NPASS Compound

Natural Product: NPC512034

Natural Product ID	NPC512034
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{S},4~{S},5~{R},6~{R})-4-hydroxy-2-(hydroxymethyl)-5-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-6-[(1~{R},2~{S},4~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-7,9,13-trimethyl-5'-methylene-spiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{S},4~{S},5~{R},6~{R})-4-hydroxy-2-(hydroxymethyl)-5-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-6-[(1~{R},2~{S},4~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-7,9,13-trimethyl-5'-methylene-spiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 134142 0 0 0 0 0 0 0 0999 V2000 12.5570 0.7847 0.7475 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2898 0.7745 0.4249 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8186 0.0194 -0.7492 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3772 0.4843 -0.9918 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5364 0.4022 0.2383 C 0 0 1 0 0 0 0 0 0 0 0 0 9.2154 0.6801 1.4220 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3107 1.5229 1.2378 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4850 1.3476 0.1836 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6461 0.9587 1.2308 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2610 1.5460 1.0544 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3885 0.3516 0.7749 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1761 0.6280 -0.0346 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1953 1.3891 0.8675 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7785 1.0962 0.5022 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6790 0.9011 -0.9970 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7518 0.9739 -1.3985 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4825 -0.3455 -1.3569 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7866 -0.1480 -1.8023 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7560 -0.5776 -0.9068 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4753 -1.6071 -1.4515 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6863 -1.9065 -0.9191 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8250 -1.6866 -1.9293 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0510 -2.0004 -1.3529 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0254 -1.3596 0.4165 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8328 -2.3026 1.4197 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0510 -2.6144 2.0090 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0888 -2.3818 3.3664 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9525 -2.8547 3.9717 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1194 -2.6340 5.4790 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7102 -4.3215 3.7779 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3274 -4.5406 3.9679 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0343 -4.7966 2.3906 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3475 -6.1668 2.4923 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2475 -4.1242 1.8120 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4191 -4.4522 2.4534 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3867 -0.0442 0.7765 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2615 0.8220 1.3938 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6570 0.5331 -0.4061 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.9265 1.6655 -0.1073 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3130 2.7800 -0.8410 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2724 3.1773 -1.7214 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8536 3.9304 -2.7235 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7958 4.8254 -3.3826 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7813 4.0821 -3.9354 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0392 4.7347 -2.3066 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2566 4.1605 -2.7427 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0873 5.0844 -0.8554 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4553 6.2891 -0.6504 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5521 3.9854 0.0369 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3452 3.7495 1.1297 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7205 -1.2671 -2.3009 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6155 -1.5356 -1.6510 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4317 -0.2990 -1.4664 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0455 0.0351 -2.8246 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5125 -0.6410 -0.4380 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3936 -1.7248 -0.9349 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6955 -1.8511 -0.1949 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3392 -0.5143 -0.0314 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6659 0.1349 -1.3467 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5098 -0.5395 0.9232 C 0 0 1 0 0 0 0 0 0 0 0 0 7.8095 -0.9296 0.3208 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5620 -1.7630 1.3672 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9591 1.3274 1.6069 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2632 0.2313 0.1433 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8012 -1.0785 -0.6011 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4079 0.3204 -1.6345 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9779 -0.2195 -1.7565 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3997 1.4987 -1.4478 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6815 1.8007 2.2361 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0162 2.4284 0.6388 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0719 1.1296 2.2224 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2036 2.3430 0.3156 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9253 2.0013 2.0297 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1813 -0.1874 1.7206 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4747 1.2691 -0.8939 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4364 2.4715 0.8963 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3579 1.0034 1.8948 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1742 2.0083 0.7343 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3226 0.2644 1.0666 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1802 1.8090 -1.4390 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2558 1.6543 -0.6506 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9120 1.4890 -2.3734 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4320 -0.7878 -0.3627 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2157 -0.9780 -0.0156 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6772 -3.0397 -0.7998 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7079 -2.3979 -2.7914 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7931 -0.6749 -2.3780 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7871 -1.4308 -1.7030 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1337 -1.1396 0.3954 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9013 -2.0550 1.5662 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0976 -2.2259 3.6720 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7637 -3.4971 5.8209 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6974 -1.7232 5.6708 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1638 -2.7090 6.0038 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2098 -4.9312 4.5540 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8904 -3.7851 3.4637 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1990 -4.7257 1.6806 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5287 -6.7209 2.4552 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2745 -4.3141 0.7217 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5166 -5.4212 2.4857 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5929 -0.2888 1.5424 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2838 0.6268 2.3841 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3907 0.8447 -1.1844 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1449 2.5229 -1.5061 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1949 3.2390 -3.5493 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3138 5.4852 -4.1087 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4423 5.4968 -2.5557 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6628 4.3194 -4.8771 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9883 5.7089 -2.8775 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0885 3.5797 -3.5154 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1707 5.2040 -0.5804 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1616 6.3230 0.2979 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5249 4.3350 0.3518 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0841 4.3726 1.2262 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2248 -2.2471 -2.4107 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5797 -0.7433 -3.2610 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1938 -2.1990 -2.3592 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4561 -2.1200 -0.7280 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1850 0.4738 -3.4138 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7807 0.8503 -2.7645 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3523 -0.8483 -3.3864 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9401 -1.0060 0.4542 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5820 -1.7260 -2.0284 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8480 -2.7001 -0.7544 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3648 -2.5026 -0.7805 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5679 -2.2932 0.8171 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8475 -0.1310 -2.0596 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6980 1.2320 -1.3178 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5820 -0.2961 -1.8008 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2180 -1.1081 1.8118 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7646 -1.4642 -0.6254 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2850 -2.4413 0.9075 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7895 -2.3097 1.9747 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0946 -1.1163 2.0923 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 1 6 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 28 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 24 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 47 49 1 0 49 50 1 0 17 51 1 0 51 52 1 0 52 53 1 0 53 54 1 6 53 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 6 58 60 1 0 60 61 1 0 61 62 1 0 7 2 1 0 60 9 1 0 61 5 1 0 58 11 1 0 55 12 1 0 53 15 1 0 38 19 1 0 49 40 1 0 34 26 1 0 1 63 1 0 1 64 1 0 3 65 1 0 3 66 1 0 4 67 1 0 4 68 1 0 7 69 1 0 7 70 1 0 9 71 1 1 10 72 1 0 10 73 1 0 11 74 1 1 12 75 1 6 13 76 1 0 13 77 1 0 14 78 1 0 14 79 1 0 15 80 1 6 16 81 1 0 16 82 1 0 17 83 1 1 19 84 1 1 21 85 1 1 22 86 1 0 22 87 1 0 23 88 1 0 24 89 1 6 26 90 1 6 28 91 1 6 29 92 1 0 29 93 1 0 29 94 1 0 30 95 1 1 31 96 1 0 32 97 1 6 33 98 1 0 34 99 1 6 35100 1 0 36101 1 1 37102 1 0 38103 1 6 40104 1 6 42105 1 6 43106 1 0 43107 1 0 44108 1 0 45109 1 6 46110 1 0 47111 1 1 48112 1 0 49113 1 1 50114 1 0 51115 1 0 51116 1 0 52117 1 0 52118 1 0 54119 1 0 54120 1 0 54121 1 0 55122 1 1 56123 1 0 56124 1 0 57125 1 0 57126 1 0 59127 1 0 59128 1 0 59129 1 0 60130 1 1 61131 1 6 62132 1 0 62133 1 0 62134 1 0 M END

Standard InCHIKey	GTHFQEMYVCDXKR-CSZPLYFWSA-N
Standard InCHI	InChI=1S/C45H72O17/c1-19-8-13-45(55-18-19)20(2)30-27(62-45)15-26-24-7-6-22-14-23(9-11-43(22,4)25(24)10-12-44(26,30)5)57-42-39(61-41-36(53)34(51)32(49)28(16-46)58-41)37(54)38(29(17-47)59-42)60-40-35(52)33(50)31(48)21(3)56-40/h20-42,46-54H,1,6-18H2,2-5H3/t20-,21-,22+,23-,24+,25-,26-,27-,28+,29+,30-,31-,32+,33+,34-,35+,36+,37-,38+,39+,40-,41-,42+,43-,44-,45+/m0/s1
SMILES	C=C1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC[C@@H]5C[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O[C@@H]7O[C@@H](C)[C@H](O)[C@@H](O)[C@H]7O)[C@H](O)[C@H]6O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	884.48	Volume:	856.665 ? Van der Waals volume.
Dense:	1.032	LogP:	1.435 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.397 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.205 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	49.0
TPSA:	255.91 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	9.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.117	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.741	Fsp³:	0.956
MCE-18:	230.455 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.657	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.011 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.257	Promiscuous compounds:	0.046

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.243	MDCK Permeability:	-5.051
Pgp-inhibitor:	0.0	Pgp-substrate:	0.199
PAMPA:	0.948 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.009	30% Bioavailability (F30%):	0.95
50% Bioavailability (F50%):	0.996

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.142	MRP1:	0.016
Plasma Protein Binding (PPB):	66.423%	Volume Distribution (VD):	-0.454
Fu:	27.842% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.058
BSEP inhibitor:	0.109

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.996	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.549
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.165

Half-life (T1/2):

3.4

ADMET: Toxicity

hERG Blockers:	0.021	hERG Blockers (10um):	0.095
Human Hepatotoxicity (H-HT):	0.49	Drug-induced Liver Injury (DILI):	0.968
AMES Toxicity:	0.879	Rat Oral Acute Toxicity:	0.004
Maximum Recommended Daily Dose:	0.003	Skin Sensitization:	1.0
Carcinogencity:	0.032	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.998
Hematotoxicity:	0.171	Drug-induced Nephrotoxicity:	0.439
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.239
A549 Cytotoxicity:	0.61	Hek293 Cytotoxicity:	0.752
BCF:	1.72 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.438 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.612 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.034 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO17292	Asparagus racemosus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO17292	Asparagus racemosus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC512034 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26482
0.1-0.2	20178
0.2-0.3	2453
0.3-0.4	500
0.4-0.5	127
0.5-0.6	65
0.6-0.7	34
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8667	High Similarity	NPC6295
0.8333	Intermediate Similarity	NPC19400
0.7872	Intermediate Similarity	NPC125324
0.7677	Intermediate Similarity	NPC42171
0.7347	Intermediate Similarity	NPC160426
0.7327	Intermediate Similarity	NPC51172
0.7327	Intermediate Similarity	NPC49032
0.732	Intermediate Similarity	NPC485595
0.7245	Intermediate Similarity	NPC195297
0.7234	Intermediate Similarity	NPC477451
0.7087	Intermediate Similarity	NPC480555
0.7087	Intermediate Similarity	NPC150372
0.7021	Intermediate Similarity	NPC297348
0.7021	Intermediate Similarity	NPC249204
0.7021	Intermediate Similarity	NPC48339
0.7021	Intermediate Similarity	NPC141769
0.7021	Intermediate Similarity	NPC477547
0.699	Remote Similarity	NPC471464
0.6923	Remote Similarity	NPC128572
0.6869	Remote Similarity	NPC107962
0.6842	Remote Similarity	NPC325828
0.6837	Remote Similarity	NPC211354
0.6837	Remote Similarity	NPC54619
0.6796	Remote Similarity	NPC470433
0.6796	Remote Similarity	NPC46190
0.6796	Remote Similarity	NPC475643
0.6796	Remote Similarity	NPC171073
0.6735	Remote Similarity	NPC206003
0.6735	Remote Similarity	NPC473610
0.6577	Remote Similarity	NPC480553
0.6571	Remote Similarity	NPC248746
0.6455	Remote Similarity	NPC194207
0.6455	Remote Similarity	NPC22779
0.6422	Remote Similarity	NPC269297
0.6422	Remote Similarity	NPC222202
0.6396	Remote Similarity	NPC480554
0.6364	Remote Similarity	NPC475333
0.6364	Remote Similarity	NPC224098
0.6364	Remote Similarity	NPC208383
0.6337	Remote Similarity	NPC107188
0.6286	Remote Similarity	NPC475351
0.6263	Remote Similarity	NPC234352
0.625	Remote Similarity	NPC108072
0.6174	Remote Similarity	NPC232054
0.6147	Remote Similarity	NPC151134
0.6091	Remote Similarity	NPC97700
0.6091	Remote Similarity	NPC184617
0.6091	Remote Similarity	NPC30856
0.6061	Remote Similarity	NPC481424
0.6061	Remote Similarity	NPC481422
0.6017	Remote Similarity	NPC480556
0.598	Remote Similarity	NPC250393
0.598	Remote Similarity	NPC222731
0.596	Remote Similarity	NPC485594
0.5929	Remote Similarity	NPC32361
0.5929	Remote Similarity	NPC475625
0.5888	Remote Similarity	NPC113044
0.5888	Remote Similarity	NPC283829
0.5888	Remote Similarity	NPC161676
0.5833	Remote Similarity	NPC224314
0.5818	Remote Similarity	NPC92890
0.5784	Remote Similarity	NPC294686
0.5766	Remote Similarity	NPC274200
0.5766	Remote Similarity	NPC300557
0.5743	Remote Similarity	NPC481425
0.5743	Remote Similarity	NPC481426
0.5726	Remote Similarity	NPC132080
0.5652	Remote Similarity	NPC13193
0.5652	Remote Similarity	NPC116756
0.5641	Remote Similarity	NPC83137
0.5586	Remote Similarity	NPC602423
0.5556	Remote Similarity	NPC470432
0.5556	Remote Similarity	NPC230507
0.5556	Remote Similarity	NPC94272
0.5556	Remote Similarity	NPC470864
0.5545	Remote Similarity	NPC112274
0.5536	Remote Similarity	NPC477809
0.5534	Remote Similarity	NPC177834
0.5505	Remote Similarity	NPC141433
0.5487	Remote Similarity	NPC6806
0.547	Remote Similarity	NPC232037
0.5455	Remote Similarity	NPC470867
0.5403	Remote Similarity	NPC477808
0.5391	Remote Similarity	NPC73243
0.5391	Remote Similarity	NPC244086
0.5391	Remote Similarity	NPC84956
0.5345	Remote Similarity	NPC475319
0.5328	Remote Similarity	NPC470866
0.5304	Remote Similarity	NPC475182
0.5299	Remote Similarity	NPC247037
0.5288	Remote Similarity	NPC181845
0.5269	Remote Similarity	NPC481427
0.5259	Remote Similarity	NPC481189
0.5254	Remote Similarity	NPC309278
0.5221	Remote Similarity	NPC473601
0.5214	Remote Similarity	NPC115165
0.5207	Remote Similarity	NPC233433
0.5189	Remote Similarity	NPC291203
0.5189	Remote Similarity	NPC217205
0.5179	Remote Similarity	NPC305423
0.5179	Remote Similarity	NPC14704
0.5169	Remote Similarity	NPC475550
0.5167	Remote Similarity	NPC249265
0.5149	Remote Similarity	NPC329807
0.5146	Remote Similarity	NPC24960
0.5138	Remote Similarity	NPC306131
0.5138	Remote Similarity	NPC200802
0.5124	Remote Similarity	NPC23808
0.5124	Remote Similarity	NPC87998
0.5093	Remote Similarity	NPC474399
0.5091	Remote Similarity	NPC264101
0.5049	Remote Similarity	NPC473774
0.5049	Remote Similarity	NPC481419
0.5049	Remote Similarity	NPC481417
0.5046	Remote Similarity	NPC128123
0.5046	Remote Similarity	NPC121453

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC512034 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7868
0.1-0.2	1200
0.2-0.3	65
0.3-0.4	11
0.4-0.5	3
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6842	Remote Similarity	NPD8171	Phase 2
0.5849	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data