NPASS Compound

Natural Product: NPC469421

Natural Product ID	NPC469421
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Paeonidanin E
IUPAC Name	n.a.
Synonyms	Paeonidanin E
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1078416
PubChem CID	46883515
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 121131 0 0 0 0 0 0 0 0999 V2000 -3.4815 -2.2285 2.9144 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9567 -0.8871 2.5516 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4325 -0.1432 3.7949 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0501 1.2156 3.3662 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1372 1.8057 3.8717 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8881 1.8106 2.2471 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2568 1.2306 2.4732 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7540 -0.0078 1.6753 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7103 0.9114 1.0783 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4504 0.0375 1.1903 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7937 -1.1297 1.7889 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9644 -0.1824 -0.0704 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3191 0.3889 -0.2426 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7625 0.1002 -1.6813 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5296 -1.3107 -2.0877 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7862 -1.9730 -2.5934 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0011 -1.5724 -1.7994 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1082 -0.0921 -1.5776 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9894 0.6094 -1.9615 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3480 0.1372 -0.2479 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4031 0.8538 0.1462 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4998 0.9624 1.6348 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0197 0.9916 1.4370 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8044 0.3722 0.0886 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4593 1.3155 -0.8828 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4266 2.0520 -1.4627 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5567 2.2640 -0.3955 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3408 3.1524 0.5844 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5097 2.3663 1.0599 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2969 2.0825 -0.0777 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2547 2.9829 2.0344 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3060 2.9746 -0.7160 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1606 -1.0423 0.0285 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4842 -1.3066 -0.0960 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6530 -1.1707 0.5003 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7123 -0.6055 1.6111 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9382 -1.6515 -0.0633 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0894 -1.4539 0.6542 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3313 -1.8868 0.1689 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4286 -2.5253 -1.0478 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2677 -2.7206 -1.7639 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0268 -2.2877 -1.2781 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0392 -2.3125 -0.6159 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6068 -3.3490 -2.4819 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4825 -1.3699 -3.0360 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8810 1.3710 -0.3045 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0265 1.8811 -0.8014 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7736 2.9913 -0.5761 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3564 3.7933 0.2968 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0073 3.2970 -1.2778 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6999 4.4402 -0.9695 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8744 4.7441 -1.6341 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3254 3.8745 -2.6057 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6571 2.7213 -2.9397 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4818 2.4576 -2.2455 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7010 -0.4876 0.8286 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8050 -1.0374 1.3932 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0961 -0.3352 1.0114 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6696 -0.7527 -0.2939 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2630 -2.0900 -0.8029 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9437 -2.5658 -0.2456 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0180 -2.3886 1.1318 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8383 -4.0558 -0.4967 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9591 -4.7084 0.0175 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2404 -3.0459 -0.5967 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0794 -0.7874 -0.1622 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0335 -0.6338 2.0231 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5603 -2.8611 2.0118 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2892 -2.2861 3.6329 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6026 -2.7309 3.4730 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5696 -0.7366 4.1645 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1762 -0.1637 4.6169 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7705 2.8798 2.1521 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4809 0.9501 3.5252 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0476 1.7323 1.9470 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6968 0.6255 1.7613 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2924 1.4757 -0.1092 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9634 -0.1077 0.4963 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0427 0.7354 -2.2833 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1255 -1.8479 -1.1816 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8844 -1.7433 -3.6739 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8822 -1.8918 -2.3863 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9393 0.3601 -2.1597 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0693 1.8298 2.1271 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2518 0.0273 2.1957 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5536 0.4726 2.2154 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0343 0.7227 -1.6210 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7472 3.9796 -0.0681 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7104 3.5960 1.3497 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1382 2.5714 2.1274 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4083 2.6151 -0.1763 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1550 3.0597 -1.8264 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3623 4.0677 -0.4092 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7027 -1.5281 0.9513 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6564 -1.6113 -0.7995 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0595 -0.9592 1.6106 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2326 -1.7216 0.7507 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3824 -2.8680 -1.4405 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3278 -3.2188 -2.7172 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1274 -2.4415 -1.8374 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6881 -1.8305 0.1589 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3748 -3.8664 -2.8307 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8122 -2.3053 -3.1790 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5719 0.4982 -0.9896 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9905 2.0785 -0.5003 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3621 5.1458 -0.2026 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4075 5.6309 -1.3917 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2399 4.1035 -3.1283 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0652 2.0914 -3.7037 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9254 1.5557 -2.4810 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7662 -0.9653 2.5113 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0068 0.7648 1.0141 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5011 0.0496 -1.0588 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1251 -2.0022 -1.9128 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1000 -2.0069 -0.6422 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9392 -4.4166 0.0426 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7286 -4.2298 -1.5853 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0514 -4.5879 0.9784 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4294 -3.5653 -1.4121 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5173 -0.9627 -1.0303 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7500 -0.2540 2.8921 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 2 0 4 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 27 32 1 0 24 33 1 0 33 34 1 0 34 35 1 0 35 36 2 0 35 37 1 0 37 38 2 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 2 0 17 43 1 0 16 44 1 0 15 45 1 0 9 46 1 0 46 47 1 0 47 48 1 0 48 49 2 0 48 50 1 0 50 51 2 0 51 52 1 0 52 53 2 0 53 54 1 0 54 55 2 0 8 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 61 63 1 0 63 64 1 0 60 65 1 0 59 66 1 0 58 67 1 0 8 2 1 0 55 50 1 0 62 57 1 0 11 2 1 0 9 6 1 0 19 14 1 0 24 21 1 0 27 21 1 0 29 23 1 0 30 25 1 0 42 37 1 0 1 68 1 0 1 69 1 0 1 70 1 0 3 71 1 0 3 72 1 0 6 73 1 0 7 74 1 0 7 75 1 0 10 76 1 0 13 77 1 0 13 78 1 0 14 79 1 0 15 80 1 0 16 81 1 0 17 82 1 0 18 83 1 0 22 84 1 0 22 85 1 0 23 86 1 0 25 87 1 0 28 88 1 0 28 89 1 0 31 90 1 0 32 91 1 0 32 92 1 0 32 93 1 0 33 94 1 0 33 95 1 0 38 96 1 0 39 97 1 0 40 98 1 0 41 99 1 0 42100 1 0 43101 1 0 44102 1 0 45103 1 0 46104 1 0 46105 1 0 51106 1 0 52107 1 0 53108 1 0 54109 1 0 55110 1 0 57111 1 0 58112 1 0 59113 1 0 60114 1 0 61115 1 0 63116 1 0 63117 1 0 64118 1 0 65119 1 0 66120 1 0 67121 1 0 M END

Standard InCHIKey	FPEQOYMLKLIEMS-IYNAHQBOSA-N
Standard InCHI	InChI=1S/C46H54O21/c1-40-14-24(48)23-13-45(40,63-36-32(53)30(51)28(49)25(16-47)61-36)42(23,19-59-34(55)21-9-5-3-6-10-21)38(65-40)58-17-26-29(50)31(52)33(54)37(62-26)64-46-15-27-43(46,20-60-35(56)22-11-7-4-8-12-22)39-66-41(46,2)18-44(27,57)67-39/h3-12,23,25-33,36-39,47,49-54,57H,13-20H2,1-2H3/t23-,25-,26-,27+,28-,29-,30+,31+,32-,33-,36+,37+,38+,39-,40+,41+,42+,43+,44-,45-,46-/m1/s1
SMILES	CC12CC(=O)C3CC1(C3(C(O2)OCC4C(C(C(C(O4)OC56CC7C5(C8OC6(CC7(O8)O)C)COC(=O)C9=CC=CC=C9)O)O)O)COC(=O)C1=CC=CC=C1)OC1C(C(C(C(O1)CO)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	942.32	Volume:	870.917 ? Van der Waals volume.
Dense:	1.082	LogP:	0.637 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.179 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.82 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	51.0
TPSA:	305.35 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	8.0	Rings:	14.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.097	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.987	Fsp³:	0.674
MCE-18:	266.403 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.139	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.329 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.323	Promiscuous compounds:	0.001

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.545	MDCK Permeability:	-5.168
Pgp-inhibitor:	0.0	Pgp-substrate:	0.969
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.488
20% Bioavailability (F20%):	0.014	30% Bioavailability (F30%):	0.869
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.042	MRP1:	0.998
Plasma Protein Binding (PPB):	50.295%	Volume Distribution (VD):	-0.756
Fu:	86.244% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.894	BCRP inhibitor:	0.006
BSEP inhibitor:	0.519

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.172	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.995
HLM stability:	0.91 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.852

Half-life (T1/2):

3.381

ADMET: Toxicity

hERG Blockers:	0.091	hERG Blockers (10um):	0.503
Human Hepatotoxicity (H-HT):	0.14	Drug-induced Liver Injury (DILI):	0.21
AMES Toxicity:	0.762	Rat Oral Acute Toxicity:	0.4
Maximum Recommended Daily Dose:	0.489	Skin Sensitization:	0.023
Carcinogencity:	0.144	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.901	Ototoxicity:	0.998
Hematotoxicity:	0.004	Drug-induced Nephrotoxicity:	0.135
Genotoxicity:	0.442	RPMI-8226 Immunitoxicity:	0.171
A549 Cytotoxicity:	0.012	Hek293 Cytotoxicity:	0.944
BCF:	0.228 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.713 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.065 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.551 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO30226	Paeonia albiflora	Species	Paeoniaceae	Eukaryota	roots	n.a.	n.a.	PMID[19691309]
NPO30226	Paeonia albiflora	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO30226	Paeonia albiflora	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO30226	Paeonia albiflora	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	4
IC50	1

Activity Type	# Activity
Cell line	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT848	Cell line	N9	Homo sapiens	Inhibition	=	101.9	%	PMID[25681711]
NPT848	Cell line	N9	Homo sapiens	Inhibition	=	101.8	%	PMID[17291045]
NPT848	Cell line	N9	Homo sapiens	Inhibition	=	88.8	%	PMID[11430012]
NPT848	Cell line	N9	Homo sapiens	Inhibition	=	69.2	%	PMID[19880317]
NPT848	Cell line	N9	Homo sapiens	IC50	=	64700.0	nM	PMID[24144848]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC469421 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	15650
0.1-0.2	29610
0.2-0.3	4414
0.3-0.4	140
0.4-0.5	7
0.5-0.6	10
0.6-0.7	16
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8409	Intermediate Similarity	NPC469398
0.8295	Intermediate Similarity	NPC469420
0.7791	Intermediate Similarity	NPC303429
0.7791	Intermediate Similarity	NPC56594
0.7614	Intermediate Similarity	NPC34066
0.7614	Intermediate Similarity	NPC190862
0.7234	Intermediate Similarity	NPC469396
0.7234	Intermediate Similarity	NPC469458
0.7234	Intermediate Similarity	NPC149002
0.7111	Intermediate Similarity	NPC469417
0.6957	Remote Similarity	NPC293568
0.6957	Remote Similarity	NPC161626
0.6907	Remote Similarity	NPC80360
0.69	Remote Similarity	NPC478828
0.6832	Remote Similarity	NPC188217
0.6809	Remote Similarity	NPC88176
0.6702	Remote Similarity	NPC120012
0.6699	Remote Similarity	NPC477617
0.6667	Remote Similarity	NPC469419
0.6635	Remote Similarity	NPC478826
0.6635	Remote Similarity	NPC478827
0.6538	Remote Similarity	NPC478829
0.6465	Remote Similarity	NPC469418
0.6355	Remote Similarity	NPC469397
0.6337	Remote Similarity	NPC195114
0.6275	Remote Similarity	NPC148185
0.5657	Remote Similarity	NPC222102
0.5455	Remote Similarity	NPC469448
0.5446	Remote Similarity	NPC469422
0.5377	Remote Similarity	NPC469438
0.5253	Remote Similarity	NPC133430
0.5149	Remote Similarity	NPC469399
0.5098	Remote Similarity	NPC469477
0.5094	Remote Similarity	NPC469415
0.5051	Remote Similarity	NPC478832
0.5048	Remote Similarity	NPC117943

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC469421 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4578
0.1-0.2	4484
0.2-0.3	87
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data