NPASS Compound

Natural Product: NPC179144

Natural Product ID	NPC179144
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	XGYNVBAFYOIJRP-FRGGILKTSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	21670028
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 152161 0 0 0 0 0 0 0 0999 V2000 15.7090 0.5092 1.4411 C 0 0 0 0 0 0 0 0 0 0 0 0 14.4197 0.5186 0.6646 C 0 0 2 0 0 0 0 0 0 0 0 0 13.4653 1.5979 1.1244 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2514 1.5593 0.2319 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6640 0.1697 0.1280 C 0 0 2 0 0 0 0 0 0 0 0 0 10.6998 0.1571 -1.0398 C 0 0 1 0 0 0 0 0 0 0 0 0 11.3055 -0.6277 -2.2106 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5620 -0.6322 -0.5023 C 0 0 1 0 0 0 0 0 0 0 0 0 9.9730 -1.0819 0.8997 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7251 -0.9826 1.7640 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6551 -0.7769 0.7691 C 0 0 1 0 0 0 0 0 0 0 0 0 6.3360 -0.2631 1.2873 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7848 -1.3401 2.1788 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3360 -1.2465 2.3391 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5486 -0.5386 1.5546 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0857 -0.5233 1.8185 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3183 -1.1263 0.6627 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2757 -1.2539 -0.5014 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0972 -0.0200 -0.7440 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0492 0.2518 0.3974 C 0 0 1 0 0 0 0 0 0 0 0 0 3.9202 1.7166 0.7544 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4682 -0.1242 0.0557 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0744 0.8391 -0.9407 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4190 0.3281 -1.3831 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3173 0.1698 -0.2083 C 0 0 2 0 0 0 0 0 0 0 0 0 8.6215 1.4792 0.4688 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2213 -0.3676 0.3915 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9859 -1.0546 0.4789 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9432 -0.5626 1.4887 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0977 0.2462 1.0152 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.5178 -0.1532 -0.3504 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.2660 -0.1602 -1.2307 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5902 1.1671 -1.2985 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5215 2.1040 -1.7268 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4548 -1.2050 -0.8114 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5161 0.5764 -0.9319 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5561 -0.2272 -1.3620 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8562 0.0226 -0.6229 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4793 1.3431 -0.9904 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7044 1.9325 -2.1782 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5340 0.8235 -3.1798 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9603 1.3678 -4.4832 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9275 0.3403 -5.4109 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7208 -0.1922 -2.7452 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5379 2.8984 -2.7409 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5637 2.2484 0.0450 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8369 2.6922 0.2874 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.3617 2.4506 1.6626 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.8835 2.5662 1.5668 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.3009 3.7861 0.8153 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.3778 4.2238 -0.2699 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0245 4.0499 0.0125 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.5433 3.4992 0.2059 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.4774 2.5315 2.8094 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0480 1.1535 2.0463 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7375 -0.9779 -1.0348 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1541 -1.8163 -0.0032 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6322 -1.6684 0.1185 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.3302 -2.7686 -0.6601 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.8980 -4.0900 -0.0590 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5057 -3.9812 0.5387 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8703 -5.3551 0.6629 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7052 -5.8180 -0.6611 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7027 -3.1147 -0.1854 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8334 -4.4436 0.9107 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9907 -2.6373 -1.9881 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0061 -1.7166 1.4651 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8952 1.6197 1.1500 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4765 -1.6849 2.1761 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9698 -0.2101 1.2549 O 0 0 0 0 0 0 0 0 0 0 0 0 12.6443 -0.7783 -0.1254 O 0 0 0 0 0 0 0 0 0 0 0 0 13.6651 -0.7991 0.7996 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8595 -0.4254 2.0101 H 0 0 0 0 0 0 0 0 0 0 0 0 16.5464 0.6067 0.6945 H 0 0 0 0 0 0 0 0 0 0 0 0 15.8093 1.4192 2.0838 H 0 0 0 0 0 0 0 0 0 0 0 0 14.5969 0.6684 -0.4343 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1620 1.3536 2.1584 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9189 2.6069 1.0290 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4532 2.2341 0.5435 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5914 1.8300 -0.7972 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4575 1.1477 -1.4247 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9937 -1.4106 -1.8236 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9287 0.0773 -2.7974 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5215 -1.0356 -2.8746 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2480 -1.4886 -1.1228 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3287 -2.1347 0.8230 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5813 -1.9814 2.2584 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8060 -0.2492 2.5642 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4509 -1.7294 0.2354 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4500 0.6981 1.8233 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3319 -1.3935 3.1503 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9794 -2.3173 1.6398 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8977 -1.8183 3.1861 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7926 0.5481 1.9880 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8512 -1.0321 2.7893 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0732 -2.1812 0.9505 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 -2.0651 -0.2158 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7910 -1.5945 -1.4295 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7038 -0.2397 -1.6660 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4709 0.8479 -1.0122 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8380 1.9306 0.9101 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5032 1.9858 1.6568 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2098 2.3687 -0.1203 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4369 -1.1186 -0.4328 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1371 1.8681 -0.5711 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4093 0.8509 -1.8270 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8470 1.0486 -2.1167 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2484 -0.6672 -1.8421 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2380 1.3548 1.3553 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6724 1.9462 0.7681 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1268 2.1741 -0.2150 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6781 -2.1070 0.7770 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3654 -0.0303 2.2856 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9758 0.0278 1.6935 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8232 -1.2362 -0.3283 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6196 -0.4183 -2.2497 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1364 1.5194 -0.3757 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7965 1.0801 -2.0920 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3176 3.0075 -1.3978 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2864 -1.2854 -1.1164 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6268 0.0140 0.4403 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5294 1.2079 -1.3804 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7718 2.4003 -1.8695 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5743 0.4670 -3.4395 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9193 1.7243 -4.3439 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6339 2.1556 -4.8522 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7091 0.4169 -6.0061 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3993 3.7931 -2.3499 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5251 2.1678 -0.4393 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9798 3.1915 2.4098 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2171 1.6681 0.9930 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4908 4.6374 1.4967 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6341 5.2619 -0.5458 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5832 3.5695 -1.1613 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2670 4.0851 0.5322 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5420 3.4534 3.1891 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2672 1.1114 2.6534 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6744 -1.4547 0.9292 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9393 -0.6534 -0.2502 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4137 -2.6538 -0.4907 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9537 -4.8535 -0.8629 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6125 -3.5785 1.5629 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5565 -6.0789 1.1438 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9358 -5.3407 1.2172 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9621 -6.4629 -0.7336 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7444 -4.2072 0.5985 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9588 -3.5164 -2.4432 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9147 -1.3259 1.5891 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0196 1.8391 2.1248 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8456 -2.3505 1.5738 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3156 -0.9568 1.8337 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3647 -1.5913 0.5208 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 40 45 1 0 39 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 50 53 1 0 49 54 1 0 48 55 1 0 38 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 61 64 1 0 60 65 1 0 59 66 1 0 58 67 1 0 30 68 1 0 29 69 1 0 9 70 1 0 5 71 1 6 71 72 1 0 72 2 1 0 70 5 1 0 25 8 1 0 35 28 1 0 44 37 1 0 52 47 1 0 64 57 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 73 1 0 1 74 1 0 1 75 1 0 2 76 1 6 3 77 1 0 3 78 1 0 4 79 1 0 4 80 1 0 6 81 1 6 7 82 1 0 7 83 1 0 7 84 1 0 8 85 1 6 9 86 1 6 10 87 1 0 10 88 1 0 11 89 1 6 12 90 1 1 13 91 1 0 13 92 1 0 14 93 1 0 16 94 1 0 16 95 1 0 17 96 1 1 18 97 1 0 18 98 1 0 19 99 1 0 19100 1 0 21101 1 0 21102 1 0 21103 1 0 22104 1 6 23105 1 0 23106 1 0 24107 1 0 24108 1 0 26109 1 0 26110 1 0 26111 1 0 28112 1 1 29113 1 1 30114 1 1 31115 1 1 32116 1 6 33117 1 0 33118 1 0 34119 1 0 37120 1 6 38121 1 1 39122 1 6 40123 1 1 41124 1 6 42125 1 0 42126 1 0 43127 1 0 45128 1 0 47129 1 6 48130 1 1 49131 1 6 50132 1 1 51133 1 0 51134 1 0 53135 1 0 54136 1 0 55137 1 0 57138 1 1 58139 1 6 59140 1 6 60141 1 6 61142 1 1 62143 1 0 62144 1 0 63145 1 0 65146 1 0 66147 1 0 67148 1 0 68149 1 0 69150 1 0 72151 1 0 72152 1 0 M END

Standard InCHIKey	XGYNVBAFYOIJRP-FRGGILKTSA-N
Standard InCHI	InChI=1S/C50H80O22/c1-20-7-12-50(64-18-20)21(2)32-28(72-50)14-26-24-6-5-22-13-23(8-10-48(22,3)25(24)9-11-49(26,32)4)65-45-40(62)37(59)41(31(17-53)68-45)69-47-43(71-46-39(61)36(58)34(56)29(15-51)66-46)42(35(57)30(16-52)67-47)70-44-38(60)33(55)27(54)19-63-44/h5,20-21,23-47,51-62H,6-19H2,1-4H3/t20-,21+,23+,24-,25+,26+,27-,28+,29-,30-,31-,32+,33+,34-,35-,36+,37-,38-,39-,40-,41+,42+,43-,44+,45-,46+,47+,48+,49+,50-/m1/s1
SMILES	C[C@@H]1CC[C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@H](CC[C@]6(C)[C@H]5CC[C@]34C)O[C@H]3[C@@H]([C@H]([C@H]([C@@H](CO)O3)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O[C@H]3[C@@H]([C@H]([C@@H](CO3)O)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1032.51	Volume:	978.54 ? Van der Waals volume.
Dense:	1.055	LogP:	1.34 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.203 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.257 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	54.0
TPSA:	335.06 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	12.0	Rings:	10.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.096	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.143	Fsp³:	0.96
MCE-18:	257.061 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.698	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.303	Promiscuous compounds:	0.008

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.642	MDCK Permeability:	-5.101
Pgp-inhibitor:	0.0	Pgp-substrate:	0.888
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.118
20% Bioavailability (F20%):	0.234	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.005
Plasma Protein Binding (PPB):	49.499%	Volume Distribution (VD):	-0.419
Fu:	38.438% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.116
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.822	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.74
HLM stability:	0.026 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.09

Half-life (T1/2):

2.976

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.005
Human Hepatotoxicity (H-HT):	0.533	Drug-induced Liver Injury (DILI):	0.991
AMES Toxicity:	0.99	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.068	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.505	Drug-induced Nephrotoxicity:	0.956
Genotoxicity:	0.004	RPMI-8226 Immunitoxicity:	0.416
A549 Cytotoxicity:	0.989	Hek293 Cytotoxicity:	0.949
BCF:	1.387 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.321 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.474 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.737 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO2237	Solanum lyratum	Species	Solanaceae	Eukaryota	n.a.	whole plant	n.a.	PMID[19336938]
NPO2237	Solanum lyratum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO2237	Solanum lyratum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO2237	Solanum lyratum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO2237	Solanum lyratum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO2009	Geranium rectum	Species	Geraniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO3133	Crotalaria saltiana	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO2237	Solanum lyratum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC179144 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24393
0.1-0.2	21937
0.2-0.3	2627
0.3-0.4	655
0.4-0.5	78
0.5-0.6	77
0.6-0.7	51
0.7-0.8	0
0.8-0.85	7
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8762	High Similarity	NPC31896
0.8667	High Similarity	NPC477811
0.8214	Intermediate Similarity	NPC210569
0.8155	Intermediate Similarity	NPC300557
0.8	Intermediate Similarity	NPC97700
0.8	Intermediate Similarity	NPC305771
0.8	Intermediate Similarity	NPC30856
0.8	Intermediate Similarity	NPC94072
0.8	Intermediate Similarity	NPC169816
0.7961	Intermediate Similarity	NPC602423
0.7885	Intermediate Similarity	NPC477809
0.7739	Intermediate Similarity	NPC15918
0.7647	Intermediate Similarity	NPC470432
0.7647	Intermediate Similarity	NPC230507
0.7615	Intermediate Similarity	NPC309278
0.7542	Intermediate Similarity	NPC263359
0.75	Intermediate Similarity	NPC132080
0.75	Intermediate Similarity	NPC477808
0.7477	Intermediate Similarity	NPC6806
0.7455	Intermediate Similarity	NPC475333
0.7455	Intermediate Similarity	NPC224098
0.7455	Intermediate Similarity	NPC208383
0.7449	Intermediate Similarity	NPC181845
0.7297	Intermediate Similarity	NPC116756
0.7273	Intermediate Similarity	NPC115165
0.7265	Intermediate Similarity	NPC477807
0.7264	Intermediate Similarity	NPC475351
0.725	Intermediate Similarity	NPC244431
0.7232	Intermediate Similarity	NPC232037
0.7179	Intermediate Similarity	NPC480556
0.7143	Intermediate Similarity	NPC473518
0.7105	Intermediate Similarity	NPC476112
0.7105	Intermediate Similarity	NPC307534
0.7091	Intermediate Similarity	NPC480555
0.7091	Intermediate Similarity	NPC150372
0.7069	Intermediate Similarity	NPC232054
0.7043	Intermediate Similarity	NPC233433
0.7	Intermediate Similarity	NPC79900
0.6903	Remote Similarity	NPC475550
0.6875	Remote Similarity	NPC184617
0.6864	Remote Similarity	NPC470866
0.6818	Remote Similarity	NPC470433
0.6818	Remote Similarity	NPC46190
0.6818	Remote Similarity	NPC171073
0.678	Remote Similarity	NPC167183
0.6754	Remote Similarity	NPC269297
0.6754	Remote Similarity	NPC222202
0.6752	Remote Similarity	NPC480553
0.6727	Remote Similarity	NPC473601
0.6724	Remote Similarity	NPC218571
0.6724	Remote Similarity	NPC487615
0.6697	Remote Similarity	NPC113044
0.6697	Remote Similarity	NPC283829
0.6697	Remote Similarity	NPC14704
0.6697	Remote Similarity	NPC161676
0.6667	Remote Similarity	NPC250393
0.6639	Remote Similarity	NPC220836
0.6638	Remote Similarity	NPC194207
0.6638	Remote Similarity	NPC22779
0.6638	Remote Similarity	NPC232611
0.6604	Remote Similarity	NPC206003
0.6604	Remote Similarity	NPC473610
0.6581	Remote Similarity	NPC480554
0.6549	Remote Similarity	NPC249553
0.6549	Remote Similarity	NPC51172
0.6549	Remote Similarity	NPC49032
0.6441	Remote Similarity	NPC470864
0.6423	Remote Similarity	NPC473505
0.6423	Remote Similarity	NPC224314
0.641	Remote Similarity	NPC475625
0.64	Remote Similarity	NPC32707
0.6393	Remote Similarity	NPC94086
0.6393	Remote Similarity	NPC473817
0.6387	Remote Similarity	NPC83137
0.6381	Remote Similarity	NPC325828
0.6379	Remote Similarity	NPC475319
0.6341	Remote Similarity	NPC248202
0.6333	Remote Similarity	NPC256983
0.6316	Remote Similarity	NPC248746
0.6293	Remote Similarity	NPC102016
0.6293	Remote Similarity	NPC95051
0.6142	Remote Similarity	NPC208832
0.6126	Remote Similarity	NPC107962
0.6083	Remote Similarity	NPC197003
0.6068	Remote Similarity	NPC151134
0.6017	Remote Similarity	NPC98018
0.6017	Remote Similarity	NPC284104
0.6017	Remote Similarity	NPC103616
0.6	Remote Similarity	NPC32361
0.5983	Remote Similarity	NPC42171
0.5983	Remote Similarity	NPC182900
0.5929	Remote Similarity	NPC125324
0.5902	Remote Similarity	NPC249265
0.5882	Remote Similarity	NPC294129
0.5868	Remote Similarity	NPC13193
0.5854	Remote Similarity	NPC470862
0.5821	Remote Similarity	NPC330026
0.5804	Remote Similarity	NPC107188
0.5798	Remote Similarity	NPC150057
0.5798	Remote Similarity	NPC128572
0.5798	Remote Similarity	NPC147753
0.5797	Remote Similarity	NPC481189
0.5772	Remote Similarity	NPC108072
0.575	Remote Similarity	NPC308459
0.5748	Remote Similarity	NPC190939
0.5693	Remote Similarity	NPC329807
0.568	Remote Similarity	NPC84111
0.568	Remote Similarity	NPC287483
0.568	Remote Similarity	NPC470865
0.5643	Remote Similarity	NPC329727
0.5547	Remote Similarity	NPC262050
0.5537	Remote Similarity	NPC475182
0.5528	Remote Similarity	NPC247037
0.5517	Remote Similarity	NPC6295
0.5515	Remote Similarity	NPC481190
0.5492	Remote Similarity	NPC73243
0.5492	Remote Similarity	NPC244086
0.5492	Remote Similarity	NPC84956
0.5476	Remote Similarity	NPC23808
0.5476	Remote Similarity	NPC87998
0.547	Remote Similarity	NPC141433
0.5455	Remote Similarity	NPC471464
0.5447	Remote Similarity	NPC51520
0.5447	Remote Similarity	NPC303069
0.5446	Remote Similarity	NPC234352
0.5437	Remote Similarity	NPC100451
0.5433	Remote Similarity	NPC92297
0.5426	Remote Similarity	NPC470867
0.5424	Remote Similarity	NPC305423
0.5424	Remote Similarity	NPC160426
0.539	Remote Similarity	NPC329820
0.5372	Remote Similarity	NPC92890
0.5357	Remote Similarity	NPC297348
0.5357	Remote Similarity	NPC249204
0.5357	Remote Similarity	NPC48339
0.5357	Remote Similarity	NPC177834
0.5357	Remote Similarity	NPC141769
0.5357	Remote Similarity	NPC477547
0.5315	Remote Similarity	NPC485594
0.528	Remote Similarity	NPC470863
0.5271	Remote Similarity	NPC308140
0.5259	Remote Similarity	NPC211354
0.5259	Remote Similarity	NPC19400
0.5254	Remote Similarity	NPC15249
0.5254	Remote Similarity	NPC25455
0.5242	Remote Similarity	NPC475247
0.521	Remote Similarity	NPC70204
0.5207	Remote Similarity	NPC98696
0.5203	Remote Similarity	NPC48886
0.5203	Remote Similarity	NPC124677
0.5203	Remote Similarity	NPC94881
0.5172	Remote Similarity	NPC121453
0.5149	Remote Similarity	NPC273002
0.513	Remote Similarity	NPC477451
0.5126	Remote Similarity	NPC94272
0.5126	Remote Similarity	NPC485595
0.5096	Remote Similarity	NPC235126
0.5096	Remote Similarity	NPC242419
0.5086	Remote Similarity	NPC86020
0.5085	Remote Similarity	NPC264101
0.5083	Remote Similarity	NPC195297
0.5082	Remote Similarity	NPC42482
0.5082	Remote Similarity	NPC40440
0.5049	Remote Similarity	NPC207617
0.5049	Remote Similarity	NPC607440
0.504	Remote Similarity	NPC156789

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC179144 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7680
0.1-0.2	1383
0.2-0.3	79
0.3-0.4	4
0.4-0.5	1
0.5-0.6	2
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6381	Remote Similarity	NPD8171	Phase 2
0.5798	Remote Similarity	NPD8450	Suspended
0.5789	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data