaria | Lamiaceae |
|
| Pinus monticola | Pinus | Pinaceae |
|
| Myrrhis odorata | Myrrhis | Apiaceae |
|
| Pinus excelsa | Pinus | Pinaceae |
|
| Alstonia spectabilis | Alstonia | Apocynaceae |
|
| Derris indica | Derris | Fabaceae |
|
| Salvia virgata | Salvia | Lamiaceae |
|
| Rubia tetragona | Rubia | Rubiaceae | |
| Vachellia pennatula | Vachellia | Fabaceae |
|
| Petunia axillaris subsp. parodii | Petunia | Solanaceae |
|
| Ormosia hosiei | Ormosia | Fabaceae |
|
| Elettaria cardamomum | Elettaria | Zingiberaceae |
|
| Bethencourtia palmensis | Bethencourtia | Asteraceae | |
| Lepechinia urbanii | Lepechinia | Lamiaceae | |
| Licaria chrysophylla | Licaria | Lauraceae | |
| Hippocrepis emerus | Hippocrepis | Fabaceae | |
| Oricia gabonensis | Oricia | Rutaceae |
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC127447 | C16H12O4 | Techtochrysin | 268.07 | -1.0157 | 2.78 | 3.682 | 1 | 1 | 55.76 | 4 | 3 | 20 | 0 |
| NPC148423 | C18H12O4 | 292.0735589 | -0.7095 | 3 | 4.284 | 1 | 0 | 48.67 | 3 | 4 | 22 | 0 | |
| NPC157522 | C19H14O6 | 338.0790382 | -0.9744 | 2.89 | 2.833 | 2 | 1 | 78.13 | 6 | 4 | 25 | 0 | |
| NPC167479 | C18H10O5 | Pongaglabrone | 306.05 | -0.9604 | 2.89 | 3.134 | 1 | 0 | 57.9 | 1 | 5 | 23 | 0 |
| NPC241820 | C17H10O6 | 310.047738 | -2.0347 | 2.67 | 2.946 | 2 | 3 | 100.13 | 4 | 4 | 23 | 0 | |
| NPC263676 | C18H14O4 | Pongamol | 294.09 | -0.6717 | 3 | 4.427 | 2 | 1 | 59.67 | 6 | 3 | 22 | 0 |
| NPC269906 | C17H12O6 | 312.0633881 | -1.6585 | 2.67 | 2.772 | 2 | 1 | 74.22 | 4 | 4 | 23 | 0 | |
| NPC29353 | C17H14O5 | 298.0841235 | -1.0675 | 2.78 | 2.605 | 1 | 1 | 64.99 | 6 | 3 | 22 | 0 | |
| NPC299923 | C19H18O6 | Fisetin Tetramethyl Ether | 342.11 | -1.0509 | 2.89 | 3.364 | 2 | 0 | 63.22 | 9 | 3 | 25 | 0 |
| NPC302741 | C22H18O6 | 378.1103383 | -0.2904 | 3.22 | 4.172 | 2 | 0 | 63.22 | 5 | 5 | 28 | 0 | |
| NPC38914 | C17H10O5 | 294.0528234 | -1.5783 | 2.78 | 2.598 | 1 | 2 | 79.9 | 3 | 4 | 22 | 0 | |
| NPC41719 | C18H12O4 | Karanjin | 292.07 | -1.0496 | 3 | 4.968 | 2 | 0 | 48.67 | 3 | 4 | 22 | 0 |
| NPC45404 | C8H6O4 | Piperonylic Acid | 166.03 | -0.5425 | 1.9 | 1.072 | 2 | 1 | 55.76 | 2 | 2 | 12 | 0 |
| NPC476342 | C24H28O6 | 412.19 | 1.2367 | 3.44 | 3.48 | 1 | 0 | 63.22 | 13 | 3 | 30 | 0 | |
| NPC62640 | C19H12O6 | 336.0633881 | -1.3523 | 2.89 | 3.374 | 2 | 0 | 67.13 | 3 | 5 | 25 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
