Drug Information| Drug ID:   | NPD7094 |
| Drug Name:   | testosterone phenylpropionate |
| Molecular Formula:   | C28H36O3 |
| Canonical SMILES:   | O=C(O[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@]12C)CCc1ccccc1 |
| Standard InCHI:   | "InChI=1S/C28H36O3/c1-27-16-14-21(29)18-20(27)9-10-22-23-11-12-25(28(23,2)17-15-24(22)27)31-26(30)13-8-19-6-4-3-5-7-19/h3-7,18,22-25H,8-17H2,1-2H3/t22-,23-,24-,25-,27-,28-/m0/s1" |
| Standard InCHIKey:   | HHSXYDOROIURIP-FEZCWRLCSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD7094Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6984 | NPC323765 |
| Remote Similarity | 0.6618 | NPC291149 |
| Remote Similarity | 0.6618 | NPC611589 |
| Remote Similarity | 0.5316 | NPC329433 |
| Remote Similarity | 0.5286 | NPC215755 |
| Remote Similarity | 0.5068 | NPC322676 |
| Molecular Weight   | 420.27 |
| ALogP   | 0.7279 |
| MLogP   | 4.21 |
| XLogP   | 8.104 |
| HDA   | 3 |
| HBD   | 0 |
| Rotatable Bonds   | 7 |
| TPSA   | 43.37 |
| RO5 Violation   | 1 |