Drug Information| Drug ID:   | NPD8032 |
| Drug Name:   | Oleoyl estrone |
| Molecular Formula:   | C36H54O3 |
| Canonical SMILES:   | CCCCCCCC/C=CCCCCCCCC(=O)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CCC2=O)C |
| Standard InCHI:   | "InChI=1S/C36H54O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-35(38)39-29-20-22-30-28(27-29)19-21-32-31(30)25-26-36(2)33(32)23-24-34(36)37/h10-11,20,22,27,31-33H,3-9,12-19,21,23-26H2,1-2H3/b11-10-/t31-,32-,33+,36+/m1/s1" |
| Standard InCHIKey:   | IMIPDPVHGGHVNH-YWVHRCQQSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD8032Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC493067 |
| Intermediate Similarity | 0.7313 | NPC220771 |
| Remote Similarity | 0.6765 | NPC498325 |
| Remote Similarity | 0.5455 | NPC320074 |
| Remote Similarity | 0.5385 | NPC21216 |
| Remote Similarity | 0.5385 | NPC611951 |
| Remote Similarity | 0.5169 | NPC326278 |
| Remote Similarity | 0.5132 | NPC252343 |
| Remote Similarity | 0.5132 | NPC602434 |
| Remote Similarity | 0.5068 | NPC15127 |
| Remote Similarity | 0.5067 | NPC190501 |
| Remote Similarity | 0.5067 | NPC318552 |
| Remote Similarity | 0.5067 | NPC144109 |
| Remote Similarity | 0.5067 | NPC114161 |
| Remote Similarity | 0.5067 | NPC611728 |
| Molecular Weight   | 534.41 |
| ALogP   | -1.6339 |
| MLogP   | 5.09 |
| XLogP   | 13.051 |
| HDA   | 2 |
| HBD   | 0 |
| Rotatable Bonds   | 19 |
| TPSA   | 43.37 |
| RO5 Violation   | 2 |