NPASS Compound

Natural Product: NPC470157

Natural Product ID	NPC470157
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	FXJPPIJUTVUQRL-XDVWIUBESA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1796135
PubChem CID	44598261
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001550] Sesquiterpenoids [CHEMONTID:0002051] Agarofurans

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 79 83 0 0 0 0 0 0 0 0999 V2000 2.5845 0.9223 -0.9536 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3169 0.2442 0.0460 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1811 -0.5884 -0.1774 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4728 -0.6191 -1.3850 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3774 -1.9182 -2.0845 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.1025 -2.2789 -2.3728 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.2360 -3.3539 -3.1797 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5534 -2.4341 -0.9659 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8861 -1.0083 -0.5421 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8989 -0.0146 -1.0462 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6266 1.0447 -0.1492 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7451 2.3796 -0.4714 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1222 2.6100 -1.6475 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4795 3.4899 0.4041 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0592 3.3601 1.7113 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1775 4.4682 2.4985 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0031 5.7562 2.0090 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4135 5.8942 0.7139 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6421 4.7837 -0.0479 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2211 -0.6468 -1.1992 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1036 -0.9712 0.9442 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.1412 -2.3302 1.5814 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9142 -3.3463 0.8258 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5739 -3.4340 -0.6476 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8333 -3.5211 -1.4074 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3369 -0.3480 1.2824 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4250 0.7443 2.0967 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3778 1.2359 2.5795 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7760 1.3164 2.3837 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4246 -2.9225 -0.3036 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6252 -3.0789 -1.1395 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7224 -4.3298 -1.9359 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9334 -2.9672 -0.3799 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9139 0.1552 1.3125 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9734 0.7713 1.7150 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7641 1.6525 0.9470 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3633 2.7155 1.6630 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2515 3.5956 1.0983 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6044 3.4805 -0.2117 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0600 2.4729 -0.9520 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1515 1.5770 -0.3582 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9884 0.0996 -2.0689 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9698 -1.9957 -3.0154 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4794 -1.3894 -2.9033 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8360 -3.1746 -3.9362 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2163 0.4132 -2.0325 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0786 2.3701 2.0982 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5114 4.3808 3.5373 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1745 6.6404 2.5822 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5713 6.8868 0.2632 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9753 4.9391 -1.0818 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0513 -0.6538 -0.4748 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3887 -1.1858 -2.1343 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2050 0.4318 -1.5584 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2387 -0.4378 1.4375 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1186 -2.6854 1.9050 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6695 -2.1990 2.5731 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7683 -4.3276 1.3620 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0168 -3.1392 0.9719 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0974 -4.4535 -0.7738 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2510 -4.5566 -1.1894 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6737 -2.8797 -1.0469 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7343 -3.5274 -2.5115 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0249 2.0617 1.5971 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8604 1.7075 3.4049 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5486 0.5089 2.2794 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1165 -4.9968 -1.9719 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9829 -4.0580 -2.9942 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5987 -4.9829 -1.6294 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6659 -2.4244 -0.9764 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4053 -3.9955 -0.2530 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8090 -2.6445 0.6706 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4099 -0.5315 2.0634 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3127 0.5811 2.7963 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1330 2.8721 2.7085 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7000 4.4118 1.6800 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3101 4.1986 -0.6217 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3470 2.3919 -1.9871 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8612 0.7850 -1.0239 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 2 0 12 14 1 0 14 15 2 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 2 0 9 20 1 6 9 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 21 26 1 0 26 27 1 0 27 28 2 0 27 29 1 0 8 30 1 1 30 31 1 0 31 32 1 0 31 33 1 0 2 34 1 0 34 35 2 0 35 36 1 0 36 37 2 0 37 38 1 0 38 39 2 0 39 40 1 0 40 41 2 0 10 4 1 0 19 14 1 0 41 36 1 0 31 5 1 0 24 8 1 0 4 42 1 6 5 43 1 6 6 44 1 6 7 45 1 0 10 46 1 6 15 47 1 0 16 48 1 0 17 49 1 0 18 50 1 0 19 51 1 0 20 52 1 0 20 53 1 0 20 54 1 0 21 55 1 1 22 56 1 0 22 57 1 0 23 58 1 0 23 59 1 0 24 60 1 1 25 61 1 0 25 62 1 0 25 63 1 0 29 64 1 0 29 65 1 0 29 66 1 0 32 67 1 0 32 68 1 0 32 69 1 0 33 70 1 0 33 71 1 0 33 72 1 0 34 73 1 0 35 74 1 0 37 75 1 0 38 76 1 0 39 77 1 0 40 78 1 0 41 79 1 0 M END

Standard InCHIKey	FXJPPIJUTVUQRL-XDVWIUBESA-N
Standard InCHI	InChI=1S/C33H38O8/c1-20-16-18-24(38-21(2)34)32(5)29(40-30(37)23-14-10-7-11-15-23)27(26-28(36)33(20,32)41-31(26,3)4)39-25(35)19-17-22-12-8-6-9-13-22/h6-15,17,19-20,24,26-29,36H,16,18H2,1-5H3/b19-17-/t20-,24+,26-,27+,28-,29+,32+,33-/m1/s1
SMILES	O=C(O[C@H]1[C@@H]2[C@@H](O)[C@]3([C@@]([C@H]1OC(=O)c1ccccc1)(C)[C@H](CC[C@H]3C)OC(=O)C)OC2(C)C)/C=Cc1ccccc1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	562.26	Volume:	580.499 ? Van der Waals volume.
Dense:	0.969	LogP:	3.677 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.374 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.126 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	30.0
TPSA:	108.36 ? Topological Polar Surface Area.	H-Bond Acceptor:	8.0
H-Bond Donor:	1.0	Rings:	5.0
Heavy Atoms:	8.0

MedChem Properties

QED Drug-Likeness Score:	0.306	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.653	Fsp³:	0.485
MCE-18:	155.714 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.849	Fluc inhibitor:	0.831 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.041 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.356 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.078	Promiscuous compounds:	0.152

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.243	MDCK Permeability:	-4.92
Pgp-inhibitor:	0.993	Pgp-substrate:	0.01
PAMPA:	0.518 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.215	30% Bioavailability (F30%):	0.472
50% Bioavailability (F50%):	0.987

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.828	MRP1:	0.958
Plasma Protein Binding (PPB):	97.525%	Volume Distribution (VD):	-0.432
Fu:	1.879% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.996	BCRP inhibitor:	0.01
BSEP inhibitor:	0.982

ADMET: Metabolism

CYP1A2-inhibitor:	0.001	CYP1A2-substrate:	0.413
CYP2C19-inhibitor:	0.001	CYP2C19-substrate:	0.615
CYP2C9-inhibitor:	0.005	CYP2C9-substrate:	0.013
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.006
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.284
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.824 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

7.496

Half-life (T1/2):

0.633

ADMET: Toxicity

hERG Blockers:	0.091	hERG Blockers (10um):	0.651
Human Hepatotoxicity (H-HT):	0.235	Drug-induced Liver Injury (DILI):	0.347
AMES Toxicity:	0.449	Rat Oral Acute Toxicity:	0.072
Maximum Recommended Daily Dose:	0.264	Skin Sensitization:	1.0
Carcinogencity:	0.123	Eye Corrosion:	0.007
Eye Irritation:	0.887	Respiratory Toxicity:	0.121
Drug-induced Neurotoxicity:	0.446	Ototoxicity:	0.12
Hematotoxicity:	0.008	Drug-induced Nephrotoxicity:	0.634
Genotoxicity:	0.103	RPMI-8226 Immunitoxicity:	0.058
A549 Cytotoxicity:	0.717	Hek293 Cytotoxicity:	0.665
BCF:	0.962 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.875 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.246 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.905 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO15653	Celastrus vulcanicola	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[18616221]
NPO15653	Celastrus vulcanicola	Species	Celastraceae	Eukaryota	stems	Montecristo National Park, province of Santa Ana, El Salvador	2004-JUN	PMID[20873773]
NPO15653	Celastrus vulcanicola	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21419633]
NPO15653	Celastrus vulcanicola	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25695368]
NPO15653	Celastrus vulcanicola	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	2

Activity Type	# Activity
Organism	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT88	Organism	Mycobacterium tuberculosis	Mycobacterium tuberculosis	MIC	=	25.0	ug.mL-1	PMID[22079864]
NPT790	Organism	Mycobacterium tuberculosis H37Rv	Mycobacterium tuberculosis H37Rv	MIC	>	25.0	ug.mL-1	PMID[12542359]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC470157 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8255
0.1-0.2	36664
0.2-0.3	4196
0.3-0.4	597
0.4-0.5	99
0.5-0.6	32
0.6-0.7	8
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC29704
0.806	Intermediate Similarity	NPC118080
0.7632	Intermediate Similarity	NPC70403
0.7632	Intermediate Similarity	NPC177940
0.7	Intermediate Similarity	NPC301556
0.6835	Remote Similarity	NPC470159
0.6625	Remote Similarity	NPC472571
0.6622	Remote Similarity	NPC470158
0.6447	Remote Similarity	NPC483846
0.6265	Remote Similarity	NPC125106
0.6265	Remote Similarity	NPC472573
0.6145	Remote Similarity	NPC483866
0.6081	Remote Similarity	NPC100913
0.5974	Remote Similarity	NPC87448
0.5926	Remote Similarity	NPC210591
0.5833	Remote Similarity	NPC603877
0.5595	Remote Similarity	NPC470153
0.5584	Remote Similarity	NPC483863
0.5517	Remote Similarity	NPC174982
0.5476	Remote Similarity	NPC488909
0.5476	Remote Similarity	NPC488905
0.5455	Remote Similarity	NPC171525
0.5402	Remote Similarity	NPC605086
0.5341	Remote Similarity	NPC483865
0.5294	Remote Similarity	NPC488914
0.5287	Remote Similarity	NPC475122
0.5287	Remote Similarity	NPC483878
0.5281	Remote Similarity	NPC483859
0.5281	Remote Similarity	NPC184817
0.525	Remote Similarity	NPC483847
0.525	Remote Similarity	NPC470152
0.5233	Remote Similarity	NPC481050
0.5233	Remote Similarity	NPC609221
0.5227	Remote Similarity	NPC25768
0.519	Remote Similarity	NPC211137
0.519	Remote Similarity	NPC66761
0.519	Remote Similarity	NPC483843
0.5169	Remote Similarity	NPC483861
0.5169	Remote Similarity	NPC483860
0.5125	Remote Similarity	NPC84129
0.5111	Remote Similarity	NPC188865
0.5111	Remote Similarity	NPC488916
0.5062	Remote Similarity	NPC311175
0.5052	Remote Similarity	NPC294579
0.5052	Remote Similarity	NPC144779

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC470157 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3171
0.1-0.2	5781
0.2-0.3	197
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data