Drug Information| Drug ID:   | NPD7680 |
| Drug Name:   | Teniposide |
| Molecular Formula:   | C32H32O13S |
| Canonical SMILES:   | COc1cc(cc(c1O)OC)[C@H]1[C@H]2C(=O)OC[C@@H]2[C@@H](c2c1cc1OCOc1c2)O[C@@H]1O[C@@H]2CO[C@H](O[C@H]2[C@@H]([C@H]1O)O)c1cccs1 |
| Standard InCHI:   | "InChI=1S/C32H32O13S/c1-37-19-6-13(7-20(38-2)25(19)33)23-14-8-17-18(42-12-41-17)9-15(14)28(16-10-39-30(36)24(16)23)44-32-27(35)26(34)29-21(43-32)11-40-31(45-29)22-4-3-5-46-22/h3-9,16,21,23-24,26-29,31-35H,10-12H2,1-2H3/t16-,21+,23+,24-,26+,27+,28+,29+,31+,32-/m0/s1" |
| Standard InCHIKey:   | NRUKOCRGYNPUPR-QBPJDGROSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD7680Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC473803 |
| High Similarity | 1.0 | NPC611936 |
| Intermediate Similarity | 0.7423 | NPC185498 |
| Intermediate Similarity | 0.7423 | NPC599833 |
| Remote Similarity | 0.6566 | NPC116759 |
| Remote Similarity | 0.6566 | NPC14294 |
| Remote Similarity | 0.6566 | NPC40370 |
| Remote Similarity | 0.6286 | NPC179240 |
| Remote Similarity | 0.5701 | NPC236125 |
| Remote Similarity | 0.5631 | NPC152424 |
| Remote Similarity | 0.5631 | NPC183435 |
| Remote Similarity | 0.5631 | NPC282185 |
| Remote Similarity | 0.5631 | NPC305954 |
| Remote Similarity | 0.5631 | NPC301351 |
| Remote Similarity | 0.5619 | NPC100465 |
| Remote Similarity | 0.5413 | NPC306475 |
| Remote Similarity | 0.5413 | NPC40278 |
| Remote Similarity | 0.5413 | NPC167910 |
| Remote Similarity | 0.5413 | NPC603930 |
| Molecular Weight   | 656.16 |
| ALogP   | -2.3208 |
| MLogP   | 3.44 |
| XLogP   | 1.374 |
| HDA   | 8 |
| HBD   | 3 |
| Rotatable Bonds   | 11 |
| TPSA   | 189.07 |
| RO5 Violation   | 0 |