Drug Information| Drug ID:   | NPD7584 |
| Drug Name:   | |
| Molecular Formula:   | C31H36N2O11 |
| Canonical SMILES:   | CO[C@@H]1[C@@H](OC(=N)O)[C@@H](O)[C@@H](OC1(C)C)Oc1ccc2c(c1C)oc(c(c2=O)NC(=O)c1ccc(c(c1)CC=C(C)C)O)O |
| Standard InCHI:   | "InChI=1S/C31H36N2O11/c1-14(2)7-8-16-13-17(9-11-19(16)34)27(37)33-21-22(35)18-10-12-20(15(3)24(18)42-28(21)38)41-29-23(36)25(43-30(32)39)26(40-6)31(4,5)44-29/h7,9-13,23,25-26,29,34,36,38H,8H2,1-6H3,(H2,32,39)(H,33,37)/t23-,25+,26-,29-/m1/s1" |
| Standard InCHIKey:   | DYYIUCVAQGRACE-KGSXXDOSSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7584Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7358 | NPC68899 |
| Intermediate Similarity | 0.7358 | NPC257728 |
| Intermediate Similarity | 0.7358 | NPC33636 |
| Remote Similarity | 0.6486 | NPC568564 |
| Remote Similarity | 0.6486 | NPC577971 |
| Remote Similarity | 0.6486 | NPC611592 |
| Remote Similarity | 0.6087 | NPC257266 |
| Remote Similarity | 0.6034 | NPC506771 |
| Remote Similarity | 0.5877 | NPC486975 |
| Remote Similarity | 0.5763 | NPC314025 |
| Remote Similarity | 0.5678 | NPC596170 |
| Remote Similarity | 0.5641 | NPC485253 |
| Remote Similarity | 0.5641 | NPC486976 |
| Remote Similarity | 0.5641 | NPC503724 |
| Remote Similarity | 0.5546 | NPC153365 |
| Remote Similarity | 0.5424 | NPC519673 |
| Remote Similarity | 0.5424 | NPC530256 |
| Remote Similarity | 0.5197 | NPC550247 |
| Remote Similarity | 0.5156 | NPC552795 |
| Remote Similarity | 0.5156 | NPC585638 |
| Remote Similarity | 0.5156 | NPC608249 |
| Remote Similarity | 0.513 | NPC315298 |
| TTD   | DAP001500; DAP001002 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 9346 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 612.23 |
| ALogP   | 1.1444 |
| MLogP   | 3.44 |
| XLogP   | 5.068 |
| HDA   | 10 |
| HBD   | 6 |
| Rotatable Bonds   | 20 |
| TPSA   | 197.09 |
| RO5 Violation   | 2 |