Drug Information| Drug ID:   | NPD7090 |
| Drug Name:   | |
| Molecular Formula:   | C28H36N2O7 |
| Canonical SMILES:   | COc1cc(cc(c1O)OC)[C@H]1[C@H]2C(=O)OC[C@@H]2[C@@H](c2c1cc1OCOc1c2)CCN(CCN(C)C)C |
| Standard InCHI:   | "InChI=1S/C28H36N2O7/c1-29(2)8-9-30(3)7-6-17-18-12-21-22(37-15-36-21)13-19(18)25(26-20(17)14-35-28(26)32)16-10-23(33-4)27(31)24(11-16)34-5/h10-13,17,20,25-26,31H,6-9,14-15H2,1-5H3/t17-,20-,25-,26+/m1/s1" |
| Standard InCHIKey:   | KLCCMMSKRMSMKI-QVNMXXJYSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7090Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5513 | NPC30009 |
| Remote Similarity | 0.5513 | NPC103197 |
| Remote Similarity | 0.5443 | NPC91634 |
| Remote Similarity | 0.5443 | NPC150943 |
| Remote Similarity | 0.5443 | NPC268718 |
| Remote Similarity | 0.506 | NPC18980 |
| Remote Similarity | 0.506 | NPC163527 |
| Remote Similarity | 0.506 | NPC8838 |
| Molecular Weight   | 512.25 |
| ALogP   | -1.3526 |
| MLogP   | 3.55 |
| XLogP   | 1.708 |
| HDA   | 4 |
| HBD   | 1 |
| Rotatable Bonds   | 15 |
| TPSA   | 89.93 |
| RO5 Violation   | 0 |