NPASS Compound

Natural Product: NPC25768

Natural Product ID	NPC25768
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	QDISWXTVLYHRCQ-PYVDIHNFSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1076616
PubChem CID	46185591
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001550] Sesquiterpenoids [CHEMONTID:0002051] Agarofurans

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 85 89 0 0 0 0 0 0 0 0999 V2000 -3.2486 0.2943 4.3959 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3167 0.3866 2.9232 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0913 1.1499 2.3018 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4827 -0.4097 2.1651 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4613 -0.4054 0.7483 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.1487 0.2049 0.2380 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.1587 0.0446 -1.2539 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4016 0.7182 -1.7996 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0282 0.6860 -1.9164 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0912 0.3868 -3.4074 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1595 -1.0604 -3.7063 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5226 -1.4573 -3.1048 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1019 -1.4248 -1.6402 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9023 -2.3304 -0.7898 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7373 -3.3062 -1.6410 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8233 -1.7098 0.1778 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9803 -2.6319 1.2721 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1466 -3.2589 1.5974 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1774 -3.0213 0.8930 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3095 -4.2062 2.7203 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0203 -3.1904 -0.0879 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2422 -1.7788 -1.6122 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7044 -1.9827 -2.8864 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1806 -1.7370 -3.0330 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4606 -3.4081 -3.3902 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2319 0.2815 -1.2909 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1873 1.1035 -0.7713 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0261 2.3367 -0.8357 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4033 0.5282 -0.1371 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3269 1.3165 0.3655 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5323 0.8033 0.9949 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4737 1.7031 1.5089 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6222 1.2731 2.1099 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9235 -0.0735 2.2465 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9976 -0.9566 1.7410 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8380 -0.5256 1.1342 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2392 1.6171 0.4651 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4094 2.3433 1.2651 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5055 1.7265 1.8593 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5748 3.8042 1.4316 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2693 4.5282 2.2424 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1125 5.8986 2.3956 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9041 6.5392 1.7243 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7529 5.8493 0.9166 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5767 4.4842 0.7798 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2036 0.1263 4.7575 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5826 1.2440 4.9001 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9178 -0.5343 4.7303 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2285 0.3446 0.4531 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2919 -0.2676 0.6952 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2042 1.2521 -2.7444 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2952 0.0851 -1.8050 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6381 1.5534 -1.0692 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0566 1.7838 -1.8528 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6473 0.9975 -3.9325 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0835 0.6908 -3.7556 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1177 -1.2325 -4.7720 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2570 -0.6777 -3.3647 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8285 -2.4416 -3.4501 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5102 -2.7858 -2.2062 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2802 -3.9293 -0.8689 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1295 -4.0152 -2.1974 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8575 -1.6769 -0.2828 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2313 -5.2329 2.2920 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3354 -4.1301 3.1302 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5748 -4.0434 3.5338 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0428 -2.9438 0.8571 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7431 -1.8693 -2.0621 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4362 -0.7773 -3.5182 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6714 -2.5092 -3.7002 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2250 -4.0770 -2.5538 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4037 -3.8455 -3.8388 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2638 -3.4425 -4.2281 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5309 -0.5409 -0.0877 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1557 2.4026 0.2937 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2359 2.7622 1.4011 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3379 1.9743 2.5008 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8321 -0.4153 2.7222 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2179 -2.0279 1.8398 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1614 -1.2621 0.7631 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0588 4.0373 2.7651 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7691 6.4853 3.0315 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0618 7.6136 1.8167 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5745 6.2898 0.3585 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2418 3.9024 0.1388 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 6 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 14 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 14 21 1 1 13 22 1 6 22 23 1 0 23 24 1 0 23 25 1 0 9 26 1 0 26 27 1 0 27 28 2 0 27 29 1 0 29 30 2 0 30 31 1 0 31 32 2 0 32 33 1 0 33 34 2 0 34 35 1 0 35 36 2 0 6 37 1 0 37 38 1 0 38 39 2 0 38 40 1 0 40 41 2 0 41 42 1 0 42 43 2 0 43 44 1 0 44 45 2 0 16 5 1 0 36 31 1 0 45 40 1 0 13 7 1 0 23 11 1 0 1 46 1 0 1 47 1 0 1 48 1 0 5 49 1 6 6 50 1 1 8 51 1 0 8 52 1 0 8 53 1 0 9 54 1 6 10 55 1 0 10 56 1 0 11 57 1 6 12 58 1 0 12 59 1 0 15 60 1 0 15 61 1 0 15 62 1 0 16 63 1 6 20 64 1 0 20 65 1 0 20 66 1 0 21 67 1 0 24 68 1 0 24 69 1 0 24 70 1 0 25 71 1 0 25 72 1 0 25 73 1 0 29 74 1 0 30 75 1 0 32 76 1 0 33 77 1 0 34 78 1 0 35 79 1 0 36 80 1 0 41 81 1 0 42 82 1 0 43 83 1 0 44 84 1 0 45 85 1 0 M END

Standard InCHIKey	QDISWXTVLYHRCQ-PYVDIHNFSA-N
Standard InCHI	InChI=1S/C35H40O10/c1-21(36)41-28-29(44-31(39)24-15-11-8-12-16-24)33(5)26(43-27(38)18-17-23-13-9-7-10-14-23)19-25-20-35(33,45-32(25,3)4)34(6,40)30(28)42-22(2)37/h7-18,25-26,28-30,40H,19-20H2,1-6H3/b18-17+/t25-,26+,28+,29+,30+,33-,34+,35-/m1/s1
SMILES	CC(=O)O[C@H]1[C@@H]([C@@]2(C)[C@H](C[C@@H]3C[C@@]2([C@](C)([C@H]1OC(=O)C)O)OC3(C)C)OC(=O)/C=C/c1ccccc1)OC(=O)c1ccccc1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	620.26	Volume:	630.035 ? Van der Waals volume.
Dense:	0.984	LogP:	3.754 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.323 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.261 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	31.0
TPSA:	134.66 ? Topological Polar Surface Area.	H-Bond Acceptor:	10.0
H-Bond Donor:	1.0	Rings:	5.0
Heavy Atoms:	10.0

MedChem Properties

QED Drug-Likeness Score:	0.269	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.85	Fsp³:	0.486
MCE-18:	168.077 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.835	Fluc inhibitor:	0.916 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.016 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.436 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.151	Promiscuous compounds:	0.272

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.388	MDCK Permeability:	-4.824
Pgp-inhibitor:	1.0	Pgp-substrate:	0.011
PAMPA:	0.402 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.492	30% Bioavailability (F30%):	0.969
50% Bioavailability (F50%):	0.986

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.967
Plasma Protein Binding (PPB):	91.07%	Volume Distribution (VD):	-0.114
Fu:	10.923% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.99	BCRP inhibitor:	0.004
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.724
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.047
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.253
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.002	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.509 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

6.808

Half-life (T1/2):

0.626

ADMET: Toxicity

hERG Blockers:	0.037	hERG Blockers (10um):	0.302
Human Hepatotoxicity (H-HT):	0.271	Drug-induced Liver Injury (DILI):	0.715
AMES Toxicity:	0.435	Rat Oral Acute Toxicity:	0.28
Maximum Recommended Daily Dose:	0.536	Skin Sensitization:	0.997
Carcinogencity:	0.301	Eye Corrosion:	0.019
Eye Irritation:	0.437	Respiratory Toxicity:	0.18
Drug-induced Neurotoxicity:	0.42	Ototoxicity:	0.27
Hematotoxicity:	0.136	Drug-induced Nephrotoxicity:	0.853
Genotoxicity:	0.557	RPMI-8226 Immunitoxicity:	0.039
A549 Cytotoxicity:	0.249	Hek293 Cytotoxicity:	0.276
BCF:	0.761 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.909 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.281 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.97 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[20146433]
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	fruits	n.a.	n.a.	PMID[21856049]
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[27541714]
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	5

Activity Type	# Activity
Cell line	1
Others	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT80	Cell line	Raji	Homo sapiens	Activity	=	60.0	%	PMID[22050318]
NPT2	Others	Unspecified	n.a.	Activity	=	11.8	%	PMID[21489793]
NPT2	Others	Unspecified	n.a.	Activity	=	53.2	%	PMID[7911157]
NPT2	Others	Unspecified	n.a.	Activity	=	86.3	%	PMID[9513595]
NPT2	Others	Unspecified	n.a.	Activity	=	100.0	%	PMID[18809945]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC25768 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	10574
0.1-0.2	35651
0.2-0.3	2888
0.3-0.4	634
0.4-0.5	65
0.5-0.6	26
0.6-0.7	10
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7763	Intermediate Similarity	NPC483878
0.7564	Intermediate Similarity	NPC469349
0.7342	Intermediate Similarity	NPC483861
0.7308	Intermediate Similarity	NPC483867
0.7294	Intermediate Similarity	NPC483891
0.725	Intermediate Similarity	NPC188865
0.725	Intermediate Similarity	NPC171525
0.6375	Remote Similarity	NPC214550
0.6353	Remote Similarity	NPC483871
0.6322	Remote Similarity	NPC86800
0.631	Remote Similarity	NPC483860
0.6235	Remote Similarity	NPC483859
0.6129	Remote Similarity	NPC483880
0.6129	Remote Similarity	NPC156941
0.6104	Remote Similarity	NPC152440
0.6104	Remote Similarity	NPC483882
0.6104	Remote Similarity	NPC483888
0.593	Remote Similarity	NPC174982
0.5897	Remote Similarity	NPC483879
0.5862	Remote Similarity	NPC184817
0.5824	Remote Similarity	NPC483873
0.5747	Remote Similarity	NPC483865
0.5632	Remote Similarity	NPC483866
0.5632	Remote Similarity	NPC473109
0.55	Remote Similarity	NPC37641
0.55	Remote Similarity	NPC114927
0.5393	Remote Similarity	NPC483881
0.5393	Remote Similarity	NPC470231
0.5375	Remote Similarity	NPC84129
0.5349	Remote Similarity	NPC473085
0.5341	Remote Similarity	NPC472571
0.5281	Remote Similarity	NPC70403
0.5281	Remote Similarity	NPC177940
0.5238	Remote Similarity	NPC473889
0.5227	Remote Similarity	NPC29704
0.5227	Remote Similarity	NPC470157
0.5222	Remote Similarity	NPC125106
0.5222	Remote Similarity	NPC472573
0.5181	Remote Similarity	NPC475933
0.5169	Remote Similarity	NPC470159
0.5161	Remote Similarity	NPC473214
0.5111	Remote Similarity	NPC483889
0.5057	Remote Similarity	NPC473082

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC25768 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4019
0.1-0.2	5009
0.2-0.3	121
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data