NPASS drugs

Drug Information

Drug ID:	NPD7801
Drug Name:
Molecular Formula:	C33H40N2O12
Canonical SMILES:	OCC(=O)[C@@]1(O)C[C@H](OC2OC(C)C(C(C2)N=C([C@H](CC(C)C)N)O)O)c2c(C1)c(O)c1c(c2O)C(=O)c2c(C1=O)cccc2OC
Standard InCHI:	"InChI=1S/C33H40N2O12/c1-13(2)8-17(34)32(43)35-18-9-22(46-14(3)27(18)38)47-20-11-33(44,21(37)12-36)10-16-24(20)31(42)26-25(29(16)40)28(39)15-6-5-7-19(45-4)23(15)30(26)41/h5-7,13-14,17-18,20,22,27,36,38,40,42,44H,8-12,34H2,1-4H3,(H,35,43)/t14?,17-,18?,20-,22?,27?,33-/m0/s1"
Standard InCHIKey:	HROXIDVVXKDCBD-BPNCSAMRSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD7801

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	51648
0.1-0.2	156374
0.2-0.3	3516
0.3-0.4	113
0.4-0.5	29
0.5-0.6	36
0.6-0.7	16
0.7-0.8	6
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7234	NPC261012
Intermediate Similarity	0.7234	NPC314738
Intermediate Similarity	0.7234	NPC23467
Intermediate Similarity	0.7234	NPC599904
Intermediate Similarity	0.7158	NPC468994
Intermediate Similarity	0.7158	NPC599791
Remote Similarity	0.6562	NPC55094
Remote Similarity	0.6562	NPC109403
Remote Similarity	0.6562	NPC37318
Remote Similarity	0.6562	NPC559703
Remote Similarity	0.6562	NPC612087
Remote Similarity	0.6495	NPC487573
Remote Similarity	0.6495	NPC611676
Remote Similarity	0.6176	NPC593984
Remote Similarity	0.6176	NPC600087
Remote Similarity	0.602	NPC503116
Remote Similarity	0.6019	NPC524103
Remote Similarity	0.6019	NPC551304
Remote Similarity	0.6019	NPC573717
Remote Similarity	0.6019	NPC587726
Remote Similarity	0.6	NPC510219
Remote Similarity	0.6	NPC572620
Remote Similarity	0.598	NPC580365
Remote Similarity	0.598	NPC594153
Remote Similarity	0.596	NPC532268
Remote Similarity	0.596	NPC574720
Remote Similarity	0.596	NPC582713
Remote Similarity	0.596	NPC603200
Remote Similarity	0.5941	NPC549797
Remote Similarity	0.5941	NPC601855
Remote Similarity	0.5905	NPC512117
Remote Similarity	0.5905	NPC548113
Remote Similarity	0.5905	NPC567919
Remote Similarity	0.5741	NPC558539
Remote Similarity	0.5741	NPC559618
Remote Similarity	0.5741	NPC573204
Remote Similarity	0.5619	NPC498484
Remote Similarity	0.5472	NPC555495
Remote Similarity	0.5472	NPC579843
Remote Similarity	0.5439	NPC544248
Remote Similarity	0.5439	NPC583546
Remote Similarity	0.5439	NPC586088
Remote Similarity	0.5417	NPC496202
Remote Similarity	0.5417	NPC532430
Remote Similarity	0.5417	NPC597507
Remote Similarity	0.5385	NPC515159
Remote Similarity	0.5385	NPC517461
Remote Similarity	0.5385	NPC569191
Remote Similarity	0.5306	NPC569653
Remote Similarity	0.5306	NPC611971
Remote Similarity	0.5304	NPC522051
Remote Similarity	0.5246	NPC256596
Remote Similarity	0.5246	NPC307834
Remote Similarity	0.5217	NPC496533
Remote Similarity	0.5217	NPC582117
Remote Similarity	0.521	NPC99361
Remote Similarity	0.521	NPC577128
Remote Similarity	0.5172	NPC530848

Drug Structure

NPD7801 OpenBabel08211712032D 55 59 0 0 1 0 0 0 0 0999 V2000 -7.7942 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6603 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9282 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 3.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7942 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 3.0000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0622 -0.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3301 1.5000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 1.7321 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5000 3.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 1.5000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 1.7321 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 2.5000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 2.5981 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1962 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 3.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0622 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.1962 1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 4.7321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 4.7321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1962 3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5000 3.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 2.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1962 -2.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9282 -2.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 4.7321 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1962 4.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 2.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -0.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 -0.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 3.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 13 1 0 0 0 0 2 13 1 0 0 0 0 3 14 1 0 0 0 0 4 45 1 0 0 0 0 5 6 2 0 0 0 0 5 7 1 0 0 0 0 6 15 1 0 0 0 0 7 19 2 0 0 0 0 8 13 1 0 0 0 0 9 18 1 0 0 0 0 9 22 1 0 0 0 0 10 16 1 0 0 0 0 10 33 1 0 0 0 0 11 20 1 0 0 0 0 11 33 1 0 0 0 0 12 21 1 0 0 0 0 12 36 1 0 0 0 0 14 27 1 0 0 0 0 14 46 1 0 0 0 0 15 23 2 0 0 0 0 15 28 1 0 0 0 0 16 24 1 0 0 0 0 16 29 2 0 0 0 0 17 8 1 1 0 0 0 17 32 1 0 0 0 0 17 34 1 0 0 0 0 18 27 1 0 0 0 0 18 35 1 0 0 0 0 19 23 1 0 0 0 0 19 45 1 0 0 0 0 20 24 1 0 0 0 0 20 47 1 1 0 0 0 21 37 2 0 0 0 0 22 46 1 0 0 0 0 22 47 1 0 0 0 0 23 30 1 0 0 0 0 24 31 2 0 0 0 0 25 26 2 0 0 0 0 25 28 1 0 0 0 0 25 29 1 0 0 0 0 26 30 1 0 0 0 0 26 31 1 0 0 0 0 27 38 1 0 0 0 0 28 39 2 0 0 0 0 29 40 1 0 0 0 0 30 41 2 0 0 0 0 31 42 1 0 0 0 0 32 35 2 3 0 0 0 32 43 1 0 0 0 0 33 21 1 6 0 0 0 33 44 1 0 0 0 0 34 48 1 0 0 0 0 34 49 1 0 0 0 0 36 50 1 0 0 0 0 38 51 1 0 0 0 0 40 52 1 0 0 0 0 42 53 1 0 0 0 0 43 54 1 0 0 0 0 44 55 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB005041
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	656.26
ALogP	-3.9411
MLogP	3.55
XLogP	-0.491
HDA	11
HBD	7
Rotatable Bonds	20
TPSA	238.66
RO5 Violation	2