NPASS Compound

Natural Product: NPC523113

Natural Product ID	NPC523113
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	[(2~{R},3~{S},4~{S},5~{R},6~{S})-3,4,5-trihydroxy-6-[(2~{R},3~{S},4~{S},5~{R},6~{R})-4-hydroxy-2-(hydroxymethyl)-6-[(1~{R},2~{S},4~{S},5'~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-5-[(2~{S},3~{R},4~{R},5~{R},6~{S})-3,4,5-trihydroxy-6-methyl-tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-tetrahydropyran-2-yl]methyl acetate
IUPAC Name	[(2~{R},3~{S},4~{S},5~{R},6~{S})-3,4,5-trihydroxy-6-[(2~{R},3~{S},4~{S},5~{R},6~{R})-4-hydroxy-2-(hydroxymethyl)-6-[(1~{R},2~{S},4~{S},5'~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-5-[(2~{S},3~{R},4~{R},5~{R},6~{S})-3,4,5-trihydroxy-6-methyl-tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-tetrahydropyran-2-yl]methyl acetate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 141149 0 0 0 0 0 0 0 0999 V2000 -12.5976 2.7540 -0.4230 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3474 2.3649 -1.1083 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3999 1.7461 -2.1921 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1148 2.6746 -0.5690 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8905 2.3302 -1.1745 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7222 0.8363 -1.3430 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5017 0.5764 -1.9455 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0611 -0.7085 -1.7690 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0186 -0.7260 -0.8634 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8352 -1.2369 -1.4010 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7213 -0.2520 -1.3972 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.6181 -0.8165 -2.0416 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2738 0.0833 0.0157 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2119 0.8179 0.6073 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9660 2.1097 0.9577 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0875 2.1905 2.3447 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9302 3.4517 2.8491 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8257 3.4286 3.8839 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5790 4.5090 1.8270 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7253 5.7583 2.4283 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5135 4.4527 0.6327 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7957 4.8556 -0.4896 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0409 3.0505 0.4227 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3797 2.7911 -0.8797 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8628 -1.2073 0.6361 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7224 -1.6590 -0.0031 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6256 -1.8385 0.7959 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0551 -3.2344 0.7772 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4362 -3.0987 1.1236 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1675 -2.6771 -0.1140 C 0 0 1 0 0 0 0 0 0 0 0 0 2.4302 -3.8864 -0.9586 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2525 -1.6671 -0.8256 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0503 -0.6413 -1.5682 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3573 -1.1882 -2.0936 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2581 -1.5777 -0.9451 C 0 0 2 0 0 0 0 0 0 0 0 0 3.3920 -1.9122 0.2652 C 0 0 2 0 0 0 0 0 0 0 0 0 4.2530 -2.5248 1.3038 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3218 -1.5267 1.7002 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1279 -1.0632 0.5358 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9397 -2.1791 -0.0481 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9171 0.1938 0.7774 C 0 0 2 0 0 0 0 0 0 0 0 0 7.2516 0.5568 -0.6819 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0812 0.0713 -1.5078 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1582 -0.4996 -0.4985 C 0 0 1 0 0 0 0 0 0 0 0 0 8.3752 -0.2755 -0.8645 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1716 0.1612 0.1939 C 0 0 1 0 0 0 0 0 0 0 0 0 10.4700 -0.5942 0.3191 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6644 0.3334 0.1133 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4874 1.2516 -1.0504 C 0 0 2 0 0 0 0 0 0 0 0 0 12.3551 2.4901 -0.8382 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0631 1.7232 -1.2267 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3917 1.5256 -0.0328 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2631 0.0211 1.3672 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5167 1.2110 2.3035 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4638 -0.9276 0.2600 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7965 -2.2022 0.5663 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4792 -2.4376 -0.5668 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7019 -3.4714 -1.3961 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6018 -4.6251 -0.6162 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1637 -1.6833 -1.3584 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.0070 -1.8060 -2.4830 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8985 -1.2646 -0.1297 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5087 -1.9486 1.0122 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8113 0.2290 0.0412 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.0029 0.6701 0.6141 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.4853 2.7596 0.6770 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4076 2.0594 -0.6996 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9044 3.7802 -0.7215 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7435 2.8746 -2.1507 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0964 2.7494 -0.5009 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5110 0.4108 -1.9586 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7272 -1.0975 -2.7771 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0202 -1.5279 -2.4611 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9516 0.6738 -1.9734 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7617 -0.8890 -3.0151 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3544 0.7219 -0.1189 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9516 2.4872 0.7305 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8875 3.7089 3.3821 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9154 3.9381 3.4860 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5470 2.3983 4.1247 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1230 4.0223 4.7740 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5552 4.3690 1.4709 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3670 5.7506 3.3596 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3574 5.1547 0.7551 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8337 4.7489 -0.4134 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9329 2.9078 1.0618 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0817 3.4476 -1.5399 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5819 -1.1155 1.7085 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7820 -1.5849 1.8580 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4748 -3.8651 1.6068 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0925 -3.7270 -0.2053 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8142 -4.0264 1.5815 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5222 -2.2969 1.8991 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7941 -3.9197 -1.8906 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5033 -4.0392 -1.2068 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1331 -4.8307 -0.4138 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5356 -2.1982 -1.4575 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3175 0.2263 -0.9067 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4560 -0.2641 -2.4032 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8033 -0.4375 -2.7535 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1420 -2.1038 -2.6748 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8148 -2.4772 -1.2107 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0428 -0.9161 0.6681 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6352 -3.5192 1.0765 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6146 -2.6464 2.2291 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8383 -0.7082 2.2431 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0249 -2.1003 2.3728 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9713 -2.2286 0.3538 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4588 -3.1423 0.2503 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0067 -2.1777 -1.1346 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2706 0.9334 1.2485 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4771 1.6177 -0.7940 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3843 -0.6283 -2.3061 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6200 0.9519 -2.0061 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5747 0.3185 -0.0245 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5398 -0.9488 1.3834 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4982 -1.4386 -0.3728 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5255 -0.3466 -0.1343 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9425 0.8459 1.0496 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8170 0.7969 -2.0116 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3770 2.3442 -1.2081 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4039 2.7657 0.2348 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9387 3.3752 -1.3664 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5412 1.1211 -2.0076 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0356 2.8048 -1.4502 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4090 -0.8942 1.9641 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5894 1.2867 2.5273 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2114 2.1632 1.8211 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8961 1.1021 3.2256 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0038 -0.0504 -0.2838 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0851 -0.5032 1.0419 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4355 -2.9973 -0.2845 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6864 -3.0721 -1.5299 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2217 -3.6679 -2.3551 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9215 -4.4964 0.2996 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6538 -2.6555 -1.1844 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6954 -2.4657 -2.2881 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9830 -1.5049 -0.3024 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2759 -2.4564 1.4248 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9895 0.5516 0.6934 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4816 -0.0652 1.0638 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 19 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 13 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 6 30 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 6 39 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 46 45 1 6 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 49 51 1 0 51 52 1 0 46 53 1 0 53 54 1 0 32 55 1 0 25 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 8 60 1 0 60 61 1 0 60 62 1 0 62 63 1 0 62 64 1 0 64 65 1 0 64 6 1 0 57 10 1 0 23 15 1 0 55 27 1 0 36 30 1 0 44 39 1 0 52 46 1 0 44 35 1 0 53 41 1 0 1 66 1 0 1 67 1 0 1 68 1 0 5 69 1 0 5 70 1 0 6 71 1 6 8 72 1 6 10 73 1 6 11 74 1 6 12 75 1 0 13 76 1 6 15 77 1 1 17 78 1 1 18 79 1 0 18 80 1 0 18 81 1 0 19 82 1 6 20 83 1 0 21 84 1 1 22 85 1 0 23 86 1 1 24 87 1 0 25 88 1 1 27 89 1 1 28 90 1 0 28 91 1 0 29 92 1 0 29 93 1 0 31 94 1 0 31 95 1 0 31 96 1 0 32 97 1 6 33 98 1 0 33 99 1 0 34100 1 0 34101 1 0 35102 1 6 36103 1 1 37104 1 0 37105 1 0 38106 1 0 38107 1 0 40108 1 0 40109 1 0 40110 1 0 41111 1 1 42112 1 1 43113 1 0 43114 1 0 44115 1 1 47116 1 0 47117 1 0 48118 1 0 48119 1 0 49120 1 6 50121 1 0 50122 1 0 50123 1 0 51124 1 0 51125 1 0 53126 1 1 54127 1 0 54128 1 0 54129 1 0 55130 1 0 55131 1 0 57132 1 1 58133 1 0 58134 1 0 59135 1 0 60136 1 1 61137 1 0 62138 1 6 63139 1 0 64140 1 1 65141 1 0 M END

Standard InCHIKey	QPCXNOOIVSKVLM-KCROQFHVSA-N
Standard InCHI	InChI=1S/C47H76O18/c1-20-9-14-47(58-18-20)21(2)32-29(65-47)16-28-26-8-7-24-15-25(10-12-45(24,5)27(26)11-13-46(28,32)6)60-44-41(64-42-37(54)35(52)33(50)22(3)59-42)39(56)40(30(17-48)61-44)63-43-38(55)36(53)34(51)31(62-43)19-57-23(4)49/h20-22,24-44,48,50-56H,7-19H2,1-6H3/t20-,21-,22-,24+,25-,26+,27-,28-,29-,30+,31+,32-,33-,34+,35+,36-,37+,38+,39-,40+,41+,42-,43-,44+,45-,46-,47+/m0/s1
SMILES	CC(=O)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@H](O[C@H]3CC[C@@]4(C)[C@H](CC[C@@H]5[C@@H]4CC[C@]4(C)[C@@H]6[C@H](C[C@@H]54)O[C@]4(CC[C@H](C)CO4)[C@H]6C)C3)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	928.5	Volume:	900.047 ? Van der Waals volume.
Dense:	1.032	LogP:	1.471 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.35 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.653 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	49.0
TPSA:	261.98 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	8.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.118	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.755	Fsp³:	0.979
MCE-18:	232.849 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.776	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.238	Promiscuous compounds:	0.281

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.106	MDCK Permeability:	-5.185
Pgp-inhibitor:	0.0	Pgp-substrate:	0.89
PAMPA:	0.987 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.047
20% Bioavailability (F20%):	0.722	30% Bioavailability (F30%):	0.995
50% Bioavailability (F50%):	0.99

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.014	MRP1:	0.853
Plasma Protein Binding (PPB):	78.2%	Volume Distribution (VD):	-0.46
Fu:	15.799% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.971	BCRP inhibitor:	0.002
BSEP inhibitor:	0.073

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.022	CYP3A4-substrate:	0.708
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.328
HLM stability:	0.446 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.238

Half-life (T1/2):

2.7

ADMET: Toxicity

hERG Blockers:	0.01	hERG Blockers (10um):	0.088
Human Hepatotoxicity (H-HT):	0.273	Drug-induced Liver Injury (DILI):	0.982
AMES Toxicity:	0.984	Rat Oral Acute Toxicity:	0.015
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.13	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.995
Hematotoxicity:	0.325	Drug-induced Nephrotoxicity:	0.991
Genotoxicity:	0.3	RPMI-8226 Immunitoxicity:	0.416
A549 Cytotoxicity:	0.974	Hek293 Cytotoxicity:	0.759
BCF:	1.388 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.311 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.483 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.877 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO17292	Asparagus racemosus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO17292	Asparagus racemosus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC523113 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25333
0.1-0.2	21219
0.2-0.3	2622
0.3-0.4	453
0.4-0.5	113
0.5-0.6	66
0.6-0.7	39
0.7-0.8	0
0.8-0.85	0
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8876	High Similarity	NPC19400
0.8587	High Similarity	NPC6295
0.7812	Intermediate Similarity	NPC485595
0.78	Intermediate Similarity	NPC471464
0.7475	Intermediate Similarity	NPC160426
0.7374	Intermediate Similarity	NPC195297
0.7368	Intermediate Similarity	NPC477451
0.7143	Intermediate Similarity	NPC211354
0.7087	Intermediate Similarity	NPC470433
0.7087	Intermediate Similarity	NPC46190
0.7087	Intermediate Similarity	NPC171073
0.7048	Intermediate Similarity	NPC128572
0.6979	Remote Similarity	NPC297348
0.6979	Remote Similarity	NPC249204
0.6979	Remote Similarity	NPC48339
0.6979	Remote Similarity	NPC141769
0.6979	Remote Similarity	NPC477547
0.6923	Remote Similarity	NPC475643
0.6887	Remote Similarity	NPC480555
0.6887	Remote Similarity	NPC150372
0.6832	Remote Similarity	NPC107962
0.6804	Remote Similarity	NPC325828
0.6789	Remote Similarity	NPC475333
0.6789	Remote Similarity	NPC224098
0.6789	Remote Similarity	NPC208383
0.67	Remote Similarity	NPC206003
0.67	Remote Similarity	NPC473610
0.6697	Remote Similarity	NPC269297
0.6697	Remote Similarity	NPC222202
0.6633	Remote Similarity	NPC177834
0.66	Remote Similarity	NPC250393
0.6542	Remote Similarity	NPC248746
0.6518	Remote Similarity	NPC480554
0.6471	Remote Similarity	NPC107188
0.6429	Remote Similarity	NPC194207
0.6429	Remote Similarity	NPC22779
0.6415	Remote Similarity	NPC475351
0.6404	Remote Similarity	NPC480553
0.6339	Remote Similarity	NPC32361
0.633	Remote Similarity	NPC274200
0.6275	Remote Similarity	NPC222731
0.6271	Remote Similarity	NPC480556
0.6238	Remote Similarity	NPC234352
0.6218	Remote Similarity	NPC224314
0.6216	Remote Similarity	NPC97700
0.6216	Remote Similarity	NPC30856
0.6195	Remote Similarity	NPC475625
0.6182	Remote Similarity	NPC42171
0.6174	Remote Similarity	NPC83137
0.6154	Remote Similarity	NPC232054
0.6071	Remote Similarity	NPC184617
0.5946	Remote Similarity	NPC92890
0.5941	Remote Similarity	NPC485594
0.5922	Remote Similarity	NPC294686
0.5872	Remote Similarity	NPC113044
0.5872	Remote Similarity	NPC283829
0.5872	Remote Similarity	NPC161676
0.5862	Remote Similarity	NPC232037
0.5847	Remote Similarity	NPC132080
0.5846	Remote Similarity	NPC329807
0.5833	Remote Similarity	NPC125324
0.5833	Remote Similarity	NPC470432
0.5833	Remote Similarity	NPC230507
0.5776	Remote Similarity	NPC116756
0.5741	Remote Similarity	NPC215408
0.5714	Remote Similarity	NPC602423
0.5678	Remote Similarity	NPC470864
0.5672	Remote Similarity	NPC329727
0.5667	Remote Similarity	NPC287885
0.5648	Remote Similarity	NPC264101
0.5645	Remote Similarity	NPC477808
0.5614	Remote Similarity	NPC51172
0.5614	Remote Similarity	NPC300557
0.5614	Remote Similarity	NPC49032
0.5603	Remote Similarity	NPC475319
0.5597	Remote Similarity	NPC481189
0.5508	Remote Similarity	NPC13193
0.5495	Remote Similarity	NPC141433
0.549	Remote Similarity	NPC473774
0.549	Remote Similarity	NPC481419
0.549	Remote Similarity	NPC481417
0.5487	Remote Similarity	NPC473601
0.547	Remote Similarity	NPC115165
0.5455	Remote Similarity	NPC233433
0.5447	Remote Similarity	NPC470866
0.5413	Remote Similarity	NPC306131
0.5413	Remote Similarity	NPC200802
0.5407	Remote Similarity	NPC329820
0.5391	Remote Similarity	NPC477809
0.531	Remote Similarity	NPC14704
0.525	Remote Similarity	NPC309278
0.5221	Remote Similarity	NPC70204
0.5217	Remote Similarity	NPC202898
0.5214	Remote Similarity	NPC6806
0.5214	Remote Similarity	NPC124677
0.5196	Remote Similarity	NPC144790
0.5196	Remote Similarity	NPC149400
0.5192	Remote Similarity	NPC481420
0.5192	Remote Similarity	NPC481421
0.5188	Remote Similarity	NPC481190
0.5169	Remote Similarity	NPC475182
0.5159	Remote Similarity	NPC94086
0.5159	Remote Similarity	NPC473817
0.5156	Remote Similarity	NPC220836
0.5143	Remote Similarity	NPC24960
0.514	Remote Similarity	NPC181845
0.5135	Remote Similarity	NPC54619
0.5126	Remote Similarity	NPC73243
0.5126	Remote Similarity	NPC244086
0.5126	Remote Similarity	NPC84956
0.5122	Remote Similarity	NPC476112
0.5122	Remote Similarity	NPC307534
0.5091	Remote Similarity	NPC474399
0.5082	Remote Similarity	NPC232611
0.5046	Remote Similarity	NPC291203
0.5046	Remote Similarity	NPC217205
0.5041	Remote Similarity	NPC247037

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC523113 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7568
0.1-0.2	1503
0.2-0.3	63
0.3-0.4	10
0.4-0.5	4
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6804	Remote Similarity	NPD8171	Phase 2
0.5981	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data