NPASS Compound

Natural Product: NPC477188

Natural Product ID	NPC477188
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	[(1R,2R,6S,7S,8R,10S,11S,12R,16R,17R,18R)-6,7-dihydroxy-8-(hydroxymethyl)-4,18-dimethyl-14-[(1Z,3Z)-nona-1,3-dienyl]-5-oxo-16-prop-1-en-2-yl-9,13,15,19-tetraoxahexacyclo[12.4.1.01,11.02,6.08,10.012,16]nonadec-3-en-17-yl] benzoate
IUPAC Name	[(1R,2R,6S,7S,8R,10S,11S,12R,16R,17R,18R)-6,7-dihydroxy-8-(hydroxymethyl)-4,18-dimethyl-14-[(1Z,3Z)-nona-1,3-dienyl]-5-oxo-16-prop-1-en-2-yl-9,13,15,19-tetraoxahexacyclo[12.4.1.01,11.02,6.08,10.012,16]nonadec-3-en-17-yl] benzoate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	122180652
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001551] Diterpenoids [CHEMONTID:0003494] Rhamnofolane and daphnane diterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 91 97 0 0 0 0 0 0 0 0999 V2000 -13.1347 -8.3809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.1145 -7.2814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0942 -6.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0740 -5.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0537 -3.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0335 -2.8830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5711 -3.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1289 -4.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6665 -4.9840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6463 -3.8844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1839 -4.2182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1636 -3.1186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6058 -1.6852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4330 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4330 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6058 1.6852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0682 1.3515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7190 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0682 -1.3515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0884 -2.4510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2197 -2.9479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0522 -2.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1861 -4.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6194 -5.0606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0141 -5.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3934 -4.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1650 -7.0074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7151 -2.3570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1242 -2.8714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3833 -4.3488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2742 -1.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6832 -2.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8332 -1.4595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5741 0.0179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1651 0.5323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0151 -0.4308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4427 -0.5429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2054 0.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4732 1.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1523 2.3880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9510 3.8745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8247 2.3281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0812 0.2218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2566 3.0367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4120 1.9894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2569 3.2287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.0352 -9.4012 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.2343 -7.3607 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.1550 -9.4805 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2141 -6.2611 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0149 -8.3016 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9947 -7.2020 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1938 -5.1615 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1735 -4.0619 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9744 -6.1025 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1533 -2.9624 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9541 -5.0029 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4756 -1.4497 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5508 -2.1172 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1492 -5.7498 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2244 -6.4173 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3361 -3.0886 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1724 -2.1274 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8950 -1.4475 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5558 2.7564 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6007 -1.2135 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3083 -1.8650 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7133 -4.2854 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5936 -5.8284 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9276 -3.5269 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3243 -7.1865 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6542 -6.8283 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3440 -8.4967 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9423 -3.9001 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2422 -1.9739 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7241 0.9810 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9060 2.0098 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7724 0.4092 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2599 0.3796 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9389 -0.4368 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9777 0.8832 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2420 -0.8828 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1739 3.6795 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4755 0.9766 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1761 2.9789 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5831 0.1470 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4116 4.2760 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7151 2.9791 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6513 1.1444 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7528 3.1166 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 2 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 1 26 27 2 0 26 28 1 0 23 29 1 0 29 30 1 0 30 31 2 0 30 32 1 0 32 33 2 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 2 0 22 38 1 0 19 39 1 0 39 40 2 0 40 41 1 0 41 42 2 0 40 43 1 0 18 44 1 6 17 45 1 0 15 46 1 6 46 47 1 0 21 10 1 0 25 10 1 0 24 12 1 0 20 13 1 0 16 14 1 0 41 18 1 0 37 32 1 0 1 48 1 0 1 49 1 0 1 50 1 0 2 51 1 0 2 52 1 0 3 53 1 0 3 54 1 0 4 55 1 0 4 56 1 0 5 57 1 0 5 58 1 0 6 59 1 0 7 60 1 0 8 61 1 0 9 62 1 0 12 63 1 1 13 64 1 6 14 65 1 6 17 66 1 1 19 67 1 1 22 68 1 1 23 69 1 6 27 70 1 0 27 71 1 0 28 72 1 0 28 73 1 0 28 74 1 0 33 75 1 0 34 76 1 0 35 77 1 0 36 78 1 0 37 79 1 0 38 80 1 0 38 81 1 0 38 82 1 0 39 83 1 0 43 84 1 0 43 85 1 0 43 86 1 0 44 87 1 0 45 88 1 0 46 89 1 0 46 90 1 0 47 91 1 0 M END

Standard InCHIKey	CGSGRJNIABXQJQ-SIJGATCLSA-N
Standard InCHI	InChI=1S/C37H44O10/c1-6-7-8-9-10-11-15-18-34-45-30-26-29-33(20-38,44-29)32(41)35(42)25(19-22(4)27(35)39)37(26,47-34)23(5)28(36(30,46-34)21(2)3)43-31(40)24-16-13-12-14-17-24/h10-19,23,25-26,28-30,32,38,41-42H,2,6-9,20H2,1,3-5H3/b11-10-,18-15-/t23-,25-,26+,28-,29+,30-,32-,33+,34?,35-,36-,37+/m1/s1
SMILES	CCCCC/C=C\C=C/C12O[C@@H]3[C@@H]4[C@H]5[C@](O5)([C@H]([C@]6([C@H]([C@@]4(O1)[C@@H]([C@H]([C@]3(O2)C(=C)C)OC(=O)C7=CC=CC=C7)C)C=C(C6=O)C)O)O)CO

Calculated Properties

Physi-Chem Properties

Molecular Weight:	648.29	Volume:	652.787 ? Van der Waals volume.
Dense:	0.993	LogP:	4.454 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.0 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.378 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	35.0
TPSA:	144.28 ? Topological Polar Surface Area.	H-Bond Acceptor:	10.0
H-Bond Donor:	3.0	Rings:	7.0
Heavy Atoms:	10.0

MedChem Properties

QED Drug-Likeness Score:	0.113	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.696	Fsp³:	0.568
MCE-18:	163.862 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.732	Fluc inhibitor:	0.246 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.014 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.036 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.106	Promiscuous compounds:	0.189

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.37	MDCK Permeability:	-5.001
Pgp-inhibitor:	0.111	Pgp-substrate:	0.001
PAMPA:	0.033 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.107	30% Bioavailability (F30%):	0.91
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.985	MRP1:	0.996
Plasma Protein Binding (PPB):	95.889%	Volume Distribution (VD):	-0.076
Fu:	3.39% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.998
OATP1B3 inhibitor:	0.996	BCRP inhibitor:	0.038
BSEP inhibitor:	0.999

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.981
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.452
CYP2C9-inhibitor:	0.601	CYP2C9-substrate:	0.002
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.478 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

5.31

Half-life (T1/2):

0.845

ADMET: Toxicity

hERG Blockers:	0.154	hERG Blockers (10um):	0.532
Human Hepatotoxicity (H-HT):	0.222	Drug-induced Liver Injury (DILI):	0.068
AMES Toxicity:	0.939	Rat Oral Acute Toxicity:	0.21
Maximum Recommended Daily Dose:	0.177	Skin Sensitization:	1.0
Carcinogencity:	0.175	Eye Corrosion:	0.0
Eye Irritation:	0.164	Respiratory Toxicity:	0.165
Drug-induced Neurotoxicity:	0.338	Ototoxicity:	0.785
Hematotoxicity:	0.305	Drug-induced Nephrotoxicity:	0.435
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.174
A549 Cytotoxicity:	0.951	Hek293 Cytotoxicity:	0.946
BCF:	1.472 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.353 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.648 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.211 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO19476	Gnidia polycephala	Species	Thymelaeaceae	Eukaryota	roots	n.a.	n.a.	PMID[26091146]
NPO19476	Gnidia polycephala	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19476	Gnidia polycephala	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO19476	Gnidia polycephala	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	1

Activity Type	# Activity
Individual protein	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT98	Individual protein	HERG	Homo sapiens	Inhibition	=	42.5	%	PMID[26091146]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC477188 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8866
0.1-0.2	39023
0.2-0.3	1808
0.3-0.4	77
0.4-0.5	31
0.5-0.6	10
0.6-0.7	12
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	2
0.95-1	4

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC92598
1.0	High Similarity	NPC43304
1.0	High Similarity	NPC481753
1.0	High Similarity	NPC477190
0.9286	High Similarity	NPC164150
0.9286	High Similarity	NPC481754
0.7791	Intermediate Similarity	NPC182266
0.7791	Intermediate Similarity	NPC475154
0.7791	Intermediate Similarity	NPC485700
0.7766	Intermediate Similarity	NPC101786
0.7674	Intermediate Similarity	NPC223356
0.7674	Intermediate Similarity	NPC298697
0.7674	Intermediate Similarity	NPC475500
0.7674	Intermediate Similarity	NPC100017
0.7674	Intermediate Similarity	NPC481742
0.7586	Intermediate Similarity	NPC75831
0.7586	Intermediate Similarity	NPC471137
0.7528	Intermediate Similarity	NPC605479
0.7527	Intermediate Similarity	NPC481745
0.75	Intermediate Similarity	NPC471136
0.75	Intermediate Similarity	NPC116727
0.75	Intermediate Similarity	NPC39509
0.7416	Intermediate Similarity	NPC481744
0.7416	Intermediate Similarity	NPC481743
0.7188	Intermediate Similarity	NPC130886
0.7188	Intermediate Similarity	NPC486153
0.7159	Intermediate Similarity	NPC180902
0.7071	Intermediate Similarity	NPC481773
0.7045	Intermediate Similarity	NPC324104
0.7045	Intermediate Similarity	NPC473548
0.6698	Remote Similarity	NPC69240
0.6667	Remote Similarity	NPC474508
0.6667	Remote Similarity	NPC473485
0.6667	Remote Similarity	NPC171411
0.6667	Remote Similarity	NPC485701
0.6593	Remote Similarity	NPC485693
0.6556	Remote Similarity	NPC251564
0.6556	Remote Similarity	NPC477189
0.6535	Remote Similarity	NPC481774
0.6484	Remote Similarity	NPC475314
0.6484	Remote Similarity	NPC102997
0.6204	Remote Similarity	NPC191992
0.5978	Remote Similarity	NPC162495
0.5938	Remote Similarity	NPC61891
0.5914	Remote Similarity	NPC475606
0.54	Remote Similarity	NPC254588
0.5377	Remote Similarity	NPC68282
0.5377	Remote Similarity	NPC486154
0.5283	Remote Similarity	NPC251139
0.5283	Remote Similarity	NPC156682
0.5283	Remote Similarity	NPC49297
0.51	Remote Similarity	NPC322420

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC477188 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3406
0.1-0.2	5666
0.2-0.3	78
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data