NPASS Compound

Natural Product: NPC162542

Natural Product ID	NPC162542
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	AHIONNAGCSGVAB-PTCKUGFYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	6325134
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 118124 0 0 0 0 0 0 0 0999 V2000 10.8887 2.0347 1.0033 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6658 2.2895 -0.4866 C 0 0 1 0 0 0 0 0 0 0 0 0 11.5512 1.3482 -1.2404 C 0 0 2 0 0 0 0 0 0 0 0 0 11.0159 -0.0560 -1.0798 C 0 0 2 0 0 0 0 0 0 0 0 0 9.5906 -0.0195 -1.6408 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7806 0.9588 -0.8344 C 0 0 1 0 0 0 0 0 0 0 0 0 9.3321 2.2016 -0.7414 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4841 0.9623 -1.3383 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5370 0.4969 -0.4687 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4473 1.5277 -0.1893 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2070 1.1178 -0.6948 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7384 0.1001 0.1486 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7407 -1.0013 0.1508 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8161 -0.7531 -0.9185 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1046 -0.4245 -2.0899 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4461 -1.0457 1.3688 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4562 -0.2919 -0.1272 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5397 0.0086 0.9043 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5461 1.0464 0.4346 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4227 0.4863 -0.5872 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0423 -0.8113 -0.2173 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4511 -1.8261 -1.2246 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5909 -1.3344 1.1385 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3186 -0.7415 2.2932 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5233 0.0793 1.9415 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3479 -0.5934 0.8586 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8240 -1.8861 1.5499 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5373 -0.9145 -0.3504 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0412 -0.3097 -1.6299 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5170 -0.2208 -1.6806 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2880 0.0276 -0.6263 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7387 0.0874 -0.8170 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3083 1.4808 -0.9166 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7641 1.4652 -1.3124 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8846 1.4933 -2.8260 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4153 2.7693 -0.8308 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4814 0.2671 -0.8089 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8751 -0.3278 0.4092 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4096 -0.7495 0.2267 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7308 -0.7846 1.5537 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5916 0.1476 1.7413 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5806 0.2308 0.6521 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1090 1.6972 0.6412 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5009 -2.1301 -0.3314 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0145 -3.1462 0.1943 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1804 -2.2891 -1.5284 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8762 -1.2436 1.3879 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6339 -2.4865 0.8949 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0782 -1.2754 2.9141 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1140 -1.3037 -1.5831 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0074 -0.4108 0.2601 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8554 1.3589 -0.7999 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1137 1.3900 1.4465 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8707 1.5450 1.1941 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9242 2.9904 1.5669 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0806 3.3126 -0.6577 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4958 1.6339 -2.3134 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5980 -0.7892 -1.6758 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7026 0.2926 -2.6993 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7355 0.5461 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0737 0.2145 0.4803 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7555 2.5156 -0.5588 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3349 1.5781 0.9130 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7351 0.5774 1.1725 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3504 -1.9967 -0.0389 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4471 -1.6293 -1.0426 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6471 -1.2211 -2.4317 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8172 -1.1492 2.1218 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1424 0.5090 1.6915 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0442 1.5093 1.3076 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1302 1.8546 -0.0534 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1164 1.3231 -0.7916 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1933 0.4476 -1.5416 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2038 -1.9988 -2.0086 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4396 -1.4390 -1.7279 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2967 -2.8124 -0.7426 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7609 -2.4569 1.0653 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6949 -0.0861 2.9454 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6842 -1.5819 2.9478 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2849 1.1336 1.7234 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1586 0.1159 2.8735 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0001 -2.6126 1.6925 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4694 -2.3655 0.7837 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2575 -1.7275 2.5250 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7117 -2.0299 -0.5320 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7676 -0.9531 -2.5186 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6417 0.6732 -1.8911 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0228 -0.3644 -2.6472 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0071 -0.3823 -1.8137 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2505 2.0818 -0.0143 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7512 2.0094 -1.7170 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8391 0.9723 -3.1085 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0045 1.0203 -3.3104 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9557 2.5245 -3.2218 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6476 3.5570 -0.9821 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6727 2.7443 0.2252 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3145 3.0029 -1.4316 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5122 0.6241 -0.4999 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6012 -0.4619 -1.6333 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4996 -1.2060 0.7091 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9432 0.3873 1.2554 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5043 -0.4871 2.3300 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5427 -1.8436 1.8280 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0675 1.1778 1.8337 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1885 0.0043 2.7629 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2119 1.8712 0.0763 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8931 2.3527 0.1585 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0817 2.0860 1.7019 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4523 -3.1760 -1.9192 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5967 -2.5944 1.4838 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0824 -3.4027 1.1125 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9809 -2.3704 -0.1521 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2815 -1.8009 3.4347 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2930 -0.2431 3.3037 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0276 -1.8351 3.1712 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5258 -1.8445 -2.2891 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4253 -1.2955 0.4207 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2034 2.2722 -0.7246 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 13 16 1 0 12 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 6 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 1 26 28 1 0 28 29 1 0 29 30 1 0 30 31 2 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 34 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 39 44 1 6 44 45 2 0 44 46 1 0 23 47 1 0 47 48 1 0 47 49 1 0 5 50 1 0 4 51 1 0 3 52 1 0 7 2 1 0 14 9 1 0 47 18 1 0 28 21 1 0 42 31 1 0 42 26 1 0 39 32 1 0 1 53 1 0 1 54 1 0 1 55 1 0 2 56 1 1 3 57 1 6 4 58 1 6 5 59 1 6 6 60 1 1 9 61 1 1 10 62 1 0 10 63 1 0 12 64 1 1 13 65 1 6 14 66 1 6 15 67 1 0 16 68 1 0 18 69 1 1 19 70 1 0 19 71 1 0 20 72 1 0 20 73 1 0 22 74 1 0 22 75 1 0 22 76 1 0 23 77 1 0 24 78 1 0 24 79 1 0 25 80 1 0 25 81 1 0 27 82 1 0 27 83 1 0 27 84 1 0 28 85 1 0 29 86 1 0 29 87 1 0 30 88 1 0 32 89 1 6 33 90 1 0 33 91 1 0 35 92 1 0 35 93 1 0 35 94 1 0 36 95 1 0 36 96 1 0 36 97 1 0 37 98 1 0 37 99 1 0 38100 1 0 38101 1 0 40102 1 0 40103 1 0 41104 1 0 41105 1 0 43106 1 0 43107 1 0 43108 1 0 46109 1 0 48110 1 0 48111 1 0 48112 1 0 49113 1 0 49114 1 0 49115 1 0 50116 1 0 51117 1 0 52118 1 0 M END

Standard InCHIKey	AHIONNAGCSGVAB-PTCKUGFYSA-N
Standard InCHI	InChI=1S/C41H66O11/c1-21-28(42)30(44)32(46)34(50-21)51-24-20-49-33(31(45)29(24)43)52-27-12-13-38(6)25(37(27,4)5)11-14-40(8)26(38)10-9-22-23-19-36(2,3)15-17-41(23,35(47)48)18-16-39(22,40)7/h9,21,23-34,42-46H,10-20H2,1-8H3,(H,47,48)/t21-,23-,24-,25?,26?,27-,28+,29-,30+,31+,32+,33-,34-,38-,39?,40+,41-/m0/s1
SMILES	C[C@H]1[C@H]([C@H]([C@H]([C@@H](O1)O[C@H]1CO[C@H]([C@@H]([C@H]1O)O)O[C@H]1CC[C@@]2(C)C(CC[C@]3(C)C2CC=C2[C@@H]4CC(C)(C)CC[C@@]4(CCC32C)C(=O)O)C1(C)C)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	734.46	Volume:	749.216 ? Van der Waals volume.
Dense:	0.98	LogP:	3.169 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.43 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.296 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	5.0	Rigid Bonds:	39.0
TPSA:	175.37 ? Topological Polar Surface Area.	H-Bond Acceptor:	11.0
H-Bond Donor:	6.0	Rings:	7.0
Heavy Atoms:	11.0

MedChem Properties

QED Drug-Likeness Score:	0.173	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.673	Fsp³:	0.927
MCE-18:	149.013 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.972	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.01 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.004 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.163	Promiscuous compounds:	0.098

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.669	MDCK Permeability:	-5.15
Pgp-inhibitor:	0.0	Pgp-substrate:	0.03
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.004
20% Bioavailability (F20%):	0.158	30% Bioavailability (F30%):	0.069
50% Bioavailability (F50%):	0.996

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.724
Plasma Protein Binding (PPB):	83.539%	Volume Distribution (VD):	-0.445
Fu:	12.261% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.951	BCRP inhibitor:	0.0
BSEP inhibitor:	0.62

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.001	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.001	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.002	CYP3A4-substrate:	0.231
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.076
HLM stability:	0.055 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.366

Half-life (T1/2):

2.614

ADMET: Toxicity

hERG Blockers:	0.022	hERG Blockers (10um):	0.136
Human Hepatotoxicity (H-HT):	0.846	Drug-induced Liver Injury (DILI):	0.912
AMES Toxicity:	0.378	Rat Oral Acute Toxicity:	0.196
Maximum Recommended Daily Dose:	0.169	Skin Sensitization:	0.991
Carcinogencity:	0.223	Eye Corrosion:	0.0
Eye Irritation:	0.078	Respiratory Toxicity:	0.275
Drug-induced Neurotoxicity:	0.044	Ototoxicity:	0.968
Hematotoxicity:	0.347	Drug-induced Nephrotoxicity:	0.93
Genotoxicity:	0.664	RPMI-8226 Immunitoxicity:	0.107
A549 Cytotoxicity:	0.448	Hek293 Cytotoxicity:	0.273
BCF:	2.111 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.839 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.038 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.606 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[31301930]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[Article]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC162542 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20477
0.1-0.2	24338
0.2-0.3	3550
0.3-0.4	920
0.4-0.5	406
0.5-0.6	92
0.6-0.7	45
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8202	Intermediate Similarity	NPC136877
0.7912	Intermediate Similarity	NPC56713
0.7812	Intermediate Similarity	NPC257468
0.7789	Intermediate Similarity	NPC104400
0.7789	Intermediate Similarity	NPC10320
0.7674	Intermediate Similarity	NPC283849
0.7674	Intermediate Similarity	NPC606107
0.7527	Intermediate Similarity	NPC25605
0.75	Intermediate Similarity	NPC219180
0.7447	Intermediate Similarity	NPC114441
0.7444	Intermediate Similarity	NPC284807
0.7339	Intermediate Similarity	NPC161717
0.72	Intermediate Similarity	NPC119794
0.7172	Intermediate Similarity	NPC139044
0.7172	Intermediate Similarity	NPC471383
0.7158	Intermediate Similarity	NPC174679
0.7158	Intermediate Similarity	NPC279554
0.7083	Intermediate Similarity	NPC127056
0.7021	Intermediate Similarity	NPC164194
0.701	Intermediate Similarity	NPC488516
0.699	Remote Similarity	NPC488564
0.6966	Remote Similarity	NPC204407
0.6931	Remote Similarity	NPC73829
0.6923	Remote Similarity	NPC286347
0.6893	Remote Similarity	NPC323359
0.6889	Remote Similarity	NPC28198
0.6889	Remote Similarity	NPC476123
0.6875	Remote Similarity	NPC12288
0.6852	Remote Similarity	NPC166422
0.6837	Remote Similarity	NPC472949
0.6837	Remote Similarity	NPC488561
0.6765	Remote Similarity	NPC481082
0.6765	Remote Similarity	NPC164419
0.6733	Remote Similarity	NPC180550
0.6733	Remote Similarity	NPC35405
0.6731	Remote Similarity	NPC324875
0.6731	Remote Similarity	NPC292677
0.6727	Remote Similarity	NPC54636
0.67	Remote Similarity	NPC469945
0.6667	Remote Similarity	NPC100383
0.6667	Remote Similarity	NPC6377
0.6667	Remote Similarity	NPC208381
0.6634	Remote Similarity	NPC114304
0.6566	Remote Similarity	NPC109079
0.6542	Remote Similarity	NPC280941
0.6542	Remote Similarity	NPC235772
0.6538	Remote Similarity	NPC79718
0.6538	Remote Similarity	NPC488515
0.6495	Remote Similarity	NPC270667
0.6465	Remote Similarity	NPC59804
0.6436	Remote Similarity	NPC22956
0.6396	Remote Similarity	NPC251263
0.6383	Remote Similarity	NPC31839
0.6316	Remote Similarity	NPC242611
0.6306	Remote Similarity	NPC323341
0.625	Remote Similarity	NPC473383
0.6239	Remote Similarity	NPC62725
0.6204	Remote Similarity	NPC488209
0.6168	Remote Similarity	NPC276093
0.6163	Remote Similarity	NPC120840
0.6078	Remote Similarity	NPC480424
0.6075	Remote Similarity	NPC484832
0.602	Remote Similarity	NPC294112
0.6019	Remote Similarity	NPC37134
0.6017	Remote Similarity	NPC471385
0.5962	Remote Similarity	NPC80843
0.596	Remote Similarity	NPC191410
0.59	Remote Similarity	NPC475472
0.5893	Remote Similarity	NPC288205
0.5893	Remote Similarity	NPC51465
0.5877	Remote Similarity	NPC133818
0.5818	Remote Similarity	NPC75318
0.5794	Remote Similarity	NPC173859
0.5794	Remote Similarity	NPC148603
0.5784	Remote Similarity	NPC48499
0.5766	Remote Similarity	NPC295823
0.5766	Remote Similarity	NPC174720
0.5766	Remote Similarity	NPC475467
0.5741	Remote Similarity	NPC148417
0.5739	Remote Similarity	NPC471384
0.5714	Remote Similarity	NPC475486
0.57	Remote Similarity	NPC473538
0.5691	Remote Similarity	NPC488212
0.5678	Remote Similarity	NPC488211
0.5673	Remote Similarity	NPC108748
0.566	Remote Similarity	NPC76497
0.5632	Remote Similarity	NPC480946
0.5632	Remote Similarity	NPC130577
0.5632	Remote Similarity	NPC142415
0.5632	Remote Similarity	NPC102683
0.5614	Remote Similarity	NPC476992
0.5588	Remote Similarity	NPC480938
0.5568	Remote Similarity	NPC270768
0.5568	Remote Similarity	NPC59263
0.5568	Remote Similarity	NPC210106
0.5537	Remote Similarity	NPC258617
0.5536	Remote Similarity	NPC481079
0.551	Remote Similarity	NPC57362
0.5455	Remote Similarity	NPC177246
0.5437	Remote Similarity	NPC475611
0.5431	Remote Similarity	NPC60557
0.5431	Remote Similarity	NPC473824
0.5431	Remote Similarity	NPC67857
0.5421	Remote Similarity	NPC470512
0.5398	Remote Similarity	NPC291903
0.5393	Remote Similarity	NPC275809
0.5385	Remote Similarity	NPC151543
0.5378	Remote Similarity	NPC475160
0.5378	Remote Similarity	NPC473714
0.5377	Remote Similarity	NPC475296
0.5376	Remote Similarity	NPC96580
0.5361	Remote Similarity	NPC484195
0.5351	Remote Similarity	NPC241909
0.5333	Remote Similarity	NPC488560
0.5327	Remote Similarity	NPC173583
0.5294	Remote Similarity	NPC135904
0.5288	Remote Similarity	NPC473481
0.5275	Remote Similarity	NPC298554
0.5269	Remote Similarity	NPC296164
0.5259	Remote Similarity	NPC470915
0.525	Remote Similarity	NPC470218
0.5238	Remote Similarity	NPC127853
0.5234	Remote Similarity	NPC474589
0.5214	Remote Similarity	NPC475119
0.521	Remote Similarity	NPC470911
0.5185	Remote Similarity	NPC473373
0.5179	Remote Similarity	NPC258885
0.5179	Remote Similarity	NPC63159
0.5179	Remote Similarity	NPC473405
0.5175	Remote Similarity	NPC145899
0.5175	Remote Similarity	NPC114484
0.5165	Remote Similarity	NPC231063
0.5165	Remote Similarity	NPC282395
0.5165	Remote Similarity	NPC158141
0.5164	Remote Similarity	NPC481080
0.5143	Remote Similarity	NPC51947
0.514	Remote Similarity	NPC250089
0.514	Remote Similarity	NPC157530
0.5128	Remote Similarity	NPC480939
0.5126	Remote Similarity	NPC192600
0.5124	Remote Similarity	NPC475140
0.5122	Remote Similarity	NPC476068
0.5096	Remote Similarity	NPC475633
0.5089	Remote Similarity	NPC488526
0.5089	Remote Similarity	NPC102439
0.5083	Remote Similarity	NPC243680
0.5055	Remote Similarity	NPC282616
0.5055	Remote Similarity	NPC84319
0.5055	Remote Similarity	NPC52021
0.5055	Remote Similarity	NPC599947
0.5045	Remote Similarity	NPC112352
0.5044	Remote Similarity	NPC105800
0.5042	Remote Similarity	NPC76972
0.5042	Remote Similarity	NPC469782
0.5042	Remote Similarity	NPC204414
0.5039	Remote Similarity	NPC261506
0.5039	Remote Similarity	NPC4328

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC162542 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6483
0.1-0.2	2612
0.2-0.3	44
0.3-0.4	10
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data