9 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
6 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC474880
Formula: C29H36N4
Ingredient ID: NPC474880
| Common Name | Ochrolifuanine E |
| IUPAC Name | (2S,3R,12bR)-3-ethyl-2-[[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]methyl]-1,2,3,4,6,7,7a,12,12a,12b-decahydroindolo[2,3-a]quinolizine |
| Canonical SMILES | CC[C@H]1CN2CCC3C([C@H]2C[C@@H]1C[C@@H]1NCCc2c1[nH]c1c2cccc1)Nc1c3cccc1 |
| Standard InCHI | InChI=1S/C29H36N4/c1-2-18-17-33-14-12-23-21-8-4-6-10-25(21)32-29(23)27(33)16-19(18)15-26-28-22(11-13-30-26)20-7-3-5-9-24(20)31-28/h3-10,18-19,23,26-27,29-32H,2,11-17H2,1H3/t18-,19-,23?,26-,27+,29?/m0/s1 |
| Standard InCHIKey | WPRCHZNIQPXBQO-QTZZMGCWSA-N |
| Ingredient External Links |
PubChem CID: 44559859 ChEMBL ID: CHEMBL486025 |
| Plant-Ingredient Association Reference |
PMID: 12398531 Database: NPASS [NPC474880] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Strychnos potatorum | Strychnos | Loganiaceae |
  |
Ingredient ID: NPC34770
Formula: C14H13NO4
Ingredient ID: NPC34770
| Common Name | Skimmianine |
| IUPAC Name | 4,7,8-trimethoxyfuro[2,3-b]quinoline |
| Canonical SMILES | COc1ccc2c(c1OC)nc1c(c2OC)cco1 |
| Standard InCHI | InChI=1S/C14H13NO4/c1-16-10-5-4-8-11(13(10)18-3)15-14-9(6-7-19-14)12(8)17-2/h4-7H,1-3H3 |
| Standard InCHIKey | SLSIBLKBHNKZTB-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 6760 ZINC ID: ZINC000000035525 ChEMBL ID: CHEMBL21396 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC34770] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Glycosmis pseudoracemosa | Glycosmis | Rutaceae |
|
| Platonia insignis | Platonia | Clusiaceae |
|
| Ficus conraui | Ficus | Moraceae |
|
| Matricaria suffruticosa | Matricaria | Asteraceae |
|
| Dictamnus dasycarpus | Dictamnus | Rutaceae |
|
| Corydalis persica | Corydalis | Papaveraceae | |
| Salta triflora | Salta | Polygonaceae | |
| Trapa japonica | Trapa | Lythraceae |
|
| Inula grantioides | Inula | Asteraceae |
|
| Vernonia chloropappa | Vernonia | Asteraceae | |
| Diospyros peregrina | Diospyros | Ebenaceae |
|
| Diospyros elliptifolia | Diospyros | Ebenaceae | |
| Juniperus horizontalis | Juniperus | Cupressaceae |
|
| Acronychia laurifolia | Acronychia | Rutaceae |
|
| Diospyros abyssinica | Diospyros | Ebenaceae |
|
| Cratystylis conocephala | Cratystylis | Asteraceae | |
| Strychnos spinosa | Strychnos | Loganiaceae |
|
| Esenbeckia hartmanii | Esenbeckia | Rutaceae | |
| Talipariti tiliaceum | Talipariti | Malvaceae |
|
| Centaurea calcitrapa | Centaurea | Asteraceae |
|
| Beaucarnea recurvata | Beaucarnea | Asparagaceae | |
| Peperomia pellucida | Peperomia | Piperaceae |
|
| Amomum daniellii | Amomum | Zingiberaceae | |
| Aeollanthus buchnerianus | Aeollanthus | Lamiaceae | |
| Hesperocyparis goveniana var. abramsiana | Hesperocyparis | Cupressaceae | |
| Plectranthus caninus | Plectranthus | Lamiaceae |
|
| Wedelia prostrata | Wedelia | Asteraceae | |
| Erica glauca | Erica | Ericaceae | |
| Lathyrus tingitanus | Lathyrus | Fabaceae |
|
| Echium plantagineum | Echium | Boraginaceae |
|
| Rauvolfia salicifolia | Rauvolfia | Apocynaceae | |
| Balanophora japonica | Balanophora | Balanophoraceae |
|
| Aconitum volubile | Aconitum | Ranunculaceae |
|
| Leucas neufliseana | Leucas | Lamiaceae | |
| Espeletiopsis purpurascens | Espeletiopsis | Asteraceae | |
| Leptospermum recurvum | Leptospermum | Myrtaceae | |
| Cota tinctoria | Cota | Asteraceae |
 |
| Ipomoea nil | Ipomoea | Convolvulaceae |
|
| Pycnarrhena australiana | Pycnarrhena | Menispermaceae | |
| Amomum reticulatum | Amomum | Zingiberaceae | |
| Zanthoxylum planispinum | Zanthoxylum | Rutaceae |
|
| Zanthoxylum avicennae | Zanthoxylum | Rutaceae |
|
| Hernandia sonora | Hernandia | Hernandiaceae |
|
| Helianthus niveus | Helianthus | Asteraceae |
|
| Hosta sieboldiana | Hosta | Asparagaceae |
|
| Plectranthus hereroensis | Plectranthus | Lamiaceae | |
| Udotea petiolata | Udotea | Udoteaceae | |
| Oricia suaveolens | Oricia | Rutaceae | |
| Melicope semecarpifolia | Melicope | Rutaceae |
|
| Cynoglossum viridiflorum | Cynoglossum | Boraginaceae | |
| Citrus trifoliata | Citrus | Rutaceae |
|
| Tecoma pentaphylla | Tecoma | Bignoniaceae | |
| Phellodendron chinense | Phellodendron | Rutaceae |
|
| Inula salsoloides | Inula | Asteraceae | |
| Eutrochium purpureum | Eutrochium | Asteraceae |
|
| Alchornea cordifolia | Alchornea | Euphorbiaceae |
|
| Caralluma russeliana | Caralluma | Apocynaceae | |
| Dalbergia monetaria | Dalbergia | Fabaceae |
|
| Zanthoxylum ailanthoides | Zanthoxylum | Rutaceae |
|
| Ursinia anthemoides | Ursinia | Asteraceae | |
| Imperata cylindrica | Imperata | Poaceae |
|
| Tetradium glabrifolium | Tetradium | Rutaceae | |
| Trollius macropetalus | Trollius | Ranunculaceae | |
| Polypodium aureum | Polypodium | Polypodiaceae | |
| Alpinia officinarum | Alpinia | Zingiberaceae |
|
| Casimiroa edulis | Casimiroa | Rutaceae |
|
| Tylophora asthmatica | Tylophora | Apocynaceae |
|
| Helianthus californicus | Helianthus | Asteraceae | |
| Phellodendron amurense | Phellodendron | Rutaceae |
|
| Morinda coreia | Morinda | Rubiaceae |
|
| Jacobaea cannabifolia | Jacobaea | Asteraceae | |
| Skimmia japonica | Skimmia | Rutaceae |
|
| Conium maculatum | Conium | Apiaceae |
|
| Aglaia pyramidata | Aglaia | Meliaceae | |
| Schrebera swietenoides | Schrebera | Oleaceae |
|
| Senecio gilliesi | Senecio | Asteraceae | |
| Derris malaccensis | Derris | Fabaceae |
|
| Celastrus monospermus | Celastrus | Celastraceae | |
| Beta vulgaris | Beta | Chenopodiaceae |
 |
| Solanum spirale | Solanum | Solanaceae |
|
| Agave deserti | Agave | Asparagaceae |
|
| Asclepias subulata | Asclepias | Apocynaceae |
|
| Strychnos potatorum | Strychnos | Loganiaceae |
|
| Zanthoxylum simulans | Zanthoxylum | Rutaceae |
|
| Phellodendron chinese | Phellodendron | Rutaceae | |
| Daphne tangutica | Daphne | Thymelaeaceae | |
| Jacobaea vulgaris | Jacobaea | Asteraceae | |
| Sophora leachiana | Sophora | Fabaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Sarcomelicope glauca | Sarcomelicope | Rutaceae | |
| Vernonia lilacina | Vernonia | Asteraceae | |
| Wikstroemia chamaedaphne | Wikstroemia | Thymelaeaceae |
|
| Vepris punctata | Vepris | Rutaceae | |
| Passiflora morifolia | Passiflora | Passifloraceae |
|
| Orixa japonica | Orixa | Rutaceae |
|
| Trifolium montanum | Trifolium | Fabaceae | |
| Limonium bicolor | Limonium | Plumbaginaceae | |
| Ruta graveolens | Ruta | Rutaceae |
|
| Hortonia floribunda | Hortonia | Monimiaceae | |
| Corynanthe pachyceras | Corynanthe | Rubiaceae | |
| Ulmus americana | Ulmus | Ulmaceae |
|
| Peucedanum praeruptorum | Peucedanum | Apiaceae |
|
| Reaumuria hirtella | Reaumuria | Tamaricaceae | |
| Vitellaria paradoxa | Vitellaria | Sapotaceae |
|
| Centaurea arenaria | Centaurea | Asteraceae | |
| Coleus esquirolii | Coleus | Lamiaceae | |
| Scorzonera hispanica | Scorzonera | Asteraceae |
|
| Zanthoxylum bungeanum | Zanthoxylum | Rutaceae |
|
| Peucedanum oroselinum | Peucedanum | Apiaceae | |
| Ageratina saltillensis | Ageratina | Asteraceae | |
| Cynoglossum amabile | Cynoglossum | Boraginaceae |
|
| Litsea glutinosa | Litsea | Lauraceae |
|
| Vicia balansae | Vicia | Fabaceae | |
| Echinosophora koreensis | Echinosophora | Fabaceae | |
| Gutenbergia cordifolia | Gutenbergia | Asteraceae |
|
| Glycosmis cochinchinensis | Glycosmis | Rutaceae |
|
| Garcinia intermedia | Garcinia | Clusiaceae |
|
| Bellium bellidioides | Bellium | Asteraceae | |
| Elegia deusta | Elegia | Restionaceae | |
| Atalantia wightii | Atalantia | Rutaceae | |
| Sida veronicaefolia | Sida | Malvaceae |
|
| Salvia polystachya | Salvia | Lamiaceae |
|
| Toddalia asiatica | Toddalia | Rutaceae |
|
| Spiraea prunifolia | Spiraea | Rosaceae |
|
| Salvia munzii | Salvia | Lamiaceae | |
| Kielmeyera coriacea | Kielmeyera | Calophyllaceae |
|
| Solanum transcaucasicum | Solanum | Solanaceae | |
| Senecio densiflorus | Senecio | Asteraceae | |
| Grewia villosa | Grewia | Malvaceae |
|
| Consolida hohenackeri | Consolida | Ranunculaceae | |
| Angelica taiwaniana | Angelica | Apiaceae |
|
| Lithospermum officinale | Lithospermum | Boraginaceae |
|
| Zanthoxylum schinifolium | Zanthoxylum | Rutaceae |
|
| Euonymus europaeus | Euonymus | Celastraceae |
|
| Persicaria tinctoria | Persicaria | Polygonaceae |
|
| Sarcococca vagans | Sarcococca | Buxaceae |
|
| Trachelospermum lucidum | Trachelospermum | Apocynaceae |
|
| Phyllodium pulchellum | Phyllodium | Fabaceae |
|
| Zanthoxylum nitidum | Zanthoxylum | Rutaceae |
|
| Mikania scandens | Mikania | Asteraceae |
|
| Cotylelobium scabriusculum | Cotylelobium | Dipterocarpaceae | |
| Cynara humilis | Cynara | Asteraceae |
|
Ingredient ID: NPC308812
Formula: C9H8N2O
Ingredient ID: NPC308812
| Common Name | n.a. |
| IUPAC Name | 1-methylquinazolin-4-one |
| Canonical SMILES | Cn1cnc(=O)c2c1cccc2 |
| Standard InCHI | InChI=1S/C9H8N2O/c1-11-6-10-9(12)7-4-2-3-5-8(7)11/h2-6H,1H3 |
| Standard InCHIKey | QAXCWBIVFCEYGG-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 18992 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD170273] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Strychnos potatorum | Strychnos | Loganiaceae |
|
| Daphne tangutica | Daphne | Thymelaeaceae | |
| Vitellaria paradoxa | Vitellaria | Sapotaceae |
|
Ingredient ID: NPC300299
Formula: C16H14N2O
Ingredient ID: NPC300299
| Common Name | n.a. |
| IUPAC Name | 2-benzyl-1-methylquinazolin-4-one |
| Canonical SMILES | O=c1nc(Cc2ccccc2)n(c2c1cccc2)C |
| Standard InCHI | InChI=1S/C16H14N2O/c1-18-14-10-6-5-9-13(14)16(19)17-15(18)11-12-7-3-2-4-8-12/h2-10H,11H2,1H3 |
| Standard InCHIKey | XVPZRKIQCKKYNE-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 63123 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD100925] Database: NPASS [NPC300299] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Strychnos potatorum | Strychnos | Loganiaceae |
|
| Daphne tangutica | Daphne | Thymelaeaceae | |
| Ruta graveolens | Ruta | Rutaceae |
|
| Vitellaria paradoxa | Vitellaria | Sapotaceae |
|
Ingredient ID: NPC269367
Formula: C12H9NO2
Ingredient ID: NPC269367
| Common Name | Dictamnine |
| IUPAC Name | 4-methoxyfuro[2,3-b]quinoline |
| Canonical SMILES | COc1c2ccccc2nc2c1cco2 |
| Standard InCHI | InChI=1S/C12H9NO2/c1-14-11-8-4-2-3-5-10(8)13-12-9(11)6-7-15-12/h2-7H,1H3 |
| Standard InCHIKey | WIONIXOBNMDJFJ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 68085 ZINC ID: ZINC000000265517 ChEMBL ID: CHEMBL22533 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC269367] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Glycosmis pseudoracemosa | Glycosmis | Rutaceae |
|
| Ficus conraui | Ficus | Moraceae |
|
| Dictamnus dasycarpus | Dictamnus | Rutaceae |
|
| Machilus odoratissima | Machilus | Lauraceae |
|
| Corydalis persica | Corydalis | Papaveraceae | |
| Salta triflora | Salta | Polygonaceae | |
| Sideritis perfoliata | Sideritis | Lamiaceae |
|
| Inula grantioides | Inula | Asteraceae |
|
| Arachniodes mutica | Arachniodes | Dryopteridaceae | |
| Vernonia chloropappa | Vernonia | Asteraceae | |
| Jasione montana | Jasione | Campanulaceae | |
| Juniperus horizontalis | Juniperus | Cupressaceae |
|
| Psiadia anchusifolia | Psiadia | Asteraceae | |
| Acronychia laurifolia | Acronychia | Rutaceae |
|
| Strychnos spinosa | Strychnos | Loganiaceae |
|
| Esenbeckia hartmanii | Esenbeckia | Rutaceae | |
| Talipariti tiliaceum | Talipariti | Malvaceae |
|
| Amomum daniellii | Amomum | Zingiberaceae | |
| Plectranthus caninus | Plectranthus | Lamiaceae |
|
| Lathyrus tingitanus | Lathyrus | Fabaceae |
|
| Rauvolfia salicifolia | Rauvolfia | Apocynaceae | |
| Balanophora japonica | Balanophora | Balanophoraceae |
|
| Angelica sinensis | Angelica | Apiaceae |
|
| Cota tinctoria | Cota | Asteraceae |
|
| Pycnarrhena australiana | Pycnarrhena | Menispermaceae | |
| Zanthoxylum planispinum | Zanthoxylum | Rutaceae |
|
| Clausena vestita | Clausena | Rutaceae | |
| Zanthoxylum avicennae | Zanthoxylum | Rutaceae |
|
| Hosta sieboldiana | Hosta | Asparagaceae |
|
| Flueggea microcarpa | Flueggea | Phyllanthaceae |
|
| Inula salsoloides | Inula | Asteraceae | |
| Millettia pachycarpa | Millettia | Fabaceae |
|
| Eutrochium purpureum | Eutrochium | Asteraceae |
|
| Alchornea cordifolia | Alchornea | Euphorbiaceae |
|
| Zanthoxylum ailanthoides | Zanthoxylum | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Tetradium glabrifolium | Tetradium | Rutaceae | |
| Morinda coreia | Morinda | Rubiaceae |
|
| Boenninghausenia albiflora | Boenninghausenia | Rutaceae |
|
| Iris sanguinea | Iris | Iridaceae | |
| Jacobaea cannabifolia | Jacobaea | Asteraceae | |
| Mycetia nutans | Mycetia | Rubiaceae |
|
| Conium maculatum | Conium | Apiaceae |
|
| Aglaia pyramidata | Aglaia | Meliaceae | |
| Schrebera swietenoides | Schrebera | Oleaceae |
|
| Senecio gilliesi | Senecio | Asteraceae | |
| Celastrus monospermus | Celastrus | Celastraceae | |
| Solanum spirale | Solanum | Solanaceae |
|
| Agave deserti | Agave | Asparagaceae |
|
| Asclepias subulata | Asclepias | Apocynaceae |
|
| Strychnos potatorum | Strychnos | Loganiaceae |
|
| Zanthoxylum simulans | Zanthoxylum | Rutaceae |
|
| Daphne tangutica | Daphne | Thymelaeaceae | |
| Sophora leachiana | Sophora | Fabaceae |
|
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Vernonia lilacina | Vernonia | Asteraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae | |
| Passiflora morifolia | Passiflora | Passifloraceae |
|
| Trifolium montanum | Trifolium | Fabaceae | |
| Hortonia floribunda | Hortonia | Monimiaceae | |
| Corynanthe pachyceras | Corynanthe | Rubiaceae | |
| Machilus zuihoensis | Machilus | Lauraceae |
|
| Vitellaria paradoxa | Vitellaria | Sapotaceae |
|
| Zanthoxylum decaryi | Zanthoxylum | Rutaceae |
|
| Peucedanum oroselinum | Peucedanum | Apiaceae | |
| Ageratina saltillensis | Ageratina | Asteraceae | |
| Cynoglossum amabile | Cynoglossum | Boraginaceae |
|
| Zanthoxylum chiloperone | Zanthoxylum | Rutaceae | |
| Glinus oppositifolius | Glinus | Molluginaceae |
|
| Vicia balansae | Vicia | Fabaceae | |
| Jurinea maxima | Jurinea | Asteraceae | |
| Atalantia wightii | Atalantia | Rutaceae | |
| Pilocarpus grandiflorus | Pilocarpus | Rutaceae | |
| Salvia polystachya | Salvia | Lamiaceae |
|
| Toddalia asiatica | Toddalia | Rutaceae |
|
| Grewia villosa | Grewia | Malvaceae |
|
| Gentiana strictiflora | Gentiana | Gentianaceae | |
| Euonymus europaeus | Euonymus | Celastraceae |
|
| Persicaria tinctoria | Persicaria | Polygonaceae |
|
| Rosa transmorrisonensis | Rosa | Rosaceae | |
| Zanthoxylum nitidum | Zanthoxylum | Rutaceae |
|
Ingredient ID: NPC221786
Formula: C29H36N4
Ingredient ID: NPC221786
| Common Name | Ochrolifuanine A |
| IUPAC Name | (2S,3R,12bS)-3-ethyl-2-[[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]methyl]-1,2,3,4,6,7,7a,12,12a,12b-decahydroindolo[2,3-a]quinolizine |
| Canonical SMILES | CC[C@H]1CN2CCC3C([C@@H]2C[C@@H]1C[C@H]1NCCc2c1[nH]c1c2cccc1)Nc1c3cccc1 |
| Standard InCHI | InChI=1S/C29H36N4/c1-2-18-17-33-14-12-23-21-8-4-6-10-25(21)32-29(23)27(33)16-19(18)15-26-28-22(11-13-30-26)20-7-3-5-9-24(20)31-28/h3-10,18-19,23,26-27,29-32H,2,11-17H2,1H3/t18-,19-,23?,26+,27-,29?/m0/s1 |
| Standard InCHIKey | WPRCHZNIQPXBQO-IWOKYBKVSA-N |
| Ingredient External Links |
PubChem CID: 44559929 ChEMBL ID: CHEMBL459625 |
| Plant-Ingredient Association Reference |
PMID: 12398531 Database: NPASS [NPC221786] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Strychnos potatorum | Strychnos | Loganiaceae |
|
| Senna tora | Senna | Fabaceae |
|
Ingredient ID: NPC220241
Formula: C16H15NO4
Ingredient ID: NPC220241
| Common Name | Arborinine |
| IUPAC Name | 1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one |
| Canonical SMILES | COc1cc2c(c(c1OC)O)c(=O)c1c(n2C)cccc1 |
| Standard InCHI | InChI=1S/C16H15NO4/c1-17-10-7-5-4-6-9(10)14(18)13-11(17)8-12(20-2)16(21-3)15(13)19/h4-8,19H,1-3H3 |
| Standard InCHIKey | ATBZZQPALSPNMF-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5281832 ChEMBL ID: CHEMBL349609 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD122031] Database: NPASS [NPC220241] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Strychnos potatorum | Strychnos | Loganiaceae |
|
| Daphne tangutica | Daphne | Thymelaeaceae | |
| Ruta graveolens | Ruta | Rutaceae |
|
| Vitellaria paradoxa | Vitellaria | Sapotaceae |
|
Ingredient ID: NPC217176
Formula: C14H13NO4
Ingredient ID: NPC217176
| Common Name | Kokusaginine |
| IUPAC Name | 4,6,7-trimethoxyfuro[2,3-b]quinoline |
| Canonical SMILES | COc1cc2c(cc1OC)nc1c(c2OC)cco1 |
| Standard InCHI | InChI=1S/C14H13NO4/c1-16-11-6-9-10(7-12(11)17-2)15-14-8(4-5-19-14)13(9)18-3/h4-7H,1-3H3 |
| Standard InCHIKey | JBRXRVFXQIKPEA-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 10227 ZINC ID: ZINC000000900216 ChEMBL ID: CHEMBL278779 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC217176] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Aeollanthus buchnerianus | Aeollanthus | Lamiaceae | |
| Echium plantagineum | Echium | Boraginaceae |
|
| Aconitum volubile | Aconitum | Ranunculaceae |
|
| Leptospermum recurvum | Leptospermum | Myrtaceae | |
| Hernandia sonora | Hernandia | Hernandiaceae |
|
| Helianthus niveus | Helianthus | Asteraceae |
|
| Oricia suaveolens | Oricia | Rutaceae | |
| Melicope semecarpifolia | Melicope | Rutaceae |
|
| Cynoglossum viridiflorum | Cynoglossum | Boraginaceae | |
| Derris malaccensis | Derris | Fabaceae |
|
| Strychnos potatorum | Strychnos | Loganiaceae |
|
| Euphorbia hirta | Euphorbia | Euphorbiaceae |
|
| Daphne tangutica | Daphne | Thymelaeaceae | |
| Sarcomelicope glauca | Sarcomelicope | Rutaceae | |
| Vepris punctata | Vepris | Rutaceae | |
| Orixa japonica | Orixa | Rutaceae |
|
| Limonium bicolor | Limonium | Plumbaginaceae | |
| Ruta graveolens | Ruta | Rutaceae |
|
| Vitellaria paradoxa | Vitellaria | Sapotaceae |
|
| Zanthoxylum bungeanum | Zanthoxylum | Rutaceae |
|
| Glycosmis cochinchinensis | Glycosmis | Rutaceae |
|
Ingredient ID: NPC182853
Formula: C16H15NO5
Ingredient ID: NPC182853
| Common Name | n.a. |
| IUPAC Name | 1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one |
| Canonical SMILES | COc1cc2c(c(c1OC)O)c(=O)c1c(n2C)c(O)ccc1 |
| Standard InCHI | InChI=1S/C16H15NO5/c1-17-9-7-11(21-2)16(22-3)15(20)12(9)14(19)8-5-4-6-10(18)13(8)17/h4-7,18,20H,1-3H3 |
| Standard InCHIKey | WUPPOLDDVHCHKK-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 14463129 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD72697] Database: NPASS [NPC182853] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Citropsis articulata | Citropsis | Rutaceae |
|
| Strychnos potatorum | Strychnos | Loganiaceae |
|
| Daphne tangutica | Daphne | Thymelaeaceae | |
| Vitellaria paradoxa | Vitellaria | Sapotaceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC182853 | C16H15NO5 | 301.0950226 | -1.1725 | 2.56 | 0.732 | 2 | 2 | 79.23 | 7 | 3 | 22 | 0 | |
| NPC217176 | C14H13NO4 | Kokusaginine | 259.08 | -0.3095 | 2.45 | 1.624 | 1 | 0 | 53.72 | 6 | 3 | 19 | 0 |
| NPC220241 | C16H15NO4 | Arborinine | 285.1 | -0.7122 | 2.67 | 1.906 | 2 | 1 | 59 | 6 | 3 | 21 | 0 |
| NPC221786 | C29H36N4 | Ochrolifuanine A | 440.29 | -2.0406 | 4.21 | 5.917 | 4 | 3 | 43.09 | 4 | 7 | 33 | 1 |
| NPC269367 | C12H9NO2 | Dictamnine | 199.06 | -0.2059 | 2.45 | 2.723 | 1 | 0 | 35.26 | 2 | 3 | 15 | 0 |
| NPC300299 | C16H14N2O | 250.1106131 | -1.1092 | 2.89 | 5.993 | 3 | 0 | 32.67 | 3 | 3 | 19 | 1 | |
| NPC308812 | C9H8N2O | 1-methylquinazolin-4-one | 160.0636629 | -1.2129 | 2.12 | 2.597 | 3 | 0 | 32.67 | 0 | 2 | 12 | 0 |
| NPC34770 | C14H13NO4 | Skimmianine | 259.08 | -0.3095 | 2.45 | 1.624 | 1 | 0 | 53.72 | 6 | 3 | 19 | 0 |
| NPC474880 | C29H36N4 | Ochrolifuanine E | 440.29 | -2.0406 | 4.21 | 5.917 | 4 | 3 | 43.09 | 4 | 7 | 33 | 1 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
