Drug Information| Drug ID:   | NPD5619 |
| Drug Name:   | |
| Molecular Formula:   | C23H27NO9 |
| Canonical SMILES:   | O[C@@H]1[C@@H](O)[C@@H](O[C@@H]([C@H]1O)C(=O)O)O[C@H]1C=C[C@@H]2[C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1O |
| Standard InCHI:   | "InChI=1S/C23H27NO9/c1-24-7-6-23-10-3-5-13(31-22-17(28)15(26)16(27)19(33-22)21(29)30)20(23)32-18-12(25)4-2-9(14(18)23)8-11(10)24/h2-5,10-11,13,15-17,19-20,22,25-28H,6-8H2,1H3,(H,29,30)/t10-,11+,13-,15-,16-,17+,19-,20-,22+,23-/m0/s1" |
| Standard InCHIKey:   | GNJCUHZOSOYIEC-GAROZEBRSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD5619Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7556 | NPC320999 |
| Remote Similarity | 0.6512 | NPC43726 |
| Remote Similarity | 0.6512 | NPC147161 |
| Remote Similarity | 0.5862 | NPC328423 |
| Remote Similarity | 0.5862 | NPC74436 |
| Remote Similarity | 0.5862 | NPC232533 |
| Remote Similarity | 0.5862 | NPC298343 |
| Remote Similarity | 0.5862 | NPC566104 |
| Remote Similarity | 0.5862 | NPC607466 |
| Remote Similarity | 0.5862 | NPC608460 |
| Remote Similarity | 0.5795 | NPC485664 |
| Remote Similarity | 0.5543 | NPC258640 |
| Remote Similarity | 0.5392 | NPC26746 |
| Remote Similarity | 0.5281 | NPC97086 |
| Molecular Weight   | 461.17 |
| ALogP   | -1.8992 |
| MLogP   | 2.89 |
| XLogP   | -0.839 |
| HDA   | 10 |
| HBD   | 5 |
| Rotatable Bonds   | 9 |
| TPSA   | 149.15 |
| RO5 Violation   | 0 |