NPASS Compound

Natural Product: NPC488906

Natural Product ID	NPC488906
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	MHMBHJFVPZXQLH-SJCLVHBOSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 85 88 0 0 0 0 0 0 0 0999 V2000 2.5300 -0.9825 3.0725 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7818 -1.6176 1.9564 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0081 -2.8347 1.6622 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8692 -0.8626 1.2811 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1268 -1.4604 0.1888 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8156 -0.3853 -0.3745 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0090 0.8015 -0.8461 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4535 1.2526 -2.1966 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.1776 0.1048 -3.1221 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2205 -0.9486 -2.8213 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6552 -2.2820 -3.2202 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7539 -0.9109 -1.4161 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.1980 -2.2863 -0.9993 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2495 -1.8275 0.0217 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.6237 -1.1108 1.1956 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6666 -0.0314 0.8212 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8524 0.4330 1.8235 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7775 1.6707 2.3852 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5417 2.5343 1.9576 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2098 1.9061 3.4693 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6959 -0.6835 1.9816 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0750 -1.1939 3.1887 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3923 -2.1324 3.6256 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2462 -0.6211 3.8968 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9871 -0.8668 -0.8962 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9766 0.0056 -0.1323 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8715 -1.7178 -1.8033 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9726 -0.2229 -1.4832 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8444 -2.9672 -2.0293 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2406 -0.6777 -3.7723 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0556 2.4737 -2.6065 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6909 3.5805 -2.8628 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9315 3.5382 -2.7314 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0824 4.8816 -3.3064 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3599 0.4903 -0.7557 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3599 1.0601 -0.0505 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0210 2.0263 0.6352 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7462 0.6460 -0.0338 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6364 1.2726 0.6911 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0520 0.9019 0.7491 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5942 -0.1396 0.0409 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9364 -0.4739 0.1102 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7770 0.2402 0.9036 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2657 1.3028 1.6367 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9130 1.6204 1.5511 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6754 0.0764 2.8184 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4777 -1.5077 3.3074 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8288 -1.0043 3.9565 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4141 -2.2337 0.7727 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8711 -1.8066 -0.5105 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1501 1.6700 -0.1813 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5420 1.4173 -2.1404 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1642 0.3852 -4.1809 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8090 -0.3917 -2.8978 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2690 -2.1632 -3.8414 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3610 -2.8686 -3.8453 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3717 -2.9188 -2.3691 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4634 -2.9684 -0.6338 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8712 -2.6468 0.3797 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1560 -1.9537 1.7762 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2726 0.8254 0.4704 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3137 2.5483 4.2388 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4854 0.9809 4.0001 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0753 2.5185 3.1551 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1300 -0.8241 3.2348 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4565 -1.1075 4.8608 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1369 0.4671 4.0468 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6000 0.9456 0.2309 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5535 -0.6150 0.5898 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7721 0.3121 -0.8849 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9394 -1.3275 -1.8326 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5894 -1.7118 -2.8517 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0421 -2.7459 -1.3657 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8932 -3.9156 -1.8347 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7623 -0.6681 -4.6535 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9523 4.6993 -3.6575 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0248 5.5553 -2.4143 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7506 5.3036 -4.0639 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0376 -0.1981 -0.6361 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2620 2.1221 1.2765 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9753 -0.7413 -0.6059 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3433 -1.3038 -0.4617 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8245 -0.0088 0.9675 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9683 1.8433 2.2541 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5670 2.4549 2.1409 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 6 5 1 1 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 15 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 14 25 1 0 25 26 1 0 25 27 1 0 25 28 1 0 13 29 1 0 10 30 1 6 8 31 1 0 31 32 1 0 32 33 2 0 32 34 1 0 7 35 1 0 35 36 1 0 36 37 2 0 36 38 1 0 38 39 2 0 39 40 1 0 40 41 2 0 41 42 1 0 42 43 2 0 43 44 1 0 44 45 2 0 16 6 1 0 45 40 1 0 12 6 1 0 12 28 1 6 1 46 1 0 1 47 1 0 1 48 1 0 5 49 1 0 5 50 1 0 7 51 1 1 8 52 1 1 9 53 1 0 9 54 1 0 11 55 1 0 11 56 1 0 11 57 1 0 13 58 1 1 14 59 1 1 15 60 1 1 16 61 1 6 20 62 1 0 20 63 1 0 20 64 1 0 24 65 1 0 24 66 1 0 24 67 1 0 26 68 1 0 26 69 1 0 26 70 1 0 27 71 1 0 27 72 1 0 27 73 1 0 29 74 1 0 30 75 1 0 34 76 1 0 34 77 1 0 34 78 1 0 38 79 1 0 39 80 1 0 41 81 1 0 42 82 1 0 43 83 1 0 44 84 1 0 45 85 1 0 M END

Standard InCHIKey	MHMBHJFVPZXQLH-SJCLVHBOSA-N
Standard InCHI	InChI=1S/C32H40O13/c1-17(33)40-16-31-27(44-23(37)14-13-21-11-9-8-10-12-21)22(41-18(2)34)15-30(7,39)32(31)26(38)24(29(5,6)45-32)25(42-19(3)35)28(31)43-20(4)36/h8-14,22,24-28,38-39H,15-16H2,1-7H3/b14-13+/t22-,24+,25-,26+,27-,28+,30-,31-,32-/m0/s1
SMILES	CC(=O)OC[C@]12[C@H]([C@H](C[C@@](C)([C@]32[C@@H]([C@@H]([C@@H]([C@H]1OC(=O)C)OC(=O)C)C(C)(C)O3)O)O)OC(=O)C)OC(=O)/C=C/c1ccccc1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	632.25	Volume:	618.347 ? Van der Waals volume.
Dense:	1.022	LogP:	2.541 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.684 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.705 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	26.0
TPSA:	181.19 ? Topological Polar Surface Area.	H-Bond Acceptor:	13.0
H-Bond Donor:	2.0	Rings:	4.0
Heavy Atoms:	13.0

MedChem Properties

QED Drug-Likeness Score:	0.24	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.123	Fsp³:	0.594
MCE-18:	159.529 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.547	Fluc inhibitor:	0.327 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.029 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.304 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.036	Promiscuous compounds:	0.388

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.339	MDCK Permeability:	-4.776
Pgp-inhibitor:	0.988	Pgp-substrate:	0.08
PAMPA:	0.102 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.123	30% Bioavailability (F30%):	0.255
50% Bioavailability (F50%):	0.981

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.562	MRP1:	0.993
Plasma Protein Binding (PPB):	79.15%	Volume Distribution (VD):	-0.334
Fu:	20.348% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.951	BCRP inhibitor:	0.001
BSEP inhibitor:	0.996

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.995
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.614
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.187
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.981
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.537 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.442

Half-life (T1/2):

1.46

ADMET: Toxicity

hERG Blockers:	0.015	hERG Blockers (10um):	0.111
Human Hepatotoxicity (H-HT):	0.228	Drug-induced Liver Injury (DILI):	0.774
AMES Toxicity:	0.931	Rat Oral Acute Toxicity:	0.145
Maximum Recommended Daily Dose:	0.37	Skin Sensitization:	0.999
Carcinogencity:	0.681	Eye Corrosion:	0.006
Eye Irritation:	0.67	Respiratory Toxicity:	0.033
Drug-induced Neurotoxicity:	0.17	Ototoxicity:	0.202
Hematotoxicity:	0.159	Drug-induced Nephrotoxicity:	0.868
Genotoxicity:	0.604	RPMI-8226 Immunitoxicity:	0.108
A549 Cytotoxicity:	0.113	Hek293 Cytotoxicity:	0.449
BCF:	0.638 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.451 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.964 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.483 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/0031-9422(90)85349-K]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	DOI[10.1186/1471-2202-6-1]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10579865]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	leaf	n.a.	PMID[10716597]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10757718]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11374948]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11561442]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12579877]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1375626]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[1375626]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[1602302]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1602302]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[16864458]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	roots	n.a.	n.a.	PMID[16989518]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[17250858]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[17265278]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[1823717]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	leaf	n.a.	PMID[1823717]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[18554602]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	bark	n.a.	PMID[18996177]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	root	n.a.	n.a.	PMID[21486005]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[21486005]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21514608]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	dried roots	purchased from Sichuan Neautus Traditional Chinese Medicine Co. Ltd. (Chengdu, P.R. China)	n.a.	PMID[22148431]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	leaves	n.a.	n.a.	PMID[23268606]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[23852638]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24549173]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24963543]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25237706]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	bark	n.a.	PMID[2534610]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	PMID[2816380]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	Leaves	n.a.	n.a.	PMID[29355322]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	Leaves	n.a.	n.a.	PMID[31556299]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[7102323]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[7304185]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8699928]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8722541]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[Article]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	Database[Article]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO13661	Tripterygium wilfordii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT113	Cell line	RAW264.7	Mus musculus	IC50	=	24200.0	nM	PMID[31556299]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC488906 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	9879
0.1-0.2	35443
0.2-0.3	4116
0.3-0.4	334
0.4-0.5	56
0.5-0.6	14
0.6-0.7	8
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC488908
0.7703	Intermediate Similarity	NPC488907
0.76	Intermediate Similarity	NPC488920
0.7333	Intermediate Similarity	NPC488909
0.7333	Intermediate Similarity	NPC488905
0.7273	Intermediate Similarity	NPC488917
0.7143	Intermediate Similarity	NPC488912
0.7143	Intermediate Similarity	NPC488910
0.6883	Remote Similarity	NPC481490
0.6835	Remote Similarity	NPC472571
0.6456	Remote Similarity	NPC488914
0.6222	Remote Similarity	NPC294579
0.6222	Remote Similarity	NPC144779
0.622	Remote Similarity	NPC488919
0.6	Remote Similarity	NPC488918
0.6	Remote Similarity	NPC488913
0.5783	Remote Similarity	NPC488915
0.5783	Remote Similarity	NPC476972
0.5542	Remote Similarity	NPC106895
0.5465	Remote Similarity	NPC470159
0.5465	Remote Similarity	NPC476971
0.5402	Remote Similarity	NPC70403
0.5402	Remote Similarity	NPC177940
0.5349	Remote Similarity	NPC481487
0.5213	Remote Similarity	NPC96801
0.5213	Remote Similarity	NPC150698
0.5119	Remote Similarity	NPC473110
0.5116	Remote Similarity	NPC476970
0.5059	Remote Similarity	NPC16912
0.5059	Remote Similarity	NPC472570

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC488906 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3425
0.1-0.2	5576
0.2-0.3	149
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data