Drug Information| Drug ID:   | NPD6858 |
| Drug Name:   | Nandrolone Phenpropionate |
| Molecular Formula:   | C27H34O3 |
| Canonical SMILES:   | O=C(O[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12)CCc1ccccc1 |
| Standard InCHI:   | "InChI=1S/C27H34O3/c1-27-16-15-22-21-11-9-20(28)17-19(21)8-10-23(22)24(27)12-13-25(27)30-26(29)14-7-18-5-3-2-4-6-18/h2-6,17,21-25H,7-16H2,1H3/t21-,22+,23+,24-,25-,27-/m0/s1" |
| Standard InCHIKey:   | UBWXUGDQUBIEIZ-QNTYDACNSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6858Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6618 | NPC612035 |
| Remote Similarity | 0.5571 | NPC108896 |
| Remote Similarity | 0.5278 | NPC5441 |
| Remote Similarity | 0.5139 | NPC75643 |
| Remote Similarity | 0.507 | NPC323765 |
| TTD   | DNAP001664; DAP000903 |
| DrugBank   | DB00984 |
| ChEMBL   | CHEMBL1200412 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA164746281 |
| KEGG Drug   | D00956 |
| PubChem CID   | 229455 |
| ChEBI   | 7468 |
| CAS Number   | 62-90-8 |
| Molecular Weight   | 406.25 |
| ALogP   | 0.3428 |
| MLogP   | 4.1 |
| XLogP   | 7.692 |
| HDA   | 3 |
| HBD   | 0 |
| Rotatable Bonds   | 6 |
| TPSA   | 43.37 |
| RO5 Violation   | 1 |