NPASS Compound

Natural Product: NPC106895

Natural Product ID	NPC106895
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	QJAJUHALIDUBKY-KWCKHUKPSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL363942
PubChem CID	11342594
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001550] Sesquiterpenoids [CHEMONTID:0002051] Agarofurans

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 81 85 0 0 0 0 0 0 0 0999 V2000 0.4455 4.0948 -1.0574 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0616 2.8806 -1.7306 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7064 2.9116 -2.7966 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1953 1.6459 -1.1411 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2965 0.4430 -1.7816 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1204 -0.6997 -0.9101 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4527 -0.5044 0.4403 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5524 0.3727 0.5294 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6530 1.5426 1.1890 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6182 1.8797 1.8048 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7989 2.4321 1.2625 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7906 3.6071 1.9686 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8938 4.4339 2.0218 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0537 4.0763 1.3438 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0911 2.9079 0.6299 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9736 2.1108 0.6003 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6411 -1.7731 1.2229 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3162 -1.4416 2.4220 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7622 -1.6205 3.6814 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4060 -2.1064 3.7213 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4446 -1.2836 4.9391 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4177 -2.8329 0.5173 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3664 -2.7404 -0.9891 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.1539 -2.0619 -1.5180 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9129 -2.9592 -1.4146 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6091 -3.0879 -2.5685 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2697 -1.7437 -3.2614 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9666 -0.7677 -2.3893 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8021 -0.0916 -2.9142 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6434 -0.6508 -0.9828 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1006 0.4097 -0.2505 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7455 0.3282 0.9715 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8827 -0.8458 1.3846 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2225 1.4731 1.7154 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8350 1.3113 2.9556 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3078 2.3793 3.6879 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1850 3.6657 3.2027 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5832 3.8556 1.9782 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1195 2.7711 1.2666 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2219 -1.8028 -3.0038 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7780 -2.8972 -3.6609 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2714 -4.1745 -3.5189 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1222 -3.1598 -2.4215 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6573 -2.1545 -1.5481 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3809 -4.0746 -1.4123 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1954 4.9778 -1.2492 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4724 3.9770 0.0596 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4991 4.3367 -1.3506 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3263 0.4867 -2.7371 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3512 0.5953 -1.9268 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3126 0.0536 1.0347 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8606 3.8515 2.4870 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8619 5.3674 2.5930 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8833 4.7659 1.4245 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9872 2.6303 0.1053 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9705 1.1804 0.0449 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3510 -2.1749 1.5171 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1639 -2.0453 5.7121 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5347 -1.2590 4.8069 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0898 -0.3016 5.3580 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5008 -2.8515 0.7870 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0594 -3.8113 0.9128 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5642 -1.7172 -4.2963 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9099 -1.5712 -0.3762 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9161 0.2823 3.3101 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7825 2.2139 4.6566 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5616 4.5151 3.7863 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4923 4.8589 1.6094 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6432 2.8826 0.2922 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8005 -0.9613 -3.3336 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2418 -2.6533 -4.5006 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4362 -4.8240 -3.3070 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1193 -4.9203 -3.6769 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1461 -3.7903 -4.5765 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5665 -2.7533 -3.3759 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4111 -4.2537 -2.4487 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5569 -2.7689 -1.5326 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5154 -1.4566 -2.3674 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3892 -2.9063 -1.8354 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0896 -1.5517 -0.6957 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2354 -4.4622 -1.0967 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 6 5 1 6 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 9 11 1 0 11 12 2 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 2 0 7 17 1 0 17 18 1 0 18 19 1 0 19 20 2 0 19 21 1 0 17 22 1 0 22 23 1 0 23 24 1 0 24 25 1 6 25 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 28 30 1 0 30 31 1 0 31 32 1 0 32 33 2 0 32 34 1 0 34 35 2 0 35 36 1 0 36 37 2 0 37 38 1 0 38 39 2 0 27 40 1 0 40 41 1 0 26 42 1 0 26 43 1 0 23 44 1 0 23 45 1 6 30 6 1 0 39 34 1 0 24 6 1 0 16 11 1 0 40 24 1 0 1 46 1 0 1 47 1 0 1 48 1 0 5 49 1 0 5 50 1 0 7 51 1 1 12 52 1 0 13 53 1 0 14 54 1 0 15 55 1 0 16 56 1 0 17 57 1 1 21 58 1 0 21 59 1 0 21 60 1 0 22 61 1 0 22 62 1 0 27 63 1 6 30 64 1 1 35 65 1 0 36 66 1 0 37 67 1 0 38 68 1 0 39 69 1 0 40 70 1 1 41 71 1 0 42 72 1 0 42 73 1 0 42 74 1 0 43 75 1 0 43 76 1 0 43 77 1 0 44 78 1 0 44 79 1 0 44 80 1 0 45 81 1 0 M END

Standard InCHIKey	QJAJUHALIDUBKY-KWCKHUKPSA-N
Standard InCHI	InChI=1S/C33H36O12/c1-18(34)41-17-32-26(43-28(38)20-12-8-6-9-13-20)22(42-19(2)35)16-31(5,40)33(32)25(37)23(30(3,4)45-33)24(36)27(32)44-29(39)21-14-10-7-11-15-21/h6-15,22-23,25-27,37,40H,16-17H2,1-5H3/t22-,23+,25+,26-,27+,31-,32-,33-/m0/s1
SMILES	CC(=O)OC[C@]12[C@@H](OC(=O)c3ccccc3)[C@@H](OC(=O)C)C[C@]([C@@]32OC([C@H](C(=O)[C@H]1OC(=O)c1ccccc1)[C@H]3O)(C)C)(C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	624.22	Volume:	613.023 ? Van der Waals volume.
Dense:	1.018	LogP:	2.662 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.766 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.529 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	31.0
TPSA:	171.96 ? Topological Polar Surface Area.	H-Bond Acceptor:	12.0
H-Bond Donor:	2.0	Rings:	5.0
Heavy Atoms:	12.0

MedChem Properties

QED Drug-Likeness Score:	0.34	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.866	Fsp³:	0.485
MCE-18:	171.918 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.269	Fluc inhibitor:	0.012 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.01 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.243 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.048	Promiscuous compounds:	0.137

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.575	MDCK Permeability:	-4.882
Pgp-inhibitor:	0.85	Pgp-substrate:	0.15
PAMPA:	0.272 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.002	30% Bioavailability (F30%):	0.007
50% Bioavailability (F50%):	0.596

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.685	MRP1:	0.999
Plasma Protein Binding (PPB):	86.867%	Volume Distribution (VD):	-0.113
Fu:	15.363% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.998
OATP1B3 inhibitor:	0.966	BCRP inhibitor:	0.0
BSEP inhibitor:	0.926

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.304
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.202
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.004
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	0.212	CYP3A4-substrate:	0.037
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.959 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.517

Half-life (T1/2):

1.363

ADMET: Toxicity

hERG Blockers:	0.019	hERG Blockers (10um):	0.312
Human Hepatotoxicity (H-HT):	0.034	Drug-induced Liver Injury (DILI):	0.966
AMES Toxicity:	0.826	Rat Oral Acute Toxicity:	0.17
Maximum Recommended Daily Dose:	0.42	Skin Sensitization:	1.0
Carcinogencity:	0.888	Eye Corrosion:	0.0
Eye Irritation:	0.637	Respiratory Toxicity:	0.03
Drug-induced Neurotoxicity:	0.762	Ototoxicity:	0.147
Hematotoxicity:	0.043	Drug-induced Nephrotoxicity:	0.838
Genotoxicity:	0.727	RPMI-8226 Immunitoxicity:	0.167
A549 Cytotoxicity:	0.537	Hek293 Cytotoxicity:	0.758
BCF:	0.582 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.395 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.721 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.229 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33107	zinowiewia costaricensis	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[15974580]
NPO33107	zinowiewia costaricensis	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Ki	1
Activity	5

Activity Type	# Activity
Cell line	2
Others	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT886	Cell line	NIH3T3	Mus musculus	Ki	=	3967.0	nM	PMID[24033131]
NPT80	Cell line	Raji	Homo sapiens	Activity	=	60.0	%	PMID[18183025]
NPT2	Others	Unspecified	n.a.	Activity	=	11.2	%	PMID[19388705]
NPT2	Others	Unspecified	n.a.	Activity	=	53.2	%	PMID[19738013]
NPT2	Others	Unspecified	n.a.	Activity	=	81.6	%	PubChem BioAssay data set
NPT2	Others	Unspecified	n.a.	Activity	=	100.0	%	PubChem BioAssay data set

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC106895 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	10949
0.1-0.2	35592
0.2-0.3	2613
0.3-0.4	560
0.4-0.5	105
0.5-0.6	25
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7162	Intermediate Similarity	NPC282239
0.6974	Remote Similarity	NPC488920
0.6933	Remote Similarity	NPC481490
0.6711	Remote Similarity	NPC471102
0.6538	Remote Similarity	NPC481487
0.6026	Remote Similarity	NPC11685
0.6026	Remote Similarity	NPC16912
0.6026	Remote Similarity	NPC472570
0.5802	Remote Similarity	NPC481489
0.5769	Remote Similarity	NPC254558
0.575	Remote Similarity	NPC95265
0.575	Remote Similarity	NPC97667
0.5663	Remote Similarity	NPC472571
0.5625	Remote Similarity	NPC472569
0.561	Remote Similarity	NPC479042
0.5556	Remote Similarity	NPC96801
0.5556	Remote Similarity	NPC150698
0.5542	Remote Similarity	NPC481488
0.5542	Remote Similarity	NPC488908
0.5542	Remote Similarity	NPC488906
0.5488	Remote Similarity	NPC472568
0.5465	Remote Similarity	NPC610134
0.5375	Remote Similarity	NPC471107
0.5375	Remote Similarity	NPC471100
0.5375	Remote Similarity	NPC605884
0.5366	Remote Similarity	NPC70716
0.5301	Remote Similarity	NPC51602
0.5244	Remote Similarity	NPC57628
0.519	Remote Similarity	NPC281717
0.5176	Remote Similarity	NPC481486
0.5063	Remote Similarity	NPC483879
0.5062	Remote Similarity	NPC483846
0.506	Remote Similarity	NPC479043

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC106895 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3446
0.1-0.2	5497
0.2-0.3	204
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data