Natural Product: NPC611971| Natural Product ID | NPC611971 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| XDXDZDZNSLXDNA-TZNDIEGXSA-N |
| IUPAC Name | n.a. |
| Synonyms | |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL1117 |
| PubChem CID | n.a. |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | XDXDZDZNSLXDNA-TZNDIEGXSA-N |
| Standard InCHI | InChI=1S/C26H27NO9/c1-10-21(29)15(27)7-17(35-10)36-16-9-26(34,11(2)28)8-14-18(16)25(33)20-19(24(14)32)22(30)12-5-3-4-6-13(12)23(20)31/h3-6,10,15-17,21,29,32-34H,7-9,27H2,1-2H3/t10-,15-,16-,17-,21+,26-/m0/s1 |
| SMILES | CC(=O)[C@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](O[C@H]2C[C@H](N)[C@H](O)[C@H](C)O2)C1)C(=O)c1ccccc1C3=O |
  Calculated Properties
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO53222 | Streptomyces peucetius var. caesius | Genus | Streptomycetaceae | Bacteria | n.a. | n.a. | n.a. | Database[COCONUT] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | n.a. | 29092.9 | nM | PubChem BioAssay data set |
| NPT198 | Individual protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 6309.6 | nM | PubChem BioAssay data set |
| NPT257 | Individual protein | Arachidonate 15-lipoxygenase | Oryctolagus cuniculus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT260 | Individual protein | Melanocortin receptor 5 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT252 | Individual protein | Histamine H2 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT239 | Individual protein | Cholecystokinin A receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT245 | Individual protein | Dopamine D4 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2769 | Individual protein | Thromboxane A2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT14 | Individual protein | Tyrosine-protein kinase FYN | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT135 | Individual protein | Chromobox protein homolog 1 | Homo sapiens | Potency | n.a. | 39810.7 | nM | PubChem BioAssay data set |
| NPT297 | Individual protein | Neurokinin 1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT105 | Individual protein | Muscleblind-like protein 1 | Homo sapiens | Potency | n.a. | 7943.3 | nM | PubChem BioAssay data set |
| NPT1038 | Individual protein | Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT286 | Individual protein | Receptor protein-tyrosine kinase erbB-2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | Potency | n.a. | 11220.2 | nM | PubChem BioAssay data set |
| NPT301 | Individual protein | Vascular endothelial growth factor receptor 1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT280 | Individual protein | Matrix metalloproteinase 9 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT289 | Individual protein | Serotonin 1b (5-HT1b) receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT275 | Individual protein | Progesterone receptor | Bos taurus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT300 | Individual protein | Thromboxane-A synthase | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT220 | Individual protein | Alpha-1b adrenergic receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | AC50 | = | 17000.0 | nM | PMID[37468498] |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT265 | Individual protein | Muscarinic acetylcholine receptor M4 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT287 | Individual protein | Leukocyte common antigen | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT298 | Individual protein | Neurokinin 2 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT240 | Individual protein | Cytochrome P450 2A6 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT241 | Individual protein | Cytochrome P450 2E1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT260 | Individual protein | Melanocortin receptor 5 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT274 | Individual protein | Platelet activating factor receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT14 | Individual protein | Tyrosine-protein kinase FYN | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT264 | Individual protein | Muscarinic acetylcholine receptor M3 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT279 | Individual protein | Leukocyte elastase | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT13 | Individual protein | Tyrosine-protein kinase LCK | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT182 | Individual protein | Protein kinase C alpha | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT239 | Individual protein | Cholecystokinin A receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT264 | Individual protein | Muscarinic acetylcholine receptor M3 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT273 | Individual protein | Phosphodiesterase 5A | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT276 | Individual protein | Angiotensin-converting enzyme | Oryctolagus cuniculus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT269 | Individual protein | Nitric-oxide synthase, brain | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT199 | Individual protein | DNA polymerase kappa | Homo sapiens | Potency | n.a. | 26679.5 | nM | PubChem BioAssay data set |
| NPT272 | Individual protein | Kappa opioid receptor | Homo sapiens | AC50 | = | 14000.1 | nM | PMID[37468498] |
| NPT276 | Individual protein | Angiotensin-converting enzyme | Oryctolagus cuniculus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT289 | Individual protein | Serotonin 1b (5-HT1b) receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT300 | Individual protein | Thromboxane-A synthase | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT237 | Individual protein | Interleukin-8 receptor A | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT233 | Individual protein | Carbonic anhydrase II | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT220 | Individual protein | Alpha-1b adrenergic receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | AC50 | = | 18999.8 | nM | PMID[37468498] |
| NPT1038 | Individual protein | Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 19952.6 | nM | PubChem BioAssay data set |
| NPT272 | Individual protein | Kappa opioid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT104 | Individual protein | Cerebroside-sulfatase | Homo sapiens | Potency | n.a. | 11995.5 | nM | PubChem BioAssay data set |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | AC50 | = | 23000.1 | nM | PMID[37468498] |
| NPT303 | Individual protein | Vasopressin V1a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT252 | Individual protein | Histamine H2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT236 | Individual protein | C-C chemokine receptor type 5 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT237 | Individual protein | Interleukin-8 receptor A | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1163 | Individual protein | Glutamate (NMDA) receptor subunit zeta 1 | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT266 | Individual protein | Muscarinic acetylcholine receptor M5 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT256 | Individual protein | Cysteinyl leukotriene receptor 1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT182 | Individual protein | Protein kinase C alpha | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT13 | Individual protein | Tyrosine-protein kinase LCK | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT219 | Individual protein | Alpha-1a adrenergic receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT298 | Individual protein | Neurokinin 2 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1623 | Individual protein | DNA polymerase III | Bacillus subtilis (strain 168) | Potency | n.a. | 1062.1 | nM | PubChem BioAssay data set |
| NPT199 | Individual protein | DNA polymerase kappa | Homo sapiens | Potency | n.a. | 7943.3 | nM | PubChem BioAssay data set |
| NPT269 | Individual protein | Nitric-oxide synthase, brain | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1594 | Individual protein | Multidrug resistance-associated protein 1 | Homo sapiens | Activity | = | 52.0 | % | PMID[9188796] |
| NPT245 | Individual protein | Dopamine D4 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT283 | Individual protein | MAP kinase p38 alpha | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT285 | Individual protein | Epidermal growth factor receptor erbB1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT286 | Individual protein | Receptor protein-tyrosine kinase erbB-2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1410 | Individual protein | GABA receptor alpha-1 subunit | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1098 | Individual protein | Eyes absent homolog 2 | Homo sapiens | Potency | n.a. | 125892.5 | nM | PubChem BioAssay data set |
| NPT273 | Individual protein | Phosphodiesterase 5A | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT296 | Individual protein | Sigma opioid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT274 | Individual protein | Platelet activating factor receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT275 | Individual protein | Progesterone receptor | Bos taurus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT257 | Individual protein | Arachidonate 15-lipoxygenase | Oryctolagus cuniculus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT256 | Individual protein | Cysteinyl leukotriene receptor 1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT259 | Individual protein | Melanocortin receptor 4 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT236 | Individual protein | C-C chemokine receptor type 5 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | = | 1995.3 | nM | PubChem BioAssay data set |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT241 | Individual protein | Cytochrome P450 2E1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT281 | Individual protein | MAP kinase ERK1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT301 | Individual protein | Vascular endothelial growth factor receptor 1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT255 | Individual protein | Leukotriene C4 synthase | Cavia porcellus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT234 | Individual protein | C-C chemokine receptor type 2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT248 | Individual protein | Estrogen receptor beta | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT253 | Individual protein | HMG-CoA reductase | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT229 | Individual protein | Angiotensin II type 2 (AT-2) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT240 | Individual protein | Cytochrome P450 2A6 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT277 | Individual protein | Caspase-1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | Potency | n.a. | 2909.1 | nM | PubChem BioAssay data set |
| NPT288 | Individual protein | Serotonin 1a (5-HT1a) receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT293 | Individual protein | Serotonin 4 (5-HT4) receptor | Cavia porcellus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT303 | Individual protein | Vasopressin V1a receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT303 | Individual protein | Vasopressin V1a receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT294 | Individual protein | Serotonin 6 (5-HT6) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT285 | Individual protein | Epidermal growth factor receptor erbB1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT230 | Individual protein | Bradykinin B2 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT259 | Individual protein | Melanocortin receptor 4 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT248 | Individual protein | Estrogen receptor beta | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT267 | Individual protein | Neuropeptide Y receptor type 1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2719 | Individual protein | Voltage-gated L-type calcium channel alpha-1C subunit | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT235 | Individual protein | C-C chemokine receptor type 4 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT235 | Individual protein | C-C chemokine receptor type 4 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT293 | Individual protein | Serotonin 4 (5-HT4) receptor | Cavia porcellus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Potency | = | 22387.2 | nM | PubChem BioAssay data set |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT279 | Individual protein | Leukocyte elastase | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT233 | Individual protein | Carbonic anhydrase II | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT281 | Individual protein | MAP kinase ERK1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT234 | Individual protein | C-C chemokine receptor type 2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT264 | Individual protein | Muscarinic acetylcholine receptor M3 | Homo sapiens | AC50 | = | 14000.1 | nM | PMID[37468498] |
| NPT1197 | Individual protein | Huntingtin | Homo sapiens | Potency | = | 631.0 | nM | PubChem BioAssay data set |
| NPT267 | Individual protein | Neuropeptide Y receptor type 1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT277 | Individual protein | Caspase-1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT287 | Individual protein | Leukocyte common antigen | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT266 | Individual protein | Muscarinic acetylcholine receptor M5 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT272 | Individual protein | Kappa opioid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | AC50 | = | 17999.9 | nM | PMID[37468498] |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | AC50 | = | 15000.0 | nM | PMID[37468498] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT255 | Individual protein | Leukotriene C4 synthase | Cavia porcellus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT253 | Individual protein | HMG-CoA reductase | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | AC50 | = | 7300.0 | nM | PMID[37468498] |
| NPT239 | Individual protein | Cholecystokinin A receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT267 | Individual protein | Neuropeptide Y receptor type 1 | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT227 | Individual protein | Beta-3 adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT247 | Individual protein | Endothelin receptor ET-A | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT247 | Individual protein | Endothelin receptor ET-A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT230 | Individual protein | Bradykinin B2 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT1044 | Individual protein | DNA topoisomerase II alpha | Homo sapiens | IC50 | = | 2.6 | nM | PMID[37847948] |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | AC50 | = | 110.0 | nM | PMID[37468498] |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | AC50 | = | 10999.9 | nM | PMID[37468498] |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | AC50 | = | 8700.0 | nM | PMID[37468498] |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | AC50 | = | 17000.0 | nM | PMID[37468498] |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1464 | Individual protein | Phosphodiesterase 4D | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1647 | Individual protein | Vasopressin V2 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | AC50 | = | 20000.0 | nM | PMID[37468498] |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | AC50 | = | 10000.0 | nM | PMID[37468498] |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | AC50 | = | 9299.9 | nM | PMID[37468498] |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT1005 | Individual protein | Tumor susceptibility gene 101 protein | Homo sapiens | Potency | n.a. | 7943.3 | nM | PubChem BioAssay data set |
| NPT198 | Individual protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 8912.5 | nM | PubChem BioAssay data set |
| NPT294 | Individual protein | Serotonin 6 (5-HT6) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT296 | Individual protein | Sigma opioid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT227 | Individual protein | Beta-3 adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT221 | Individual protein | Alpha-1d adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT284 | Individual protein | Serine/threonine protein phosphatase 2B catalytic subunit, alpha isoform | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT297 | Individual protein | Neurokinin 1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT252 | Individual protein | Histamine H2 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT247 | Individual protein | Endothelin receptor ET-A | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT229 | Individual protein | Angiotensin II type 2 (AT-2) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT230 | Individual protein | Bradykinin B2 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2879 | Individual protein | Equilibrative nucleoside transporter 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | AC50 | = | 10000.0 | nM | PMID[37468498] |
| NPT221 | Individual protein | Alpha-1d adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT219 | Individual protein | Alpha-1a adrenergic receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT278 | Individual protein | Cathepsin G | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT280 | Individual protein | Matrix metalloproteinase 9 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT283 | Individual protein | MAP kinase p38 alpha | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT284 | Individual protein | Serine/threonine protein phosphatase 2B catalytic subunit, alpha isoform | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT288 | Individual protein | Serotonin 1a (5-HT1a) receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT265 | Individual protein | Muscarinic acetylcholine receptor M4 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT278 | Individual protein | Cathepsin G | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT796 | Individual protein | Peripheral myelin protein 22 | Homo sapiens | Potency | = | 425.6 | nM | PubChem BioAssay data set |
| NPT9 | Individual protein | DNA polymerase eta | Homo sapiens | Potency | n.a. | 14125.4 | nM | PubChem BioAssay data set |
| NPT58 | Individual protein | Bloom syndrome protein | Homo sapiens | Potency | = | 6461.8 | nM | PubChem BioAssay data set |
| NPT537 | Individual protein | Ras-related protein Rab-9A | Homo sapiens | Potency | = | 58047.9 | nM | PubChem BioAssay data set |
| NPT5301 | Individual protein | Motilin receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 17782.8 | nM | PubChem BioAssay data set |
| NPT803 | Individual protein | Flap endonuclease 1 | Homo sapiens | Potency | n.a. | 26679.5 | nM | PubChem BioAssay data set |
| NPT58 | Individual protein | Bloom syndrome protein | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT483 | Individual protein | Prelamin-A/C | Homo sapiens | Potency | = | 316.2 | nM | PubChem BioAssay data set |
| NPT987 | Individual protein | Histamine H3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT483 | Individual protein | Prelamin-A/C | Homo sapiens | Potency | = | 251.2 | nM | PubChem BioAssay data set |
| NPT893 | Individual protein | Monoamine oxidase B | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[18834112] |
| NPT800 | Individual protein | M-phase phosphoprotein 8 | Homo sapiens | Potency | n.a. | 28183.8 | nM | PubChem BioAssay data set |
| NPT940 | Individual protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Potency | = | 11668.1 | nM | PubChem BioAssay data set |
| NPT940 | Individual protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Potency | = | 414.0 | nM | PubChem BioAssay data set |
| NPT98 | Individual protein | HERG | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT68 | Individual protein | Aldose reductase | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT69 | Individual protein | Matrix metalloproteinase-1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT29498 | Single protein | Interleukin-8 receptor B | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT444 | Individual protein | Ubiquitin carboxyl-terminal hydrolase 1 | Homo sapiens | Potency | n.a. | 39810.7 | nM | PubChem BioAssay data set |
| NPT538 | Individual protein | Niemann-Pick C1 protein | Homo sapiens | Potency | = | 115820.8 | nM | PubChem BioAssay data set |
| NPT800 | Individual protein | M-phase phosphoprotein 8 | Homo sapiens | Potency | n.a. | 29934.9 | nM | PubChem BioAssay data set |
| NPT4358 | Individual protein | Type-1 angiotensin II receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT98 | Individual protein | HERG | Homo sapiens | AC50 | = | 20700.0 | nM | PMID[37468498] |
| NPT940 | Individual protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Potency | = | 2328.1 | nM | PubChem BioAssay data set |
| NPT69 | Individual protein | Matrix metalloproteinase-1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 26679.5 | nM | PubChem BioAssay data set |
| NPT29498 | Single protein | Interleukin-8 receptor B | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -16.45 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT444 | Individual protein | Ubiquitin carboxyl-terminal hydrolase 1 | Homo sapiens | Potency | n.a. | 50118.7 | nM | PubChem BioAssay data set |
| NPT940 | Individual protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Potency | = | 10399.2 | nM | PubChem BioAssay data set |
| NPT98 | Individual protein | HERG | Homo sapiens | Potency | n.a. | 10000.0 | nM | PubChem BioAssay data set |
| NPT4729 | Individual protein | Cholecystokinin B receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT68 | Individual protein | Aldose reductase | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | 9.63 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 13.17 | % | Identification of inhibitors of SARS-Cov2 M-Pro enzymatic activity using a small molecule repurposing screen |
| NPT29430 | Single protein | Neuronal acetylcholine receptor protein alpha-4 subunit | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT54 | Individual protein | Nonstructural protein 1 | Influenza A virus | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT98 | Individual protein | HERG | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | AC50 | = | 5800.0 | nM | PMID[37468498] |
| NPT698 | Individual protein | Regulator of G-protein signaling 4 | Homo sapiens | Potency | n.a. | 37685.8 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 7943.3 | nM | PubChem BioAssay data set |
| NPT46 | Individual protein | Thyroid hormone receptor beta-1 | Homo sapiens | Potency | = | 44668.4 | nM | PubChem BioAssay data set |
| NPT583 | Individual protein | Inositol monophosphatase 1 | Rattus norvegicus | Potency | = | 1995.3 | nM | PubChem BioAssay data set |
| NPT755 | Individual protein | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | Homo sapiens | Potency | n.a. | 26854.5 | nM | PubChem BioAssay data set |
| NPT445 | Individual protein | Peripheral myelin protein 22 | Rattus norvegicus | Potency | n.a. | 99.9 | nM | PubChem BioAssay data set |
| NPT20859 | Single protein | Neuropeptide Y receptor type 2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT20859 | Single protein | Neuropeptide Y receptor type 2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT478 | Individual protein | Ataxin-2 | Homo sapiens | Potency | n.a. | 19952.6 | nM | PubChem BioAssay data set |
| NPT8 | Individual protein | DNA polymerase iota | Homo sapiens | Potency | n.a. | 7943.3 | nM | PubChem BioAssay data set |
| NPT794 | Individual protein | Endonuclease 4 | Escherichia coli K-12 | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT30107 | Single protein | Amyloid-beta A4 protein | Homo sapiens | Potency | n.a. | 23109.3 | nM | PubChem BioAssay data set |
| NPT59 | Individual protein | DNA polymerase beta | Homo sapiens | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT478 | Individual protein | Ataxin-2 | Homo sapiens | Potency | n.a. | 100.0 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 3548.1 | nM | PubChem BioAssay data set |
| NPT445 | Individual protein | Peripheral myelin protein 22 | Rattus norvegicus | Potency | n.a. | 3219.7 | nM | PubChem BioAssay data set |
| NPT5975 | Individual protein | Cyclooxygenase-1 | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT46 | Individual protein | Thyroid hormone receptor beta-1 | Homo sapiens | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT93 | Individual protein | Survival motor neuron protein | Homo sapiens | Potency | = | 631.0 | nM | PubChem BioAssay data set |
| NPT29582 | Single protein | Son of sevenless homolog 1 | Homo sapiens | IC50 | = | 6000.0 | nM | PMID[36987571] |
| NPT5104 | Individual protein | Phosphodiesterase 3A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT28814 | Single protein | Ghrelin receptor | Homo sapiens | AC50 | = | 7700.0 | nM | PMID[37468498] |
| NPT892 | Individual protein | Monoamine oxidase A | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[18834112] |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT47 | Individual protein | ATP-dependent DNA helicase Q1 | Homo sapiens | Potency | = | 11220.2 | nM | PubChem BioAssay data set |
| NPT47 | Individual protein | ATP-dependent DNA helicase Q1 | Homo sapiens | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT5 | Individual protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 12589.3 | nM | PubChem BioAssay data set |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT543 | Individual protein | Pregnane X receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT29442 | Protein complex group | Glycine receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT28550 | Single protein | Vasoactive intestinal polypeptide receptor 1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT443 | Individual protein | Histone acetyltransferase GCN5 | Homo sapiens | Potency | n.a. | 22387.2 | nM | PubChem BioAssay data set |
| NPT28398 | Single protein | Insulin receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT64 | Individual protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 5802.4 | nM | PubChem BioAssay data set |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT62 | Individual protein | 6-phospho-1-fructokinase | Trypanosoma brucei | Potency | n.a. | 30131.3 | nM | PubChem BioAssay data set |
| NPT45 | Individual protein | Ubiquitin carboxyl-terminal hydrolase 2 | Homo sapiens | Potency | = | 16481.6 | nM | PubChem BioAssay data set |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT28398 | Single protein | Insulin receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT5 | Individual protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 3162.3 | nM | PubChem BioAssay data set |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 19952.6 | nM | PubChem BioAssay data set |
| NPT64 | Individual protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 580.2 | nM | PubChem BioAssay data set |
| NPT442 | Individual protein | Ferritin light chain | Equus caballus | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT47 | Individual protein | ATP-dependent DNA helicase Q1 | Homo sapiens | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT5 | Individual protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 13371.4 | nM | PubChem BioAssay data set |
| NPT30010 | Single protein | Calcitonin receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30010 | Single protein | Calcitonin receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT425 | Individual protein | Serotonin 3a (5-HT3a) receptor | Homo sapiens | AC50 | = | 12999.9 | nM | PMID[37468498] |
| NPT29442 | Protein complex group | Glycine receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | AC50 | = | 17999.9 | nM | PMID[37468498] |
| NPT28550 | Single protein | Vasoactive intestinal polypeptide receptor 1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 12300.0 | nM | PMID[22586124] |
| NPT1160 | Cell line | BJ | Homo sapiens | Activity | = | 100.0 | % | PMID[33513390] |
| NPT111 | Cell line | K562 | Homo sapiens | GI50 | = | 3300.0 | nM | PMID[25420175] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 2.0 | nM | PMID[10425093] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 4500.0 | nM | PMID[24900668] |
| NPT71 | Cell line | HEK293 | Homo sapiens | Potency | n.a. | 56.2 | nM | PubChem BioAssay data set |
| NPT2502 | Cell line | MEL-JUSO | Homo sapiens | IC50 | = | 89.0 | nM | PMID[37561481] |
| NPT1160 | Cell line | BJ | Homo sapiens | Inhibition | = | 100.0 | % | PMID[34157390] |
| NPT519 | Cell line | SH-SY5Y | Homo sapiens | Potency | n.a. | 19952.6 | nM | PubChem BioAssay data set |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 27.0 | nM | PMID[37561481] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 7300.0 | nM | PMID[24900668] |
| NPT1045 | Cell line | U2OS | Homo sapiens | IC50 | = | 24.0 | nM | PMID[37561481] |
| NPT71 | Cell line | HEK293 | Homo sapiens | Potency | n.a. | 259.2 | nM | PubChem BioAssay data set |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 12.0 | nM | PMID[18076140] |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | = | 56.2 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 82.0 | % | PMID[33324471] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT28438 | Unchecked | Unchecked | n.a. | Ac50 | n.a. | 1.122 | uM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (malignant tumour) | = | 0.0 | n.a. | PMID[15646539] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 0.71 | nM | PMID[19734910] |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | = | 562.3 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 1000.0 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | > | 5000.0 | nM | PMID[22586124] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 250000.0 | nM | PMID[33324471] |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | n.a. | 39.8 | nM | PubChem BioAssay data set |
| NPT20912 | Phenotype | Phospholipidosis | n.a. | Phospholipidosis | n.a. | n.a. | n.a. | PMID[20020916] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 3294.4 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 1.05 | nM | PMID[19734910] |
| NPT28438 | Unchecked | Unchecked | n.a. | ALB_CHANGE | n.a. | n.a. | n.a. | FDA drug approval package for Epirubicin (NDA: 21-010 and 50-778) |
| NPT28438 | Unchecked | Unchecked | n.a. | AC50 | n.a. | 28190.0 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Incidence | n.a. | n.a. | n.a. | FDA drug approval package for Epirubicin (NDA: 21-010 and 50-778) |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (comment) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | WBC_CHANGE | = | 35.0 | % | FDA drug approval package for Epirubicin (NDA: 21-010 and 50-778) |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | n.a. | n.a. | % | PMID[17417631] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 7300.0 | nM | PMID[23591260] |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | n.a. | 707.9 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 1258.93 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 1.26 | nM | PMID[19734910] |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | n.a. | 32196.8 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | = | 3981.1 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Imax | = | 590.0 | % | PMID[23591260] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 5.0 | n.a. | PMID[24900668] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 1970.0 | nM | PMID[24900668] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 890.0 | nM | PMID[24900668] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 3696.4 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (acute) | = | 1.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | = | 17782.8 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 1.41 | nM | PMID[19734910] |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | n.a. | 2003.1 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 3793.3 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Ac50 | n.a. | 31.62 | uM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | n.a. | 1122.0 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | WBC_CHANGE | = | 55.0 | % | FDA drug approval package for Epirubicin (NDA: 21-010 and 50-778) |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 3.0 | n.a. | PMID[24900668] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 700.0 | nM | PMID[23591260] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 33000.0 | nM | Cytopathic SARS-Cov2 screening on VERO-E6 cells in a large repurposing effort |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 10.21 | % | Cytopathic SARS-Cov2 screening on VERO-E6 cells in a large repurposing effort |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | n.a. | 61078.1 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 1.0 | nM | PMID[19734910] |
| NPT28438 | Unchecked | Unchecked | n.a. | AC50 | n.a. | 31622.8 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 1.17 | nM | PMID[19734910] |
| NPT28438 | Unchecked | Unchecked | n.a. | WBC_CHANGE | = | 50.0 | % | FDA drug approval package for Epirubicin (NDA: 21-010 and 50-778) |
| NPT28438 | Unchecked | Unchecked | n.a. | AC50 | n.a. | 1122.0 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | n.a. | 100391.6 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Ac50 | n.a. | 28.18 | uM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 100.0 | % | PMID[32945666] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 630.96 | nM | PMID[19734910] |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | = | 794.3 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Imax | = | 100.0 | % | PMID[23591260] |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | n.a. | 5804.8 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 2685.5 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | n.a. | 410.8 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (cytolytic) | = | 1.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (association with vascular disease) | = | 1.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (cirrhosis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (steatosis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (chronic liver disease) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (severe hepatitis) | = | 2.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (choleostasis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (successful reintroduction) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Potency | = | 707.9 | nM | PubChem BioAssay data set |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Potency | = | 1000.0 | nM | PubChem BioAssay data set |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | PHOSLPD_CHANGE | n.a. | n.a. | n.a. | FDA drug approval package for Epirubicin (NDA: 21-010 and 50-778) |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (acute) | = | 0.0 | % | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Potency | = | 1258.9 | nM | PubChem BioAssay data set |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | CHOL_CHANGE | n.a. | n.a. | n.a. | FDA drug approval package for Epirubicin (NDA: 21-010 and 50-778) |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | TRIG_CHANGE | n.a. | n.a. | n.a. | FDA drug approval package for Epirubicin (NDA: 21-010 and 50-778) |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 2300.0 | nM | PMID[24900668] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | n.a. | n.a. | n.a. | PMID[24900668] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Potency | = | 1584.9 | nM | PubChem BioAssay data set |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (mechanism) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 3200.0 | nM | PMID[24900668] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Potency | = | 1122.0 | nM | PubChem BioAssay data set |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (moderate) | = | 7.0 | n.a. | PMID[15646539] |
| NPT22224 | Cell line | Vero C1008 | Chlorocebus sabaeus | CC50 | = | 200.0 | nM | Cytopathic SARS-Cov2 screening on VERO-E6 cells in a large repurposing effort |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (benign tumour) | = | 0.0 | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (moderate) | = | 18.2 | % | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (time to onset) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (granulomatous hepatitis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (animal toxicity known) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT28513 | Organism | Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | IC50 | = | 3610.0 | nM | PMID[19786608] |
| NPT28513 | Organism | Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | MIC | = | 25000.0 | nM | PMID[19786608] |
| NPT28513 | Organism | Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | IC50 | = | 6680.0 | nM | PMID[19786608] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | DILI_Concern | n.a. | n.a. | n.a. | PMID[26948801] |
| NPT28513 | Organism | Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | MIC | = | 12500.0 | nM | PMID[19786608] |
| NPT474 | Organism | Plasmodium berghei | Plasmodium berghei | IC50 | = | 6620.0 | nM | PMID[22586124] |
| NPT28513 | Organism | Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | IC50 | = | 5130.0 | nM | PMID[19786608] |
| NPT29533 | Protein-protein interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 1778.3 | nM | PubChem BioAssay data set |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | SGPT Increase - Number of Reports | < | 4.0 | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | GGT Increase - Number of Reports | < | 4.0 | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | SGPT Increase - Index Value | = | 0.0 | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_hepatomegaly | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_liver function tests abnormal | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_cholecystitis | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_cholelithiasis | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | Composite Activity - Active | = | 0.0 | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | LDH Increase - Number of Reports | < | 4.0 | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | GGT Increase - Index Value | = | 0.0 | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | Alkaline Phosphatase Increase - Index Value | = | 0.0 | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_jaundice | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | SGOT Increase - Number of Reports | < | 4.0 | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | SGPT Increase - Activity Score | n.a. | n.a. | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_cirrhosis | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | Alkaline Phosphatase Increase - Number of Reports | < | 4.0 | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | Composite Activity - Score | n.a. | n.a. | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | Alkaline Phosphatase Increase - Activity Score | n.a. | n.a. | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_bilirubinemia | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_hepatic necrosis | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_liver fatty | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | SGOT Increase - Activity Score | n.a. | n.a. | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_hepatic failure | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | Composite Activity - Marginal | = | 0.0 | n.a. | PMID[16472241] |
| NPT29533 | Protein-protein interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_Combined Scores | = | 0.0 | n.a. | PMID[22194678] |
| NPT29533 | Protein-protein interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | SGOT Increase - Index Value | = | 0.0 | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | GGT Increase - Activity Score | n.a. | n.a. | n.a. | PMID[16472241] |
| NPT29533 | Protein-protein interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 4466.8 | nM | PubChem BioAssay data set |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | LDH Increase - Index Value | = | 0.0 | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | LDH Increase - Activity Score | n.a. | n.a. | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_liver disease | = | 0.0 | n.a. | PMID[22194678] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT28438 | Unchecked | Unchecked | n.a. | Mortality | n.a. | n.a. | n.a. | FDA drug approval package for Epirubicin (NDA: 21-010 and 50-778) |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_hepatitis | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_elevated liver function tests | = | 0.0 | n.a. | PMID[22194678] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1493.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 20.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 0.078 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 0.0467 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 66.9 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 1.8 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 62500.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 309000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 1.73 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 13.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 298.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 119.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 261.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1807.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 223.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 368700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5470000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 62.25 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 2.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASO | = | 0.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 40000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1165.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 0.0525 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 1.33 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 23.57 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 2.33 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 158.83 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 23.87 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 123.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 38.75 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 326700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 2.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 6.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 4289.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 4.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 104.25 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 0.32 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 0.47 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 0.27 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 113.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 148.0 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 106.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 2.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 635.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 57800.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1359000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 0.82 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 76.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.46 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 259.25 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 694.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 62000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 0.66 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 7.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.62 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 1.58 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 35.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 91.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.58 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 190.25 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 130700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 2.1 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 6680000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 13820.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 3.52 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASO | = | 0.28 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.2 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 59.76 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.72 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 6.6 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASO | = | 0.32 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 32500.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 112.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 2.17 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 135000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 17620.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 45.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 62200.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 149.2 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 3.13 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASO | = | 0.1 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1144500.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 136600.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.38 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 911500.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 151.0 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 31.75 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 134000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 150.5 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1755.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 9903.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 97.5 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 102.67 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 80.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 1.33 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.16 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 668.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 89.5 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 370700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 33.3 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1456.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 2.95 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 93.33 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 1052.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 1.4 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 7460000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 94.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 372300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 30.67 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 47.3 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 23.9 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBCNUC | = | 0.0 | /100WBC | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 145.2 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.35 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1433.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 126000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 0.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5740000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 8.67 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 13190.83 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Tissue Severity Score | n.a. | n.a. | n.a. | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 87.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 540.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 42000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.4 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 149300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.58 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 247.67 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 47.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 193.67 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 580.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.23 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 8.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 156.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 4277.67 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 42200.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 60500.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 31.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 89.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 55300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 234.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 180.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 76.3 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 13570.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.18 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 595.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 434.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 0.52 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 8.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 106.0 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 2.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 389.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 25670000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 390.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 153.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 1.67 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 15130.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 7.17 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 2.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 11870.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 311.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 135.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 138500.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 55.4 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 6.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 673.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 111.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 88.83 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 8.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 306500.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 272.4 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1861.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5730000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1656.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 93.67 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 200.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 119.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 16.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 62.03 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 63.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.03 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 40800.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 185.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 536.83 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 951.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5050000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 5.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 33.23 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 6530000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 64.38 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 102.2 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 27.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 205.25 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 143.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 125.75 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 349.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 1.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 58.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 63.25 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 63.75 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 96.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 13.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 7.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASO | = | 0.4 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 41.83 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 74.43 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 41.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 108.25 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 65.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1710.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 22.48 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 105.75 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 0.67 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 200.25 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 84.22 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 17.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 0.28 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 9.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 26000000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 2.1 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 36250000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 19.93 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 64.17 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 18.63 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 314500.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 15650.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 63400.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 337.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 20.73 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 42800.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 1527.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 52.25 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 41.48 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 61000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 36200.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 13940.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 104.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 148.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 72.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.6 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 4.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 146.03 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 58.67 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 71.83 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 20.25 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 59.02 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 24.93 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1396670.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5350000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 733.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 50.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 103.0 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 55700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 125700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 88.67 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 336.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.9 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 144.42 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 307.67 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 188.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 183.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 703.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 64.07 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 33.17 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 1.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBCNUC | = | 0.33 | /100WBC | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5200000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1576.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 17.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 5.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 156.25 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 65.9 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 152.0 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 76.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.12 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.23 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 471.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 136300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 19.35 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 123.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 130.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 12.19 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 11.32 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 45.85 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 4600.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.3 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 352.67 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1424670.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 158.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 21.85 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 167.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1240400.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 11.2 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 0.045 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1473250.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.88 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 106.75 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBCNUC | = | 0.17 | /100WBC | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 136700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.55 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1476750.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 25000000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 390.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 107.75 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1420.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 7340000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 12.9 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 8.83 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 34400.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 0.075 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 12.45 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 102.6 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 28800.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 154200.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 127.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 40.15 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.53 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 306800.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 71.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 23.73 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 64.03 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 122700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASO | = | 0.23 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 18.97 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 314.75 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 117.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 0.042 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 0.025 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 10.8 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 42.82 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 750.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 142.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 87.25 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 0.48 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 73.24 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 55.25 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 65.77 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 104.0 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.09 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 378700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 371000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 27000000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 126500.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 14970.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 352.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 0.76 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1512.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 424.75 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 412.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 20.6 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 313000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 7160000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 132300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 59.8 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 356.75 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 10.2 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 108.0 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 338.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 137.4 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1660.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 742.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 0.26 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 2.18 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 41800000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 148.4 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 64.72 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 14.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 0.8 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 475.25 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 94.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 153.5 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 40250000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 96.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 63300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 18.74 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 67.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 112.25 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 37.2 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 103.2 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 23.6 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 12.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 1.75 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1491250.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 7400.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 1220.5 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 88.17 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1266000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 325000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1357.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 112.0 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 271.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 0.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 69.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 106.25 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1275500.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 7040000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 24900.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 36000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 313300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 140.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1400000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 379700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.67 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 13.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 8.33 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 279.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 143.13 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 75.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 36.77 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 541.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 101.75 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 16.75 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 279.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 61.35 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 60.7 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 37500000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 36000000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 780.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 46.25 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 136.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 154.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 3.45 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 2.98 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 18.75 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 600.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 0.0375 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 42.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1120000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 6570000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 9.06 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1473.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 66700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 151.25 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 305.4 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 42300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 95.17 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 13517.17 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 2.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 25.9 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASO | = | 0.18 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 6610000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 22550.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 10.02 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 45700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 879250.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 267.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 173.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 11170.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 9.25 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 41700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 757.75 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 80.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 96.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1314330.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 545.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 24.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 415.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 206.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 60000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 686.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 550.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 64.33 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 90.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 12.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 10947.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 1.53 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 6730000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 2.4 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 154.5 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.29 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 414.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 116.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 32.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1441330.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 39.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 27500000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 143.57 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 49.17 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 18.64 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 1.3 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 383.17 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 33.98 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.52 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 34200.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1537.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 1104.67 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 36.85 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 23.17 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 21.25 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 9.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 21.05 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 11.75 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 63.45 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 117.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 12170.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 813.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 143.8 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 116.2 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 317500.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 4570.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 313600.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.37 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.7 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 124000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 70.68 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 19360.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.67 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 7090000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 50.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1534.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 0.4 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 66.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 6640000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 59.43 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 8.17 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1307170.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 32000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 320.75 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 1.05 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 42.27 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 127300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 73.22 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 63.1 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 1.73 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 32.8 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 58.8 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 97.4 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 62.75 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 130000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 62.82 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 19.43 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 30.45 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 42.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 41670000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 626.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 10.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 18.56 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 717.5 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 44.28 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 217.75 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 13.59 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 2.3 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 34600.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 64000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 2.78 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 20.48 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 127.75 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASO | = | 0.25 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 66.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 15.2 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 9.43 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 43.3 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 42.75 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 42.6 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 20.37 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 315600.0 | ug.mL-1 | DrugMatrix |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Homo sapiens | n.a. | CL | = | 24.0 | mL.min-1.kg-1 | PMID[19445515] |
| Homo sapiens | Kidney | CL_renal | = | 1.8 | mL.min-1.kg-1 | PMID[19445515] |
| Homo sapiens | n.a. | Fu | = | 0.076 | n.a. | PMID[18426954] |
| n.a. | n.a. | LogP | = | 0.2 | n.a. | PMID[20106561] |
| Mus musculus | n.a. | Drug uptake | n.a. | n.a. | n.a. | PMID[24900668] |
| Canis lupus familiaris | Plasma | AUC | = | 305.0 | ug.ml-1 | FDA drug approval package for Epirubicin (NDA: 21-010 and 50-778) |
| Mus musculus | n.a. | Drug uptake | = | 65.13 | % | PMID[24900668] |
| Mus musculus | n.a. | Drug uptake | = | 72.11 | % | PMID[24900668] |
| Homo sapiens | Urine | Compound recovery | = | 0.6 | % | Therapeutic Drugs |
| Canis lupus familiaris | Plasma | T1/2 | = | 0.1 | hr | FDA drug approval package for Epirubicin (NDA: 21-010 and 50-778) |
| Homo sapiens | n.a. | Vdss | = | 38.0 | L.kg-1 | PMID[18426954] |
| Homo sapiens | n.a. | CL | = | 24.0 | mL.min-1.kg-1 | PMID[18426954] |
| Homo sapiens | n.a. | T1/2 | = | 16.0 | hr | PMID[18426954] |
| Canis lupus familiaris | Plasma | Vd | = | 34.5 | L.kg-1 | FDA drug approval package for Epirubicin (NDA: 21-010 and 50-778) |
| Homo sapiens | Urine | Compound recovery | = | 2.0 | % | Therapeutic Drugs |
| Canis lupus familiaris | Plasma | T1/2 | = | 18.9 | hr | FDA drug approval package for Epirubicin (NDA: 21-010 and 50-778) |
| Homo sapiens | n.a. | MRT | = | 26.0 | hr | PMID[18426954] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|---|---|---|---|---|---|
| - | Mus musculus | LD50 | = | 16.0 | mg/kg | ToxVal |
| - | Homo sapiens | DILI_severity_class | = | 3.0 | n.a. | PMID[26948801] |
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC611971 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 0.8194 | Intermediate Similarity | NPC109403 |
| 0.8082 | Intermediate Similarity | NPC487573 |
| 0.7403 | Intermediate Similarity | NPC261012 |
| 0.7403 | Intermediate Similarity | NPC314738 |
| 0.7308 | Intermediate Similarity | NPC468994 |
| 0.726 | Intermediate Similarity | NPC602774 |
| 0.6883 | Remote Similarity | NPC603200 |
| 0.6625 | Remote Similarity | NPC601855 |
| 0.593 | Remote Similarity | NPC600087 |
| 0.5595 | Remote Similarity | NPC603758 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC611971 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| 1.0 | High Similarity | NPD6535 | Phase 4 |
| 0.9839 | High Similarity | NPD6534 | Approved |
| 0.8194 | Intermediate Similarity | NPD6778 | Phase 4 |
| 0.8082 | Intermediate Similarity | NPD6777 | Approved |
| 0.7532 | Intermediate Similarity | NPD7699 | Phase 2 |
| 0.7532 | Intermediate Similarity | NPD7700 | Phase 2 |
| 0.7403 | Intermediate Similarity | NPD6781 | Phase 4 |
| 0.7403 | Intermediate Similarity | NPD6782 | Phase 4 |
| 0.7308 | Intermediate Similarity | NPD6779 | Approved |
| 0.7308 | Intermediate Similarity | NPD6780 | Approved |
| 0.7024 | Intermediate Similarity | NPD6776 | Approved |
| 0.6125 | Remote Similarity | NPD7211 | Clinical (unspecified phase) |
| 0.5862 | Remote Similarity | NPD6823 | Phase 2 |
| 0.57 | Remote Similarity | NPD8058 | Clinical (unspecified phase) |
| 0.57 | Remote Similarity | NPD8059 | Phase 3 |
| 0.5484 | Remote Similarity | NPD7871 | Phase 2 |
| 0.5446 | Remote Similarity | NPD8155 | Clinical (unspecified phase) |
| 0.5426 | Remote Similarity | NPD7870 | Phase 2 |
| 0.5306 | Remote Similarity | NPD7801 | Approved |
| 0.5263 | Remote Similarity | NPD7696 | Phase 3 |
| 0.5263 | Remote Similarity | NPD7697 | Phase 3 |
| 0.5263 | Remote Similarity | NPD7698 | Approved |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
