Drug Information| Drug ID:   | NPD7782 |
| Drug Name:   | |
| Molecular Formula:   | C33H35NO13 |
| Canonical SMILES:   | COC1C(N)C(OC(C1O)C)OC1C(OC(C(C1(C)O)O)C)Oc1cccc2c1c1oc(=O)c3c4c1c(c2O)c(=O)oc4ccc3C |
| Standard InCHI:   | "InChI=1S/C33H35NO13/c1-11-9-10-16-19-17(11)29(38)46-25-18-14(24(36)21(20(19)25)30(39)44-16)7-6-8-15(18)45-32-28(33(4,40)27(37)13(3)43-32)47-31-22(34)26(41-5)23(35)12(2)42-31/h6-10,12-13,22-23,26-28,31-32,35-37,40H,34H2,1-5H3" |
| Standard InCHIKey:   | MGQRRMONVLMKJL-UHFFFAOYSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7782Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC538506 |
| High Similarity | 1.0 | NPC607738 |
| Remote Similarity | 0.6667 | NPC585854 |
| Remote Similarity | 0.6635 | NPC241847 |
| Remote Similarity | 0.6635 | NPC516210 |
| Remote Similarity | 0.6449 | NPC228806 |
| Remote Similarity | 0.6449 | NPC66835 |
| Remote Similarity | 0.6311 | NPC57466 |
| Remote Similarity | 0.6311 | NPC555012 |
| Molecular Weight   | 653.21 |
| ALogP   | -2.6307 |
| MLogP   | 3.55 |
| XLogP   | 1.703 |
| HDA   | 10 |
| HBD   | 5 |
| Rotatable Bonds   | 15 |
| TPSA   | 205.69 |
| RO5 Violation   | 0 |