Drug Information| Drug ID:   | NPD7058 |
| Drug Name:   | "prednisolone sodium metazoate (COLAL), Alizyme" |
| Molecular Formula:   | C28H32O9S |
| Canonical SMILES:   | O=C1C=C[C@]2(C(=C1)CC[C@@H]1[C@@H]2[C@@H](O)C[C@]2([C@H]1CC[C@]2(O)C(=O)COC(=O)c1cccc(c1)S(=O)(=O)[O-])C)C |
| Standard InCHI:   | "InChI=1S/C28H32O9S/c1-26-10-8-18(29)13-17(26)6-7-20-21-9-11-28(33,27(21,2)14-22(30)24(20)26)23(31)15-37-25(32)16-4-3-5-19(12-16)38(34,35)36/h3-5,8,10,12-13,20-22,24,30,33H,6-7,9,11,14-15H2,1-2H3,(H,34,35,36)/p-1/t20-,21-,22-,24+,26-,27-,28-/m0/s1" |
| Standard InCHIKey:   | WVKSUFYQOHQCMM-YGZHYJPASA-M |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7058Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6456 | NPC44063 |
| Remote Similarity | 0.6456 | NPC235800 |
| Remote Similarity | 0.6456 | NPC611921 |
| Remote Similarity | 0.5625 | NPC334061 |
| Remote Similarity | 0.5625 | NPC611819 |
| Remote Similarity | 0.506 | NPC530777 |
| Molecular Weight   | 543.17 |
| ALogP   | -1.7078 |
| MLogP   | 3.44 |
| XLogP   | 1.664 |
| HDA   | 9 |
| HBD   | 2 |
| Rotatable Bonds   | 11 |
| TPSA   | 166.48 |
| RO5 Violation   | 0 |