NPASS Compound

Natural Product: NPC483865

Natural Product ID	NPC483865
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	AVCSOVWRPHGUKF-ZLWYAKHXSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	134139657
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 85 89 0 0 0 0 0 0 0 0999 V2000 -1.5310 -3.8575 -2.1261 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1023 -2.9355 -1.0553 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8474 -1.8078 -1.6560 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3403 -0.4392 -1.4651 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.3887 -0.2385 -0.3012 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3912 -1.3271 -0.3571 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1588 -1.4302 -1.7644 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8382 -1.1403 0.4950 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6756 -1.6239 1.8989 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0225 -2.9273 1.9543 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.2472 -3.5613 0.5556 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.1594 -2.6063 0.0297 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9776 -2.1953 1.1142 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4784 -2.6632 2.2788 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6558 -1.6759 3.4101 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1200 -3.9623 2.7446 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3924 -4.8617 0.8002 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3420 -5.9642 0.5875 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3887 -5.6313 0.0304 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0837 -7.3199 0.9768 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3085 0.1890 0.3984 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5315 0.5419 -0.1029 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2651 -0.4247 -0.5047 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0648 1.8938 -0.2179 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2573 2.1512 -0.7179 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8312 3.4809 -0.8527 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2066 4.6291 -0.4777 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8609 5.8305 -0.6591 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1239 5.8842 -1.2086 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7674 4.7277 -1.5926 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1145 3.5475 -1.4099 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9261 1.0761 -0.3527 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2788 2.0194 0.6033 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0393 1.5925 1.5237 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8562 3.3971 0.6179 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2542 4.2250 1.6355 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8859 5.5616 1.6911 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1001 6.0968 0.7111 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3138 5.2881 -0.3224 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0654 3.9410 -0.3660 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3845 0.5001 -1.2591 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5678 1.6022 -2.0785 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7604 1.7446 -3.0305 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6777 2.5907 -1.8507 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2269 -1.7830 -1.3084 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4314 -3.9784 -2.0340 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8582 -3.5496 -3.1438 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9298 -4.9060 -2.0481 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9137 -3.5632 -0.5642 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8989 -1.9852 -2.7759 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7933 -0.0663 -2.3626 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0452 -0.3466 0.6144 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0543 -2.1186 -1.7342 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5388 -1.6440 -2.5463 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6070 -0.4227 -1.9746 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6954 -1.7509 0.0717 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1266 -0.8563 2.4685 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6907 -1.7455 2.3438 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4467 -3.6244 2.6416 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7422 -3.4752 0.0609 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7991 -1.7331 4.1368 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5503 -1.9690 4.0382 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8568 -0.6598 3.0745 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6280 -4.4664 1.8812 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8538 -3.8165 3.5381 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3304 -4.6543 3.1127 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1561 -7.4931 0.7724 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1687 -7.5270 2.0532 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5444 -8.0486 0.3924 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4787 2.7314 0.1178 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8191 1.2822 -1.0404 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2307 4.5917 -0.0526 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3851 6.7814 -0.3668 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6667 6.8126 -1.3652 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7704 4.7437 -2.0313 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6438 2.6413 -1.7219 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8884 3.8403 2.4491 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2076 6.2007 2.4996 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2126 7.1556 0.7220 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9343 5.7309 -1.0867 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2953 3.3758 -1.2005 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2430 3.6323 -1.8795 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3267 2.5215 -2.7493 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2112 2.3918 -0.9223 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3395 -2.1667 -0.4083 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 6 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 1 13 14 1 0 14 15 1 0 14 16 1 0 11 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 8 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 24 25 2 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 2 0 5 32 1 0 32 33 1 0 33 34 2 0 33 35 1 0 35 36 2 0 36 37 1 0 37 38 2 0 38 39 1 0 39 40 2 0 4 41 1 0 41 42 1 0 42 43 2 0 42 44 1 0 3 45 1 0 12 2 1 0 31 26 1 0 40 35 1 0 12 6 1 0 14 10 1 0 1 46 1 0 1 47 1 0 1 48 1 0 2 49 1 1 3 50 1 6 4 51 1 6 5 52 1 1 7 53 1 0 7 54 1 0 7 55 1 0 8 56 1 6 9 57 1 0 9 58 1 0 10 59 1 1 11 60 1 6 15 61 1 0 15 62 1 0 15 63 1 0 16 64 1 0 16 65 1 0 16 66 1 0 20 67 1 0 20 68 1 0 20 69 1 0 24 70 1 0 25 71 1 0 27 72 1 0 28 73 1 0 29 74 1 0 30 75 1 0 31 76 1 0 36 77 1 0 37 78 1 0 38 79 1 0 39 80 1 0 40 81 1 0 44 82 1 0 44 83 1 0 44 84 1 0 45 85 1 0 M END

Standard InCHIKey	AVCSOVWRPHGUKF-ZLWYAKHXSA-N
Standard InCHI	InChI=1S/C35H40O10/c1-20-28(39)29(41-21(2)36)31(44-32(40)24-15-11-8-12-16-24)34(6)26(43-27(38)18-17-23-13-9-7-10-14-23)19-25-30(42-22(3)37)35(20,34)45-33(25,4)5/h7-18,20,25-26,28-31,39H,19H2,1-6H3/b18-17+/t20-,25-,26+,28-,29-,30-,31+,34-,35-/m1/s1
SMILES	C[C@@H]1[C@H]([C@H]([C@@H]([C@@]2(C)[C@H](C[C@@H]3[C@H]([C@]12OC3(C)C)OC(=O)C)OC(=O)/C=C/c1ccccc1)OC(=O)c1ccccc1)OC(=O)C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	620.26	Volume:	630.035 ? Van der Waals volume.
Dense:	0.984	LogP:	4.026 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.484 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.477 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	31.0
TPSA:	134.66 ? Topological Polar Surface Area.	H-Bond Acceptor:	10.0
H-Bond Donor:	1.0	Rings:	5.0
Heavy Atoms:	10.0

MedChem Properties

QED Drug-Likeness Score:	0.271	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.873	Fsp³:	0.486
MCE-18:	163.654 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.958	Fluc inhibitor:	0.664 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.041 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.282 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.096	Promiscuous compounds:	0.027

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.438	MDCK Permeability:	-4.992
Pgp-inhibitor:	0.999	Pgp-substrate:	0.024
PAMPA:	0.626 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.124	30% Bioavailability (F30%):	0.563
50% Bioavailability (F50%):	0.975

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.338	MRP1:	0.902
Plasma Protein Binding (PPB):	88.621%	Volume Distribution (VD):	-0.289
Fu:	10.403% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.996	BCRP inhibitor:	0.005
BSEP inhibitor:	0.983

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.708
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.374
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.001
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.999
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.799 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

7.078

Half-life (T1/2):

0.684

ADMET: Toxicity

hERG Blockers:	0.086	hERG Blockers (10um):	0.539
Human Hepatotoxicity (H-HT):	0.376	Drug-induced Liver Injury (DILI):	0.916
AMES Toxicity:	0.687	Rat Oral Acute Toxicity:	0.067
Maximum Recommended Daily Dose:	0.223	Skin Sensitization:	0.999
Carcinogencity:	0.512	Eye Corrosion:	0.0
Eye Irritation:	0.252	Respiratory Toxicity:	0.022
Drug-induced Neurotoxicity:	0.439	Ototoxicity:	0.354
Hematotoxicity:	0.1	Drug-induced Nephrotoxicity:	0.728
Genotoxicity:	0.582	RPMI-8226 Immunitoxicity:	0.068
A549 Cytotoxicity:	0.246	Hek293 Cytotoxicity:	0.566
BCF:	0.76 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.768 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.236 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.898 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[20146433]
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	fruits	n.a.	n.a.	PMID[21856049]
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[27541714]
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO26437	Maytenus jelskii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1

Activity Type	# Activity
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	Activity	>	60.0	%	PMID[27541714]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC483865 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	10169
0.1-0.2	35963
0.2-0.3	3065
0.3-0.4	490
0.4-0.5	118
0.5-0.6	36
0.6-0.7	10
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7887	Intermediate Similarity	NPC483883
0.7887	Intermediate Similarity	NPC151585
0.7375	Intermediate Similarity	NPC184817
0.7273	Intermediate Similarity	NPC473085
0.7125	Intermediate Similarity	NPC483866
0.6835	Remote Similarity	NPC473112
0.6625	Remote Similarity	NPC607428
0.6548	Remote Similarity	NPC188865
0.6364	Remote Similarity	NPC70973
0.6364	Remote Similarity	NPC473111
0.6296	Remote Similarity	NPC210591
0.6235	Remote Similarity	NPC174982
0.6026	Remote Similarity	NPC311175
0.6026	Remote Similarity	NPC483862
0.6	Remote Similarity	NPC483878
0.5833	Remote Similarity	NPC473613
0.5747	Remote Similarity	NPC25768
0.5747	Remote Similarity	NPC605086
0.5729	Remote Similarity	NPC483880
0.5729	Remote Similarity	NPC156941
0.5632	Remote Similarity	NPC603877
0.5618	Remote Similarity	NPC171525
0.5618	Remote Similarity	NPC488916
0.561	Remote Similarity	NPC158663
0.5604	Remote Similarity	NPC473214
0.5581	Remote Similarity	NPC481050
0.5529	Remote Similarity	NPC214550
0.5506	Remote Similarity	NPC125106
0.5506	Remote Similarity	NPC469349
0.5506	Remote Similarity	NPC472573
0.5444	Remote Similarity	NPC483859
0.5443	Remote Similarity	NPC473081
0.5443	Remote Similarity	NPC195647
0.5422	Remote Similarity	NPC270590
0.5402	Remote Similarity	NPC609221
0.5393	Remote Similarity	NPC70403
0.5393	Remote Similarity	NPC177940
0.5341	Remote Similarity	NPC29704
0.5341	Remote Similarity	NPC470157
0.5333	Remote Similarity	NPC483861
0.5125	Remote Similarity	NPC474608
0.5116	Remote Similarity	NPC41481
0.5114	Remote Similarity	NPC475652
0.5111	Remote Similarity	NPC472571
0.5111	Remote Similarity	NPC470159
0.5062	Remote Similarity	NPC200592
0.5062	Remote Similarity	NPC270498
0.5062	Remote Similarity	NPC610542
0.5059	Remote Similarity	NPC473871
0.5059	Remote Similarity	NPC27377
0.5054	Remote Similarity	NPC483864

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC483865 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4117
0.1-0.2	4915
0.2-0.3	118
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data