Drug Information| Drug ID:   | NPD164 |
| Drug Name:   | Dimethyl Phthalate |
| Molecular Formula:   | C10H10O4 |
| Canonical SMILES:   | COC(=O)c1ccccc1C(=O)OC |
| Standard InCHI:   | "InChI=1S/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3" |
| Standard InCHIKey:   | NIQCNGHVCWTJSM-UHFFFAOYSA-N |
| Max Developmental Stage:   | Pre-clinical |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD164Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC31786 |
| Intermediate Similarity | 0.7143 | NPC45613 |
| Intermediate Similarity | 0.7083 | NPC593208 |
| Remote Similarity | 0.68 | NPC564393 |
| Remote Similarity | 0.625 | NPC119271 |
| Remote Similarity | 0.625 | NPC300748 |
| Remote Similarity | 0.6207 | NPC20754 |
| Remote Similarity | 0.6154 | NPC174099 |
| Remote Similarity | 0.6087 | NPC608341 |
| Remote Similarity | 0.6087 | NPC509471 |
| Remote Similarity | 0.5556 | NPC214067 |
| Remote Similarity | 0.5455 | NPC203925 |
| Remote Similarity | 0.5455 | NPC527653 |
| Remote Similarity | 0.5455 | NPC572984 |
| Remote Similarity | 0.5333 | NPC143524 |
| Remote Similarity | 0.5294 | NPC496771 |
| Remote Similarity | 0.5294 | NPC572769 |
| Remote Similarity | 0.5294 | NPC580168 |
| Remote Similarity | 0.5294 | NPC580412 |
| Remote Similarity | 0.5294 | NPC592428 |
| Remote Similarity | 0.5185 | NPC183860 |
| Remote Similarity | 0.5185 | NPC89886 |
| Remote Similarity | 0.5185 | NPC101245 |
| Remote Similarity | 0.5172 | NPC10251 |
| Remote Similarity | 0.5172 | NPC271027 |
| Remote Similarity | 0.5143 | NPC297048 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 194.06 |
| ALogP   | 0.0224 |
| MLogP   | 2.12 |
| XLogP   | 2.334 |
| HDA   | 4 |
| HBD   | 0 |
| Rotatable Bonds   | 6 |
| TPSA   | 52.6 |
| RO5 Violation   | 0 |