Drug Information| Drug ID:   | NPD1930 |
| Drug Name:   | Dexketoprofen |
| Molecular Formula:   | C16H14O3 |
| Canonical SMILES:   | OC(=O)[C@H](c1cccc(c1)C(=O)c1ccccc1)C |
| Standard InCHI:   | "InChI=1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)/t11-/m0/s1" |
| Standard InCHIKey:   | DKYWVDODHFEZIM-NSHDSACASA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD1930Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | DB09214 |
| ChEMBL   | CHEMBL75435 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | D07269 |
| PubChem CID   | 0 |
| ChEBI   | 76128 |
| CAS Number   | 22161-81-5 |
| Molecular Weight   | 254.09 |
| ALogP   | -0.2088 |
| MLogP   | 2.89 |
| XLogP   | 4.988 |
| HDA   | 3 |
| HBD   | 1 |
| Rotatable Bonds   | 6 |
| TPSA   | 54.37 |
| RO5 Violation   | 0 |