NPASS Compound

Natural Product: NPC171764

Natural Product ID	NPC171764
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	BHGJAYRDOPBBLT-TZHBTPGTSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 135143 0 0 0 0 0 0 0 0999 V2000 8.8504 -2.9501 0.3339 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3130 -1.5285 0.1567 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9939 -1.4360 0.7979 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3029 -0.5997 2.0637 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0005 0.0359 2.4392 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0594 -0.3594 1.3506 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0342 0.6606 0.9949 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1900 1.0655 2.1976 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7459 0.9369 1.9800 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1141 0.8703 0.8250 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3429 0.7403 0.7899 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9363 0.5412 -0.5363 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0789 1.0340 -1.6891 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2362 0.2853 -1.5576 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9848 0.9338 -0.4068 C 0 0 1 0 0 0 0 0 0 0 0 0 2.3361 2.3226 -0.8062 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1731 0.0691 -0.0867 C 0 0 1 0 0 0 0 0 0 0 0 0 3.9678 -0.3190 -1.2727 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1735 -1.1423 -0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9924 -0.5488 0.1614 C 0 0 2 0 0 0 0 0 0 0 0 0 6.5203 0.7835 -0.2701 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2420 1.0738 -0.6259 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1566 0.1393 -1.1134 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4998 0.2291 -0.4972 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5002 -0.3600 -1.4228 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8333 -1.4204 -2.2534 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7576 -0.7693 -3.0890 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3755 -0.3838 -4.4411 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7991 -1.4959 -5.1168 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3826 0.4603 -2.5103 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2616 -2.4158 -1.4973 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3283 0.5021 -2.0944 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6521 0.3323 -1.8361 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3361 1.6386 -1.6215 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.7410 1.6460 -2.2029 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.3996 0.2816 -2.1500 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.4624 -0.7872 -2.6614 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.0093 -1.4982 -3.8613 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2435 -2.1028 -3.6559 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2281 -0.2180 -3.0241 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7802 0.0744 -0.8202 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7249 2.0290 -3.5624 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2972 2.1292 -0.3363 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6578 -0.2098 0.8029 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0081 0.8281 1.6602 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2888 0.8640 2.9557 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6244 -0.2904 3.8790 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0609 -0.6859 3.7165 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7735 0.5378 3.1582 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.2933 0.3425 3.2353 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4129 0.8152 1.8735 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6823 -0.9975 4.9335 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7203 -1.3166 3.6496 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9068 0.9562 2.7535 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2310 0.2861 1.5205 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1659 -0.5659 0.9418 C 0 0 2 0 0 0 0 0 0 0 0 0 10.1522 0.1798 0.0697 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5393 -0.4452 0.2789 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9662 -0.2849 1.7207 C 0 0 1 0 0 0 0 0 0 0 0 0 12.4650 1.1473 1.9330 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5462 1.3453 1.0657 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7636 -0.5332 2.6204 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7934 -1.2784 1.9560 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0304 -3.6781 0.0830 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6463 -3.1017 -0.4293 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2759 -3.1186 1.3383 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3400 -1.3462 -0.9290 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5650 -2.4022 1.0343 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7427 -1.2528 2.8381 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6430 -0.4828 3.3740 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0666 1.1041 2.6355 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5744 -1.3192 1.5758 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4826 1.5900 0.6019 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4173 2.0829 2.5563 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4442 0.3709 3.0452 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1237 0.8886 2.8755 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7463 1.6922 1.2491 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6524 -0.0623 1.5186 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0522 -0.5527 -0.7635 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0820 2.0998 -1.7236 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5571 0.6764 -2.6165 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0180 -0.7731 -1.2984 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8364 0.3208 -2.4722 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4548 2.3590 -1.9144 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4845 3.0198 -0.5563 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2227 2.7625 -0.3454 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7342 -0.8831 0.3579 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3107 -1.0223 -1.8967 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1577 0.5147 -1.9517 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8278 -1.0987 -1.8595 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9340 -2.2161 -0.8212 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4629 0.7830 -0.8095 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5680 1.5531 0.5183 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7661 1.1938 -1.0115 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6675 -0.8325 -1.1872 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7715 1.3519 -0.4585 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2120 -0.9619 -0.7574 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5979 -1.8344 -2.9735 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8859 -1.4313 -3.2085 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5972 0.1779 -5.0294 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1836 0.3499 -4.2293 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2883 -1.1759 -5.9343 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7951 -3.0265 -2.0987 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8225 -0.4311 -1.0198 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7689 2.3929 -2.2489 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3500 2.3538 -1.6248 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3099 0.2924 -2.7640 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3410 -1.5532 -1.8415 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9487 -0.8913 -4.7830 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2838 -2.3566 -4.0533 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2727 -2.9483 -4.2111 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3920 0.8537 -0.6187 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7719 2.1444 -3.8252 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2226 2.2400 -0.0043 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8883 1.8328 1.1481 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5682 1.7932 3.4844 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4950 0.0638 4.9419 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1185 -1.5563 3.0395 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5145 1.3825 3.8190 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5891 -0.4370 2.4975 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6314 0.1358 4.2684 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7512 1.3181 2.9659 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1886 -1.7644 5.3584 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1503 -2.2140 3.6557 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3917 0.4381 3.3921 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8828 0.0860 -0.9792 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2262 1.2395 0.4046 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2395 0.1651 -0.3484 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5316 -1.5019 -0.0180 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8030 -0.9937 1.9273 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6255 1.8340 1.7464 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8376 1.2943 2.9674 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1236 2.0450 1.4220 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1195 -1.1611 3.4727 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3638 0.4106 3.0581 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 6 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 12 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 27 30 1 0 26 31 1 0 25 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 37 40 1 0 36 41 1 0 35 42 1 0 34 43 1 0 24 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 49 51 1 0 48 52 1 0 47 53 1 0 46 54 1 0 4 55 1 0 56 55 1 1 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 59 62 1 0 62 63 1 0 56 2 1 0 20 3 1 0 30 23 1 0 40 33 1 0 51 45 1 0 63 56 1 0 20 6 1 0 17 7 1 0 15 10 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 6 3 68 1 1 4 69 1 1 5 70 1 0 5 71 1 0 6 72 1 1 7 73 1 6 8 74 1 0 8 75 1 0 9 76 1 0 11 77 1 0 11 78 1 0 12 79 1 6 13 80 1 0 13 81 1 0 14 82 1 0 14 83 1 0 16 84 1 0 16 85 1 0 16 86 1 0 17 87 1 1 18 88 1 0 18 89 1 0 19 90 1 0 19 91 1 0 21 92 1 0 21 93 1 0 21 94 1 0 23 95 1 6 24 96 1 1 25 97 1 1 26 98 1 6 27 99 1 6 28100 1 0 28101 1 0 29102 1 0 31103 1 0 33104 1 1 34105 1 6 35106 1 1 36107 1 6 37108 1 1 38109 1 0 38110 1 0 39111 1 0 41112 1 0 42113 1 0 43114 1 0 45115 1 6 46116 1 1 47117 1 1 48118 1 6 49119 1 1 50120 1 0 50121 1 0 50122 1 0 52123 1 0 53124 1 0 54125 1 0 57126 1 0 57127 1 0 58128 1 0 58129 1 0 59130 1 1 60131 1 0 60132 1 0 61133 1 0 62134 1 0 62135 1 0 M END

Standard InCHIKey	BHGJAYRDOPBBLT-TZHBTPGTSA-N
Standard InCHI	InChI=1S/C45H72O18/c1-19-30-27(63-45(19)12-7-21(15-46)18-56-45)14-26-24-6-5-22-13-23(8-10-43(22,3)25(24)9-11-44(26,30)4)58-42-39(62-40-36(54)34(52)31(49)20(2)57-40)38(33(51)29(17-48)60-42)61-41-37(55)35(53)32(50)28(16-47)59-41/h5,19-21,23-42,46-55H,6-18H2,1-4H3/t19-,20-,21-,23-,24+,25-,26-,27-,28+,29+,30-,31-,32+,33+,34+,35-,36+,37+,38-,39+,40+,41-,42+,43-,44-,45+/m0/s1
SMILES	C[C@H]1[C@H]2[C@H](C[C@H]3[C@@H]4CC=C5C[C@H](CC[C@]5(C)[C@H]4CC[C@]23C)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O[C@@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)O[C@@]21CC[C@@H](CO)CO2

Calculated Properties

Physi-Chem Properties

Molecular Weight:	900.47	Volume:	865.455 ? Van der Waals volume.
Dense:	1.04	LogP:	0.927 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.825 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.442 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	48.0
TPSA:	276.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	10.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.127	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.751	Fsp³:	0.956
MCE-18:	229.091 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.683	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.233	Promiscuous compounds:	0.008

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.83	MDCK Permeability:	-4.825
Pgp-inhibitor:	0.0	Pgp-substrate:	0.98
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.024	30% Bioavailability (F30%):	0.691
50% Bioavailability (F50%):	0.969

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.018
Plasma Protein Binding (PPB):	61.994%	Volume Distribution (VD):	-0.422
Fu:	31.038% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.108
BSEP inhibitor:	0.001

ADMET: Metabolism

CYP1A2-inhibitor:	0.032	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.002
CYP3A4-inhibitor:	0.61	CYP3A4-substrate:	0.003
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.061 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.559

Half-life (T1/2):

2.794

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.003
Human Hepatotoxicity (H-HT):	0.622	Drug-induced Liver Injury (DILI):	0.968
AMES Toxicity:	0.994	Rat Oral Acute Toxicity:	0.004
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.606	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.736	Drug-induced Nephrotoxicity:	0.997
Genotoxicity:	0.035	RPMI-8226 Immunitoxicity:	0.363
A549 Cytotoxicity:	0.991	Hek293 Cytotoxicity:	0.899
BCF:	1.334 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.328 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.432 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.816 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO127	Phragmites australis	Species	Poaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO15886	Lepidium campestre	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO15886	Lepidium campestre	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO127	Phragmites australis	Species	Poaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO15886	Lepidium campestre	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO127	Phragmites australis	Species	Poaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO15886	Lepidium campestre	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO127	Phragmites australis	Species	Poaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7802	Dacrycarpus vieillardii	Species	Podocarpaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC171764 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24177
0.1-0.2	22125
0.2-0.3	2688
0.3-0.4	628
0.4-0.5	98
0.5-0.6	77
0.6-0.7	40
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9247	High Similarity	NPC300557
0.9032	High Similarity	NPC602423
0.8218	Intermediate Similarity	NPC309278
0.798	Intermediate Similarity	NPC248746
0.7647	Intermediate Similarity	NPC480555
0.7647	Intermediate Similarity	NPC150372
0.7576	Intermediate Similarity	NPC113044
0.7576	Intermediate Similarity	NPC283829
0.7576	Intermediate Similarity	NPC161676
0.757	Intermediate Similarity	NPC477811
0.7353	Intermediate Similarity	NPC470433
0.7353	Intermediate Similarity	NPC46190
0.7353	Intermediate Similarity	NPC171073
0.734	Intermediate Similarity	NPC181845
0.7257	Intermediate Similarity	NPC477808
0.7248	Intermediate Similarity	NPC480553
0.7228	Intermediate Similarity	NPC14704
0.7212	Intermediate Similarity	NPC6806
0.72	Intermediate Similarity	NPC470432
0.72	Intermediate Similarity	NPC230507
0.7064	Intermediate Similarity	NPC480554
0.697	Remote Similarity	NPC206003
0.697	Remote Similarity	NPC473610
0.6944	Remote Similarity	NPC269297
0.6944	Remote Similarity	NPC222202
0.6944	Remote Similarity	NPC475550
0.6916	Remote Similarity	NPC102016
0.6916	Remote Similarity	NPC95051
0.6887	Remote Similarity	NPC42171
0.6881	Remote Similarity	NPC475333
0.6881	Remote Similarity	NPC224098
0.6881	Remote Similarity	NPC208383
0.6822	Remote Similarity	NPC150057
0.6822	Remote Similarity	NPC147753
0.6818	Remote Similarity	NPC194207
0.6818	Remote Similarity	NPC22779
0.6792	Remote Similarity	NPC477809
0.6726	Remote Similarity	NPC31896
0.6638	Remote Similarity	NPC480556
0.6607	Remote Similarity	NPC218571
0.6607	Remote Similarity	NPC487615
0.6571	Remote Similarity	NPC305423
0.6538	Remote Similarity	NPC125324
0.6522	Remote Similarity	NPC232054
0.6509	Remote Similarity	NPC475351
0.6333	Remote Similarity	NPC210569
0.6303	Remote Similarity	NPC224314
0.6283	Remote Similarity	NPC13193
0.6168	Remote Similarity	NPC141433
0.6167	Remote Similarity	NPC477807
0.6126	Remote Similarity	NPC48886
0.6126	Remote Similarity	NPC51172
0.6126	Remote Similarity	NPC49032
0.6126	Remote Similarity	NPC94881
0.6048	Remote Similarity	NPC305771
0.6048	Remote Similarity	NPC94072
0.6048	Remote Similarity	NPC169816
0.6018	Remote Similarity	NPC97700
0.6018	Remote Similarity	NPC184617
0.6018	Remote Similarity	NPC30856
0.6	Remote Similarity	NPC32361
0.5926	Remote Similarity	NPC94272
0.5926	Remote Similarity	NPC6295
0.592	Remote Similarity	NPC244431
0.5856	Remote Similarity	NPC473601
0.5847	Remote Similarity	NPC83137
0.581	Remote Similarity	NPC477451
0.5806	Remote Similarity	NPC15918
0.5794	Remote Similarity	NPC263359
0.5789	Remote Similarity	NPC475182
0.5739	Remote Similarity	NPC73243
0.5739	Remote Similarity	NPC244086
0.5739	Remote Similarity	NPC84956
0.5729	Remote Similarity	NPC486119
0.5728	Remote Similarity	NPC485594
0.5714	Remote Similarity	NPC98696
0.5714	Remote Similarity	NPC40440
0.5702	Remote Similarity	NPC249553
0.5702	Remote Similarity	NPC182900
0.569	Remote Similarity	NPC475319
0.5667	Remote Similarity	NPC132080
0.5648	Remote Similarity	NPC19400
0.5641	Remote Similarity	NPC247037
0.5619	Remote Similarity	NPC297348
0.5619	Remote Similarity	NPC249204
0.5619	Remote Similarity	NPC48339
0.5619	Remote Similarity	NPC141769
0.5619	Remote Similarity	NPC477547
0.5565	Remote Similarity	NPC124677
0.5556	Remote Similarity	NPC115165
0.5517	Remote Similarity	NPC151134
0.5505	Remote Similarity	NPC306131
0.5505	Remote Similarity	NPC200802
0.55	Remote Similarity	NPC249265
0.5495	Remote Similarity	NPC485595
0.5472	Remote Similarity	NPC325828
0.547	Remote Similarity	NPC294129
0.5462	Remote Similarity	NPC116756
0.5455	Remote Similarity	NPC23808
0.5455	Remote Similarity	NPC87998
0.5439	Remote Similarity	NPC161738
0.5439	Remote Similarity	NPC42482
0.5421	Remote Similarity	NPC234352
0.5417	Remote Similarity	NPC232037
0.5398	Remote Similarity	NPC160426
0.5391	Remote Similarity	NPC469347
0.5372	Remote Similarity	NPC108072
0.5372	Remote Similarity	NPC470864
0.5345	Remote Similarity	NPC122819
0.5333	Remote Similarity	NPC473518
0.5312	Remote Similarity	NPC79900
0.531	Remote Similarity	NPC195297
0.531	Remote Similarity	NPC70204
0.5285	Remote Similarity	NPC233433
0.5273	Remote Similarity	NPC121453
0.5268	Remote Similarity	NPC107962
0.5253	Remote Similarity	NPC100451
0.5242	Remote Similarity	NPC308140
0.5225	Remote Similarity	NPC211354
0.5225	Remote Similarity	NPC107188
0.5221	Remote Similarity	NPC15249
0.5221	Remote Similarity	NPC25455
0.521	Remote Similarity	NPC475247
0.5203	Remote Similarity	NPC476112
0.5203	Remote Similarity	NPC307534
0.5182	Remote Similarity	NPC222731
0.5159	Remote Similarity	NPC470866
0.514	Remote Similarity	NPC165439
0.5133	Remote Similarity	NPC295980
0.5126	Remote Similarity	NPC128572
0.5108	Remote Similarity	NPC481189
0.5079	Remote Similarity	NPC167183
0.5051	Remote Similarity	NPC235126
0.5051	Remote Similarity	NPC242419
0.5043	Remote Similarity	NPC475670
0.5043	Remote Similarity	NPC486388
0.5041	Remote Similarity	NPC232611
0.504	Remote Similarity	NPC256983

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC171764 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7609
0.1-0.2	1461
0.2-0.3	69
0.3-0.4	7
0.4-0.5	1
0.5-0.6	2
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6822	Remote Similarity	NPD8450	Suspended
0.5472	Remote Similarity	NPD8171	Phase 2
0.5345	Remote Similarity	NPD8449	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data