Drug Information| Drug ID:   | NPD7211 |
| Drug Name:   | |
| Molecular Formula:   | C29H31NO11S |
| Canonical SMILES:   | C[C@@H]1OC(C[C@@H]([C@@H]1OS(=O)(=O)C)N1CC1)O[C@H]1C[C@@](O)(Cc2c1c(O)c1c(c2O)C(=O)c2c(C1=O)cccc2)C(=O)C |
| Standard InCHI:   | "InChI=1S/C29H31NO11S/c1-13-28(41-42(3,37)38)18(30-8-9-30)10-20(39-13)40-19-12-29(36,14(2)31)11-17-21(19)27(35)23-22(26(17)34)24(32)15-6-4-5-7-16(15)25(23)33/h4-7,13,18-20,28,34-36H,8-12H2,1-3H3/t13-,18-,19-,20?,28+,29-/m0/s1" |
| Standard InCHIKey:   | VMDWTZZCNDEKIO-MPBJIDKLSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7211Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6125 | NPC569653 |
| Remote Similarity | 0.6125 | NPC611971 |
| Remote Similarity | 0.5347 | NPC20134 |
| Remote Similarity | 0.5347 | NPC586467 |
| Remote Similarity | 0.5347 | NPC596912 |
| Remote Similarity | 0.5269 | NPC518169 |
| Remote Similarity | 0.5165 | NPC55094 |
| Remote Similarity | 0.5165 | NPC109403 |
| Remote Similarity | 0.5165 | NPC37318 |
| Remote Similarity | 0.5165 | NPC559703 |
| Remote Similarity | 0.5165 | NPC612087 |
| Remote Similarity | 0.5158 | NPC505892 |
| Remote Similarity | 0.5158 | NPC548484 |
| Remote Similarity | 0.5158 | NPC575491 |
| Remote Similarity | 0.5158 | NPC596187 |
| Remote Similarity | 0.5111 | NPC560000 |
| Remote Similarity | 0.5109 | NPC487573 |
| Remote Similarity | 0.5109 | NPC611676 |
| Molecular Weight   | 601.16 |
| ALogP   | -2.7389 |
| MLogP   | 3.22 |
| XLogP   | -0.585 |
| HDA   | 10 |
| HBD   | 3 |
| Rotatable Bonds   | 12 |
| TPSA   | 185.12 |
| RO5 Violation   | 0 |